NO117072B - - Google Patents
Download PDFInfo
- Publication number
- NO117072B NO117072B NO160266A NO16026665A NO117072B NO 117072 B NO117072 B NO 117072B NO 160266 A NO160266 A NO 160266A NO 16026665 A NO16026665 A NO 16026665A NO 117072 B NO117072 B NO 117072B
- Authority
- NO
- Norway
- Prior art keywords
- bristles
- bristle
- cross
- toothbrush
- sectional area
- Prior art date
Links
- 239000011248 coating agent Substances 0.000 claims description 4
- 238000000576 coating method Methods 0.000 claims description 4
- -1 polyethylene Polymers 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 3
- 239000012459 cleaning agent Substances 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229920001169 thermoplastic Polymers 0.000 claims 1
- 239000004416 thermosoftening plastic Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000013543 active substance Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000551 dentifrice Substances 0.000 description 3
- 210000003296 saliva Anatomy 0.000 description 3
- 230000003248 secreting effect Effects 0.000 description 3
- 239000000606 toothpaste Substances 0.000 description 3
- 229940034610 toothpaste Drugs 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000001680 brushing effect Effects 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical class [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical class O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- 241000549893 Carphochaete Species 0.000 description 1
- 208000002064 Dental Plaque Diseases 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- WHLHMYQCPHAFGR-UHFFFAOYSA-N dodecyl nitrate;sodium Chemical compound [Na].CCCCCCCCCCCCO[N+]([O-])=O WHLHMYQCPHAFGR-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 230000000474 nursing effect Effects 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003351 stiffener Substances 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B9/00—Arrangements of the bristles in the brush body
- A46B9/02—Position or arrangement of bristles in relation to surface of the brush body, e.g. inclined, in rows, in groups
- A46B9/04—Arranged like in or for toothbrushes
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B1/00—Brush bodies and bristles moulded as a unit
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46D—MANUFACTURE OF BRUSHES
- A46D1/00—Bristles; Selection of materials for bristles
- A46D1/02—Bristles details
- A46D1/0238—Bristles with non-round cross-section
Landscapes
- Brushes (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE13124/64A SE310646B (forum.php) | 1964-10-30 | 1964-10-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117072B true NO117072B (forum.php) | 1969-06-30 |
Family
ID=20296870
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO160266A NO117072B (forum.php) | 1964-10-30 | 1965-10-29 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3302230A (forum.php) |
| AT (1) | AT283581B (forum.php) |
| BE (1) | BE671636A (forum.php) |
| CH (1) | CH445444A (forum.php) |
| DE (1) | DE1532799B2 (forum.php) |
| FI (1) | FI42821B (forum.php) |
| GB (1) | GB1083369A (forum.php) |
| NL (1) | NL6514044A (forum.php) |
| NO (1) | NO117072B (forum.php) |
| SE (1) | SE310646B (forum.php) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3378870A (en) * | 1967-03-22 | 1968-04-23 | Matsunaga Kenji | Toothbrush |
| US3589823A (en) * | 1969-09-02 | 1971-06-29 | Orrin W Hendrickson | Disposable toothbrush |
| USD248696S (en) | 1976-09-02 | 1978-08-01 | Sylvan Greenberg | Tooth brush |
| DE3240637A1 (de) * | 1982-11-04 | 1984-05-10 | Makowsky, Herbert, Dr.med., 2800 Bremen | Zahnbuerste |
