NL73179C - - Google Patents
Info
- Publication number
- NL73179C NL73179C NL73179DA NL73179C NL 73179 C NL73179 C NL 73179C NL 73179D A NL73179D A NL 73179DA NL 73179 C NL73179 C NL 73179C
- Authority
- NL
- Netherlands
- Prior art keywords
- divinyl
- hydrocarbon
- copolymer
- mixture
- aromatic
- Prior art date
Links
- 239000004215 Carbon black (E152) Substances 0.000 abstract 10
- 229930195733 hydrocarbon Natural products 0.000 abstract 10
- 229920001577 copolymer Polymers 0.000 abstract 9
- -1 aromatic divinyl hydrocarbon Chemical class 0.000 abstract 6
- 239000000203 mixture Substances 0.000 abstract 6
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 abstract 6
- 125000001188 haloalkyl group Chemical group 0.000 abstract 5
- 125000003118 aryl group Chemical group 0.000 abstract 4
- 150000002430 hydrocarbons Chemical class 0.000 abstract 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 abstract 3
- 150000001412 amines Chemical class 0.000 abstract 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 abstract 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 abstract 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 abstract 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 abstract 2
- 239000003957 anion exchange resin Substances 0.000 abstract 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 2
- 229910052794 bromium Chemical group 0.000 abstract 2
- 239000000460 chlorine Substances 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 abstract 2
- 150000003335 secondary amines Chemical class 0.000 abstract 2
- 150000003512 tertiary amines Chemical class 0.000 abstract 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 abstract 2
- ZJQIXGGEADDPQB-UHFFFAOYSA-N 1,2-bis(ethenyl)-3,4-dimethylbenzene Chemical group CC1=CC=C(C=C)C(C=C)=C1C ZJQIXGGEADDPQB-UHFFFAOYSA-N 0.000 abstract 1
- YKKDJUGGSDWUKX-UHFFFAOYSA-N 1,2-bis(ethenyl)-3-ethylbenzene Chemical compound CCC1=CC=CC(C=C)=C1C=C YKKDJUGGSDWUKX-UHFFFAOYSA-N 0.000 abstract 1
- QLLUAUADIMPKIH-UHFFFAOYSA-N 1,2-bis(ethenyl)naphthalene Chemical compound C1=CC=CC2=C(C=C)C(C=C)=CC=C21 QLLUAUADIMPKIH-UHFFFAOYSA-N 0.000 abstract 1
- NVZWEEGUWXZOKI-UHFFFAOYSA-N 1-ethenyl-2-methylbenzene Chemical compound CC1=CC=CC=C1C=C NVZWEEGUWXZOKI-UHFFFAOYSA-N 0.000 abstract 1
- JZHGRUMIRATHIU-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene Chemical compound CC1=CC=CC(C=C)=C1 JZHGRUMIRATHIU-UHFFFAOYSA-N 0.000 abstract 1
- UVHXEHGUEKARKZ-UHFFFAOYSA-N 1-ethenylanthracene Chemical compound C1=CC=C2C=C3C(C=C)=CC=CC3=CC2=C1 UVHXEHGUEKARKZ-UHFFFAOYSA-N 0.000 abstract 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 abstract 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 abstract 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 abstract 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 abstract 1
- 239000012670 alkaline solution Substances 0.000 abstract 1
- 238000005576 amination reaction Methods 0.000 abstract 1
- 239000003054 catalyst Substances 0.000 abstract 1
- 239000012530 fluid Substances 0.000 abstract 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 abstract 1
- 150000004820 halides Chemical class 0.000 abstract 1
- 238000007689 inspection Methods 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical compound C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 abstract 1
- 239000011347 resin Substances 0.000 abstract 1
- 229920005989 resin Polymers 0.000 abstract 1
- 229910000029 sodium carbonate Inorganic materials 0.000 abstract 1
- 239000000243 solution Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/44—Preparation of metal salts or ammonium salts
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J41/00—Anion exchange; Use of material as anion exchangers; Treatment of material for improving the anion exchange properties
- B01J41/08—Use of material as anion exchangers; Treatment of material for improving the anion exchange properties
