KR950007754B1 - 1-하이드록시-2-피리돈의 제조방법 - Google Patents
1-하이드록시-2-피리돈의 제조방법 Download PDFInfo
- Publication number
- KR950007754B1 KR950007754B1 KR1019870003684A KR870003684A KR950007754B1 KR 950007754 B1 KR950007754 B1 KR 950007754B1 KR 1019870003684 A KR1019870003684 A KR 1019870003684A KR 870003684 A KR870003684 A KR 870003684A KR 950007754 B1 KR950007754 B1 KR 950007754B1
- Authority
- KR
- South Korea
- Prior art keywords
- compound
- formula
- oxygen
- methyl
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims description 36
- 238000002360 preparation method Methods 0.000 title claims description 6
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical class ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 98
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 23
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 21
- 229910052760 oxygen Inorganic materials 0.000 claims description 21
- 239000001301 oxygen Substances 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 15
- 239000000460 chlorine Substances 0.000 claims description 15
- 229910052801 chlorine Inorganic materials 0.000 claims description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 13
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 13
- 229910052794 bromium Inorganic materials 0.000 claims description 13
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 11
- GGOZGYRTNQBSSA-UHFFFAOYSA-N pyridine-2,3-diol Chemical class OC1=CC=CN=C1O GGOZGYRTNQBSSA-UHFFFAOYSA-N 0.000 claims description 11
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 10
- 239000002585 base Substances 0.000 claims description 9
- 125000004434 sulfur atom Chemical group 0.000 claims description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 150000001204 N-oxides Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- UDYUIWXQUBNDHC-UHFFFAOYSA-N 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 UDYUIWXQUBNDHC-UHFFFAOYSA-N 0.000 claims description 5
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000004305 biphenyl Substances 0.000 claims description 4
- 235000010290 biphenyl Nutrition 0.000 claims description 4
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 claims description 4
- VGYYSIDKAKXZEE-UHFFFAOYSA-L hydroxylammonium sulfate Chemical compound O[NH3+].O[NH3+].[O-]S([O-])(=O)=O VGYYSIDKAKXZEE-UHFFFAOYSA-L 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 235000017550 sodium carbonate Nutrition 0.000 claims description 4
- CMJRXUFGEJJSCZ-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 CMJRXUFGEJJSCZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 6
- 125000002619 bicyclic group Chemical group 0.000 claims 4
- ZTXCCUXGZQMUFW-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[(4-phenylphenoxy)methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=C(C=2C=CC=CC=2)C=C1 ZTXCCUXGZQMUFW-UHFFFAOYSA-N 0.000 claims 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims 1
- 150000002484 inorganic compounds Chemical class 0.000 claims 1
- 229910010272 inorganic material Inorganic materials 0.000 claims 1
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 claims 1
- 235000015497 potassium bicarbonate Nutrition 0.000 claims 1
- 239000011736 potassium bicarbonate Substances 0.000 claims 1
- 235000011181 potassium carbonates Nutrition 0.000 claims 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- 238000002844 melting Methods 0.000 description 70
- 230000008018 melting Effects 0.000 description 70
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 239000000047 product Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 238000004821 distillation Methods 0.000 description 16
- -1 phenyloxymethyl Chemical group 0.000 description 16
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 14
- WTDHULULXKLSOZ-UHFFFAOYSA-N hydroxylamine hydrochloride Substances Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 13
- 150000003254 radicals Chemical class 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 150000007529 inorganic bases Chemical class 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 150000007530 organic bases Chemical class 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 208000015181 infectious disease Diseases 0.000 description 7