| US4565205A (en) * | 1983-03-18 | 1986-01-21 | Super Brush Co., Inc. | Molded mascara applicator |
| GB2184003A (en) * | 1985-10-24 | 1987-06-17 | Forsheda Ab | A brush, especially a tooth brush |
| DE3743140A1 (de) * | 1987-12-18 | 1989-06-29 | Pai Tien Fa | Zahnbuerste mit weichen borsten |
| USD333216S (en) | 1991-06-18 | 1993-02-16 | The Procter & Gamble Company | Toothbrush handle |
| US5272784A (en) * | 1991-08-12 | 1993-12-28 | Levin Samuel N | Toothbrush handle |
| USD340584S (en) | 1992-01-10 | 1993-10-26 | The Procter & Gamble Company | Brush handle |
| GB2266048A (en) * | 1992-04-08 | 1993-10-20 | Yancey Huang | A brush |
| US5339482A (en) * | 1992-07-21 | 1994-08-23 | Johnson & Johnson Consumer Products, Inc. | Toothbrush having non-slip surface |
| US6033733A (en) * | 1992-08-03 | 2000-03-07 | Colgate-Palmolive Company | Method for controlling dentifrice usage |
| US5396678A (en) * | 1992-11-02 | 1995-03-14 | The Gillette Company | Toothbrush with rectangular bristles |
| US5605756A (en) * | 1993-09-14 | 1997-02-25 | Gmz Holding Company | Disposable toothbrush having mint flavored toothpaste composition bonded to bristles thereof |
| WO1995013412A1 (en) * | 1993-11-10 | 1995-05-18 | Gmz Holding Company | Disposable toothbrush having mint flavored toothpaste composition bonded to bristles thereof |
| IL108148A0 (en) * | 1993-12-22 | 1994-04-12 | Dayan Avigail | Toothbrushes, particularly for one-time use |
| US5398367A (en) * | 1993-12-27 | 1995-03-21 | Lu; Guixian | Toothbrush with both soft and hard bristles |
| EP0663162A1 (en) * | 1994-01-17 | 1995-07-19 | The Procter & Gamble Company | Toothbrush with non-circular cross section filaments |
| US6295733B1 (en) | 1994-08-03 | 2001-10-02 | Warner-Lambert Company | Changeable color shaving aid |
| US5522174A (en) * | 1994-11-21 | 1996-06-04 | Wagner; Vida A. | Sanitary bug catcher |
| GB2297489B (en) * | 1995-02-04 | 1998-10-07 | Michael William Hindmarch | A tooth-cleaner |
| US5987688A (en) * | 1995-11-09 | 1999-11-23 | Gillette Canada Inc. | Gum-massaging oral brush |
| USD386312S (en) * | 1996-04-04 | 1997-11-18 | Colgate-Palmolive Company | Toothbrush |
| USD386906S (en) * | 1996-04-04 | 1997-12-02 | Colgate-Palmolive Company | Toothbrush |
| USD386005S (en) * | 1996-04-04 | 1997-11-11 | Colgate-Palmolive Company | Toothbrush |
| US20030115707A1 (en) * | 1996-05-29 | 2003-06-26 | Buford Edward T. | Grooved brush bristle |
| WO1998004167A1 (en) * | 1996-07-25 | 1998-02-05 | Whitehill Oral Technologies, Inc. | Toothbrush with improved cleaning and abrasion efficiency |
| DE19706296A1 (de) * | 1996-10-31 | 1998-05-07 | Petr Zivny | Zahnbürste |
| USD398154S (en) | 1996-12-23 | 1998-09-15 | Colgate-Palmolive Company | Toothbrush |
| US6886207B1 (en) * | 1999-06-14 | 2005-05-03 | The Procter & Gamble Company | Toothbrush |
| US5926900A (en) | 1997-06-16 | 1999-07-27 | Chesebrough-Pond's Usa Co. | Unitarily molded toothbrush |
| US5908038A (en) * | 1997-06-16 | 1999-06-01 | Chesebrough-Pond's Usa Co. | Unitarily molded toothbrush |
| US6138315A (en) * | 1998-01-13 | 2000-10-31 | Chesebrough-Pond's Usa Co., Divison Of Conopco, Inc. | Antimicrobial active compounds |
| US6553604B1 (en) | 2000-03-16 | 2003-04-29 | Gillette Canada Company | Toothbrush |
| US20060177384A1 (en) * | 2001-12-04 | 2006-08-10 | Brown Dale G | Sialagogue coatings for interproximal devices |
| US6895624B2 (en) * | 2002-03-07 | 2005-05-24 | Ultradent Products, Inc. | Powered tongue cleaning device |
| ATE320203T1 (de) * | 2002-04-24 | 2006-04-15 | Skg Italia S P A | Zahnreinigungsvorrichtung |
| US7934284B2 (en) * | 2003-02-11 | 2011-05-03 | Braun Gmbh | Toothbrushes |
