KR840001492B1 - 저장-안정성 촉매 조성물 - Google Patents
저장-안정성 촉매 조성물 Download PDFInfo
- Publication number
- KR840001492B1 KR840001492B1 KR1019800002490A KR800002490A KR840001492B1 KR 840001492 B1 KR840001492 B1 KR 840001492B1 KR 1019800002490 A KR1019800002490 A KR 1019800002490A KR 800002490 A KR800002490 A KR 800002490A KR 840001492 B1 KR840001492 B1 KR 840001492B1
- Authority
- KR
- South Korea
- Prior art keywords
- composition
- silyl
- parts
- compositions
- silicone rubber
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 28
- 239000000203 mixture Substances 0.000 title claims description 154
- -1 furmates Chemical class 0.000 claims abstract description 42
- SXUXGFHXUDLTFO-UHFFFAOYSA-N (Z)-4-oxo-4-silyloxybut-2-enoic acid Chemical class OC(=O)C=C/C(=O)O[SiH3] SXUXGFHXUDLTFO-UHFFFAOYSA-N 0.000 claims abstract description 34
- 239000004945 silicone rubber Substances 0.000 claims abstract description 26
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 24
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims abstract description 22
- 229910000077 silane Inorganic materials 0.000 claims abstract description 22
- 239000002318 adhesion promoter Substances 0.000 claims description 42
- 229920002379 silicone rubber Polymers 0.000 claims description 30
- 239000004971 Cross linker Substances 0.000 claims description 21
- 239000007795 chemical reaction product Substances 0.000 claims description 20
- QPEZXRRQLZVKSU-UHFFFAOYSA-N 4-oxo-4-silyloxybutanoic acid Chemical compound OC(=O)CCC(=O)O[SiH3] QPEZXRRQLZVKSU-UHFFFAOYSA-N 0.000 claims description 13
- 229910052751 metal Inorganic materials 0.000 abstract description 31
- 239000002184 metal Substances 0.000 abstract description 31
- 150000003839 salts Chemical class 0.000 abstract description 17
- 238000006243 chemical reaction Methods 0.000 abstract description 16
- 239000003431 cross linking reagent Substances 0.000 abstract description 7
- 230000000737 periodic effect Effects 0.000 abstract description 5
- 150000001735 carboxylic acids Chemical class 0.000 abstract description 2
- 150000003890 succinate salts Chemical class 0.000 abstract description 2
- 101100237844 Mus musculus Mmp19 gene Proteins 0.000 abstract 1
- 150000007973 cyanuric acids Chemical class 0.000 abstract 1
- 229920002631 room-temperature vulcanizate silicone Polymers 0.000 abstract 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- 229920000642 polymer Polymers 0.000 description 25
- 239000000945 filler Substances 0.000 description 19
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 19
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 description 17
- 125000001183 hydrocarbyl group Chemical group 0.000 description 15
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 14
- 235000013405 beer Nutrition 0.000 description 11
- 229910021485 fumed silica Inorganic materials 0.000 description 11
- DVYQCRRVXOXJSA-UHFFFAOYSA-N tris(2-ethylhexoxy)-methylsilane Chemical compound CCCCC(CC)CO[Si](C)(OCC(CC)CCCC)OCC(CC)CCCC DVYQCRRVXOXJSA-UHFFFAOYSA-N 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 9
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 9
- 230000000704 physical effect Effects 0.000 description 9
- 229920001296 polysiloxane Polymers 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 229920000570 polyether Polymers 0.000 description 8
- 125000000962 organic group Chemical group 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- 239000004721 Polyphenylene oxide Substances 0.000 description 6
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 6
- 210000000613 ear canal Anatomy 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 5
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 4
- 229910052748 manganese Inorganic materials 0.000 description 4
- 239000011572 manganese Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 150000004756 silanes Chemical class 0.000 description 4