- B01J41/12—Macromolecular compounds
- B01J41/14—Macromolecular compounds obtained by reactions only involving unsaturated carbon-to-carbon bonds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F212/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring
- C08F212/02—Monomers containing only one unsaturated aliphatic radical
- C08F212/04—Monomers containing only one unsaturated aliphatic radical containing one ring
- C08F212/06—Hydrocarbons
- C08F212/08—Styrene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F212/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring
- C08F212/02—Monomers containing only one unsaturated aliphatic radical
- C08F212/32—Monomers containing only one unsaturated aliphatic radical containing two or more rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/18—Introducing halogen atoms or halogen-containing groups
- C08F8/24—Haloalkylation
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/30—Introducing nitrogen atoms or nitrogen-containing groups
- C08F8/32—Introducing nitrogen atoms or nitrogen-containing groups by reaction with amines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2800/00—Copolymer characterised by the proportions of the comonomers expressed
- C08F2800/20—Copolymer characterised by the proportions of the comonomers expressed as weight or mass percentages
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2810/00—Chemical modification of a polymer
- C08F2810/20—Chemical modification of a polymer leading to a crosslinking, either explicitly or inherently
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- General Chemical & Material Sciences (AREA)
- Saccharide Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US759309A US2591574A (en) | 1947-07-05 | 1947-07-05 | Nitrogenous anion-exchange resins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL73179C true NL73179C (pm) |
Family
ID=25055176
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL73179D NL73179C (pm) | 1947-07-05 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2591574A (pm) |
| DE (1) | DE829223C (pm) |
| FR (2) | FR988486A (pm) |
| GB (1) | GB654706A (pm) |
| NL (1) | NL73179C (pm) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1074860B (de) * | 1960-02-04 | Rohm & Haas G.m.b.H., Darmstadt | Verfahren zur Herstellung von Thiolgruppen enthaltenden polymeren Verbindungen auf Grundlage von Monochloressigsäurevinylester | |
| DE1168080B (de) * | 1964-04-16 | Bayer Ag | Verfahren zur Herstellung von feinteiligen, unloeslichen Kunststoffen mit anionenaustauschenden Eigenschaften | |
| US2631999A (en) * | 1948-12-29 | 1953-03-17 | Dow Chemical Co | Anion exchange resins from primary or secondary amines and methyl styrene polymers |
| US2632000A (en) * | 1948-12-29 | 1953-03-17 | Dow Chemical Co | Anion exchange resins from amines and alkyl styrene polymers |
| US2629710A (en) * | 1949-05-28 | 1953-02-24 | Charles H Mcburney | Halomethylated vinyl-aromatic copolymers |
| DE975480C (de) * | 1952-02-19 | 1961-12-07 | Bayer Ag | Verfahren zur Herstellung von Kationenaustauschern zur Behandlung von OEdemen |
| NL81827C (pm) * | 1952-04-14 | |||
| US2800445A (en) * | 1952-04-24 | 1957-07-23 | Ionics | Anionic permselective membrane |
| US2809943A (en) * | 1952-09-11 | 1957-10-15 | Dow Chemical Co | Weighted ion exchange resin granules and method of making same |
| US2769788A (en) * | 1952-10-01 | 1956-11-06 | Dow Chemical Co | Method of making weighted polymer beads |
| US2723245A (en) * | 1952-12-30 | 1955-11-08 | Dow Chemical Co | Method of regenerating quaternary ammonium anion exchange resins |
| US2732352A (en) * | 1953-04-14 | 1956-01-24 | Tertiary amino anion exchange resins | |
| US2785805A (en) * | 1953-06-12 | 1957-03-19 | Wix Corp | Oil filters |
| US2820756A (en) * | 1953-12-29 | 1958-01-21 | Gulf Research Development Co | Ion-exchange memberanes |