- NQBKFULMFQMZBE-UHFFFAOYSA-N n-bz-3-benzanthronylpyrazolanthron Chemical compound C12=CC=CC(C(=O)C=3C4=CC=CC=3)=C2C4=NN1C1=CC=C2C3=C1C1=CC=CC=C1C(=O)C3=CC=C2 NQBKFULMFQMZBE-UHFFFAOYSA-N 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- VNFPBHJOKIVQEB-UHFFFAOYSA-N clotrimazole Chemical compound ClC1=CC=CC=C1C(N1C=NC=C1)(C=1C=CC=CC=1)C1=CC=CC=C1 VNFPBHJOKIVQEB-UHFFFAOYSA-N 0.000 description 6
- 229960004022 clotrimazole Drugs 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000002538 fungal effect Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 4
- LUIDLGSVCGOJGK-UHFFFAOYSA-N 6-(chloromethyl)-4-methylpyran-2-one Chemical compound CC=1C=C(CCl)OC(=O)C=1 LUIDLGSVCGOJGK-UHFFFAOYSA-N 0.000 description 4
- 241000233866 Fungi Species 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 4
- 229910052736 halogen Chemical group 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 244000005700 microbiome Species 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 3
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 3
- XQMRZWSYBUCVAX-UHFFFAOYSA-N 4-(4-chlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Cl)C=C1 XQMRZWSYBUCVAX-UHFFFAOYSA-N 0.000 description 3
- MJQVWFQOPJBTIP-UHFFFAOYSA-N 6-[[4-[(2,4-dichlorophenyl)methyl]phenoxy]methyl]-1-hydroxy-3,4-dimethylpyridin-2-one Chemical compound ON1C(=O)C(C)=C(C)C=C1COC(C=C1)=CC=C1CC1=CC=C(Cl)C=C1Cl MJQVWFQOPJBTIP-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 230000000843 anti-fungal effect Effects 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- PUYPMYRZFIRPIH-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[3-(2-phenoxyethoxy)phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(OCCOC=2C=CC=CC=2)=C1 PUYPMYRZFIRPIH-UHFFFAOYSA-N 0.000 description 2
- QCOBRTWWFHKJFN-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[3-(naphthalen-1-ylmethoxy)phenyl]sulfanylmethyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1CSC1=CC=CC(OCC=2C3=CC=CC=C3C=CC=2)=C1 QCOBRTWWFHKJFN-UHFFFAOYSA-N 0.000 description 2
- QOIROKIBJHTPPE-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[4-(naphthalen-1-ylmethoxy)phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCC1=CC=CC2=CC=CC=C12 QOIROKIBJHTPPE-UHFFFAOYSA-N 0.000 description 2
- LIYGCLJYTHRBQV-UHFFFAOYSA-N 3,5-dichloro-4-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(C=O)C=C1Cl LIYGCLJYTHRBQV-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- OORPUQQGCKGIKZ-UHFFFAOYSA-N 6-[[2,6-dichloro-4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C(=C1)Cl)=C(Cl)C=C1OC1=CC=C(Cl)C=C1 OORPUQQGCKGIKZ-UHFFFAOYSA-N 0.000 description 2
- MCHNMSOCAOCXLL-UHFFFAOYSA-N 6-[[2,6-dichloro-4-(chloromethyl)phenoxy]methyl]-4-methylpyran-2-one Chemical compound O1C(=O)C=C(C)C=C1COC1=C(Cl)C=C(CCl)C=C1Cl MCHNMSOCAOCXLL-UHFFFAOYSA-N 0.000 description 2
- HUXNFDXZBIBKQD-UHFFFAOYSA-N 6-[[2,6-dichloro-4-(naphthalen-2-ylsulfanylmethyl)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C(=C1)Cl)=C(Cl)C=C1CSC1=CC=C(C=CC=C2)C2=C1 HUXNFDXZBIBKQD-UHFFFAOYSA-N 0.000 description 2
- IWTASQVSDUNCDH-UHFFFAOYSA-N 6-[[3-[3-(4-chlorophenyl)sulfanylpropylsulfanyl]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(SCCCSC=2C=CC(Cl)=CC=2)=C1 IWTASQVSDUNCDH-UHFFFAOYSA-N 0.000 description 2
- XBVBQNAVZFUVNY-UHFFFAOYSA-N 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxypyridin-2-one Chemical compound C1=CC(=O)N(O)C(COC=2C=CC(OC=3C=CC(Cl)=CC=3)=CC=2)=C1 XBVBQNAVZFUVNY-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002443 hydroxylamines Chemical class 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000000813 microbial effect Effects 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical group OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 1
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 1
- LBMKFQMJURUPKC-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCl)C=C1 LBMKFQMJURUPKC-UHFFFAOYSA-N 0.000 description 1
- HRGKYGQCSVUDHA-UHFFFAOYSA-N 1-chloro-4-(3-chloropropoxy)benzene Chemical compound ClCCCOC1=CC=C(Cl)C=C1 HRGKYGQCSVUDHA-UHFFFAOYSA-N 0.000 description 1
- GFQZQXUPTKKCLH-UHFFFAOYSA-N 1-chloro-4-(3-iodo-2,2-dimethylpropyl)sulfanylbenzene Chemical compound ICC(C)(C)CSC1=CC=C(Cl)C=C1 GFQZQXUPTKKCLH-UHFFFAOYSA-N 0.000 description 1
- PZPZVIUMVSRPMH-UHFFFAOYSA-N 1-chloro-4-(3-iodopropylsulfanyl)benzene Chemical compound ClC1=CC=C(SCCCI)C=C1 PZPZVIUMVSRPMH-UHFFFAOYSA-N 0.000 description 1
- GQOXMWRCVCPVFU-UHFFFAOYSA-N 1-chloro-4-(4-iodobutylsulfanyl)benzene Chemical compound ClC1=CC=C(SCCCCI)C=C1 GQOXMWRCVCPVFU-UHFFFAOYSA-N 0.000 description 1
- PPNCOQHHSGMKGI-UHFFFAOYSA-N 1-cyclononyldiazonane Chemical compound C1CCCCCCCC1N1NCCCCCCC1 PPNCOQHHSGMKGI-UHFFFAOYSA-N 0.000 description 1
