NL9001273A - Semi-permeabel composietmembraan. - Google Patents
Semi-permeabel composietmembraan. Download PDFInfo
- Publication number
- NL9001273A NL9001273A NL9001273A NL9001273A NL9001273A NL 9001273 A NL9001273 A NL 9001273A NL 9001273 A NL9001273 A NL 9001273A NL 9001273 A NL9001273 A NL 9001273A NL 9001273 A NL9001273 A NL 9001273A
- Authority
- NL
- Netherlands
- Prior art keywords
- polymer
- semi
- ampholytic
- ampholytic polymer
- membrane according
- Prior art date
Links
- 239000012528 membrane Substances 0.000 title claims description 57
- 239000002131 composite material Substances 0.000 title claims description 23
- 229920000642 polymer Polymers 0.000 claims description 83
- 230000014759 maintenance of location Effects 0.000 claims description 39
- 125000000129 anionic group Chemical group 0.000 claims description 25
- 239000000243 solution Substances 0.000 claims description 25
- 239000007864 aqueous solution Substances 0.000 claims description 24
- 125000002091 cationic group Chemical group 0.000 claims description 24
- 229920000768 polyamine Polymers 0.000 claims description 23
- 239000005720 sucrose Substances 0.000 claims description 21
- 239000003431 cross linking reagent Substances 0.000 claims description 20
- 239000000758 substrate Substances 0.000 claims description 14
- 239000000178 monomer Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- 238000004132 cross linking Methods 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 7
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- PSBDWGZCVUAZQS-UHFFFAOYSA-N (dimethylsulfonio)acetate Chemical compound C[S+](C)CC([O-])=O PSBDWGZCVUAZQS-UHFFFAOYSA-N 0.000 claims description 4
- MAGFQRLKWCCTQJ-UHFFFAOYSA-N 4-ethenylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(C=C)C=C1 MAGFQRLKWCCTQJ-UHFFFAOYSA-N 0.000 claims description 4
- 238000012695 Interfacial polymerization Methods 0.000 claims description 4
- 150000007942 carboxylates Chemical class 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 229920006254 polymer film Polymers 0.000 claims description 4
- 230000005855 radiation Effects 0.000 claims description 4
- 229940117986 sulfobetaine Drugs 0.000 claims description 4
- 208000029422 Hypernatremia Diseases 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium group Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- QLWOUBCORTYSPP-UHFFFAOYSA-N 1h-imidazol-1-ium;hydroxide Chemical compound O.C1=CNC=N1 QLWOUBCORTYSPP-UHFFFAOYSA-N 0.000 claims description 2
- AJWDVSJQPIRAKK-UHFFFAOYSA-N 4-ethenyl-1-methylpyridin-1-ium Chemical compound C[N+]1=CC=C(C=C)C=C1 AJWDVSJQPIRAKK-UHFFFAOYSA-N 0.000 claims description 2
- KFDVPJUYSDEJTH-UHFFFAOYSA-O 4-ethenylpyridine;hydron Chemical compound C=CC1=CC=[NH+]C=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-O 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 238000001035 drying Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000003505 polymerization initiator Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 36
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 20
- 229930006000 Sucrose Natural products 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000011780 sodium chloride Substances 0.000 description 18
- 230000004907 flux Effects 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 150000001875 compounds Chemical class 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 150000001266 acyl halides Chemical class 0.000 description 11
- 229920002873 Polyethylenimine Polymers 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 239000000370 acceptor Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- -1 aliphatic primary amine Chemical class 0.000 description 7
- 239000010408 film Substances 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 230000011987 methylation Effects 0.000 description 4