| DE1041249B (de) * | 1954-05-20 | 1958-10-16 | Rohm & Haas | Verfahren zur Herstellung von unloeslichen vernetzten Polymeren und Mischpolymeren von vinylaromatischen Kohlenwasserstoffen |
| US2883349A (en) * | 1954-08-24 | 1959-04-21 | Asahi Chemical Ind | Anion exchange resins prepared in the presence of plasticizer and polymer |
| NL92123C (pm) * | 1954-11-29 | |||
| DE1086437B (de) * | 1955-02-04 | 1960-08-04 | Asahi Garasu Kabushiki Kaisha | Verfahren zur Herstellung von anionselektiven Membranen |
| DE1065179B (de) * | 1955-02-07 | 1959-09-10 | Rohm &. Haas Company, Philadelphia, Pa. (V. St. A.) | Verfahren zur Herstellung harzartiger Produkte |
| DE1034360B (de) * | 1955-05-14 | 1958-07-17 | Wolfen Filmfab Veb | Verfahren zur Herstellung von fuer komplexbildende Metallionen selektiven Kationenaustauscherharzen |
| DE1745717A1 (de) * | 1957-03-09 | 1970-01-29 | Bayer Ag | Verfahren zur Herstellung von vernetzten Mischpolymerisaten mit Schwammstruktur |
| DE1153004B (de) * | 1957-04-20 | 1963-08-22 | Bayer Ag | Verwendung von schwachsauren Kationen-austauschern mit Schwammstruktur zur Gewinnung von Schwermetallionen aus Loesungen |
| NL113552C (pm) * | 1957-12-02 | |||
| GB860695A (en) * | 1958-07-09 | 1961-02-08 | Permutit Co Ltd | Improvements relating to ion-exchange processes |
| US4224415A (en) * | 1958-07-18 | 1980-09-23 | Rohm And Haas Company | Polymerization processes and products therefrom |
| GB859282A (en) * | 1958-08-08 | 1961-01-18 | Permutit Co Ltd | Improvements relating to ion-exchange resins |
| NL128028C (pm) * | 1960-01-21 | |||
| US3050369A (en) * | 1960-03-07 | 1962-08-21 | Dow Chemical Co | Recovery of iodine from aqueous iodide solutions |
| US3132095A (en) * | 1960-11-16 | 1964-05-05 | Wolfen Filmfab Veb | Process for the separation of an acid from a non-acidic component |
| US3216882A (en) * | 1960-12-05 | 1965-11-09 | Nalco Chemical Co | Porous plastic film |
| DE1144007B (de) * | 1961-07-27 | 1963-02-21 | Wolfen Filmfab Veb | Verfahren zur Herstellung von polyfunktionellen Anionenaustauscherharzen |
| US3378505A (en) * | 1961-11-29 | 1968-04-16 | Gen Electric | Substituted polyphenylene ethers |
| DE1184959B (de) * | 1962-12-07 | 1965-01-07 | Wolfen Filmfab Veb | Verfahren zur Herstellung von stickstoffhaltigen Anionenaustauschharzen |
| NL124157C (pm) * | 1963-08-09 | |||
| US3549562A (en) * | 1965-06-14 | 1970-12-22 | Dow Chemical Co | Production of ion exchange resin particles |
| US3716482A (en) * | 1970-09-14 | 1973-02-13 | Bayer Ag | Anion exchanger with sponge structure and process of using same |
| US4221871A (en) * | 1970-12-16 | 1980-09-09 | Rohm And Haas Company | Reticular crosslinked monovinylidene N-heterocyclic copolymer |
| DE2655765C3 (de) * | 1976-12-09 | 1980-09-18 | Permutit Gmbh, 1000 Berlin | Senken des Gehaltes und/oder Bedarfes an schwefliger Säure in Getränken |
| US4136067A (en) * | 1977-12-02 | 1979-01-23 | Rohm And Haas Company | Hybrid ion exchange resins with improved properties |
| JPS54100489A (en) * | 1978-01-26 | 1979-08-08 | Asahi Chem Ind Co Ltd | New basic crosslinked copolymer and its preparation |
| US4511677A (en) * | 1983-11-02 | 1985-04-16 | Phillips Petroleum Company | Ion exchange-active compositions consisting of water-soluble polyelectrolyte upon ion exchange functional substrate |
| USRE35741E (en) * | 1984-07-09 | 1998-03-10 | Millipore Corporation | Process for purifying water |
| GB8730010D0 (en) * | 1987-12-23 | 1988-02-03 | Smith Kline French Lab | Compounds |
| US5350523A (en) * | 1990-02-28 | 1994-09-27 | Mitsubishi Kasei Corporation | Anion exchange method |
| US5176832A (en) * | 1991-10-23 | 1993-01-05 | The Dow Chemical Company | Chromatographic separation of sugars using porous gel resins |
| US5286843A (en) * | 1992-05-22 | 1994-02-15 | Rohm And Haas Company | Process for improving water-whitening resistance of pressure sensitive adhesives |
