NO115536B - - Google Patents
Download PDFInfo
- Publication number
- NO115536B NO115536B NO152163A NO15216364A NO115536B NO 115536 B NO115536 B NO 115536B NO 152163 A NO152163 A NO 152163A NO 15216364 A NO15216364 A NO 15216364A NO 115536 B NO115536 B NO 115536B
- Authority
- NO
- Norway
- Prior art keywords
- solution
- mixture
- weight
- oil
- alkalinity
- Prior art date
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 66
- 239000002184 metal Substances 0.000 claims description 49
- 229910052751 metal Inorganic materials 0.000 claims description 48
- 239000011541 reaction mixture Substances 0.000 claims description 45
- 238000000034 method Methods 0.000 claims description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 32
- 150000003839 salts Chemical class 0.000 claims description 30
- 150000007524 organic acids Chemical class 0.000 claims description 26
- 239000010687 lubricating oil Substances 0.000 claims description 23
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 15
- 150000002739 metals Chemical class 0.000 claims description 13
- 150000001447 alkali salts Chemical class 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 11
- 235000005985 organic acids Nutrition 0.000 claims description 11
- 238000011065 in-situ storage Methods 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 230000000996 additive effect Effects 0.000 claims description 3
- 239000000243 solution Substances 0.000 description 70
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 64
- 239000000203 mixture Substances 0.000 description 60
- 239000000047 product Substances 0.000 description 44
- 239000011575 calcium Substances 0.000 description 37
- 229910052791 calcium Inorganic materials 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 37
- 239000001569 carbon dioxide Substances 0.000 description 32
- 229910002092 carbon dioxide Inorganic materials 0.000 description 32
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 27
- 239000000920 calcium hydroxide Substances 0.000 description 27
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 27
- 235000011116 calcium hydroxide Nutrition 0.000 description 27
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 25
- 239000002480 mineral oil Substances 0.000 description 25
- 235000010446 mineral oil Nutrition 0.000 description 25
- 239000003208 petroleum Substances 0.000 description 25
- 238000003756 stirring Methods 0.000 description 25
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 24
- 239000002253 acid Substances 0.000 description 22
- -1 cycloaliphatic Chemical group 0.000 description 22
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 21
- 239000008096 xylene Substances 0.000 description 21
- 239000003921 oil Substances 0.000 description 17
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 14
- 150000007513 acids Chemical class 0.000 description 12
- 239000007858 starting material Substances 0.000 description 11
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 8
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 8
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 239000003929 acidic solution Substances 0.000 description 6
- 238000007792 addition Methods 0.000 description 5
- 229910000019 calcium carbonate Inorganic materials 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000005587 bubbling Effects 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000001110 calcium chloride Substances 0.000 description 3
- 229910001628 calcium chloride Inorganic materials 0.000 description 3
- 235000011148 calcium chloride Nutrition 0.000 description 3
- OYPRJOBELJOOCE-CONNIKPHSA-N calcium-48 Chemical compound [48Ca] OYPRJOBELJOOCE-CONNIKPHSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000005608 naphthenic acid group Chemical group 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910021653 sulphate ion Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 2
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 240000005020 Acaciella glauca Species 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241000158728 Meliaceae Species 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N Methylcyclohexane Natural products CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- 235000011464 Pachycereus pringlei Nutrition 0.000 description 1
- 240000006939 Pachycereus weberi Species 0.000 description 1
