NL175646C - Spoelaandrijfmechanisme voor een draaivlechtmachine. - Google Patents
Spoelaandrijfmechanisme voor een draaivlechtmachine.Info
- Publication number
- NL175646C NL175646C NLAANVRAGE7710972,A NL7710972A NL175646C NL 175646 C NL175646 C NL 175646C NL 7710972 A NL7710972 A NL 7710972A NL 175646 C NL175646 C NL 175646C
- Authority
- NL
- Netherlands
- Prior art keywords
- drive mechanism
- spool drive
- braid machine
- twist braid
- twist
- Prior art date
Links
- ONCZDRURRATYFI-QTCHDTBASA-N methyl (2z)-2-methoxyimino-2-[2-[[(e)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate Chemical compound CO\N=C(/C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-QTCHDTBASA-N 0.000 title 1
Classifications
-
- D—TEXTILES; PAPER
- D04—BRAIDING; LACE-MAKING; KNITTING; TRIMMINGS; NON-WOVEN FABRICS
- D04C—BRAIDING OR MANUFACTURE OF LACE, INCLUDING BOBBIN-NET OR CARBONISED LACE; BRAIDING MACHINES; BRAID; LACE
- D04C3/00—Braiding or lacing machines
- D04C3/40—Braiding or lacing machines for making tubular braids by circulating strand supplies around braiding centre at equal distances
- D04C3/42—Braiding or lacing machines for making tubular braids by circulating strand supplies around braiding centre at equal distances with means for forming sheds by controlling guides for individual threads
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Braiding, Manufacturing Of Bobbin-Net Or Lace, And Manufacturing Of Nets By Knotting (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/737,220 US4034643A (en) | 1976-11-01 | 1976-11-01 | Bobbin drive mechanism for a rotary braider |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NL7710972A NL7710972A (nl) | 1978-05-03 |
| NL175646B NL175646B (nl) | 1984-07-02 |
| NL175646C true NL175646C (nl) | 1984-12-03 |
Family
ID=24963053
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NLAANVRAGE7710972,A NL175646C (nl) | 1976-11-01 | 1977-10-06 | Spoelaandrijfmechanisme voor een draaivlechtmachine. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4034643A (enExample) |
| JP (1) | JPS589181B2 (enExample) |
| BE (1) | BE860211A (enExample) |
| CA (1) | CA1061145A (enExample) |
| CH (1) | CH623622A5 (enExample) |
| DE (1) | DE2744935C2 (enExample) |
| FR (1) | FR2369368A1 (enExample) |
| GB (1) | GB1574876A (enExample) |
| IT (1) | IT1087452B (enExample) |
| NL (1) | NL175646C (enExample) |
| SE (1) | SE428808B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4130046A (en) * | 1978-02-15 | 1978-12-19 | Vincent Sokol | Braiding machine with continuous tension filament control |
| BR8003107A (pt) * | 1979-10-26 | 1981-04-28 | Wabing Srl | Maquina para fabricacao de cabos ou espias de cordoes trancados |
| US4275638A (en) * | 1980-03-10 | 1981-06-30 | Deyoung Simon A | Braiding machine |
| US4372191A (en) * | 1982-03-12 | 1983-02-08 | Rockwell International Corp. | Rotary braiding machine |
| DE8422140U1 (de) * | 1984-07-25 | 1984-10-18 | Herrenbrück, Gerd, 6290 Weilburg | Flechtmaschine |
| US4535674A (en) * | 1984-11-20 | 1985-08-20 | James F. Karg | Apparatus for control of moving strands from rotating strand supply bobbins |
| US4535675A (en) * | 1984-11-20 | 1985-08-20 | James F. Karg | Apparatus for rotating a set of carriers for a strand supply bobbin relative to moving strands from a set of contra-rotating carriers for a strand supply bobbin |
| US4620473A (en) * | 1985-08-19 | 1986-11-04 | Bull Jeffrey F | Mechanism for timing strand movement relative to rotation of spool holders or carriers for strand supply spools or bobbins |
| US4983240A (en) * | 1987-09-11 | 1991-01-08 | Kamatics Corporation | Method of making a flanged braided bearing |
| US5370031A (en) * | 1990-08-17 | 1994-12-06 | United States Surgical Corporation | Braider apparatus with improved bobbin holder |
| CA2048464A1 (en) * | 1990-08-17 | 1992-02-18 | Michael P. Chesterfield | Apparatus and method for producing braided suture products |
| IT1289350B1 (it) * | 1995-12-22 | 1998-10-02 | Sipra Patent Beteiligung | Macchina circolare per treccia |
| EP1052320B1 (de) | 1999-04-01 | 2003-05-14 | Schnellflechter Berlin GmbH | Strangführungshebel für Flechtmaschinen |
| EP1259669B1 (de) * | 2000-01-27 | 2004-09-22 | Wolfgang Emmerich | Vorrichtung zur steuerung des fadenhebels einer flechtmaschine und flechtmaschine |
| DE10231302B4 (de) * | 2002-07-10 | 2011-01-27 | Wolfgang Emmerich | Durchtrittsschleuse für einen beidseitig eingespannt bleibenden und laufenden Faden und Rotorflechtmaschine zum Umflechten von Langobjekten |
