NL189030C - Meervoudige hydro-cyclooninrichting. - Google Patents
Meervoudige hydro-cyclooninrichting.Info
- Publication number
- NL189030C NL189030C NLAANVRAGE7915046,A NL7915046A NL189030C NL 189030 C NL189030 C NL 189030C NL 7915046 A NL7915046 A NL 7915046A NL 189030 C NL189030 C NL 189030C
- Authority
- NL
- Netherlands
- Prior art keywords
- cyclonon
- multiple hydro
- hydro
- hydro cyclonon
- cyclonon device
- Prior art date
Links
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B04—CENTRIFUGAL APPARATUS OR MACHINES FOR CARRYING-OUT PHYSICAL OR CHEMICAL PROCESSES
- B04C—APPARATUS USING FREE VORTEX FLOW, e.g. CYCLONES
- B04C5/00—Apparatus in which the axial direction of the vortex is reversed
- B04C5/24—Multiple arrangement thereof
- B04C5/28—Multiple arrangement thereof for parallel flow
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/934,317 US4260480A (en) | 1978-08-16 | 1978-08-16 | Multiple hydrocyclone device |
| US93431778 | 1978-08-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NL7915046A NL7915046A (nl) | 1980-08-29 |
| NL189030B NL189030B (nl) | 1992-07-16 |
| NL189030C true NL189030C (nl) | 1992-12-16 |
Family
ID=25465347
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NLAANVRAGE7915046,A NL189030C (nl) | 1978-08-16 | 1979-08-03 | Meervoudige hydro-cyclooninrichting. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4260480A (enExample) |
| EP (1) | EP0008206A1 (enExample) |
| JP (1) | JPS5528791A (enExample) |
| AR (1) | AR217949A1 (enExample) |
| BR (1) | BR7905206A (enExample) |
| DE (1) | DE2953260A1 (enExample) |
| ES (1) | ES483394A1 (enExample) |
| FR (1) | FR2453679B1 (enExample) |
| GB (1) | GB2049495B (enExample) |
| IN (1) | IN152711B (enExample) |
| IT (1) | IT1149218B (enExample) |
| NL (1) | NL189030C (enExample) |
| PH (1) | PH22307A (enExample) |
| SE (1) | SE441154B (enExample) |
| ZA (1) | ZA793598B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4462899A (en) * | 1982-12-20 | 1984-07-31 | The Bauer Bros. Co. | Hydrocyclone cleaner assembly |
| SE503593C2 (sv) * | 1990-11-26 | 1996-07-15 | Celleco Hedemora Ab | Hydrocyklonanläggning |
| US5194150A (en) * | 1991-08-01 | 1993-03-16 | Conoco Specialty Products Inc. | Three chamber vessel for hydrocyclone separator |
| WO1995005899A1 (en) * | 1993-08-26 | 1995-03-02 | Dorr-Oliver Incorporated | Multiple hydrocyclone apparatus |
| US5388708A (en) * | 1993-10-15 | 1995-02-14 | Fluid Quip, Inc. | Multiple hydrocyclone assembly |
| US6129217A (en) * | 1996-03-29 | 2000-10-10 | Corn Products International, Inc. | Hydrocyclone and separator assemblies utilizing hydrocyclones |
| US5980639A (en) * | 1998-06-30 | 1999-11-09 | Richard Mozley Limited | Hydrocyclones and associated separator assemblies |
| US6273153B1 (en) | 1999-12-21 | 2001-08-14 | Pathfinder Systems, Inc. | Metering and dispensing particulate matter directly into bins |
| GB2425077B (en) | 2005-04-15 | 2009-11-18 | Mann & Hummel Gmbh | Centifrugal separator and rotor therefor |
| US20080277264A1 (en) * | 2007-05-10 | 2008-11-13 | Fluid-Quip, Inc. | Alcohol production using hydraulic cavitation |
| US8753505B2 (en) * | 2008-06-27 | 2014-06-17 | Fluid-Quip, Inc. | Liquid treatment apparatus and method for using same |
| US9539491B2 (en) * | 2012-06-03 | 2017-01-10 | Angela M. Payne | Apparatus and method for cleaning bowling balls |
| EP3221267B1 (en) | 2014-11-21 | 2022-08-31 | Cloudburst International, Inc. | System and method for water purification |
| CN108480067B (zh) * | 2018-03-29 | 2020-11-10 | 黑龙江鹏程生化有限公司 | 一种新型精制淀粉乳用旋流器 |
| EP4176120A4 (en) * | 2020-07-03 | 2024-06-26 | Valmet Technologies Oy | HYDROCYCLONE WITH IMPROVED FLUID INJECTION ELEMENT |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1011594A (en) * | 1910-12-02 | 1911-12-12 | Chalmers Motor Company | Oil-can holder. |
| NL75020C (enExample) * | 1950-06-14 | |||
| USRE25099E (en) | 1954-11-17 | 1961-12-19 | Centrifugal apparatus for separating solids | |