- BPZVTRRTYRIQGN-UHFFFAOYSA-N 1-hydroxy-3,4-dimethyl-6-[[3-(naphthalen-1-ylmethylsulfanyl)phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C(C)=C(C)C=C1COC1=CC=CC(SCC=2C3=CC=CC=C3C=CC=2)=C1 BPZVTRRTYRIQGN-UHFFFAOYSA-N 0.000 description 1
- YKQIXKFBYOKAHS-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[(2-phenylphenoxy)methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC=C1C1=CC=CC=C1 YKQIXKFBYOKAHS-UHFFFAOYSA-N 0.000 description 1
- KBNRSCSPPIPYEQ-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[2-(naphthalen-1-ylmethoxy)phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC=C1OCC1=CC=CC2=CC=CC=C12 KBNRSCSPPIPYEQ-UHFFFAOYSA-N 0.000 description 1
- SLVFHUBFJNYCSI-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[3-(naphthalen-1-ylmethoxy)phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(OCC=2C3=CC=CC=C3C=CC=2)=C1 SLVFHUBFJNYCSI-UHFFFAOYSA-N 0.000 description 1
- SJDVRIAOOQHWJB-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[3-(naphthalen-1-ylmethylsulfanyl)phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(SCC=2C3=CC=CC=C3C=CC=2)=C1 SJDVRIAOOQHWJB-UHFFFAOYSA-N 0.000 description 1
- WFIQWIXGBPPBEL-UHFFFAOYSA-N 1-hydroxy-4-methyl-6-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]methyl]pyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCC1=CC=C(OC(F)(F)F)C=C1 WFIQWIXGBPPBEL-UHFFFAOYSA-N 0.000 description 1
- XVBDVCYAOOQCML-UHFFFAOYSA-N 1-hydroxy-6-[[4-(4-methoxyphenyl)sulfanylphenoxy]methyl]-4-methylpyridin-2-one Chemical compound C1=CC(OC)=CC=C1SC(C=C1)=CC=C1OCC1=CC(C)=CC(=O)N1O XVBDVCYAOOQCML-UHFFFAOYSA-N 0.000 description 1
- WAXIFMGAKWIFDQ-UHFFFAOYSA-N 1-tert-butyl-4-(chloromethyl)benzene Chemical compound CC(C)(C)C1=CC=C(CCl)C=C1 WAXIFMGAKWIFDQ-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- FLAJYIKIPQZYAY-UHFFFAOYSA-N 2,4-dibromo-6-phenylphenol Chemical compound OC1=C(Br)C=C(Br)C=C1C1=CC=CC=C1 FLAJYIKIPQZYAY-UHFFFAOYSA-N 0.000 description 1
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 1
- CDMGNVWZXRKJNS-UHFFFAOYSA-N 2-benzylphenol Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1 CDMGNVWZXRKJNS-UHFFFAOYSA-N 0.000 description 1
- IGCLZKNWJBABJZ-UHFFFAOYSA-N 2-bromo-6-[[4-(4-chlorophenoxy)phenoxy]methyl]pyridine Chemical compound C1=CC(Cl)=CC=C1OC(C=C1)=CC=C1OCC1=CC=CC(Br)=N1 IGCLZKNWJBABJZ-UHFFFAOYSA-N 0.000 description 1
- SOHDPICLICFSOP-UHFFFAOYSA-N 2-bromo-6-methylpyridine Chemical compound CC1=CC=CC(Br)=N1 SOHDPICLICFSOP-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- LDUCTLWCKOLAPM-UHFFFAOYSA-N 2-methyl-1h-pyridin-2-amine Chemical compound CC1(N)NC=CC=C1 LDUCTLWCKOLAPM-UHFFFAOYSA-N 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- ITOWXKCHHSAVHM-UHFFFAOYSA-N 3,5-dichloro-4-[(4-methyl-6-oxopyran-2-yl)methoxy]benzaldehyde Chemical compound O1C(=O)C=C(C)C=C1COC1=C(Cl)C=C(C=O)C=C1Cl ITOWXKCHHSAVHM-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- ONSORTZZRTZZNR-UHFFFAOYSA-N 3-(4-chlorophenyl)sulfanylphenol Chemical compound OC1=CC=CC(SC=2C=CC(Cl)=CC=2)=C1 ONSORTZZRTZZNR-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- QXRPZAARCBAZKD-UHFFFAOYSA-N 3-(naphthalen-1-ylmethylsulfanyl)phenol Chemical compound OC1=CC=CC(SCC=2C3=CC=CC=C3C=CC=2)=C1 QXRPZAARCBAZKD-UHFFFAOYSA-N 0.000 description 1
- RPEWLIDSBZHSSW-UHFFFAOYSA-N 3-[3-(4-chlorophenyl)sulfanylpropylsulfanyl]phenol Chemical compound OC1=CC=CC(SCCCSC=2C=CC(Cl)=CC=2)=C1 RPEWLIDSBZHSSW-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- AJIHBUNFLVGSRK-UHFFFAOYSA-N 4-(4-bromo-2-chlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Br)C=C1Cl AJIHBUNFLVGSRK-UHFFFAOYSA-N 0.000 description 1
- MHAJLICSGFKVFK-UHFFFAOYSA-N 4-(4-chlorophenyl)sulfanylphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(Cl)C=C1 MHAJLICSGFKVFK-UHFFFAOYSA-N 0.000 description 1
- KIVFDFJTCRMULF-UHFFFAOYSA-N 4-(4-fluorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(F)C=C1 KIVFDFJTCRMULF-UHFFFAOYSA-N 0.000 description 1
- HHFXDKAXCKUSIV-UHFFFAOYSA-N 4-Hydroxy-3,5-dichlorobiphenyl Chemical compound C1=C(Cl)C(O)=C(Cl)C=C1C1=CC=CC=C1 HHFXDKAXCKUSIV-UHFFFAOYSA-N 0.000 description 1
- NPNHACUAJQMTLH-UHFFFAOYSA-N 4-[(2,4-dichlorophenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=C(Cl)C=C1Cl NPNHACUAJQMTLH-UHFFFAOYSA-N 0.000 description 1
- QMSAOPHPQBMKCI-UHFFFAOYSA-N 4-[4-(4-chlorophenoxy)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 QMSAOPHPQBMKCI-UHFFFAOYSA-N 0.000 description 1