- 235000011466 Pachycereus weberi Nutrition 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000005586 carbonic acid group Chemical group 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000003749 cleanliness Effects 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 229960004279 formaldehyde Drugs 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010952 in-situ formation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 239000010688 mineral lubricating oil Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229960005419 nitrogen Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 229940090181 propyl acetate Drugs 0.000 description 1
- 235000003499 redwood Nutrition 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L5/00—Arrangements affording multiple use of the transmission path
- H04L5/22—Arrangements affording multiple use of the transmission path using time-division multiplexing
- H04L5/24—Arrangements affording multiple use of the transmission path using time-division multiplexing with start-stop synchronous converters
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04L—TRANSMISSION OF DIGITAL INFORMATION, e.g. TELEGRAPHIC COMMUNICATION
- H04L5/00—Arrangements affording multiple use of the transmission path
- H04L5/22—Arrangements affording multiple use of the transmission path using time-division multiplexing
Landscapes
- Engineering & Computer Science (AREA)
- Signal Processing (AREA)
- Computer Networks & Wireless Communication (AREA)
- Time-Division Multiplex Systems (AREA)
- Communication Control (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US261676A US3310626A (en) | 1963-02-28 | 1963-02-28 | Time shared telegraph transmission system including sequence transmission with reduction of start and stop signals |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO115536B true NO115536B (pm) | 1968-10-21 |
Family
ID=22994357
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO152163A NO115536B (pm) | 1963-02-28 | 1964-02-26 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3310626A (pm) |
| BE (1) | BE644460A (pm) |
| BR (1) | BR6457102D0 (pm) |
| CH (1) | CH429826A (pm) |
| DE (1) | DE1208333B (pm) |
| DK (1) | DK119780B (pm) |
| ES (1) | ES296322A1 (pm) |
| GB (1) | GB1013978A (pm) |
| NL (1) | NL6401967A (pm) |
| NO (1) | NO115536B (pm) |
| SE (1) | SE332838B (pm) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3387086A (en) * | 1964-06-29 | 1968-06-04 | Ultronic Systems Corp | Multiplexing system for synchronous transmission of start-stop signals after removal of the start and stop bits |
| US3466397A (en) * | 1965-12-14 | 1969-09-09 | Bell Telephone Labor Inc | Character at a time data multiplexing system |
| US3571729A (en) * | 1967-07-12 | 1971-03-23 | Nippon Electric Co | Predictive gate circuit for the reception of a pulse-position-modulated pulse train |
| US3575557A (en) * | 1968-07-25 | 1971-04-20 | Gen Dynamics Corp | Time division multiplex system |
| CH495096A (de) * | 1969-08-29 | 1970-08-15 | Europ Handelsges Anst | Synchronisiereinrichtung für Telegraphenanlagen, insbesondere drahtlose Telegraphenanlagen |
| US3823397A (en) * | 1970-05-07 | 1974-07-09 | Centronics Data Computer | Serial to parallel converter for binary signals of two different pulse widths |
| US3663760A (en) * | 1970-07-08 | 1972-05-16 | Western Union Telegraph Co | Method and apparatus for time division multiplex transmission of binary data |
| US3725573A (en) * | 1971-08-31 | 1973-04-03 | Sanders Associates Inc | Video buffer |
| US3764998A (en) * | 1972-08-04 | 1973-10-09 | Bell & Howell Co | Methods and apparatus for removing parity bits from binary words |
| US3825905A (en) * | 1972-09-13 | 1974-07-23 | Action Communication Syst Inc | Binary synchronous communications processor system and method |
| US3946379A (en) * | 1974-05-31 | 1976-03-23 | Rca Corporation | Serial to parallel converter for data transmission |
| DE2441550C3 (de) * | 1974-08-30 | 1983-01-20 | Siemens AG, 1000 Berlin und 8000 München | Verfahren und Schaltungsanordnung zur zeitgerechten Übernahme von binär codierten Datenzeichen zwischen zwei isochron arbeitenden Übertragungsstrecken in einem taktgesteuerten Datennetz |
| US4071887A (en) * | 1975-10-30 | 1978-01-31 | Motorola, Inc. | Synchronous serial data adaptor |
| JPS55141823A (en) | 1979-04-24 | 1980-11-06 | Fujitsu Ltd | Data read-out circuit |