| US20040177462A1 (en) | 2003-03-14 | 2004-09-16 | The Gillette Company | Toothbrush head |
| US20060272112A9 (en) * | 2003-03-14 | 2006-12-07 | The Gillette Company | Toothbrush |
| US20090044357A1 (en) * | 2007-08-16 | 2009-02-19 | The Procter & Gamble Company | Electric toothbrushes |
| WO2004093719A2 (en) * | 2003-04-23 | 2004-11-04 | The Procter & Gamble Company | Electric toothbrushes |
| US7941886B2 (en) * | 2003-09-19 | 2011-05-17 | Braun Gmbh | Toothbrushes |
| US20060080799A1 (en) * | 2004-10-18 | 2006-04-20 | Frank Lucente | Toothbrush featuring bristles with raised annular portions |
| US8042217B2 (en) | 2004-11-02 | 2011-10-25 | Colgate-Palmolive Company | Toothbrush and method of making the same |
| BRPI0519884B1 (pt) * | 2005-02-03 | 2019-08-06 | Bic-Violex Sa | Cabo de aparelho e aparelho para barbear |
| DE102006027756A1 (de) * | 2006-06-16 | 2007-12-20 | Braun Gmbh | Zahnbürste sowie Zahnbürstenkopf und Zahnputzborste hierfür |
| US8075216B2 (en) * | 2007-01-25 | 2011-12-13 | Colgate-Palmolive Company | Oral care implement housing an oral care agent |
| USD566400S1 (en) * | 2007-06-21 | 2008-04-15 | Inhomevations | Combined banana-shaped toothbrush and teether for infants |
| USD619370S1 (en) | 2008-04-09 | 2010-07-13 | Live-Right, Llc | Combined toothbrush and teether |
| KR20110069793A (ko) * | 2008-08-29 | 2011-06-23 | 에이. 슐만, 인크. | 최적화된 풍미의 고분자 조성물 |
| US20110230587A1 (en) * | 2008-08-29 | 2011-09-22 | A. Schulman, Inc. | Flavored polymeric articles |
| EP2225966A1 (en) * | 2009-03-04 | 2010-09-08 | Braun GmbH | Toothbrush bristle and method for manufacturing such a bristle |
| SG177474A1 (en) | 2009-07-31 | 2012-02-28 | Colgate Palmolive Co | High cleaning dentifrice compositions |
| USD660598S1 (en) | 2009-08-06 | 2012-05-29 | Mcneil-Ppc, Inc. | Toothbrush bristle |
| US20110030160A1 (en) * | 2009-08-06 | 2011-02-10 | Mcneil-Ppc, Inc. | Bristle configuration |
| US20110061189A1 (en) * | 2009-09-15 | 2011-03-17 | Mark Stephen Meadows | Oral care products and methods of using and making the same |
| USD656734S1 (en) * | 2010-05-27 | 2012-04-03 | Don Allen Carpenter | One-piece toothbrush |
| JP2013535272A (ja) * | 2010-07-30 | 2013-09-12 | マイコーン デンタル サプライ カンパニー インコーポレイテッド | 歯の再石灰化のための反応性組成物付属歯ブラシ |
| EP3831242B1 (de) | 2011-01-04 | 2022-11-16 | Trisa Holding AG | Zahnbürste mit gespritzten borsten |
| WO2012096700A1 (en) * | 2011-01-12 | 2012-07-19 | Colgate-Palmolive Company | Oral care implement |
| US20120324664A1 (en) * | 2011-06-24 | 2012-12-27 | Don Allen Carpenter | Flexible toothbrush with rigid handle support |
| EP4098147B1 (de) | 2012-07-02 | 2024-12-18 | Trisa Holding AG | Interdentalbürste |
| ES2692899T3 (es) * | 2012-12-14 | 2018-12-05 | Henkel Ag & Co. Kgaa | Herramienta de aplicación |
| US10098447B2 (en) | 2014-07-15 | 2018-10-16 | The Procter & Gamble Company | Oral-care implement having color-communicative element |
| USD745283S1 (en) | 2014-12-12 | 2015-12-15 | Live-Right, Llc | Combined baby toothbrush and teether |
| ES2975359T3 (es) | 2016-06-03 | 2024-07-04 | Procter & Gamble | Filamento para un utensilio de cuidado bucal y utensilio de cuidado bucal |
| PL3251550T3 (pl) | 2016-06-03 | 2020-07-13 | The Procter & Gamble Company | Głowica narzędzia do higieny jamy ustnej i narzędzie do higieny jamy ustnej |
| US10251470B1 (en) | 2017-10-10 | 2019-04-09 | The Procter & Gamble Company | Head for an oral care implement and oral care implement |
| US10306975B2 (en) | 2017-06-01 | 2019-06-04 | Colgate-Palmolive Company | Oral care implement |
| EP3461367B1 (en) | 2017-09-28 | 2020-04-22 | The Procter & Gamble Company | Method of making a unitary brush head and unitary toothbrush head |