- FJFSSESWAFPCSU-UHFFFAOYSA-N 4-[4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 FJFSSESWAFPCSU-UHFFFAOYSA-N 0.000 description 1
- HJSPWKGEPDZNLK-UHFFFAOYSA-N 4-benzylphenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1 HJSPWKGEPDZNLK-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- MGDDMHWEDIMCON-UHFFFAOYSA-N 4-methyl-6-[[3-(2-phenoxyethoxy)phenoxy]methyl]pyran-2-one Chemical compound O1C(=O)C=C(C)C=C1COC1=CC=CC(OCCOC=2C=CC=CC=2)=C1 MGDDMHWEDIMCON-UHFFFAOYSA-N 0.000 description 1
- UHZRRWRWZLFJTF-UHFFFAOYSA-N 4-methyl-6-[[3-(naphthalen-1-ylmethoxy)phenyl]sulfanylmethyl]pyran-2-one Chemical compound O1C(=O)C=C(C)C=C1CSC1=CC=CC(OCC=2C3=CC=CC=C3C=CC=2)=C1 UHZRRWRWZLFJTF-UHFFFAOYSA-N 0.000 description 1
- SBSPTHRBJDNBGB-UHFFFAOYSA-N 4-methyl-6-[[4-(naphthalen-1-ylmethoxy)phenoxy]methyl]pyran-2-one Chemical compound O1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCC1=CC=CC2=CC=CC=C12 SBSPTHRBJDNBGB-UHFFFAOYSA-N 0.000 description 1
- FINYGTPXELVTLO-UHFFFAOYSA-N 4-methylpyran-2-one Chemical compound CC=1C=COC(=O)C=1 FINYGTPXELVTLO-UHFFFAOYSA-N 0.000 description 1
- XXRUQNNAKXZSOS-UHFFFAOYSA-N 5-(chloromethyl)-1,2,3-trimethoxybenzene Chemical compound COC1=CC(CCl)=CC(OC)=C1OC XXRUQNNAKXZSOS-UHFFFAOYSA-N 0.000 description 1
- CGLMASZXSROWGG-UHFFFAOYSA-N 6-(chloromethyl)-3,4-dimethylpyran-2-one Chemical compound CC=1C=C(CCl)OC(=O)C=1C CGLMASZXSROWGG-UHFFFAOYSA-N 0.000 description 1
- UKPLMIATQKHKLH-UHFFFAOYSA-N 6-[(2,4-dibromo-6-phenylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=C(Br)C=C(Br)C=C1C1=CC=CC=C1 UKPLMIATQKHKLH-UHFFFAOYSA-N 0.000 description 1
- PGFPFOVBOMCDLI-UHFFFAOYSA-N 6-[(2,6-dibromo-4-phenylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=C(Br)C=C(C=2C=CC=CC=2)C=C1Br PGFPFOVBOMCDLI-UHFFFAOYSA-N 0.000 description 1
- KTCMZSNZBVBROI-UHFFFAOYSA-N 6-[(2,6-dichloro-4-phenylmethoxyphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C(=C1)Cl)=C(Cl)C=C1OCC1=CC=CC=C1 KTCMZSNZBVBROI-UHFFFAOYSA-N 0.000 description 1
- BZQQNMLPZSAWKM-UHFFFAOYSA-N 6-[(2,6-dichloro-4-phenylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=C(Cl)C=C(C=2C=CC=CC=2)C=C1Cl BZQQNMLPZSAWKM-UHFFFAOYSA-N 0.000 description 1
- JTAIONWZEZFMLL-UHFFFAOYSA-N 6-[(2-benzylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC=C1CC1=CC=CC=C1 JTAIONWZEZFMLL-UHFFFAOYSA-N 0.000 description 1
- JYOITVJFCFPVSH-UHFFFAOYSA-N 6-[(2-bromo-4-phenylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=C(C=2C=CC=CC=2)C=C1Br JYOITVJFCFPVSH-UHFFFAOYSA-N 0.000 description 1
- XDFNVPOBLLDTNQ-UHFFFAOYSA-N 6-[(2-bromo-6-chloro-4-phenylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=C(Cl)C=C(C=2C=CC=CC=2)C=C1Br XDFNVPOBLLDTNQ-UHFFFAOYSA-N 0.000 description 1
- UPZOBTDFVJAUSK-UHFFFAOYSA-N 6-[(3-hydroxyphenoxy)methyl]-4-methylpyran-2-one Chemical compound O1C(=O)C=C(C)C=C1COC1=CC=CC(O)=C1 UPZOBTDFVJAUSK-UHFFFAOYSA-N 0.000 description 1
- IQEKQBCLFIITHU-UHFFFAOYSA-N 6-[(3-hydroxyphenyl)sulfanylmethyl]-4-methylpyran-2-one Chemical compound O1C(=O)C=C(C)C=C1CSC1=CC=CC(O)=C1 IQEKQBCLFIITHU-UHFFFAOYSA-N 0.000 description 1
- BRAAURUJHFSPTE-UHFFFAOYSA-N 6-[(4-benzylphenoxy)methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1CC1=CC=CC=C1 BRAAURUJHFSPTE-UHFFFAOYSA-N 0.000 description 1
- VZTLHJYHPPLLSU-UHFFFAOYSA-N 6-[(4-hydroxyphenoxy)methyl]-4-methylpyran-2-one Chemical compound O1C(=O)C=C(C)C=C1COC1=CC=C(O)C=C1 VZTLHJYHPPLLSU-UHFFFAOYSA-N 0.000 description 1
- LFHJAQCTZRQMMG-UHFFFAOYSA-N 6-[[2,6-dibromo-4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C(=C1)Br)=C(Br)C=C1OC1=CC=C(Cl)C=C1 LFHJAQCTZRQMMG-UHFFFAOYSA-N 0.000 description 1
- OJYWXMVZESDCLG-UHFFFAOYSA-N 6-[[2-[(4-chlorophenyl)methoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC=C1OCC1=CC=C(Cl)C=C1 OJYWXMVZESDCLG-UHFFFAOYSA-N 0.000 description 1
- CEBSPHRODCOIJQ-UHFFFAOYSA-N 6-[[3-(4-chlorophenyl)sulfanylphenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(SC=2C=CC(Cl)=CC=2)=C1 CEBSPHRODCOIJQ-UHFFFAOYSA-N 0.000 description 1
- VRYCHOYAQWXJTN-UHFFFAOYSA-N 6-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(OCC=2C=CC(Cl)=CC=2)=C1 VRYCHOYAQWXJTN-UHFFFAOYSA-N 0.000 description 1
- XLZXHHVOAPLHBN-UHFFFAOYSA-N 6-[[3-[(4-chlorophenyl)methoxy]phenyl]sulfanylmethyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1CSC1=CC=CC(OCC=2C=CC(Cl)=CC=2)=C1 XLZXHHVOAPLHBN-UHFFFAOYSA-N 0.000 description 1