| US2915991A (en) * | 1955-03-18 | 1959-12-08 | Smith Corp A O | Apparatus for flat loading of vehicle frames |
| DE1176613B (de) * | 1956-06-27 | 1964-08-27 | Dorr Oliver Inc | Mehrfachhydrozyklon |
| US3261467A (en) * | 1960-09-22 | 1966-07-19 | Wikdahl Nils Anders Lennart | Multiple cyclone assembly |
| US3335860A (en) * | 1964-07-27 | 1967-08-15 | Black Clawson Co | Centrifugal cleaner for paper making stock and the like |
| SE329591B (enExample) * | 1968-11-15 | 1970-10-19 | Alfa Laval Ab | |
| DE2408767A1 (de) * | 1974-02-23 | 1975-09-04 | Scholten Chemische Fab | Multihydrozyklon |
| NL7701686A (nl) * | 1977-02-17 | 1978-08-21 | Scholten Honig Research Nv | Radiale multihydrocycloon. |
| SE412169B (sv) * | 1977-03-09 | 1980-02-25 | Alfa Laval Ab | Multipelcyklonseparator |
| US4146469A (en) * | 1977-10-11 | 1979-03-27 | Clark & Vicario Corporation | Mounting of cleaners in papermaking system |
-
1978
- 1978-08-16 US US05/934,317 patent/US4260480A/en not_active Expired - Lifetime
-
1979
- 1979-07-17 ZA ZA00793598A patent/ZA793598B/xx unknown
- 1979-07-18 IN IN523/DEL/79A patent/IN152711B/en unknown
- 1979-07-26 PH PH22816A patent/PH22307A/en unknown
- 1979-08-03 GB GB8023458A patent/GB2049495B/en not_active Expired
- 1979-08-03 EP EP79301567A patent/EP0008206A1/en not_active Withdrawn
- 1979-08-03 DE DE19792953260 patent/DE2953260A1/de active Granted
- 1979-08-03 NL NLAANVRAGE7915046,A patent/NL189030C/xx not_active IP Right Cessation
- 1979-08-13 JP JP10306579A patent/JPS5528791A/ja active Granted
- 1979-08-14 BR BR7905206A patent/BR7905206A/pt unknown
- 1979-08-14 AR AR277712A patent/AR217949A1/es active
- 1979-08-14 ES ES483394A patent/ES483394A1/es not_active Expired
-
1980
- 1980-05-22 FR FR8011665A patent/FR2453679B1/fr not_active Expired
- 1980-06-17 IT IT86251/80A patent/IT1149218B/it active
- 1980-10-01 SE SE8006851A patent/SE441154B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2453679A1 (fr) | 1980-11-07 |
| IT1149218B (it) | 1986-12-03 |
| NL189030B (nl) | 1992-07-16 |
| NL7915046A (nl) | 1980-08-29 |
| GB2049495A (en) | 1980-12-31 |
| SE441154B (sv) | 1985-09-16 |
| US4260480A (en) | 1981-04-07 |
| SE8006851L (sv) | 1980-10-01 |
| EP0008206A1 (en) | 1980-02-20 |
| GB2049495B (en) | 1982-07-07 |
| ES483394A1 (es) | 1980-04-16 |
| FR2453679B1 (fr) | 1985-07-12 |
| PH22307A (en) | 1988-07-22 |
| JPS6340145B2 (enExample) | 1988-08-09 |
| AR217949A1 (es) | 1980-04-30 |
| JPS5528791A (en) | 1980-02-29 |
| DE2953260A1 (de) | 1980-10-02 |
| BR7905206A (pt) | 1981-02-17 |
| DE2953260C2 (enExample) | 1989-11-30 |
| IN152711B (enExample) | 1984-03-17 |
| ZA793598B (en) | 1980-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL185061C (nl) | Verbindingsinrichting. | |
| NL7809646A (nl) | Slag-reinigingsinrichting. | |
| NL7904036A (nl) | Halfgeleiderinrichting. | |
| NO793161L (no) | Nett-seng. | |
| NL188954C (nl) | Elektrochemische inrichting. | |
| NL7900274A (nl) | Halfgeleiderinrichting. | |
| NL7903147A (nl) | Halfgeleiderinrichting. | |
| NL7901015A (nl) | Begrenzingsinrichting. | |
| IT7924306A0 (it) | Apparecchio audio-vocale. | |
| NL189030C (nl) | Meervoudige hydro-cyclooninrichting. | |
| NL7901795A (nl) | Bevloeiingsinrichting. | |
| NL7901564A (nl) | Verbindingsinrichting. | |
| NL7803706A (nl) | Halfgeleiderinrichting. | |
| NL7806139A (nl) | Dozen-sluitinrichting. | |
| NL7801532A (nl) | Halfgeleiderinrichting. | |
| NO792717L (no) | Utvelgelsesanordning. | |
| DK429179A (da) | 2-propyl-pent-4-en-1-al. | |
| ES237776Y (es) | Dispositivo apilador-alimentador. | |
| NO158763C (no) | Koblingsanordning. | |
| ES236703Y (es) | Dispositivo mezclador-homogeneizador. | |
| ES233998Y (es) | Dispositivo compresor-depresor. | |
| ES236129Y (es) | Dispositivo medidor-propulsor. | |
| ES235483Y (es) | Dispositivo atrapainsectos perfeccionado. | |
| IT7820845U1 (it) | Apparecchio manipolatore. | |
| ES236072Y (es) | Dispositivo de autoanclaje mejorado. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| V1 | Lapsed because of non-payment of the annual fee |