NO117364B - - Google Patents
Download PDFInfo
- Publication number
- NO117364B NO117364B NO159072A NO15907265A NO117364B NO 117364 B NO117364 B NO 117364B NO 159072 A NO159072 A NO 159072A NO 15907265 A NO15907265 A NO 15907265A NO 117364 B NO117364 B NO 117364B
- Authority
- NO
- Norway
- Prior art keywords
- solution
- water
- nitroimidazole
- aminoimidazole
- sodium nitrite
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- DEPDDPLQZYCHOH-UHFFFAOYSA-N imidazol-2-ylamine Natural products NC1=NC=CN1 DEPDDPLQZYCHOH-UHFFFAOYSA-N 0.000 claims description 10
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- -1 2-amino-imidazole compound Chemical class 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000004959 2-nitroimidazoles Chemical class 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 claims 1
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 26
- 239000000243 solution Substances 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 235000010288 sodium nitrite Nutrition 0.000 description 13
- 239000000203 mixture Substances 0.000 description 10
- YZEUHQHUFTYLPH-UHFFFAOYSA-N 2-nitroimidazole Chemical compound [O-][N+](=O)C1=NC=CN1 YZEUHQHUFTYLPH-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000224527 Trichomonas vaginalis Species 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- HLEIGKIQLNEZMS-UHFFFAOYSA-N 1,5-dimethylimidazol-2-amine Chemical compound CC1=CN=C(N)N1C HLEIGKIQLNEZMS-UHFFFAOYSA-N 0.000 description 2
- NOXMCEHYBLYCTK-UHFFFAOYSA-N 1-methyl-2-nitro-5-propan-2-ylimidazole Chemical compound CC(C)C1=CN=C([N+]([O-])=O)N1C NOXMCEHYBLYCTK-UHFFFAOYSA-N 0.000 description 2
- IKJZVLQZWUDHFV-UHFFFAOYSA-N 5-ethyl-1-methyl-2-nitroimidazole Chemical compound CCC1=CN=C([N+]([O-])=O)N1C IKJZVLQZWUDHFV-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002460 imidazoles Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KGAOHUFMWYKBMY-UHFFFAOYSA-N 1,4,5-trimethyl-2-nitroimidazole Chemical compound CC=1N=C([N+]([O-])=O)N(C)C=1C KGAOHUFMWYKBMY-UHFFFAOYSA-N 0.000 description 1
- CBCIYKBGCGRWLR-UHFFFAOYSA-N 1,4,5-trimethylimidazol-2-amine Chemical compound CC=1N=C(N)N(C)C=1C CBCIYKBGCGRWLR-UHFFFAOYSA-N 0.000 description 1
- BILWDWLNZFTXAN-UHFFFAOYSA-N 1,5-dimethyl-2-nitroimidazole Chemical compound CC1=CN=C([N+]([O-])=O)N1C BILWDWLNZFTXAN-UHFFFAOYSA-N 0.000 description 1
- ISRREXWTVHSVPG-UHFFFAOYSA-N 1,5-dimethylimidazol-2-amine hydrochloride Chemical compound Cl.CN1C(=NC=C1C)N ISRREXWTVHSVPG-UHFFFAOYSA-N 0.000 description 1
- HBMINVNVQUDERA-UHFFFAOYSA-N 1-methyl-2-nitroimidazole Chemical compound CN1C=CN=C1[N+]([O-])=O HBMINVNVQUDERA-UHFFFAOYSA-N 0.000 description 1
- NWZQRGHCMOJUIU-UHFFFAOYSA-N 1-methyl-5-propan-2-ylimidazol-2-amine hydrochloride Chemical compound Cl.CN1C(=NC=C1C(C)C)N NWZQRGHCMOJUIU-UHFFFAOYSA-N 0.000 description 1
- NQCJWEXYVVFKBT-UHFFFAOYSA-N 1-methylimidazol-2-amine Chemical compound CN1C=CN=C1N NQCJWEXYVVFKBT-UHFFFAOYSA-N 0.000 description 1
- QKUZBZFCWCJPFK-UHFFFAOYSA-N 1h-imidazol-2-ylazanium;chloride Chemical compound Cl.NC1=NC=CN1 QKUZBZFCWCJPFK-UHFFFAOYSA-N 0.000 description 1
- URVVSDKRMNZBRF-UHFFFAOYSA-N 2-(methylamino)propanal Chemical compound CNC(C)C=O URVVSDKRMNZBRF-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000187747 Streptomyces Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 230000000884 anti-protozoa Effects 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012824 chemical production Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 238000010575 fractional recrystallization Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000009655 industrial fermentation Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB32843/64A GB1114154A (en) | 1964-08-12 | 1964-08-12 | Antibiotic imidazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117364B true NO117364B (es) | 1969-08-04 |
Family
ID=10344819
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO159072A NO117364B (es) | 1964-08-12 | 1965-07-23 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3420842A (es) |
| AT (1) | AT251576B (es) |
| BE (1) | BE668071A (es) |
| BR (1) | BR6571993D0 (es) |
| CH (1) | CH436313A (es) |
| DE (1) | DE1595884C3 (es) |
| DK (1) | DK106910C (es) |
| ES (1) | ES316418A1 (es) |
| FI (1) | FI44615C (es) |
| GB (1) | GB1114154A (es) |
| IL (1) | IL23932A (es) |
| NL (2) | NL6510485A (es) |
| NO (1) | NO117364B (es) |
