MY7700239A - Cinchonidine and cinchonine-derivatives - Google Patents
Cinchonidine and cinchonine-derivativesInfo
- Publication number
- MY7700239A MY7700239A MY239/77A MY7700239A MY7700239A MY 7700239 A MY7700239 A MY 7700239A MY 239/77 A MY239/77 A MY 239/77A MY 7700239 A MY7700239 A MY 7700239A MY 7700239 A MY7700239 A MY 7700239A
- Authority
- MY
- Malaysia
- Prior art keywords
- cinchonidine
- cinchonine
- derivatives
- Prior art date
Links
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 title 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
- C07D453/04—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems having a quinolyl-4, a substituted quinolyl-4 or a alkylenedioxy-quinolyl-4 radical linked through only one carbon atom, attached in position 2, e.g. quinine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42264573A | 1973-12-07 | 1973-12-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY7700239A true MY7700239A (en) | 1977-12-31 |
Family
ID=23675777
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MY239/77A MY7700239A (en) | 1973-12-07 | 1977-12-30 | Cinchonidine and cinchonine-derivatives |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5088076A (enExample) |
| AT (2) | AT339310B (enExample) |
| BE (1) | BE823023A (enExample) |
| BR (1) | BR7410249A (enExample) |
| CA (1) | CA1039283A (enExample) |
| CH (1) | CH605916A5 (enExample) |
| DE (1) | DE2458146A1 (enExample) |
| DK (1) | DK141700B (enExample) |
| FR (1) | FR2292476A1 (enExample) |
| GB (1) | GB1441519A (enExample) |
| IL (1) | IL46181A (enExample) |
| KE (1) | KE2718A (enExample) |
| MY (1) | MY7700239A (enExample) |
| NL (1) | NL7415931A (enExample) |
| PH (1) | PH10837A (enExample) |
| SE (1) | SE415100B (enExample) |
| ZA (1) | ZA747664B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2381044A1 (fr) * | 1977-02-17 | 1978-09-15 | Hoffmann La Roche | Procede pour la preparation de mefloquine |
| HU191508B (en) * | 1982-12-02 | 1987-02-27 | Alkaloida Vegyeszeti Gyar,Hu | Process for preparing new chloromethyl-quinoline derivatives |
| WO1999012532A2 (en) * | 1997-09-08 | 1999-03-18 | F.Hoffmann-La Roche Ag | Piperidine derivatives against malaria |
| JP2002360830A (ja) * | 2001-06-04 | 2002-12-17 | Heiwa Corp | 球貯蔵入賞装置 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1217427A (en) * | 1967-12-21 | 1970-12-31 | America Home Products Corp | Cinchona alkaloid derivatives |
| CH590275A5 (enExample) * | 1970-03-16 | 1977-07-29 | Hoffmann La Roche | |
| IL38492A (en) * | 1971-01-07 | 1975-08-31 | Sparamedica Ag | Quinoline derivatives,their preparation and pharmaceutical compositions containing them |
-
1974
- 1974-11-30 CH CH1586274A patent/CH605916A5/xx not_active IP Right Cessation
- 1974-12-02 ZA ZA00747664A patent/ZA747664B/xx unknown
- 1974-12-02 PH PH16586A patent/PH10837A/en unknown
- 1974-12-03 SE SE7415160A patent/SE415100B/xx unknown
- 1974-12-04 IL IL46181A patent/IL46181A/xx unknown
- 1974-12-05 CA CA215,292A patent/CA1039283A/en not_active Expired
- 1974-12-05 FR FR7439824A patent/FR2292476A1/fr active Granted
- 1974-12-06 DK DK637674AA patent/DK141700B/da unknown
- 1974-12-06 NL NL7415931A patent/NL7415931A/xx not_active Application Discontinuation
- 1974-12-06 JP JP49140423A patent/JPS5088076A/ja active Pending
- 1974-12-06 BE BE151217A patent/BE823023A/xx unknown
- 1974-12-06 AT AT977974A patent/AT339310B/de not_active IP Right Cessation
- 1974-12-06 BR BR10249/74A patent/BR7410249A/pt unknown
- 1974-12-06 GB GB5284374A patent/GB1441519A/en not_active Expired
- 1974-12-09 DE DE19742458146 patent/DE2458146A1/de not_active Withdrawn
-
1977
- 1977-01-18 AT AT24577A patent/AT353792B/de not_active IP Right Cessation
- 1977-03-30 KE KE2718A patent/KE2718A/xx unknown
- 1977-12-30 MY MY239/77A patent/MY7700239A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA747664B (en) | 1976-01-28 |
| DK141700C (enExample) | 1980-12-08 |
| ATA977974A (de) | 1977-02-15 |
| AT353792B (de) | 1979-12-10 |
| DE2458146A1 (de) | 1975-06-12 |
| AT339310B (de) | 1977-10-10 |
| GB1441519A (en) | 1976-07-07 |
| NL7415931A (nl) | 1975-06-10 |
| IL46181A0 (en) | 1975-03-13 |
| AU7559274A (en) | 1976-05-27 |
| BE823023A (fr) | 1975-06-06 |
| IL46181A (en) | 1978-03-10 |
| CH605916A5 (enExample) | 1978-10-13 |
| DK637674A (enExample) | 1975-07-28 |
| SE7415160L (enExample) | 1975-06-09 |
| ATA24577A (de) | 1979-05-15 |
| PH10837A (en) | 1977-09-09 |
| FR2292476B1 (enExample) | 1979-05-18 |
| KE2718A (en) | 1977-07-15 |
| SE415100B (sv) | 1980-09-08 |
| BR7410249A (pt) | 1976-06-29 |
| JPS5088076A (enExample) | 1975-07-15 |
| CA1039283A (en) | 1978-09-26 |
| DK141700B (da) | 1980-05-27 |
| FR2292476A1 (fr) | 1976-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL45091A0 (en) | Improved container-lid and its manufacture | |
| AU6595374A (en) | Rack and pnion assembly | |
| AU6820074A (en) | Azolyl-amidines | |
| PH12617A (en) | Aminobenzyl-amides and salts thereof | |
| AU6876974A (en) | Railbed | |
| CY969A (en) | 2-anilino-nicotinic and derivatives | |
| AU7015174A (en) | Glucuronyl-glucosamino-glycan-sulphonates | |
| AU7373674A (en) | D-homo-steroids | |
| IL44959A0 (en) | Alpha-acylureido-cephalosporins and their preparation | |
| AU7137874A (en) | Phenolaldehydes | |
| AU6616174A (en) | Flag-stone | |
| AU7351374A (en) | Carbo-chlorination | |
| AU7373974A (en) | D-homo-steroids | |
| MY7700239A (en) | Cinchonidine and cinchonine-derivatives | |
| AU6797274A (en) | Dichlorothiazolylureas | |
| AU6598974A (en) | 6-amino-th-benzocyclohepten-7-ones | |
| AU6850874A (en) | Coulping | |
| AU6797174A (en) | Motor-timer | |
| JPS511760A (en) | Konanryosei o jusuru goshokutaoru | |
| ZA744913B (en) | Groynes and their manufacture | |
| ZA744367B (en) | Bis-triazinobenzimidazoles and their preparation | |
| AU6757374A (en) | Modified interferons | |
| AU5649073A (en) | Gradio-gravimeter gradio-gravimeter | |
| AU6676574A (en) | Polypentenamers | |
| AU7144674A (en) | Raodstone |