| US11219302B2 (en) | 2017-10-10 | 2022-01-11 | The Procter & Gamble Company | Head for an oral care implement and oral care implement |
| US11877645B2 (en) | 2021-05-14 | 2024-01-23 | Colgate-Palmolive Company | Personal care implement |
| USD1029506S1 (en) | 2021-12-30 | 2024-06-04 | Colgate-Palmolive Company | Toothbrush |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA549168A (en) * | 1957-11-26 | F. Bergmann John | Tooth brush with dentifrice coated bristles | |
| DE571724C (de) * | 1933-03-04 | Eduard Alfken | Zahnbuerste | |
| US3125776A (en) * | 1964-03-24 | Moulded quills | ||
| US1773969A (en) * | 1928-09-08 | 1930-08-26 | Celanese Corp | Process of and apparatus for making artificial filaments |
| CH203802A (de) * | 1938-02-24 | 1939-03-31 | Staerkle Moser Carl | Gerät zum Polieren der Zähne. |
| US2225331A (en) * | 1938-10-18 | 1940-12-17 | Pauline Campbell | Rubber bristled toothbursh |
| US2317485A (en) * | 1940-04-27 | 1943-04-27 | Pepsodent Co | Brush |
| US2845649A (en) * | 1955-08-23 | 1958-08-05 | Robert W Hutson | Brush |
| US2876477A (en) * | 1955-12-08 | 1959-03-10 | George G Stewart | Brush |
| US2915767A (en) * | 1958-04-24 | 1959-12-08 | Frank C Vaughan | Disposable toothbrushes |
| US3103935A (en) * | 1960-07-13 | 1963-09-17 | Louis J Woodrow | Disposable toothbrush |
| US3105260A (en) * | 1961-01-23 | 1963-10-01 | Smith Allen | One-piece disposable toothbrush |
-
1964
- 1964-10-30 SE SE13124/64A patent/SE310646B/xx unknown
-
1965
- 1965-10-20 US US498504A patent/US3302230A/en not_active Expired - Lifetime
- 1965-10-29 CH CH1498365A patent/CH445444A/de unknown
- 1965-10-29 BE BE671636D patent/BE671636A/xx unknown
- 1965-10-29 NO NO160266A patent/NO117072B/no unknown
- 1965-10-29 GB GB45954/65A patent/GB1083369A/en not_active Expired
- 1965-10-29 NL NL6514044A patent/NL6514044A/xx unknown
- 1965-10-29 DE DE1965P0038003 patent/DE1532799B2/de active Granted
- 1965-10-29 AT AT980165A patent/AT283581B/de active
- 1965-10-29 FI FI2590/65A patent/FI42821B/fi active
Also Published As
| Publication number | Publication date |
|---|---|
| CH445444A (de) | 1967-10-31 |
| SE310646B (forum.php) | 1969-05-12 |
| NL6514044A (forum.php) | 1966-05-02 |
| DE1532799A1 (de) | 1969-07-24 |
| FI42821B (forum.php) | 1970-08-03 |
| AT283581B (de) | 1970-08-10 |
| DE1532799B2 (de) | 1977-01-27 |
| BE671636A (forum.php) | 1966-02-14 |
| GB1083369A (en) | 1967-09-13 |
| US3302230A (en) | 1967-02-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO117072B (forum.php) | ||
| US1924152A (en) | Toothbrush | |
| US2845649A (en) | Brush | |
| US4033008A (en) | Toothbrush | |
| US2710982A (en) | Brush of integral construction | |
| US3258805A (en) | Tooth brush | |
| US2702914A (en) | Toothbrush | |
| US3742549A (en) | Contoured toothbrush | |
| US2219753A (en) | Toothbrush | |
| KR20020068860A (ko) | 탄력성이 우수한 고도 테이퍼링 칫솔모가 식모된 칫솔 및그 제조방법 | |
| US20140325776A1 (en) | Toothbrush with thin and tapered bristles and with ingredients and with tongue cleaner | |
| US2056447A (en) | Tooth brush | |
| US2533345A (en) | Toothbrush having powder pickup grooves | |
| US2292707A (en) | Toothbrush | |
| JPH085772B2 (ja) | 口腔用組成物 | |
| NO160266B (no) | Nedsenkbar fralandsplattform. | |
| US20140325777A1 (en) | Toothbrush with thin and tapered bristles and with ingredients and with tongue cleaner | |
| RU2017101577A (ru) | Абразивная композиция для ухода за полостью рта | |
| US1935099A (en) | Toothbrush | |
| US1901866A (en) | Toothbrush | |
| US20030115707A1 (en) | Grooved brush bristle | |
| US3885029A (en) | Dentifrice preparation | |
| CN211379230U (zh) | 一种动物磨牙棒 | |
| CN105980013B (zh) | 口腔护理组合物 | |
| CN201977044U (zh) | 多功能牙刷 |