- 125000005372 silanol group Chemical group 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- BDSBOAAHMCKOCQ-UHFFFAOYSA-N (Z)-2-silylbut-2-enedioic acid Chemical class [SiH3]/C(/C(=O)O)=CC(=O)O BDSBOAAHMCKOCQ-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- TVJPBVNWVPUZBM-UHFFFAOYSA-N [diacetyloxy(methyl)silyl] acetate Chemical group CC(=O)O[Si](C)(OC(C)=O)OC(C)=O TVJPBVNWVPUZBM-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000004205 dimethyl polysiloxane Substances 0.000 description 3
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- GEIHDEVWPDTQIM-UHFFFAOYSA-N methyl-tris(phenylmethoxy)silane Chemical compound C=1C=CC=CC=1CO[Si](OCC=1C=CC=CC=1)(C)OCC1=CC=CC=C1 GEIHDEVWPDTQIM-UHFFFAOYSA-N 0.000 description 3
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 3
- 239000000565 sealant Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 238000011067 equilibration Methods 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 150000008282 halocarbons Chemical group 0.000 description 2
- 235000015220 hamburgers Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000012763 reinforcing filler Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- BDSBOAAHMCKOCQ-OWOJBTEDSA-N (E)-2-silylbut-2-enedioic acid Chemical compound [SiH3]/C(/C(=O)O)=C/C(=O)O BDSBOAAHMCKOCQ-OWOJBTEDSA-N 0.000 description 1
- JANAESJOVIBNKD-ARJAWSKDSA-N 1-O-propyl 4-O-silyl (Z)-but-2-enedioate Chemical compound CCCOC(=O)\C=C/C(=O)O[SiH3] JANAESJOVIBNKD-ARJAWSKDSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- 0 C=II(*[N+](*1N)[O-])*(N)[N+]1[O-] Chemical compound C=II(*[N+](*1N)[O-])*(N)[N+]1[O-] 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920001174 Diethylhydroxylamine Polymers 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920002176 Pluracol® Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DDJSWKLBKSLAAZ-UHFFFAOYSA-N cyclotetrasiloxane Chemical class O1[SiH2]O[SiH2]O[SiH2]O[SiH2]1 DDJSWKLBKSLAAZ-UHFFFAOYSA-N 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- FVCOIAYSJZGECG-UHFFFAOYSA-N diethylhydroxylamine Chemical class CCN(O)CC FVCOIAYSJZGECG-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229910000358 iron sulfate Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- BUZRAOJSFRKWPD-UHFFFAOYSA-N isocyanatosilane Chemical compound [SiH3]N=C=O BUZRAOJSFRKWPD-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- YIKQLNRXIWIZFA-UHFFFAOYSA-N silyl dihydrogen phosphate Chemical compound OP(O)(=O)O[SiH3] YIKQLNRXIWIZFA-UHFFFAOYSA-N 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005389 trialkylsiloxy group Chemical group 0.000 description 1
- PZJJKWKADRNWSW-UHFFFAOYSA-N trimethoxysilicon Chemical group CO[Si](OC)OC PZJJKWKADRNWSW-UHFFFAOYSA-N 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/54—Silicon-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/14—Polysiloxanes containing silicon bound to oxygen-containing groups
- C08G77/16—Polysiloxanes containing silicon bound to oxygen-containing groups to hydroxyl groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S528/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S528/901—Room temperature curable silicon-containing polymer
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Silicon Polymers (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52,042 | 1979-06-25 | ||
| US06/052,042 US4308372A (en) | 1979-06-25 | 1979-06-25 | Shelf-stable one-part room temperature vulcanizable silicone rubber compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| KR830002837A KR830002837A (ko) | 1983-05-30 |
| KR840001492B1 true KR840001492B1 (ko) | 1984-09-28 |
Family
ID=21975061
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1019800002490A Expired KR840001492B1 (ko) | 1979-06-25 | 1980-06-24 | 저장-안정성 촉매 조성물 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4308372A (https=) |
| JP (1) | JPS5620032A (https=) |
| KR (1) | KR840001492B1 (https=) |
| AU (1) | AU535083B2 (https=) |
| BE (1) | BE883979A (https=) |
| CA (1) | CA1145317A (https=) |