- UJKVLZYBXHHYSO-UHFFFAOYSA-N 6-[[3-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(OCCOCCSC=2C=CC(Cl)=CC=2)=C1 UJKVLZYBXHHYSO-UHFFFAOYSA-N 0.000 description 1
- DVYAOCDMIVEGNZ-UHFFFAOYSA-N 6-[[3-[2-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethoxy]ethylsulfanyl]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(SCCOCCOCCSC=2C=CC(Cl)=CC=2)=C1 DVYAOCDMIVEGNZ-UHFFFAOYSA-N 0.000 description 1
- BVHNGOIFIMJCKD-UHFFFAOYSA-N 6-[[3-[4-(4-chlorophenyl)sulfanylbutoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC1=CC=CC(OCCCCSC=2C=CC(Cl)=CC=2)=C1 BVHNGOIFIMJCKD-UHFFFAOYSA-N 0.000 description 1
- FICIDNLKUZDFQS-UHFFFAOYSA-N 6-[[4-(2,4-dichlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(Cl)C=C1Cl FICIDNLKUZDFQS-UHFFFAOYSA-N 0.000 description 1
- SMCURGKGTAHNQM-UHFFFAOYSA-N 6-[[4-(4-bromo-2-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(Br)C=C1Cl SMCURGKGTAHNQM-UHFFFAOYSA-N 0.000 description 1
- NOMIBIVUURZCPM-UHFFFAOYSA-N 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-3,4-dimethylpyridin-2-one Chemical compound ON1C(=O)C(C)=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 NOMIBIVUURZCPM-UHFFFAOYSA-N 0.000 description 1
- HJYWPCRRBFVCGO-UHFFFAOYSA-N 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-1-hydroxy-4,5-dimethylpyridin-2-one Chemical compound CC1=CC(=O)N(O)C(COC=2C=CC(OC=3C=CC(Cl)=CC=3)=CC=2)=C1C HJYWPCRRBFVCGO-UHFFFAOYSA-N 0.000 description 1
- NKDPPQLEQJMZPG-UHFFFAOYSA-N 6-[[4-(4-chlorophenoxy)phenoxy]methyl]-4-methylpyran-2-one Chemical compound O1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 NKDPPQLEQJMZPG-UHFFFAOYSA-N 0.000 description 1
- DKVMSUYZXLEIJP-UHFFFAOYSA-N 6-[[4-(4-chlorophenyl)sulfanylphenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1SC1=CC=C(Cl)C=C1 DKVMSUYZXLEIJP-UHFFFAOYSA-N 0.000 description 1
- QJDYXHZNCLWBBN-UHFFFAOYSA-N 6-[[4-(4-fluorophenoxy)phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC1=CC=C(F)C=C1 QJDYXHZNCLWBBN-UHFFFAOYSA-N 0.000 description 1
- WQRDQQATCFVLNN-UHFFFAOYSA-N 6-[[4-[(2,4-dichlorophenyl)methoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCC1=CC=C(Cl)C=C1Cl WQRDQQATCFVLNN-UHFFFAOYSA-N 0.000 description 1
- UXIDJHWWPFDIFK-UHFFFAOYSA-N 6-[[4-[(2,4-dichlorophenyl)methyl]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1CC1=CC=C(Cl)C=C1Cl UXIDJHWWPFDIFK-UHFFFAOYSA-N 0.000 description 1
- RDDZJSJBVWSHMD-UHFFFAOYSA-N 6-[[4-[(4-chlorophenyl)methoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCC1=CC=C(Cl)C=C1 RDDZJSJBVWSHMD-UHFFFAOYSA-N 0.000 description 1
- QIVLXDQIERFSRQ-UHFFFAOYSA-N 6-[[4-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCC1=CC=C(C(C)(C)C)C=C1 QIVLXDQIERFSRQ-UHFFFAOYSA-N 0.000 description 1
- AYHUJZVKXPBSSI-UHFFFAOYSA-N 6-[[4-[3-(4-chlorophenoxy)propoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OCCCOC1=CC=C(Cl)C=C1 AYHUJZVKXPBSSI-UHFFFAOYSA-N 0.000 description 1
- WPWWNNDIXZNAPE-UHFFFAOYSA-N 6-[[4-[4-(4-chlorophenoxy)phenoxy]phenoxy]methyl]-1-hydroxy-4-methylpyridin-2-one Chemical compound ON1C(=O)C=C(C)C=C1COC(C=C1)=CC=C1OC(C=C1)=CC=C1OC1=CC=C(Cl)C=C1 WPWWNNDIXZNAPE-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- HBCBKVDLCJIIPV-UHFFFAOYSA-N CC1=C(C(=O)N(C=C1)O)COC2=CC=CC=C2 Chemical compound CC1=C(C(=O)N(C=C1)O)COC2=CC=CC=C2 HBCBKVDLCJIIPV-UHFFFAOYSA-N 0.000 description 1
- DVIYGWQMKPQEHG-UHFFFAOYSA-N CC1=C(C(=O)OC=C1)COC2=CC=C(C=C2)O Chemical compound CC1=C(C(=O)OC=C1)COC2=CC=C(C=C2)O DVIYGWQMKPQEHG-UHFFFAOYSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000079388 Colonus Species 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 101500021084 Locusta migratoria 5 kDa peptide Proteins 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000282849 Ruminantia Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 241000893966 Trichophyton verrucosum Species 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001332 colony forming effect Effects 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125936 compound 42 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical class C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 208000024386 fungal infectious disease Diseases 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- SVEUVITYHIHZQE-UHFFFAOYSA-N n-methylpyridin-2-amine Chemical compound CNC1=CC=CC=N1 SVEUVITYHIHZQE-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- IOMMMLWIABWRKL-WUTDNEBXSA-N nazartinib Chemical compound C1N(C(=O)/C=C/CN(C)C)CCCC[C@H]1N1C2=C(Cl)C=CC=C2N=C1NC(=O)C1=CC=NC(C)=C1 IOMMMLWIABWRKL-WUTDNEBXSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- VTSJZEUDHYPVSP-UHFFFAOYSA-L silver sodium carbonate Chemical compound [Na+].[Ag+].[O-]C([O-])=O VTSJZEUDHYPVSP-UHFFFAOYSA-L 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000010421 standard material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 238000003809 water extraction Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/34—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D309/36—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