- 238000007069 methylation reaction Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- UWCPYKQBIPYOLX-UHFFFAOYSA-N benzene-1,3,5-tricarbonyl chloride Chemical compound ClC(=O)C1=CC(C(Cl)=O)=CC(C(Cl)=O)=C1 UWCPYKQBIPYOLX-UHFFFAOYSA-N 0.000 description 3
- 239000002800 charge carrier Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229920002492 poly(sulfone) Polymers 0.000 description 3
- 229920001228 polyisocyanate Polymers 0.000 description 3
- 239000005056 polyisocyanate Substances 0.000 description 3
- 238000001223 reverse osmosis Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical class CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 229960003237 betaine Drugs 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 235000011148 calcium chloride Nutrition 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 239000012510 hollow fiber Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000007761 roller coating Methods 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- QFDISQIDKZUABE-UHFFFAOYSA-N 1,1'-bipiperidine Chemical compound C1CCCCN1N1CCCCC1 QFDISQIDKZUABE-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- JOMNTHCQHJPVAZ-UHFFFAOYSA-N 2-methylpiperazine Chemical compound CC1CNCCN1 JOMNTHCQHJPVAZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- JPPYSPAXPNNOBC-UHFFFAOYSA-N 5-chlorosulfonylbenzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC(C(Cl)=O)=CC(S(Cl)(=O)=O)=C1 JPPYSPAXPNNOBC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- 241000272194 Ciconiiformes Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 239000004695 Polyether sulfone Substances 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000005862 Whey Substances 0.000 description 1
- 102000007544 Whey Proteins Human genes 0.000 description 1
- 108010046377 Whey Proteins Proteins 0.000 description 1
- QLBRROYTTDFLDX-UHFFFAOYSA-N [3-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCCC(CN)C1 QLBRROYTTDFLDX-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000005263 alkylenediamine group Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 229940045713 antineoplastic alkylating drug ethylene imines Drugs 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- FNGBYWBFWZVPPV-UHFFFAOYSA-N benzene-1,2,4,5-tetracarbonyl chloride Chemical compound ClC(=O)C1=CC(C(Cl)=O)=C(C(Cl)=O)C=C1C(Cl)=O FNGBYWBFWZVPPV-UHFFFAOYSA-N 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920006317 cationic polymer Polymers 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- GEQHKFFSPGPGLN-UHFFFAOYSA-N cyclohexane-1,3-diamine Chemical compound NC1CCCC(N)C1 GEQHKFFSPGPGLN-UHFFFAOYSA-N 0.000 description 1
- BPAAKFGBSPZPQO-UHFFFAOYSA-N cyclohexene-1,4-diamine Chemical compound NC1CCC(N)=CC1 BPAAKFGBSPZPQO-UHFFFAOYSA-N 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000002328 demineralizing effect Effects 0.000 description 1
- 239000012971 dimethylpiperazine Substances 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000010406 interfacial reaction Methods 0.000 description 1
- 125000003010 ionic group Chemical group 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- ZBKFYXZXZJPWNQ-UHFFFAOYSA-N isothiocyanate group Chemical group [N-]=C=S ZBKFYXZXZJPWNQ-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012982 microporous membrane Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 1
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 1
- 229920006393 polyether sulfone Polymers 0.000 description 1