| DE (1) | DE3022978A1 (https=) |
| DK (1) | DK270380A (https=) |
| ES (1) | ES492734A0 (https=) |
| FR (1) | FR2459820A1 (https=) |
| GB (1) | GB2053255B (https=) |
| IT (1) | IT1131835B (https=) |
| LU (1) | LU82542A1 (https=) |
| NL (1) | NL8003643A (https=) |
| NO (1) | NO801828L (https=) |
| SE (1) | SE8004665L (https=) |
| ZA (1) | ZA803116B (https=) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4395507A (en) * | 1981-12-16 | 1983-07-26 | General Electric Silicones | Self-bonding one-component dimedone RTV silicone rubber compositions |
| US4513115A (en) * | 1982-02-17 | 1985-04-23 | General Electric Company | Low modulus one component RTV compositions processes |
| US4680363A (en) * | 1982-03-30 | 1987-07-14 | General Electric Company | One component silicone compositions with good bonding properties |
| US4486703A (en) * | 1982-09-27 | 1984-12-04 | The Bendix Corporation | Boost voltage generator |
| US4489200A (en) * | 1983-04-11 | 1984-12-18 | General Electric Company | One-component RTV silicone rubber compositions with good self-bonding properties to acrylate plastics |
| CA1270973A (en) * | 1985-01-03 | 1990-06-26 | Melvin R. Toub | Self-bonding precious metal catalyzed silicone rubber compositions |
| US5164461A (en) * | 1991-03-14 | 1992-11-17 | General Electric Company | Addition-curable silicone adhesive compositions |
| US6004679A (en) * | 1991-03-14 | 1999-12-21 | General Electric Company | Laminates containing addition-curable silicone adhesive compositions |
| US5260348A (en) * | 1992-01-31 | 1993-11-09 | General Electric Company | Silicone compositions which exhibit enhanced cure characteristics |
| DE102005027399A1 (de) * | 2005-06-13 | 2006-12-14 | Universität Konstanz | Silicium- und Polysilylcyamelurate sowie -cyanurate (PSCs) - Verfahren zu deren Herstellung und Anwendung |
| US8575273B2 (en) * | 2008-11-26 | 2013-11-05 | Schlumberger Technology Corporation | Coupling agents and compositions produced using them |
| FR2946657A1 (fr) | 2009-06-12 | 2010-12-17 | Bluestar Silicones France | Procede d'etancheification et d'assemblage de composants d'un groupe moto-propulseur |
| FR2946656A1 (fr) | 2009-06-12 | 2010-12-17 | Bluestar Silicones France | Procede d'etancheification et d'assemblage de composants d'un groupe moto-propulseur |
| FR2946654A1 (fr) | 2009-06-15 | 2010-12-17 | Bluestar Silicones France | Procede d'enduction d'une composition silicone ne contenant pas d'etain sur un support souple. |
| FR2946655A1 (fr) | 2009-06-15 | 2010-12-17 | Bluestar Silicones France | Procede d'enduction d'une composition silicone ne contenant pas d'etain sur un support souple. |
| US9403962B2 (en) | 2011-12-22 | 2016-08-02 | Schlumberger Technology Corporation | Elastomer compositions with silane functionalized silica as reinforcing fillers |
| FR3014106B1 (fr) | 2013-12-03 | 2017-03-10 | Bluestar Silicones France | Composition silicone durcissable en presence d'eau ou d'humidite de l'air |
| FR3020067A1 (fr) | 2014-04-18 | 2015-10-23 | Bluestar Silicones France | Procede d'enduction d'un composition silicone sur un support souple |
Family Cites Families (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE556585A (https=) * | 1956-04-11 | |||
| LU35994A1 (fr) * | 1957-07-12 | 1958-06-17 | Rhone Poulenc Sa | Procédé de fabrication d'elastomères à base de diorgano-polysiloxanes et produits ainsi obtenus. |
| US3004859A (en) * | 1958-05-28 | 1961-10-17 | Gen Electric | Process for treating fillers |
| US3035016A (en) * | 1959-03-16 | 1962-05-15 | Dow Corning | Acyloxy siloxanes and a method of using the |
| US3065194A (en) * | 1959-07-16 | 1962-11-20 | Wacker Chemie Gmbh | Method of preparing silicone rubber compositions |
| US3170894A (en) * | 1960-09-26 | 1965-02-23 | Dow Corning | Silicon-bonded polyhydrocarbonoxy organopolysiloxanes and one-component room temperature cured compositions containing said organopolysiloxanes and condensation catalysts |
| BE623601A (https=) * | 1961-10-16 | 1900-01-01 | ||