- C07D309/38—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms one oxygen atom in position 2 or 4, e.g. pyrones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3613061.3 | 1986-04-18 | ||
| DE19863613061 DE3613061A1 (de) | 1986-04-18 | 1986-04-18 | 1-hydroxy-2-pyridone, verfahren zu ihrer herstellung und arzneimittel, die sie enthalten |
| DE19863626211 DE3626211A1 (de) | 1986-08-02 | 1986-08-02 | Verfahren zur herstellung von 1-hydroxy-2-pyridonen |
| DEP3626211.0 | 1986-08-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR870010001A KR870010001A (ko) | 1987-11-30 |
| KR950007754B1 true KR950007754B1 (ko) | 1995-07-14 |
Family
ID=25842992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1019870003684A Expired - Lifetime KR950007754B1 (ko) | 1986-04-18 | 1987-04-17 | 1-하이드록시-2-피리돈의 제조방법 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4797409A (https=) |
| EP (1) | EP0241918B1 (https=) |
| KR (1) | KR950007754B1 (https=) |
| AR (1) | AR242187A1 (https=) |
| AT (1) | AT388551B (https=) |
| AU (1) | AU602684B2 (https=) |
| CA (1) | CA1302415C (https=) |
| DE (1) | DE3779352D1 (https=) |
| DK (1) | DK167494B1 (https=) |
| ES (1) | ES2041656T3 (https=) |
| FI (1) | FI86635C (https=) |
| GR (1) | GR3005465T3 (https=) |
| HU (1) | HU198020B (https=) |
| IE (1) | IE59965B1 (https=) |
| IL (1) | IL82231A (https=) |
| NO (1) | NO170540C (https=) |
| NZ (1) | NZ220020A (https=) |
| PH (1) | PH24106A (https=) |
| PT (1) | PT84702B (https=) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3626210C1 (de) * | 1986-08-02 | 1987-10-01 | Hoechst Ag | Verfahren zur Herstellung von 1-Hydroxy-2-pyridonen |
| US4968803A (en) * | 1989-04-10 | 1990-11-06 | Allied-Signal Inc. | Process for the preparation of 2-hydroxypyridine or quinoline compounds |
| US5112981A (en) * | 1989-08-16 | 1992-05-12 | Hoechst-Roussel Pharmaceuticals Inc. | 5-(1-aminocyclohexyl)-2(1H)-pyridinone and related compounds |
| US5243087A (en) * | 1990-05-24 | 1993-09-07 | Sumitomo Chemical Company, Limited | Pyridine derivatives, their production processes and their compositions for the control of insect pests |
| DE4017019A1 (de) * | 1990-05-26 | 1991-11-28 | Hoechst Ag | Verwendung von substituierten ss-hydroxyethylaminen als potente hemmstoffe der exoenzyme von pilzen |
| HUT70031A (en) * | 1992-11-30 | 1995-09-28 | Sankyo Co | Alfa, omega-diarylalkane derivatives, their preparation and pharmaceutical compositions containing them |
| DE4333893A1 (de) * | 1993-10-05 | 1995-04-06 | Hoechst Ag | Kosmetische Zubereitungen |
| DE4405722A1 (de) * | 1994-02-23 | 1995-08-24 | Cassella Ag | Verfahren zur Herstellung von 6-Aryloxymethyl-1-hydroxy-4-methyl-2-pyridonen |
| US5817825A (en) * | 1994-11-02 | 1998-10-06 | Hoechst Aktiengesellschaft | Process for the preparation of 1-hydroxy-2-pyridones |
| DE19545139C1 (de) * | 1995-12-04 | 1997-04-17 | Hoechst Ag | Verwendung fungizider Mittel zur selektiven Dekontamination von Zahnersatz |
| DE19643831A1 (de) | 1996-10-30 | 1998-05-07 | Hoechst Ag | Verwendung von 1-Hydroxy-2-pyridonen zur Behandlung von schwer therapierbaren Schleimhauterkrankungen |
| ES2176513T3 (es) * | 1995-12-04 | 2002-12-01 | Aventis Pharma Gmbh | Empleo de 1-hidroxi-2-piridonas para el tratamiento de afecciones de las mucosas de dificil terapia. |
| DE19639817A1 (de) * | 1996-09-27 | 1998-04-02 | Hoechst Ag | Verwendung von 1-Hydroxy-2-pyridonen zur Behandlung von Hautinfektionen |
| DE19639816A1 (de) | 1996-09-27 | 1998-04-02 | Hoechst Ag | Antimykotische Mittel mit hoher Wirkstofffreisetzung |
| US20040039030A1 (en) * | 1996-09-27 | 2004-02-26 | Hoechst Akeengesellschaft | Use of 1-hydroxy-2-pyridones for the treatment of seborrheic dermatitis |
| DE19802708A1 (de) * | 1998-01-24 | 1999-07-29 | Hoechst Marion Roussel De Gmbh | Verwendung von hydroxypyridon-haltigen Puderzubereitungen zur Behandlung von Unterschenkel- und Druckgeschwüren |