| SE (1) | SE311657B (es) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2229248C3 (de) * | 1971-07-30 | 1980-03-27 | Gruppo Lepetit S.P.A., Mailand (Italien) | 5-Iminomethyl-2-nitroimidazoI-Derivate und Verfahren zu deren Herstellung |
| US3987053A (en) * | 1971-07-30 | 1976-10-19 | Gruppo Lepetit S.P.A. | 2-nitroimidazol derivatives |
| GB1480192A (en) * | 1975-01-15 | 1977-07-20 | Lepetit Spa | 1-methyl-2-nitro-imidazole-5-methanol derivatives |
| JPS5427564A (en) * | 1977-08-02 | 1979-03-01 | Sumitomo Chem Co Ltd | 1-branched alkylcarbonyl-3-(3,5-dihalogenophenyl) hydantoins, their preparation, and bactericides for pomicultural and horticultural uses containing the same as active agent. |
| US4199592A (en) * | 1978-08-29 | 1980-04-22 | E. I. Du Pont De Nemours And Company | Antiinflammatory 4,5-diaryl-2-nitroimidazoles |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3065133A (en) * | 1956-09-28 | 1962-11-20 | Rhone Poulenc Sa | Imidazoles for the control of histomoniasis |
| GB837838A (en) * | 1957-09-14 | 1960-06-15 | Rhone Poulenc Sa | New imidazole derivatives and processes for their preparation |
| GB1051388A (es) * | 1964-11-17 |
-
0
- NL NL124627D patent/NL124627C/xx active
-
1964
- 1964-08-12 GB GB32843/64A patent/GB1114154A/en not_active Expired
-
1965
- 1965-07-07 DK DK344665AA patent/DK106910C/da active
- 1965-07-12 IL IL23932A patent/IL23932A/en unknown
- 1965-07-23 NO NO159072A patent/NO117364B/no unknown
- 1965-07-29 DE DE1595884A patent/DE1595884C3/de not_active Expired
- 1965-08-02 FI FI651856A patent/FI44615C/fi active
- 1965-08-05 CH CH1100965A patent/CH436313A/fr unknown
- 1965-08-09 BE BE668071A patent/BE668071A/xx unknown
- 1965-08-10 BR BR171993/65A patent/BR6571993D0/pt unknown
- 1965-08-11 NL NL6510485A patent/NL6510485A/xx unknown
- 1965-08-11 SE SE10484/65A patent/SE311657B/xx unknown
- 1965-08-12 ES ES0316418A patent/ES316418A1/es not_active Expired
- 1965-08-12 AT AT745365A patent/AT251576B/de active
- 1965-10-14 US US496184A patent/US3420842A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SE311657B (es) | 1969-06-23 |
| DE1595884A1 (de) | 1970-02-12 |
| DE1595884C3 (de) | 1975-06-26 |
| GB1114154A (en) | 1968-05-15 |
| AT251576B (de) | 1967-01-10 |
| NL124627C (es) | |
| DE1595884B2 (de) | 1974-11-14 |
| FI44615C (fi) | 1971-12-10 |
| IL23932A (en) | 1970-02-19 |
| NL6510485A (es) | 1966-02-14 |
| US3420842A (en) | 1969-01-07 |
| CH436313A (fr) | 1967-05-31 |
| DK106910C (da) | 1967-04-03 |
| BR6571993D0 (pt) | 1973-08-14 |
| ES316418A1 (es) | 1966-04-16 |
| BE668071A (es) | 1965-12-01 |
| FI44615B (es) | 1971-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0020173B1 (en) | Imidazole guanidines, their preparation and compositions containing them | |
| EP2230234B1 (en) | Process for the preparation of rufinamide | |
| NO117364B (es) | ||
| US10851068B2 (en) | Method for preparing pyrimidone compound | |
| PL80719B1 (es) | ||
| US5008398A (en) | Preparation of p-nitrophenyl-imidazoles | |
| US2776979A (en) | 1-nitroso-2-imidazolidone and process | |
| IE42209B1 (en) | 1-alkyl-2-(phenoxymethyl)-5-nitro-imidazoles and processesfor their preparation | |
| US3287468A (en) | 2-nitroimidazoles and process | |
| US4046896A (en) | 1-Methyl-2-(pyridyl-oxymethyl)-5-nitro-imidazoles | |
| Godefroi et al. | 1-alkyl-2-aryl-5-chloroimidazoles | |
| US5453529A (en) | Nitroimino compound as intermediate for insecticides and pharmaceuticals | |
| US2905692A (en) | Synthesis of imidazoles | |
| GB1562811A (en) | Reduction process for the preparation of 4-(hydroxymethyl)-imidazoles | |
| US2872454A (en) | Spiro-hydantoins from x-chloro- | |
| US3275649A (en) | Process for the preparation of | |
| JP2001518106A (ja) | １，３−ジ置換２−ニトログアニジンの製造法 | |
| US2468324A (en) | Process for the preparation of imidazolones | |
| US4090026A (en) | Certain nitrogen heterocyclic isothiocyanate esters | |
| US5994553A (en) | Method for preparing 2-mercaptothiazole | |
| EP0106962A1 (en) | Process for preparing 4(or 5)-(1-hydroxyalkyl) imidazoles | |
| US2995597A (en) | Tricyanomethyl aromatic compounds and process for preparing them | |
| EP0276574B1 (en) | Alpha-acyloxyketone derivatives | |
| US3322780A (en) | alpha-(acinitromethyl)- and alpha-(nitromethyl)-2, 1, 3-benzothiadiazole-methanol compounds | |
| US3446815A (en) | Preparation of aminophenyl-nitroimidazoles |