NO117980B - - Google Patents
Download PDFInfo
- Publication number
- NO117980B NO117980B NO15083163A NO15083163A NO117980B NO 117980 B NO117980 B NO 117980B NO 15083163 A NO15083163 A NO 15083163A NO 15083163 A NO15083163 A NO 15083163A NO 117980 B NO117980 B NO 117980B
- Authority
- NO
- Norway
- Prior art keywords
- catalyst
- aluminum oxide
- alumina
- ester
- inactive
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 11
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 10
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 10
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 claims description 8
- 150000002596 lactones Chemical class 0.000 claims description 6
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 238000001354 calcination Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000036571 hydration Effects 0.000 description 3
- 238000006703 hydration reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- -1 acyclic ester Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical class O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 1
- IWHLYPDWHHPVAA-UHFFFAOYSA-N 6-hydroxyhexanoic acid Chemical compound OCCCCCC(O)=O IWHLYPDWHHPVAA-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000006424 Flood reaction Methods 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- AEJRNONYXDAILM-UHFFFAOYSA-N [Ba+2].[O-][Cr]([O-])=O Chemical compound [Ba+2].[O-][Cr]([O-])=O AEJRNONYXDAILM-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- WMWXXXSCZVGQAR-UHFFFAOYSA-N dialuminum;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3] WMWXXXSCZVGQAR-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- QYPUTBKHHRIDGS-UHFFFAOYSA-N octane-1,1-diol Chemical compound CCCCCCCC(O)O QYPUTBKHHRIDGS-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000010587 phase diagram Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
- C07C29/149—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof with hydrogen or hydrogen-containing gases
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23827762A | 1962-11-16 | 1962-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117980B true NO117980B (enExample) | 1969-10-20 |
Family
ID=22897219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO15083163A NO117980B (enExample) | 1962-11-16 | 1963-11-15 |
Country Status (8)
| Country | Link |
|---|---|
| AT (1) | AT257556B (enExample) |
| BE (1) | BE639814A (enExample) |
| DE (1) | DE1277233B (enExample) |
| FR (1) | FR1374807A (enExample) |
| GB (1) | GB1059598A (enExample) |
| LU (1) | LU44814A1 (enExample) |
| NL (1) | NL300600A (enExample) |
| NO (1) | NO117980B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2635396A1 (de) * | 1976-08-06 | 1978-02-09 | Basf Ag | Verfahren zur herstellung von zuckeralkoholen |
| IT1190783B (it) * | 1981-04-29 | 1988-02-24 | Davy Mckee Oil & Chem | Processo per l'idrogenolisi di esteri di acidi carbossilici |
| DE19936135A1 (de) * | 1999-07-31 | 2001-02-15 | Degussa | Festbettkatalysatoren |
| DE10225929A1 (de) | 2002-06-11 | 2003-12-24 | Basf Ag | Zweistufiges Verfahren zur Herstellung von Butandiol mit Zwischenabtrennung von Bernsteinsäureanhydrid |
| DE10225927A1 (de) | 2002-06-11 | 2003-12-24 | Basf Ag | Verfahren zur Herstellung von Butandiol durch kombinierte Gasphasen- und Flüssigphasensynthese |
| DE10225926A1 (de) | 2002-06-11 | 2003-12-24 | Basf Ag | Verfahren zur Herstellung von Butandiol |
| SE535672C2 (sv) * | 2010-07-13 | 2012-11-06 | Perstorp Ab | Framställning av 1,6-Hexandiol |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2686817A (en) * | 1951-01-02 | 1954-08-17 | Gen Aniline & Film Corp | Production of 1, 4-butanediol from tetrahydrofuran |
| US2750429A (en) * | 1952-04-09 | 1956-06-12 | Oronzio De Nora Impianti | Continuous hydrogenation of fatty material |
| DE1008273B (de) * | 1954-11-01 | 1957-05-16 | Procter & Gamble | Verfahren zur Herstellung von aliphatischen Alkoholen |
| DE1023750B (de) * | 1955-06-08 | 1958-02-06 | Bayer Ag | Verfahren zur Herstellung von Diolen |
| BE548808A (enExample) * | 1955-07-08 | 1900-01-01 |
-
1963
- 1963-11-08 AT AT896063A patent/AT257556B/de active
- 1963-11-12 BE BE639814A patent/BE639814A/cs unknown
- 1963-11-13 GB GB4479363A patent/GB1059598A/en not_active Expired
- 1963-11-14 LU LU44814D patent/LU44814A1/xx unknown
- 1963-11-14 DE DE1963C0031415 patent/DE1277233B/de active Pending
- 1963-11-15 NO NO15083163A patent/NO117980B/no unknown
- 1963-11-15 FR FR953935A patent/FR1374807A/fr not_active Expired
- 1963-11-15 NL NL300600A patent/NL300600A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1277233B (de) | 1968-09-12 |
| GB1059598A (en) | 1967-02-22 |
| AT257556B (de) | 1967-10-10 |
| LU44814A1 (enExample) | 1964-01-14 |
| FR1374807A (fr) | 1964-10-09 |
| BE639814A (enExample) | 1964-05-12 |
| NL300600A (enExample) | 1965-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0222051B2 (enExample) | ||
| US9834491B2 (en) | Method for producing bio-based homoserine lactone and bio-based organic acid from O-acyl homoserine produced by microorganisms | |
| KR840002064B1 (ko) | 피롤리돈의 제조방법 | |
| US2828335A (en) | Hydrogenation of phthalic acid salts | |
| JPS6254289B2 (enExample) | ||
| US4797382A (en) | Hydrogenation catalyst and process for preparing the catalyst | |
| NO117980B (enExample) | ||
| US2082025A (en) | Method for the reduction of furfural and furan derivatives | |
| US2105664A (en) | Catalytic hydrogenation of hydroaromatic carboxylic acids and their esters | |
| CN104785250B (zh) | 一种加氢催化剂、制备方法及其在制备六氢苯酐中的应用 | |
| US2953605A (en) | Hydrogenation of 1, 4-butynediol to 1, 4-butanediol | |
| JPS6045940B2 (ja) | 水素化触媒 | |
| US2950326A (en) | Hydrogenation of 1, 4-butynediol to 1, 4-butanediol | |
| US4772729A (en) | Hydrogenation of citric acid and substituted citric acids to 3-substituted tetrahydrofuran, 3- and 4-substituted butyrolactones and mixtures thereof | |
| US4146741A (en) | Conversion of furan to 1,4-butanediol and tetrahydrofuran | |
| US2838523A (en) | Production of tetrahydrofurfuryl alcohol | |
| KR100307255B1 (ko) | 1,4-부탄디올의제조방법 | |
| NO150831B (no) | Anordning for klaringsfri tilkobling av en arbeidsmaskin, eksempelvis et hydrualisk grabb-lesseapparat, til en traktors trepunkts-feste | |
| US2515306A (en) | Process for producing esters of omega, omega, omega-trihalo aliphatic carboxylic acids | |
| US2939879A (en) | Process for preparing allyl esters of carboxylic acids | |
| US5792875A (en) | Catalytic production of butyrolactone or tetrahydrofuran | |
| US3141036A (en) | Cyclohexane carboxylic acid produced by hydrogenation of molten benzoic acid | |
| US2340745A (en) | Isomerization of ricinoleic compounds | |
| NO822515L (no) | Hydrogenolyse av polyoler til ethylenglycol. | |
| JPH0665125A (ja) | アルコールの製法 |