- 239000013047 polymeric layer Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- OENLEHTYJXMVBG-UHFFFAOYSA-N pyridine;hydrate Chemical compound [OH-].C1=CC=[NH+]C=C1 OENLEHTYJXMVBG-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- SESSOVUNEZQNBV-UHFFFAOYSA-M sodium;2-bromoacetate Chemical compound [Na+].[O-]C(=O)CBr SESSOVUNEZQNBV-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 238000000108 ultra-filtration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D69/00—Semi-permeable membranes for separation processes or apparatus characterised by their form, structure or properties; Manufacturing processes specially adapted therefor
- B01D69/14—Dynamic membranes
- B01D69/141—Heterogeneous membranes, e.g. containing dispersed material; Mixed matrix membranes
- B01D69/1411—Heterogeneous membranes, e.g. containing dispersed material; Mixed matrix membranes containing dispersed material in a continuous matrix
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D69/00—Semi-permeable membranes for separation processes or apparatus characterised by their form, structure or properties; Manufacturing processes specially adapted therefor
- B01D69/12—Composite membranes; Ultra-thin membranes
- B01D69/125—In situ manufacturing by polymerisation, polycondensation, cross-linking or chemical reaction
- B01D69/1251—In situ manufacturing by polymerisation, polycondensation, cross-linking or chemical reaction by interfacial polymerisation
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Dispersion Chemistry (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL9001273A NL9001273A (nl) | 1990-06-06 | 1990-06-06 | Semi-permeabel composietmembraan. |
| DE69118887T DE69118887T2 (de) | 1990-06-06 | 1991-06-05 | Semipermeable komposit-membran |
| EP91912673A EP0532687B1 (fr) | 1990-06-06 | 1991-06-05 | Membrane composite semipermeable |
| DK91912673.0T DK0532687T3 (da) | 1990-06-06 | 1991-06-05 | Semipermeabel kompositmembran |
| JP91511691A JPH05507233A (ja) | 1990-06-06 | 1991-06-05 | 半透性複合膜 |
| PCT/NL1991/000090 WO1991018666A1 (fr) | 1990-06-06 | 1991-06-05 | Membrane composite semipermeable |
| US07/955,737 US5348652A (en) | 1990-06-06 | 1991-06-05 | Semipermeable composite membrane |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL9001273 | 1990-06-06 | ||
| NL9001273A NL9001273A (nl) | 1990-06-06 | 1990-06-06 | Semi-permeabel composietmembraan. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL9001273A true NL9001273A (nl) | 1992-01-02 |
Family
ID=19857193
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL9001273A NL9001273A (nl) | 1990-06-06 | 1990-06-06 | Semi-permeabel composietmembraan. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5348652A (fr) |
| EP (1) | EP0532687B1 (fr) |
| JP (1) | JPH05507233A (fr) |
| DE (1) | DE69118887T2 (fr) |
| DK (1) | DK0532687T3 (fr) |
| NL (1) | NL9001273A (fr) |
| WO (1) | WO1991018666A1 (fr) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5580650A (en) * | 1989-12-29 | 1996-12-03 | The Dow Chemical Company | Process of preparing a composite membrane |
| EP0715540A1 (fr) * | 1993-08-23 | 1996-06-12 | The Dow Chemical Company | Membranes preparees a partir de polymeres solubles reticulables |
| BE1007425A3 (nl) * | 1993-08-30 | 1995-06-13 | Holland Sweetener Co | Werkwijze en inrichting voor de terugwinning van grondstoffen in het aspartaambereidingsproces. |
| IL121046A (en) * | 1997-06-10 | 2001-07-24 | Weizmann Kiryat Membrane Prod | Semipermeable encapsulated membranes with improved acid and base stability and process for their manufacture and their use |
| DE10223078B4 (de) * | 2002-05-21 | 2005-12-22 | Novosom Ag | Polyampholyte und Verwendung als Polyelektrolytmultischichten |
| WO2008059824A1 (fr) * | 2006-11-16 | 2008-05-22 | Kurita Water Industries Ltd. | Appareil de traitement d'eau et procédé de traitement d'eau |
| CN108697996B (zh) * | 2016-02-29 | 2021-09-10 | 东丽株式会社 | 层叠半透膜 |