| DE19961256A1 (de) * | 1999-12-18 | 2001-06-21 | Clariant Gmbh | Kosmetische Zubereitungen |
| DE10011081A1 (de) * | 2000-03-09 | 2001-09-13 | Aventis Pharma Gmbh | Antiinfektive Wirkstoffkombinationen und ihre Verwendung zur topischen Behandlung von Pilzerkrankungen der Fuß- und Fingernägel |
| WO2005055931A2 (en) | 2003-12-03 | 2005-06-23 | University Of Medicine And Dentistry Of New Jersey | Method of preventing survival of retrovirally cells and of inhibiting formation of infectious retroviruses |
| BRPI0606784B1 (pt) * | 2005-02-03 | 2018-07-31 | Clariant Produkte (Deutschland) Gmbh | Conservantes |
| US9849146B2 (en) | 2009-07-20 | 2017-12-26 | Rutgers, The State University Of New Jersey | Inhibition of nonsense mediated mRNA decay by drugs that prevent hypusination of eukaryotic initiation factor 5A |
| US8603814B2 (en) * | 2009-07-20 | 2013-12-10 | Rutgers The State University Of New Jersey | Method of inhibiting nonsense-mediated mRNA decay |
| GB201420348D0 (en) * | 2014-11-17 | 2014-12-31 | Univ Northumbria Newcastle | Compounds for treating neurodegenerative diseases |
| EP3307255B1 (en) | 2015-06-11 | 2024-11-20 | Saint Louis University | Inhibitors of nucleotidyl transferases and use in herpes and hepatitis viral infections therefor |
| CN111518022A (zh) * | 2019-02-02 | 2020-08-11 | 华东理工大学 | 具有杀虫活性的芳(杂)环醚类化合物及其制备方法和用途 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2540218A (en) * | 1947-08-25 | 1951-02-06 | Squibb & Sons Inc | 2-hydroxy-pyridine-n-oxide and process for preparing same |
| FR3691M (fr) * | 1963-05-06 | 1965-11-15 | Olin Mathieson | Nouvelle composition pharmaceutique utile en tant que fongicide. |
| US3883545A (en) * | 1968-08-31 | 1975-05-13 | Hoechst Ag | Certain 1-hydroxy-2-pyridones |
| US3968118A (en) * | 1968-08-31 | 1976-07-06 | Hoechst Aktiengesellschaft | Process for the manufacture of 1-hydroxy-2-pyridones |
| US3972888A (en) * | 1972-03-25 | 1976-08-03 | Hoechst Aktiengesellschaft | Process for the preparation of 1-hydroxy-pyridones |
| DE2234009C3 (de) * | 1972-07-11 | 1979-01-11 | Hoechst Ag, 6000 Frankfurt | Kosmetische Zubereitungen |
| US4185106A (en) * | 1972-07-11 | 1980-01-22 | Hoechst Aktiengesellschaft | Pyridones as antidandruff agents |
| DE2916648A1 (de) * | 1979-04-25 | 1980-11-06 | Dynamit Nobel Ag | Neue derivate der alpha -pyronyl-6- essigsaeure |
-
1987
- 1987-04-14 ES ES198787105537T patent/ES2041656T3/es not_active Expired - Lifetime
- 1987-04-14 AR AR87307291A patent/AR242187A1/es active
- 1987-04-14 DE DE8787105537T patent/DE3779352D1/de not_active Expired - Lifetime
- 1987-04-14 EP EP87105537A patent/EP0241918B1/de not_active Expired - Lifetime
- 1987-04-15 NO NO871602A patent/NO170540C/no unknown
- 1987-04-15 DK DK198387A patent/DK167494B1/da not_active IP Right Cessation
- 1987-04-16 PT PT84702A patent/PT84702B/pt unknown
- 1987-04-16 US US07/038,903 patent/US4797409A/en not_active Expired - Lifetime
- 1987-04-16 HU HU871683A patent/HU198020B/hu unknown
- 1987-04-16 IL IL82231A patent/IL82231A/xx not_active IP Right Cessation
- 1987-04-16 NZ NZ220020A patent/NZ220020A/xx unknown
- 1987-04-16 AU AU71717/87A patent/AU602684B2/en not_active Expired
- 1987-04-16 CA CA000535001A patent/CA1302415C/en not_active Expired - Lifetime
- 1987-04-16 FI FI871699A patent/FI86635C/fi not_active IP Right Cessation
- 1987-04-16 IE IE100987A patent/IE59965B1/en not_active IP Right Cessation
- 1987-04-17 KR KR1019870003684A patent/KR950007754B1/ko not_active Expired - Lifetime
- 1987-04-20 PH PH35156A patent/PH24106A/en unknown
- 1987-10-08 AT AT0258387A patent/AT388551B/de not_active IP Right Cessation
-
1992
- 1992-08-20 GR GR920401787T patent/GR3005465T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI86635B (fi) | 1992-06-15 |
| DK198387A (da) | 1987-10-19 |
| IE59965B1 (en) | 1994-05-04 |
| EP0241918B1 (de) | 1992-05-27 |
| EP0241918A3 (en) | 1989-04-26 |
| NO871602D0 (no) | 1987-04-15 |
| FI871699A7 (fi) | 1987-10-19 |
| EP0241918A2 (de) | 1987-10-21 |
| HU198020B (en) | 1989-07-28 |
| FI86635C (fi) | 1992-09-25 |
| NO170540C (no) | 1992-10-28 |
| IE871009L (en) | 1987-10-18 |
| US4797409A (en) | 1989-01-10 |
| KR870010001A (ko) | 1987-11-30 |
| FI871699A0 (fi) | 1987-04-16 |
| ES2041656T3 (es) | 1993-12-01 |
| DK198387D0 (da) | 1987-04-15 |
| PH24106A (en) | 1990-03-05 |
| PT84702A (de) | 1987-05-01 |
| DK167494B1 (da) | 1993-11-08 |
| CA1302415C (en) | 1992-06-02 |
| HUT43824A (en) | 1987-12-28 |