| CN100445448C (zh) * | 2006-03-14 | 2008-12-24 | 黎日佳 | 高速编织机 |
| US10241015B2 (en) | 2016-07-22 | 2019-03-26 | Mitegen, Llc | Cryogenic cooling positioning apparatus, methods and applications |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US958512A (en) * | 1909-04-05 | 1910-05-17 | William T Le Blanc | Braiding-machine. |
| US1059523A (en) * | 1911-05-05 | 1913-04-22 | Jean Brondel | Machine for the production of tubular plaits. |
| US1752437A (en) * | 1927-07-27 | 1930-04-01 | Western Electric Co | Braiding machine |
| DE542182C (de) * | 1929-12-10 | 1932-01-21 | Electrical Res Prod Inc | Rundflechtmaschine mit zwei entgegengesetzt umlaufenden Spulenreihen |
| US1888477A (en) * | 1931-04-01 | 1932-11-22 | Edward K Standish | Braiding machine |
| US1955206A (en) * | 1933-03-08 | 1934-04-17 | Edward K Standish | Braiding machine |
| US1981377A (en) * | 1934-06-27 | 1934-11-20 | Edward K Standish | Braiding machine |
| US3892161A (en) * | 1974-06-06 | 1975-07-01 | Vincent Sokol | Braiding machine wire control |
| US4003290A (en) * | 1976-04-23 | 1977-01-18 | Rockwell International Corporation | Strand carrier for a strand fabricating machine |
-
1976
- 1976-11-01 US US05/737,220 patent/US4034643A/en not_active Expired - Lifetime
-
1977
- 1977-08-23 CA CA285,319A patent/CA1061145A/en not_active Expired
- 1977-09-19 GB GB39018/77A patent/GB1574876A/en not_active Expired
- 1977-09-22 IT IT27828/77A patent/IT1087452B/it active
- 1977-10-06 DE DE2744935A patent/DE2744935C2/de not_active Expired
- 1977-10-06 NL NLAANVRAGE7710972,A patent/NL175646C/xx not_active IP Right Cessation
- 1977-10-12 FR FR7730761A patent/FR2369368A1/fr active Granted
- 1977-10-28 BE BE2056366A patent/BE860211A/xx not_active IP Right Cessation
- 1977-10-31 SE SE7712258A patent/SE428808B/xx not_active IP Right Cessation
- 1977-10-31 JP JP52129788A patent/JPS589181B2/ja not_active Expired
- 1977-11-01 CH CH1329077A patent/CH623622A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US4034643A (en) | 1977-07-12 |
| SE428808B (sv) | 1983-07-25 |
| DE2744935A1 (de) | 1978-05-03 |
| JPS589181B2 (ja) | 1983-02-19 |
| NL175646B (nl) | 1984-07-02 |
| BE860211A (nl) | 1978-02-15 |
| FR2369368B1 (enExample) | 1982-12-31 |
| DE2744935C2 (de) | 1986-10-30 |
| GB1574876A (en) | 1980-09-10 |
| NL7710972A (nl) | 1978-05-03 |
| SE7712258L (sv) | 1978-05-02 |
| CH623622A5 (enExample) | 1981-06-15 |
| CA1061145A (en) | 1979-08-28 |
| JPS5358059A (en) | 1978-05-25 |
| FR2369368A1 (fr) | 1978-05-26 |
| IT1087452B (it) | 1985-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL184501C (nl) | Patroon voor een drankbereidingsmachine. | |
| NL180539C (nl) | Stelinrichting voor een machine. | |
| NL175646C (nl) | Spoelaandrijfmechanisme voor een draaivlechtmachine. | |
| NL7511705A (nl) | Numerieke besturing voor een multigereedschap- machine. | |
| IT7907219A0 (it) | Macchina cordatrice a bobine centrali. | |
| NL7512042A (nl) | Schijf voor een maaimachine. | |
| NL183990C (nl) | Toevoerinrichting aan een verpakkingsmachine. | |
| FI791060A7 (fi) | Punontakone metallikordeja varten. | |
| NL7702799A (nl) | Aandrijving voor een garenvormmachine. | |
| NL7804011A (nl) | Draadsnij-inrichting voor een naaimachine. | |
| NL165687C (nl) | Aandrijving voor een rotatiedrukmachine. | |
| IT1059577B (it) | Macchina arrotolatrice il tessuti destinati a macchine ia ciaccolretti | |
| NL7704925A (nl) | Voedingsmechanisme voor een draagbare etiketteer- machine. | |
| SE409847B (sv) | Drivanordning for en trumma, serskilt en lintrumma | |
| NL184634C (nl) | Remmende geleidingsinrichting voor een naaimachine. | |
| NL7712781A (nl) | Meervoudige draadgeleider met variabele wikkel- straal, voor een spoelwikkelmachine. | |
| NL7712130A (nl) | Hooimachine, gecombineerd met een transformatie- -inrichting. | |
| NL7806977A (nl) | Aandrijving voor een grijperwagen. | |
| NL179120C (nl) | Selectiemechanisme voor een enkel typenelement. | |
| NL7803713A (nl) | Opwikkelinrichting voor een spoel van een naaimachine. | |
| IT7827656A0 (it) | Annodatrice per spolatrici. | |
| IT7827655A0 (it) | Annodatrice per spolatrici. | |
| NL7902635A (nl) | Aandrijfmechanisme voor een weefgetouw. | |
| NL7609101A (nl) | Aandrijving voor een katoenkaardmachine. | |
| PL194668A1 (pl) | Uklad napedowy maszyn gorniczych zwlaszcza wrebiarek |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| V1 | Lapsed because of non-payment of the annual fee |