NL8400766A - Werkwijze en katalysator ter bereiding van polyfenyleenoxyde. - Google Patents
Werkwijze en katalysator ter bereiding van polyfenyleenoxyde. Download PDFInfo
- Publication number
- NL8400766A NL8400766A NL8400766A NL8400766A NL8400766A NL 8400766 A NL8400766 A NL 8400766A NL 8400766 A NL8400766 A NL 8400766A NL 8400766 A NL8400766 A NL 8400766A NL 8400766 A NL8400766 A NL 8400766A
- Authority
- NL
- Netherlands
- Prior art keywords
- diamine
- copper
- carbon atoms
- catalyst
- composition according
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 title claims description 32
- 238000000034 method Methods 0.000 title claims description 23
- 239000004721 Polyphenylene oxide Substances 0.000 title claims description 12
- 229920006380 polyphenylene oxide Polymers 0.000 title claims description 12
- 150000004985 diamines Chemical class 0.000 claims description 28
- 150000001412 amines Chemical class 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 20
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 229910052802 copper Inorganic materials 0.000 claims description 19
- 239000010949 copper Substances 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 claims description 10
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical group CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 8
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 8
- 229910001431 copper ion Inorganic materials 0.000 claims description 8
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 claims description 5
- KRFJLUBVMFXRPN-UHFFFAOYSA-N cuprous oxide Chemical compound [O-2].[Cu+].[Cu+] KRFJLUBVMFXRPN-UHFFFAOYSA-N 0.000 claims description 5
- 229940112669 cuprous oxide Drugs 0.000 claims description 5
- 150000002500 ions Chemical class 0.000 claims description 5
- DJEQZVQFEPKLOY-UHFFFAOYSA-N N,N-dimethylbutylamine Chemical group CCCCN(C)C DJEQZVQFEPKLOY-UHFFFAOYSA-N 0.000 claims description 4
- LLZRSOPHIGKISM-UHFFFAOYSA-N 1,4-diphenylpiperazine Chemical compound C1CN(C=2C=CC=CC=2)CCN1C1=CC=CC=C1 LLZRSOPHIGKISM-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- NOUUUQMKVOUUNR-UHFFFAOYSA-N n,n'-diphenylethane-1,2-diamine Chemical group C=1C=CC=CC=1NCCNC1=CC=CC=C1 NOUUUQMKVOUUNR-UHFFFAOYSA-N 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 239000004305 biphenyl Substances 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims 5
- 239000002253 acid Substances 0.000 claims 3
- 230000007704 transition Effects 0.000 claims 1
- -1 polyphenylene Polymers 0.000 description 19
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 11
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 9
- 239000001301 oxygen Substances 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 238000006116 polymerization reaction Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000005691 oxidative coupling reaction Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920000265 Polyparaphenylene Polymers 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical group [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- LDKBTTCUTLPCOC-UHFFFAOYSA-N 1,2-diphenylpiperazine Chemical compound C1NCCN(C=2C=CC=CC=2)C1C1=CC=CC=C1 LDKBTTCUTLPCOC-UHFFFAOYSA-N 0.000 description 1
- ONQBOTKLCMXPOF-UHFFFAOYSA-N 1-ethylpyrrolidine Chemical compound CCN1CCCC1 ONQBOTKLCMXPOF-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 235000011299 Brassica oleracea var botrytis Nutrition 0.000 description 1
- 235000017647 Brassica oleracea var italica Nutrition 0.000 description 1