| KR102337641B1 (ko) * | 2016-12-26 | 2021-12-10 | 도레이 카부시키가이샤 | 복합 반투막 및 그의 제조 방법 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4360434A (en) * | 1981-01-15 | 1982-11-23 | Teijin Limited | Amphoteric ion-permeable composite membrane |
| IL70415A (en) * | 1982-12-27 | 1987-07-31 | Aligena Ag | Semipermeable encapsulated membranes,their manufacture and their use |
| US4704324A (en) * | 1985-04-03 | 1987-11-03 | The Dow Chemical Company | Semi-permeable membranes prepared via reaction of cationic groups with nucleophilic groups |
| GB2189168B (en) * | 1986-04-21 | 1989-11-29 | Aligena Ag | Composite membranes useful in the separation of low molecular weight organic compounds from aqueous solutions containing inorganic salts |
| DE3643574A1 (de) * | 1986-12-19 | 1988-06-30 | Hartmut Ernst Artur Brueschke | Polymer mit betainstruktur, loesungsdiffusionsmembran, verfahren zu ihrer herstellung und ihre verwendung |
| US4769148A (en) * | 1987-11-18 | 1988-09-06 | The Dow Chemical Company | Novel polyamide reverse osmosis membranes |
-
1990
- 1990-06-06 NL NL9001273A patent/NL9001273A/nl not_active Application Discontinuation
-
1991
- 1991-06-05 WO PCT/NL1991/000090 patent/WO1991018666A1/fr active IP Right Grant
- 1991-06-05 JP JP91511691A patent/JPH05507233A/ja active Pending
- 1991-06-05 EP EP91912673A patent/EP0532687B1/fr not_active Expired - Lifetime
- 1991-06-05 DE DE69118887T patent/DE69118887T2/de not_active Expired - Lifetime
- 1991-06-05 DK DK91912673.0T patent/DK0532687T3/da active
- 1991-06-05 US US07/955,737 patent/US5348652A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPH05507233A (ja) | 1993-10-21 |
| DE69118887D1 (de) | 1996-05-23 |
| DE69118887T2 (de) | 1996-09-12 |
| WO1991018666A1 (fr) | 1991-12-12 |
| DK0532687T3 (da) | 1996-05-20 |
| EP0532687A1 (fr) | 1993-03-24 |
| US5348652A (en) | 1994-09-20 |
| EP0532687B1 (fr) | 1996-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Cadotte et al. | Interfacial synthesis in the preparation of reverse osmosis membranes | |
| CA1333462C (fr) | Membranes d'osmose inverse a base de polyamide | |
| US4859384A (en) | Novel polyamide reverse osmosis membranes | |
| US6258276B1 (en) | Microporous membranes and uses thereof | |
| AU600627B2 (en) | Ultrafiltration thin film membranes | |
| US3951815A (en) | Composite semipermeable membranes made from polyethylenimine | |
| EP1958685B1 (fr) | Membrane sélective comportant une forte résistance à l'encrassement | |
| US6413425B1 (en) | Reverse osmosis composite membrane and reverse osmosis treatment method for water using the same | |
| CA2409605C (fr) | Membranes pour nanofiltration presentant une stabilite aux acides | |
| US7909179B2 (en) | Modified polyamide matrices and methods for their preparation | |
| US5069945A (en) | Ultrapous thin-film membranes | |
| US3945927A (en) | Ion-exchange group bearing composite membranes | |
| JP2001025648A (ja) | 逆浸透および／またはナノ濾過のための界面重合されたビピペリジン−ポリアミド膜およびその製造方法 | |
| WO2021134060A1 (fr) | Membranes perméables à l'eau à flux élevé | |
| EP1013337B1 (fr) | Membrane composite d'osmose inverse à haute perméabilité et la fabrication d'une telle membrane | |
| WO2018049013A1 (fr) | Membranes à couches sélectives alternatives | |
| JPH03114518A (ja) | 限外濾過または微細濾過に使用するための親水性膜およびその製造法 | |
| NL9001273A (nl) | Semi-permeabel composietmembraan. | |
| JP3646362B2 (ja) | 半透膜およびその製造方法 | |
| JPH0790152B2 (ja) | 複合逆浸透膜 | |
| KR100817450B1 (ko) | 순수광학이성질체 제조용 분자각인 고분자 분리막 및 이의제조방법 | |
| NO20170560A1 (en) | TFC membranes and a process for the preparation of such membranes | |
| Uragami | Functional separation membranes from chitin and chitosan derivatives | |
| KR0123279B1 (ko) | 염제거능이 우수한 복합반투막 및 그 제조방법 | |
| JPS6023126B2 (ja) | イオン透過性複合膜およびその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1B | A search report has been drawn up | ||
| BV | The patent application has lapsed |