| US5814672A (en) * | 1994-12-05 | 1998-09-29 | Mitsubishi Chemical Corporation | Strongly basic anion exchange resin and process for its production |
| DE10121163A1 (de) * | 2001-04-30 | 2002-10-31 | Bayer Ag | Verfahren zur Herstellung heterodisperser Chelatharze |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2304637A (en) * | 1939-11-30 | 1942-12-08 | Du Pont | Resinous anion exchange material |
| US2405806A (en) * | 1941-02-07 | 1946-08-13 | Chem Ind Basel | Derivatives of resinous ethers of hydroxyaryl compounds |
| US2388235A (en) * | 1941-07-03 | 1945-11-06 | Heyden Chemical Corp | Nitrogen-containing resins and process of exchanging anions in fluid media |
| US2366008A (en) * | 1942-08-11 | 1944-12-26 | Gen Electric | Production of synthetic polymeric compositions comprising aminated polymerizates of poly-vinyl aryl compounds and treatment of liquid media therewith |
| US2366007A (en) * | 1942-08-11 | 1944-12-26 | Gen Electric | Production of synthetic polymeric compositions comprising sulphonated polymerizates of poly-vinyl aryl compounds and treatment of liquid media therewith |
-
0
- NL NL73179D patent/NL73179C/xx active
-
1947
- 1947-07-05 US US759309A patent/US2591574A/en not_active Expired - Lifetime
-
1948
- 1948-07-02 GB GB17853/48A patent/GB654706A/en not_active Expired
- 1948-07-05 FR FR988486D patent/FR988486A/fr not_active Expired
-
1950
- 1950-01-19 FR FR60657D patent/FR60657E/fr not_active Expired
- 1950-02-23 DE DER1045A patent/DE829223C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR988486A (fr) | 1951-08-28 |
| US2591574A (en) | 1952-04-01 |
| FR60657E (fr) | 1954-11-22 |
| DE829223C (de) | 1952-01-24 |
| GB654706A (en) | 1951-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL73179C (pm) | ||
| US2500149A (en) | Sulfonation of copolymers of monovinyl-and polyvinyl-aromatic compounds | |
| US2304637A (en) | Resinous anion exchange material | |
| US2642417A (en) | Process for making anionexchange resins | |
| US3549562A (en) | Production of ion exchange resin particles | |
| US2945842A (en) | Sulfonation of finely divided polymers with sulfonation agents in gas phase | |
| US3158583A (en) | Sulphonation of cross-linked vinylbenzene polymers | |
| US2788330A (en) | Anion exchange resins from cross-liked halogenated polyvinylaromatic polymers | |
| US2691644A (en) | Sulfonation method | |
| GB786148A (en) | Insoluble resinous copolymers of (chloromethyl) styrene and polyvinyl aromatic hydrocarbons and nitrogen-containing derivatives of the copolymers | |
| US3079428A (en) | Purification of organic liquids containing acid impurities | |
| US2631999A (en) | Anion exchange resins from primary or secondary amines and methyl styrene polymers | |
| US3316223A (en) | Novel anionic polymers of certain insoluble crosslinked polymers of a pka value of at least 16 and alkali and alkaline earth metals | |
| US3791996A (en) | Direct acylaminomethylation of aromatic polymers | |
| US3254051A (en) | Process of preparing polycarbonates by contacting a monochloroformate with an insoluble crosslinked copolymer containing quaternary ammonium groups | |
| JPS5810404B2 (ja) | 官能性架橋共重合物の製法 | |
| US2670335A (en) | Anion-exchange resins from an aminated alkylene aryl acetylene | |
| GB779994A (en) | Quaternary ammonium anion-exchange resins | |
| GB779995A (en) | Anion-exchange resins containing weakly and strongly basic functional groups | |
| US3037970A (en) | Copolymer of an unsaturated side chain aromatic compound and an alkylene diamine | |
| GB795379A (en) | Anion exchange resins | |
| US3551358A (en) | Macroporous ion-exchange resins incorporating a drying oil | |
| US2764560A (en) | Resinous reaction products of hexalkylphosphinous triamides and chloromethylated vinyl aromatic copolymers | |
| GB867769A (en) | A process for the chloromethylation of aromatic vinyl polymers | |
| GB679850A (en) | Improved production of anion exchange resins |