| GR3005465T3 (https=) | 1993-05-24 |
| AU7171787A (en) | 1987-10-22 |
| DE3779352D1 (de) | 1992-07-02 |
| IL82231A (en) | 1991-06-10 |
| IL82231A0 (en) | 1987-10-30 |
| ATA258387A (de) | 1988-12-15 |
| PT84702B (pt) | 1989-11-30 |
| NO170540B (no) | 1992-07-20 |
| NO871602L (no) | 1987-10-19 |
| AT388551B (de) | 1989-07-25 |
| NZ220020A (en) | 1989-09-27 |
| AR242187A1 (es) | 1993-03-31 |
| AU602684B2 (en) | 1990-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR950007754B1 (ko) | 1-하이드록시-2-피리돈의 제조방법 | |
| JP2558001B2 (ja) | アルコキシイミノ酢酸アミド化合物および農業用殺菌剤 | |
| MXPA05000718A (es) | Derivados de azuleno y sal del mismo. | |
| US4171365A (en) | Antiviral aryloxyalkylpyrazoles | |
| US4371537A (en) | Sulfur-substituted phenoxypyridines having antiviral activity | |
| US4031246A (en) | Aryloxyalkyl diketones | |
| EP0304190B1 (en) | (arylsulphonyl)nitromethanes, process for their preparation and use in pharmaceutical compositions | |
| WO1998000389A1 (en) | 2-hydroxypropionic acid derivative and its manufacturing method | |
| US4261928A (en) | 2-Benzoyl-8-(2-chloro-4-methoxyphenoxy)-1-phenyl-1-octanone | |
| US4232161A (en) | 4-[6-(2-Chloro-4-methoxyphenoxy)hexyl]-3,5-diethyl-1-(2-pyridinyl)-1H-pyrazole | |
| JPH05504961A (ja) | 複素環化合物 | |
| KR100194993B1 (ko) | 술폰아미드 유도체 | |
| KR950007755B1 (ko) | 1-하이드록시-2-피리돈 및 이를 함유하는 약제 | |
| US4209526A (en) | Antiviral arylenedioxyalkyl substituted pyrazoles | |
| US3692794A (en) | 1,2,4-thiadiazoles | |
| JPS62249974A (ja) | １−ヒドロキシ−２−ピリドン類 | |
| EP0101951A1 (en) | 1,3-Dioxolo(4,5-g)quinolines and preparation thereof | |
| DE2304763A1 (de) | Xanthenderivate | |
| JPH07110848B2 (ja) | チオエ−テルその製法及びこれを含有するアレルギ−性疾病治療剤 | |
| JPS6411015B2 (https=) | ||
| JPS6026381B2 (ja) | ４−ヒドロキシベンゾフエノン類の塩基性エ−テルおよびその製法 | |
| WO1999059961A1 (en) | Selective anti-mycobacterial preparations, method for producing the same and pharmaceutical compositions | |
| JPH0425953B2 (https=) | ||
| Gneuwuch et al. | Pyridine isosteres of the. beta.-adrenergic antagonists, 2-(p-nitrophenyl)-1-isopropylamino-2-ethanol and 3-(p-nitrophenoxy)-1-isopropylamino-2-propanol | |
| US3525749A (en) | Certain 1,3-dioxepino-(5,6-c)-pyridines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 19870417 |
|
| PG1501 | Laying open of application | ||
| A201 | Request for examination | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 19920417 Comment text: Request for Examination of Application Patent event code: PA02011R01I Patent event date: 19870417 Comment text: Patent Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 19941219 Patent event code: PE09021S01D |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 19950327 Patent event code: PE09021S01D |
|
| G160 | Decision to publish patent application | ||
| PG1605 | Publication of application before grant of patent |
Comment text: Decision on Publication of Application Patent event code: PG16051S01I Patent event date: 19950621 |
|
| E701 | Decision to grant or registration of patent right | ||
| PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 19950925 |
|
| GRNT | Written decision to grant | ||
| PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 19951025 Patent event code: PR07011E01D |
|
| PR1002 | Payment of registration fee |
Payment date: 19951025 End annual number: 3 Start annual number: 1 |
|
| PR1001 | Payment of annual fee |
Payment date: 19980611 Start annual number: 4 End annual number: 4 |
|
| PR1001 | Payment of annual fee |
Payment date: 19990617 Start annual number: 5 End annual number: 5 |
|
| PR1001 | Payment of annual fee |
Payment date: 20000621 Start annual number: 6 End annual number: 6 |
|
| PR1001 | Payment of annual fee |
Payment date: 20010703 Start annual number: 7 End annual number: 7 |
|
| PR1001 | Payment of annual fee |
Payment date: 20020703 Start annual number: 8 End annual number: 8 |
|
| PR1001 | Payment of annual fee |
Payment date: 20030626 Start annual number: 9 End annual number: 9 |
|
| PR1001 | Payment of annual fee |
Payment date: 20040616 Start annual number: 10 End annual number: 10 |
|
| PR1001 | Payment of annual fee |
Payment date: 20050616 Start annual number: 11 End annual number: 11 |
|
| FPAY | Annual fee payment |
Payment date: 20060619 Year of fee payment: 12 |
|
| PR1001 | Payment of annual fee |
Payment date: 20060619 Start annual number: 12 End annual number: 12 |
|
| EXPY | Expiration of term | ||
| PC1801 | Expiration of term |