| US4376933A (en) * | 1979-02-22 | 1983-03-15 | Xerox Corporation | Circuit for compacting data |
| US4393501A (en) * | 1981-02-26 | 1983-07-12 | General Electric Company | Line protocol for communication system |
| US4447804A (en) * | 1981-06-22 | 1984-05-08 | The United States Of America As Represented By The Secretary Of The Navy | Serial to parallel data conversion interface circuit |
| DE3275801D1 (en) * | 1982-09-28 | 1987-04-23 | Ibm | Data transmission system |
| DE3335397A1 (de) * | 1983-09-29 | 1985-04-18 | Siemens AG, 1000 Berlin und 8000 München | Bitserielle, asynchrone uebertragungsstrecke fuer hohe datenraten |
| US4885583A (en) * | 1988-11-14 | 1989-12-05 | Chrysler Motors Corporation | Serial to parallel data conversion system |
| FR2653954A1 (fr) * | 1989-10-27 | 1991-05-03 | Trt Telecom Radio Electr | Procede pour transmettre une suite de m mots binaires de "p" elements binaires et dispositif de transmission mettant en óoeuvre ce procede. |
| US5862367A (en) * | 1995-03-17 | 1999-01-19 | United Micro Electronics Corporation | Apparatus and method for serial-to-parallel data conversion and transmission |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2946044A (en) * | 1954-08-09 | 1960-07-19 | Gen Electric | Signal processing system |
| US3016516A (en) * | 1957-01-24 | 1962-01-09 | Jr Charles H Doersam | Pulse code multiplexing systems |
| NL288425A (pm) * | 1962-02-01 |
-
1963
- 1963-02-28 US US261676A patent/US3310626A/en not_active Expired - Lifetime
-
1964
- 1964-02-11 ES ES0296322A patent/ES296322A1/es not_active Expired
- 1964-02-20 GB GB7132/64A patent/GB1013978A/en not_active Expired
- 1964-02-25 DE DEST21741A patent/DE1208333B/de active Pending
- 1964-02-26 NO NO152163A patent/NO115536B/no unknown
- 1964-02-26 BR BR157102/64A patent/BR6457102D0/pt unknown
- 1964-02-28 BE BE644460D patent/BE644460A/xx unknown
- 1964-02-28 NL NL6401967A patent/NL6401967A/xx unknown
- 1964-02-28 CH CH253764A patent/CH429826A/de unknown
- 1964-02-28 SE SE02436/64A patent/SE332838B/xx unknown
- 1964-02-28 DK DK98164AA patent/DK119780B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES296322A1 (es) | 1964-04-01 |
| US3310626A (en) | 1967-03-21 |
| NL6401967A (pm) | 1964-08-31 |
| BE644460A (pm) | 1964-08-28 |
| GB1013978A (en) | 1965-12-22 |
| SE332838B (pm) | 1971-02-22 |
| CH429826A (de) | 1967-02-15 |
| DK119780B (da) | 1971-02-22 |
| DE1208333B (de) | 1966-01-05 |
| BR6457102D0 (pt) | 1973-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO115536B (pm) | ||
| US2585520A (en) | Lubricating compositions containing highly basic metal sulfonates | |
| US2865956A (en) | Preparation of basic polyvalent metal salts of organic acids | |
| DK175287B1 (da) | Sulfurerede jordalkalimetalhydrocarbylphenater, deres fremstilling og anvendelse | |
| US3057896A (en) | Hyperbasic sulfonates | |
| US3242080A (en) | Hyperbasic metal complex | |
| DK163131B (da) | Fremgangsmaade til fremstilling af calciumbaserede additiver med detergent-/dispersions-virkning og med hoej alkalinitet samt smoeremidler indeholdende saadanne additiver | |
| GB671380A (en) | Improvements in and relating to fuel oils | |
| CA2051279C (en) | Improved overbased calcium sulfonate | |
| US4165291A (en) | Overbasing calcium petroleum sulfonates in lubricating oils employing monoalkylbenzene | |
| JPH0142998B2 (pm) | ||
| US6642190B2 (en) | Overbased detergent additives | |
| GB644043A (en) | Mineral oil composition | |
| US2884445A (en) | Metal petroleum sulfonates | |
| US3105049A (en) | Colloidal disperesions of salts | |
| US2815370A (en) | Sulfonation of petroleum oils | |
| US4879053A (en) | Process for preparing overbased calcium sulfonates | |
| US2702819A (en) | Guanidine alkyl aryl sulfonates | |
| GB1575957A (en) | Process for the preparation of neutral to slightly overbased calcium synthetic sulphonate compositions | |
| US3798261A (en) | Process for preparing high molecular weight sulfonic acids | |
| CA1120952A (en) | Process for the manufacture of overbased magnesium sulfonates | |
| GB687490A (en) | Improvements in and relating to basic metal sulphonates and compositions containing them | |
| US3007868A (en) | Light-color, oil-soluble alkaline earth metal sulfonates | |
| US3170881A (en) | Superbased barium containing lubricants | |
| JPS63309590A (ja) | 潤滑材組成物及びその製造方法 |