- 240000003259 Brassica oleracea var. botrytis Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940006460 bromide ion Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001733 carboxylic acid esters Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 244000221110 common millet Species 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000004976 cyclobutylene group Chemical group 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000004979 cyclopentylene group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- PONXTPCRRASWKW-KBPBESRZSA-N diphenylethylenediamine Chemical compound C1([C@H](N)[C@@H](N)C=2C=CC=CC=2)=CC=CC=C1 PONXTPCRRASWKW-KBPBESRZSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910001503 inorganic bromide Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 229910001509 metal bromide Inorganic materials 0.000 description 1
- OCIDXARMXNJACB-UHFFFAOYSA-N n'-phenylethane-1,2-diamine Chemical compound NCCNC1=CC=CC=C1 OCIDXARMXNJACB-UHFFFAOYSA-N 0.000 description 1
- YRGVKPIUZUOJSJ-UHFFFAOYSA-N n,n'-dibutylethane-1,2-diamine Chemical compound CCCCNCCNCCCC YRGVKPIUZUOJSJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ANORDWOIBSUYBN-UHFFFAOYSA-N n-chloro-1-phenylmethanamine Chemical compound ClNCC1=CC=CC=C1 ANORDWOIBSUYBN-UHFFFAOYSA-N 0.000 description 1
- PUUULGNNRPBVBA-UHFFFAOYSA-N n-ethylprop-2-en-1-amine Chemical compound CCNCC=C PUUULGNNRPBVBA-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- SQULHOYRZBAPJF-UHFFFAOYSA-N n-methylpent-4-en-1-amine Chemical compound CNCCCC=C SQULHOYRZBAPJF-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000005526 organic bromine compounds Chemical class 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002852 poly(2,6-dimethyl-1,4-phenylene oxide) polymer Polymers 0.000 description 1
- 229920013637 polyphenylene oxide polymer Polymers 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/474,604 US4471068A (en) | 1983-03-11 | 1983-03-11 | Process and catalyst for preparation of polyphenylene oxide |
| US47460483 | 1983-03-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8400766A true NL8400766A (nl) | 1984-10-01 |
Family
ID=23884256
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8400766A NL8400766A (nl) | 1983-03-11 | 1984-03-09 | Werkwijze en katalysator ter bereiding van polyfenyleenoxyde. |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4471068A (enExample) |
| JP (1) | JPS59196318A (enExample) |
| DE (1) | DE3408126A1 (enExample) |
| NL (1) | NL8400766A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4788277A (en) * | 1986-12-04 | 1988-11-29 | Asahi Kasei Kogyo Kabushiki Kaisha | Method for producing a polyphenylene ether |
| US4980327A (en) * | 1990-03-06 | 1990-12-25 | United Catalysts Inc. | Reduced and stabilized hydrogenation catalysts |
| US6417303B1 (en) | 1997-12-16 | 2002-07-09 | Exxonmobil Research And Engineering Company | Substantially linear copolymers |
| US6180788B1 (en) | 1997-12-16 | 2001-01-30 | Exxon Research And Engineering Company | Catalyst compositions |
| US6689928B2 (en) | 2000-04-04 | 2004-02-10 | Exxonmobil Research And Engineering Company | Transition metal complexes and oligomers therefrom |
| US6501000B1 (en) | 2000-04-04 | 2002-12-31 | Exxonmobil Research And Engineering Company | Late transition metal catalyst complexes and oligomers therefrom |
| US9861727B2 (en) | 2011-05-20 | 2018-01-09 | Surmodics, Inc. | Delivery of hydrophobic active agent particles |
| US10898446B2 (en) | 2016-12-20 | 2021-01-26 | Surmodics, Inc. | Delivery of hydrophobic active agents from hydrophilic polyether block amide copolymer surfaces |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL295699A (enExample) * | 1962-07-24 | |||
| NL295748A (enExample) * | 1962-07-24 | |||
| US3432466A (en) * | 1966-11-14 | 1969-03-11 | Gen Electric | Process of making poly-(2,6-diaryl-1,4-phenylene ethers) |