| BE623603A (https=) * | 1961-10-16 | |||
| US3122522A (en) * | 1961-10-16 | 1964-02-25 | Dow Corning | One-component room temperature curing system employing new silicone intermediates |
| FR1337516A (fr) | 1962-08-22 | 1963-09-13 | Dow Corning | Composés organosiliciques substitués par des groupements esters carboxyliques alpha, beta-non saturés |
| US3274145A (en) * | 1962-09-04 | 1966-09-20 | Dow Corning | Novel siloxane compositions |
| US3382205A (en) * | 1963-09-27 | 1968-05-07 | Gen Electric | Compositions containing silanol chainstopped polydimethyl-siloxane, organosilicon proess aid, and curing agent |
| US3294739A (en) * | 1964-11-19 | 1966-12-27 | Dow Corning | Method of making one component room temperature curing siloxane rubbers |
| GB1154724A (en) * | 1965-08-11 | 1969-06-11 | Midland Silicones Ltd | Improvements in or relating to Organopolysiloxanes |
| NL128703C (https=) | 1965-09-07 | |||
| US3334067A (en) * | 1966-04-08 | 1967-08-01 | Dow Corning | Method of making one component room temperature curing siloxane rubbers |
| US3517001A (en) * | 1967-09-20 | 1970-06-23 | Gen Electric | Nitrogen-containing organosilicon materials |
| US3542901A (en) * | 1968-06-26 | 1970-11-24 | Midland Silicones Ltd | Organosilicon compositions |
| US3499859A (en) * | 1968-07-05 | 1970-03-10 | Dow Corning | Stable thermally conductive room temperature vulcanizable silicone rubber |
| US3635743A (en) * | 1969-01-06 | 1972-01-18 | Gen Electric | Reinforcing silica filler |
| US3647917A (en) * | 1970-04-06 | 1972-03-07 | Dow Corning | Room temperature vulcanizable silicone rubber with unprimed adhesion |
| US3689454A (en) * | 1971-01-06 | 1972-09-05 | Gen Electric | Curable compositions |
| US3779986A (en) * | 1971-01-06 | 1973-12-18 | Gen Electric | Curable compositions |
| US3730932A (en) * | 1971-05-17 | 1973-05-01 | Gen Electric | Self-bonding,heat-curable silicone rubber |
| US3941741A (en) * | 1971-05-17 | 1976-03-02 | General Electric Company | Self-bonding, heat-curable silicone rubber |
| US3808248A (en) * | 1971-05-17 | 1974-04-30 | Gen Electric | Silyl maleates and polysiloxane maleates |
| US3780080A (en) * | 1971-05-17 | 1973-12-18 | Gen Electric | Silyl maleates and polysiloxane maleates |
| US3793361A (en) * | 1971-05-17 | 1974-02-19 | Gen Electric | Silyl maleates and polysiloxane maleates |
| US3773817A (en) * | 1971-05-17 | 1973-11-20 | A Berger | Polysiloxane maleates |
| US3759968A (en) * | 1971-05-17 | 1973-09-18 | Gen Electric | Silyl maleates and polysiloxane maleates |
| US3806532A (en) * | 1971-05-17 | 1974-04-23 | Gen Electric | Silyl maleates and polysiloxane maleates |
| US3778459A (en) * | 1971-05-17 | 1973-12-11 | Gen Electric | Silyl maleates and polysiloxane maleates |
| US3708467A (en) * | 1971-06-16 | 1973-01-02 | Gen Electric | Curable compositions |
| US3719635A (en) * | 1971-06-18 | 1973-03-06 | Dow Corning | Metal hydrocarbonoxides in room temperature vulcanizable silicone elastomers |
| US3891123A (en) * | 1972-03-23 | 1975-06-24 | Donald Blackburn | Automatic fluid dispensing system |
| US3896123A (en) * | 1972-04-06 | 1975-07-22 | Gen Electric | Silyl cyanurates |
| US3813364A (en) * | 1972-04-06 | 1974-05-28 | Gen Electric | Self-bonding,heat-curable silicone rubber |
| NL7311581A (https=) * | 1972-08-29 | 1974-03-04 | ||
| US4036813A (en) * | 1975-11-26 | 1977-07-19 | General Electric Company | Composition for promoting adhesion of curable silicones to substrates |
-
1979
- 1979-06-25 US US06/052,042 patent/US4308372A/en not_active Expired - Lifetime
-
1980
- 1980-05-23 ZA ZA00803116A patent/ZA803116B/xx unknown
- 1980-06-06 GB GB8018650A patent/GB2053255B/en not_active Expired
- 1980-06-18 NO NO801828A patent/NO801828L/no unknown
- 1980-06-20 AU AU59495/80A patent/AU535083B2/en not_active Ceased
- 1980-06-20 IT IT22925/80A patent/IT1131835B/it active
- 1980-06-20 CA CA000354507A patent/CA1145317A/en not_active Expired
- 1980-06-20 DE DE19803022978 patent/DE3022978A1/de not_active Withdrawn
- 1980-06-24 BE BE0/201154A patent/BE883979A/fr not_active IP Right Cessation
- 1980-06-24 SE SE8004665A patent/SE8004665L/xx not_active Application Discontinuation
- 1980-06-24 DK DK270380A patent/DK270380A/da not_active Application Discontinuation
- 1980-06-24 JP JP8468480A patent/JPS5620032A/ja active Granted
- 1980-06-24 NL NL8003643A patent/NL8003643A/nl not_active Application Discontinuation
- 1980-06-24 KR KR1019800002490A patent/KR840001492B1/ko not_active Expired
- 1980-06-24 LU LU82542A patent/LU82542A1/fr unknown
- 1980-06-25 ES ES492734A patent/ES492734A0/es active Granted
- 1980-06-25 FR FR8014067A patent/FR2459820A1/fr active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CA1145317A (en) | 1983-04-26 |
| ZA803116B (en) | 1981-08-26 |
| LU82542A1 (fr) | 1980-10-24 |
| ES8105347A1 (es) | 1981-06-01 |
| ES492734A0 (es) | 1981-06-01 |
| JPS6318625B2 (https=) | 1988-04-19 |
| IT1131835B (it) | 1986-06-25 |
| NO801828L (no) | 1980-12-29 |
| AU5949580A (en) | 1981-01-08 |
| AU535083B2 (en) | 1984-03-01 |
| DK270380A (da) | 1980-12-26 |
| IT8022925A0 (it) | 1980-06-20 |
| SE8004665L (sv) | 1981-02-16 |
| DE3022978A1 (de) | 1981-01-22 |
| NL8003643A (nl) | 1980-12-30 |
| FR2459820A1 (fr) | 1981-01-16 |
| GB2053255A (en) | 1981-02-04 |
| GB2053255B (en) | 1983-12-21 |
| BE883979A (fr) | 1980-12-24 |
| JPS5620032A (en) | 1981-02-25 |
| KR830002837A (ko) | 1983-05-30 |
| US4308372A (en) | 1981-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR840001492B1 (ko) | 저장-안정성 촉매 조성물 | |
| US4273698A (en) | Self-bonding room temperature vulcanizable silicone rubber compositions | |
| CA1253276A (en) | Curable silicone compositions and processes | |
| JP3927950B2 (ja) | オルガノポリシロキサン組成物、その製造方法、前記組成物から製造された架橋可能な材料、及び前記材料から製造された成形品 | |
| US5489479A (en) | Room temperature vulcanizable silicone compositions | |
| US4387177A (en) | Room temperature curable organopolysiloxane compositions and methods for their preparation | |
| EP0138154B1 (en) | Non-corrosive silicone rtv compositions | |
| EP0384183A2 (en) | Mixtures comprising silanol-terminated polydiorganosiloxane and processes | |
| US4323489A (en) | Extreme low modulus RTV compositions | |
| US7534840B2 (en) | Room temperature-curable organopolysiloxane compositions | |
| US4395507A (en) | Self-bonding one-component dimedone RTV silicone rubber compositions | |
| US4731411A (en) | Process for producing alkoxy-terminated polysiloxanes | |
| US4667007A (en) | Room temperature vulcanizable organopolysiloxane compositions and method for making | |
| US3485780A (en) | Room temperature vulcanizable siloxane compositions and the elastomers derived therefrom | |
| JP2001192558A (ja) | 架橋可能なオルガノポリシロキサン組成物及びこれを含有する成形体 | |
| US4489200A (en) | One-component RTV silicone rubber compositions with good self-bonding properties to acrylate plastics | |
| KR20060103928A (ko) | 유기 규소 화합물을 기재로 한 가교결합형 생성물 | |
| JPS6352673B2 (https=) | ||
| US7071278B2 (en) | Cross-linkable materials based on organosilicon compounds | |
| JPH04300964A (ja) | 改善された低モジュラス性をもつ室温硬化性シリコーン組成物 | |
| EP0491483A1 (en) | Adhesion promoter system for one-component RTV silicone compositions | |
| JPH055261B2 (https=) | ||
| KR850000534B1 (ko) | 방미성(Mildew Resistant) 실온경화성 실리콘 조성물 | |
| US6984707B2 (en) | Crosslinkable compounds on the basis of organosilicon compounds | |
| KR840001363B1 (ko) | 채색성 일-성분 실온 경화성 실리콘 고무 조성물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 19800624 |
|
| PG1501 | Laying open of application | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 19840208 Patent event code: PE09021S01D |
|
| PG1605 | Publication of application before grant of patent |
Comment text: Decision on Publication of Application Patent event code: PG16051S01I Patent event date: 19840831 |
|
| E701 | Decision to grant or registration of patent right | ||
| PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 19841214 |