| US3384619A (en) * | 1967-05-18 | 1968-05-21 | Toyo Rayon Co Ltd | Process for manufacture of polyphenylene ethers |
| US3639656A (en) * | 1969-03-13 | 1972-02-01 | Gen Electric | Formation of polyphenylene ethers |
| US3642699A (en) * | 1969-08-12 | 1972-02-15 | Gen Electric | Formation of polyphenylene ethers |
| US3661848A (en) * | 1970-11-06 | 1972-05-09 | Gen Electric | Formation of polyphenylene ethers |
| US3733299A (en) * | 1971-06-10 | 1973-05-15 | Gen Electric | Process for the preparation of polyphenylene ethers with activated copper-amine catalysts |
| US4028341A (en) * | 1974-02-11 | 1977-06-07 | General Electric Company | Process for the preparation of polyphenylene oxides with hydrolytically stable copper catalysts |
| GB1497293A (en) * | 1974-02-11 | 1978-01-05 | Gen Electric | Preparation of polymer using copper catalysts |
| US3914266A (en) * | 1974-02-11 | 1975-10-21 | Gen Electric | Copper complex |
| US4043060A (en) * | 1976-08-30 | 1977-08-23 | Caterpillar Tractor Co. | Combination strengthened loader bucket and replaceable cutting edge |
-
1983
- 1983-03-11 US US06/474,604 patent/US4471068A/en not_active Expired - Fee Related
-
1984
- 1984-03-06 DE DE19843408126 patent/DE3408126A1/de active Granted
- 1984-03-09 JP JP59044235A patent/JPS59196318A/ja active Granted
- 1984-03-09 NL NL8400766A patent/NL8400766A/nl not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3408126C2 (enExample) | 1987-12-23 |
| US4471068A (en) | 1984-09-11 |
| JPS6140690B2 (enExample) | 1986-09-10 |
| DE3408126A1 (de) | 1984-09-13 |
| JPS59196318A (ja) | 1984-11-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4116939A (en) | Intrinsic viscosity control of polyphenylene ether reaction mixtures | |
| JP5268959B2 (ja) | ポリ(アリーレンエーテル)の製造方法及び当該方法で製造したポリ(アリーレンエーテル) | |
| US4806602A (en) | Anhydride capping polyphenylene ether with carboxylic acid | |
| US4098846A (en) | Polyphenylene oxide polystyrene product-by-process | |
| US4165422A (en) | Acyl capped quinone-coupled polyphenylene oxides | |
| US4110311A (en) | Molecular weight control of polyphenylene ethers | |
| NL8004034A (nl) | Werkwijze voor het bereiden van een harssamenstelling. | |
| NL8400766A (nl) | Werkwijze en katalysator ter bereiding van polyfenyleenoxyde. | |
| US4537948A (en) | Process for the production of polyphenylene oxides | |
| US3988297A (en) | Process for the preparation of polyphenylene ethers with activated copper-amine catalysts | |
| US4039510A (en) | Removal of catalyst from polyphenylene oxide reaction mixtures with nitrogenous salts of nitrilotriacetic acid | |
| US4482697A (en) | Process, complex and catalyst for preparation of polyphenylene oxide | |
| US4503214A (en) | Continuous process for preparing polyphenylene oxides | |
| GB930993A (enExample) | ||
| US4097462A (en) | Process for making polyphenylene oxides | |
| EP0183567B1 (en) | Process for producing polyphenylene ethers | |
| US4385167A (en) | Preparation of polyphenylene ether resins | |
| JPS5825329A (ja) | ポリフエニレンエ−テルの製法 | |
| US4618668A (en) | Preparation of polyphenylene ethers | |
| US4158728A (en) | Heterocyclic-coupled polymers of polyphenylene oxides | |
| EP0194584A1 (en) | Two-stage process for continuous preparation of polyphenylene oxides | |
| US3787362A (en) | Preparation of polyphenylene ethers with dialkylformamide promoted copper-amine catalysts | |
| EP0113430B1 (en) | Polyphenylene ether resins of controlled molecular weight and process of manufacture | |
| JPH10204173A (ja) | ポリフェニレンエーテルの改質方法 | |
| KR940009243A (ko) | 저 미립자 함량의 폴리페닐렌 에테르 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |