KR20190034564A - 약학적 화합물 - Google Patents
약학적 화합물 Download PDFInfo
- Publication number
- KR20190034564A KR20190034564A KR1020197004797A KR20197004797A KR20190034564A KR 20190034564 A KR20190034564 A KR 20190034564A KR 1020197004797 A KR1020197004797 A KR 1020197004797A KR 20197004797 A KR20197004797 A KR 20197004797A KR 20190034564 A KR20190034564 A KR 20190034564A
- Authority
- KR
- South Korea
- Prior art keywords
- methyl
- hydroxy
- phenyl
- dihydropyridine
- dimethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 320
- 238000000034 method Methods 0.000 claims abstract description 246
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 22
- -1 cycloheteroalkyl Chemical group 0.000 claims description 638
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 365
- 229910052757 nitrogen Inorganic materials 0.000 claims description 130
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 105
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 claims description 94
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 59
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 53
- 229910052799 carbon Inorganic materials 0.000 claims description 50
- 238000007429 general method Methods 0.000 claims description 49
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 44
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 43
- 150000003839 salts Chemical class 0.000 claims description 38
- 125000001072 heteroaryl group Chemical group 0.000 claims description 37
- 206010028980 Neoplasm Diseases 0.000 claims description 35
- 125000005842 heteroatom Chemical group 0.000 claims description 33
- 239000002253 acid Substances 0.000 claims description 32
- 125000001424 substituent group Chemical group 0.000 claims description 32
- 125000003118 aryl group Chemical group 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 30
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 28
- 201000011510 cancer Diseases 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 26
- 125000000623 heterocyclic group Chemical group 0.000 claims description 24
- 238000011282 treatment Methods 0.000 claims description 22
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 19
- 125000003368 amide group Chemical group 0.000 claims description 19
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 18
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 16
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 14
- 125000004043 oxo group Chemical group O=* 0.000 claims description 14
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 13
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 206010006895 Cachexia Diseases 0.000 claims description 11
- 208000018737 Parkinson disease Diseases 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 11
- 125000000304 alkynyl group Chemical group 0.000 claims description 11
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 11
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 11
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 10
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 10
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 9
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 9
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical group COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 9
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 8
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 8
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethylcyclohexane Chemical class CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 claims description 8
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 8
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 7
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 7
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 7
- 201000006938 muscular dystrophy Diseases 0.000 claims description 7
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 6
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 6
- 125000004104 aryloxy group Chemical group 0.000 claims description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 150000003973 alkyl amines Chemical class 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- KDWQLICBSFIDRM-UHFFFAOYSA-N 1,1,1-trifluoropropane Chemical class CCC(F)(F)F KDWQLICBSFIDRM-UHFFFAOYSA-N 0.000 claims description 4
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 claims description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 4
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical group C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 229930192474 thiophene Natural products 0.000 claims description 4
- HQJRYFSKNWFBFH-HXUWFJFHSA-N 2-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-5-phenylpyridazin-3-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2ncc(cc2=O)-c2ccccc2)CC1)c1ccccc1 HQJRYFSKNWFBFH-HXUWFJFHSA-N 0.000 claims description 3
- TZUVVMJMXZOTPU-GOSISDBHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-prop-1-en-2-ylpyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)C(C)=C)CC1)c1ccccc1 TZUVVMJMXZOTPU-GOSISDBHSA-N 0.000 claims description 3
- DNUDULSSNHKPHP-UHFFFAOYSA-N 4-phenyl-1h-pyridin-2-one Chemical compound C1=NC(O)=CC(C=2C=CC=CC=2)=C1 DNUDULSSNHKPHP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000041 C6-C10 aryl group Chemical group 0.000 claims description 3
- 206010021118 Hypotonia Diseases 0.000 claims description 3
- 208000007379 Muscle Hypotonia Diseases 0.000 claims description 3
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 claims description 3
- 230000000144 pharmacologic effect Effects 0.000 claims description 3
- IDKDBLILJKLZII-HEIROHQZSA-N 1-[[(10R)-7-[(2R)-3-cyclobutyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound C1(CCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@@](CC1)(O)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)N(C)C)C IDKDBLILJKLZII-HEIROHQZSA-N 0.000 claims description 2
- VIXRRJFNXFTPNV-GZGVDWRWSA-N 1-[[(10R)-7-[(2R)-3-cyclohexyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound C1(CCCCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@@](CC1)(O)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)N(C)C)C VIXRRJFNXFTPNV-GZGVDWRWSA-N 0.000 claims description 2
- AXYOZQRIFBEKEN-APYJYERMSA-N 1-[[(10S)-7-[(2R)-3-cyclobutyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-4-(2-fluorophenyl)-N,N-dimethyl-6-oxopyridine-3-carboxamide Chemical compound C1(CCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@](CC1)(O)CN1C=C(C(=CC1=O)C1=C(C=CC=C1)F)C(=O)N(C)C)C AXYOZQRIFBEKEN-APYJYERMSA-N 0.000 claims description 2
- VGFSGXNOFOIMRV-ACSYHNTCSA-N 1-[[(10S)-7-[(2R)-3-cyclobutyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-4-cyclopropyl-N,N-dimethyl-6-oxopyridine-3-carboxamide Chemical compound C1(CCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@](CC1)(O)CN1C=C(C(=CC1=O)C1CC1)C(=O)N(C)C)C VGFSGXNOFOIMRV-ACSYHNTCSA-N 0.000 claims description 2
- KRHMMADNMJKZFE-PBUKZNKTSA-N 1-[[(10S)-7-[(2R)-3-cyclohexyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-4-(2-fluorophenyl)-N,N-dimethyl-6-oxopyridine-3-carboxamide Chemical compound C1(CCCCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@](CC1)(O)CN1C=C(C(=CC1=O)C1=C(C=CC=C1)F)C(=O)N(C)C)C KRHMMADNMJKZFE-PBUKZNKTSA-N 0.000 claims description 2
- NKJAZSDAKURUEC-JPZYQRIQSA-N 1-[[(10S)-7-[(2R)-3-cyclohexyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-4-cyclopropyl-N,N-dimethyl-6-oxopyridine-3-carboxamide Chemical compound C1(CCCCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@](CC1)(O)CN1C=C(C(=CC1=O)C1CC1)C(=O)N(C)C)C NKJAZSDAKURUEC-JPZYQRIQSA-N 0.000 claims description 2
- VIXRRJFNXFTPNV-QCBOHVIISA-N 1-[[(10S)-7-[(2R)-3-cyclohexyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound C[C@H](CC1CCCCC1)C(=O)N1CC[C@@](O)(Cn2cc(C(=O)N(C)C)c(cc2=O)-c2ccccc2)C2(CCCC2)C1 VIXRRJFNXFTPNV-QCBOHVIISA-N 0.000 claims description 2
- WETSVYOKPNDPIV-UHFFFAOYSA-N 1-[[1-(2,2-dimethylbutanoyl)-4-hydroxypiperidin-4-yl]methyl]-N-methyl-6-oxo-4-phenyl-N-propan-2-ylpyridine-3-carboxamide Chemical compound CCC(C)(C)C(=O)N1CCC(O)(Cn2cc(C(=O)N(C)C(C)C)c(cc2=O)-c2ccccc2)CC1 WETSVYOKPNDPIV-UHFFFAOYSA-N 0.000 claims description 2
- DXTDHTGHJUSIAU-UHFFFAOYSA-N 1-[[1-(3-cyclohexylpropanoyl)-4-hydroxypiperidin-4-yl]methyl]-N-methyl-6-oxo-4-phenyl-N-propan-2-ylpyridine-3-carboxamide Chemical compound CC(C)N(C)C(=O)c1cn(CC2(O)CCN(CC2)C(=O)CCC2CCCCC2)c(=O)cc1-c1ccccc1 DXTDHTGHJUSIAU-UHFFFAOYSA-N 0.000 claims description 2
- BNCTZIXWRHFQSM-UHFFFAOYSA-N 1-[[10-hydroxy-7-(1H-indazole-3-carbonyl)-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound OC1(CCN(CC11CCCC1)C(=O)C1=NNC2=CC=CC=C12)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)N(C)C BNCTZIXWRHFQSM-UHFFFAOYSA-N 0.000 claims description 2
- VYFZCYUMYGWCPN-KDZLRESVSA-N 1-[[10-hydroxy-7-[(1R,2S)-2-phenylcyclopropanecarbonyl]-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound OC1(CCN(CC11CCCC1)C(=O)[C@H]1[C@H](C1)C1=CC=CC=C1)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)N(C)C VYFZCYUMYGWCPN-KDZLRESVSA-N 0.000 claims description 2
- ZOOIZEFXRVLMLU-UHFFFAOYSA-N 1-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]-4-phenylpyridin-2-one Chemical compound CC(CC(=O)N1CCC(O)(Cn2ccc(cc2=O)-c2ccccc2)CC1)c1ccccc1 ZOOIZEFXRVLMLU-UHFFFAOYSA-N 0.000 claims description 2
- CZWNOIWMYUORDB-RUZDIDTESA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4,5-diphenylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(-c3ccccc3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 CZWNOIWMYUORDB-RUZDIDTESA-N 0.000 claims description 2
- CHTFZUHGTFXRPB-XMMPIXPASA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-(2-methoxyphenyl)-N-methyl-6-oxo-N-propan-2-ylpyridine-3-carboxamide Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=C(C(=CC1=O)C1=C(C=CC=C1)OC)C(=O)N(C)C(C)C CHTFZUHGTFXRPB-XMMPIXPASA-N 0.000 claims description 2
- KNQYGFQMEHODTO-XMMPIXPASA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-phenyl-5-pyridin-2-ylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(-c3ccccn3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 KNQYGFQMEHODTO-XMMPIXPASA-N 0.000 claims description 2
- NZXILBZOXKURII-XMMPIXPASA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-phenyl-5-pyridin-3-ylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(-c3cccnc3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 NZXILBZOXKURII-XMMPIXPASA-N 0.000 claims description 2
- FKZBRPBIASGKPY-HSZRJFAPSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-phenyl-5-pyrimidin-5-ylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(-c3cncnc3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 FKZBRPBIASGKPY-HSZRJFAPSA-N 0.000 claims description 2
- JAPPELWQRDSXSV-OAQYLSRUSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-5-methyl-4-phenylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 JAPPELWQRDSXSV-OAQYLSRUSA-N 0.000 claims description 2
- UJYHEUDTQPFTEL-OAQYLSRUSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carbaldehyde Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C=O)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 UJYHEUDTQPFTEL-OAQYLSRUSA-N 0.000 claims description 2
- IMYTTWDMSGNBGB-OAQYLSRUSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carbonitrile Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C#N)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 IMYTTWDMSGNBGB-OAQYLSRUSA-N 0.000 claims description 2
- JZJNRTRPQDVBRD-JOCHJYFZSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methoxy-N-methyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound CON(C)C(=O)c1cn(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)c(=O)cc1-c1ccccc1 JZJNRTRPQDVBRD-JOCHJYFZSA-N 0.000 claims description 2
- INBOFXODFCGVCP-RUZDIDTESA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-4-(3-methylphenyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)CN1C=C(C(=CC1=O)C=1C=C(C=CC=1)C)C(=O)N(C)C(C)C INBOFXODFCGVCP-RUZDIDTESA-N 0.000 claims description 2
- BOAGDSFECJZRPO-RUZDIDTESA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-4-(4-methylphenyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide Chemical compound CC(C)N(C)C(=O)c1cn(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)c(=O)cc1-c1ccc(C)cc1 BOAGDSFECJZRPO-RUZDIDTESA-N 0.000 claims description 2
- KGUJKZJYMJQXAQ-XMMPIXPASA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-6-oxo-4-phenyl-N-propan-2-ylpyridine-3-carboxamide Chemical compound CC(C)N(C)C(=O)c1cn(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)c(=O)cc1-c1ccccc1 KGUJKZJYMJQXAQ-XMMPIXPASA-N 0.000 claims description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 2
- QHKZVYQZUCNWAQ-NHCUHLMSSA-N 3-[(1R)-1-[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]ethyl]-6-phenylpyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)[C@@H](C)N1C=NC(=CC1=O)C1=CC=CC=C1 QHKZVYQZUCNWAQ-NHCUHLMSSA-N 0.000 claims description 2
- QHKZVYQZUCNWAQ-RTWAWAEBSA-N 3-[(1S)-1-[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]ethyl]-6-phenylpyrimidin-4-one Chemical compound OC1(CCN(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)[C@H](C)N1C=NC(=CC1=O)C1=CC=CC=C1 QHKZVYQZUCNWAQ-RTWAWAEBSA-N 0.000 claims description 2
- SLMODRIKTKGWRD-PIKZIKFNSA-N 3-[[(4S)-4-hydroxy-2,2-dimethyl-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-phenylpyrimidin-4-one Chemical compound O[C@@]1(CC(N(CC1)C(C[C@@H](C)C1=CC=CC=C1)=O)(C)C)CN1C=NC(=CC1=O)C1=CC=CC=C1 SLMODRIKTKGWRD-PIKZIKFNSA-N 0.000 claims description 2
- ZEFSOIQLYKIAPM-UHFFFAOYSA-N 3-[[1-(3-cyclopentylpropanoyl)-4-hydroxypiperidin-4-yl]methyl]-6-(2-fluorophenyl)pyrimidin-4-one Chemical compound C1(CCCC1)CCC(=O)N1CCC(CC1)(O)CN1C=NC(=CC1=O)C1=C(C=CC=C1)F ZEFSOIQLYKIAPM-UHFFFAOYSA-N 0.000 claims description 2
- XLCWTLKDWKZSKW-HXUWFJFHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-methyl-6-phenylpyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2c(C)nc(cc2=O)-c2ccccc2)CC1)c1ccccc1 XLCWTLKDWKZSKW-HXUWFJFHSA-N 0.000 claims description 2
- YGKMVNAZUALJON-HXUWFJFHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(2-methoxyphenyl)pyrimidin-4-one Chemical compound COc1ccccc1-c1cc(=O)n(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)cn1 YGKMVNAZUALJON-HXUWFJFHSA-N 0.000 claims description 2
- SMUHOCPZHRLANC-LJQANCHMSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-[2-(trifluoromethoxy)phenyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccccc2OC(F)(F)F)CC1)c1ccccc1 SMUHOCPZHRLANC-LJQANCHMSA-N 0.000 claims description 2
- CMXLTIZAZLIIAY-GOSISDBHSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-thiophen-3-ylpyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccsc2)CC1)c1ccccc1 CMXLTIZAZLIIAY-GOSISDBHSA-N 0.000 claims description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- YBFCXWPCJOQDFE-XMMPIXPASA-N 4-(2-cyanophenyl)-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-6-oxo-N-propan-2-ylpyridine-3-carboxamide Chemical compound CC(C)N(C)C(=O)c1cn(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)c(=O)cc1-c1ccccc1C#N YBFCXWPCJOQDFE-XMMPIXPASA-N 0.000 claims description 2
- RPNWFLVENLNYIO-HSZRJFAPSA-N 4-(2-fluorophenyl)-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-6-oxo-N-propan-2-ylpyridine-3-carboxamide Chemical compound CC(C)N(C)C(=O)c1cn(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)c(=O)cc1-c1ccccc1F RPNWFLVENLNYIO-HSZRJFAPSA-N 0.000 claims description 2
- GWRSATNRNFYMDI-UHFFFAOYSA-N 4-[(9-cyclopentyl-7,7-difluoro-5-methyl-6-oxo-8h-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-2-fluoro-5-methoxy-n-(1-methylpiperidin-4-yl)benzamide Chemical compound FC=1C=C(NC=2N=C3N(C4CCCC4)CC(F)(F)C(=O)N(C)C3=CN=2)C(OC)=CC=1C(=O)NC1CCN(C)CC1 GWRSATNRNFYMDI-UHFFFAOYSA-N 0.000 claims description 2
- TTWMAVBTWMDFNS-NHCUHLMSSA-N 6-(2-fluorophenyl)-3-[[4-hydroxy-1-[(1R,2S)-2-phenylcyclopropanecarbonyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound OC1(Cn2cnc(cc2=O)-c2ccccc2F)CCN(CC1)C(=O)[C@@H]1C[C@@H]1c1ccccc1 TTWMAVBTWMDFNS-NHCUHLMSSA-N 0.000 claims description 2
- YXXYUFKVCWCHRO-LJQANCHMSA-N 6-(4-fluorophenoxy)-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(Oc3ccc(F)cc3)cc2=O)CC1)c1ccccc1 YXXYUFKVCWCHRO-LJQANCHMSA-N 0.000 claims description 2
- XDACLIPDYCPEEQ-GOSISDBHSA-N 6-(furan-2-yl)-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccco2)CC1)c1ccccc1 XDACLIPDYCPEEQ-GOSISDBHSA-N 0.000 claims description 2
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims description 2
- HLUYXWIHDITPBU-UHFFFAOYSA-N CC(C)N(C)C(=O)C1=CNC(=O)C=C1C2=CC=CC=C2 Chemical compound CC(C)N(C)C(=O)C1=CNC(=O)C=C1C2=CC=CC=C2 HLUYXWIHDITPBU-UHFFFAOYSA-N 0.000 claims description 2
- MIKJPYYTGMNFLU-CVEARBPZSA-N CC1(CN(CC[C@@H]1O)C(=O)[C@H](CCO)CC2CCCCC2)C Chemical compound CC1(CN(CC[C@@H]1O)C(=O)[C@H](CCO)CC2CCCCC2)C MIKJPYYTGMNFLU-CVEARBPZSA-N 0.000 claims description 2
- PFBONSPDICCUIS-JOCHJYFZSA-N N-(2-hydroxyethyl)-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C(=O)NCCO)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 PFBONSPDICCUIS-JOCHJYFZSA-N 0.000 claims description 2
- BXALFGQEFJIKMM-HSZRJFAPSA-N N-(cyclopropylmethyl)-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C(=O)NCC3CC3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 BXALFGQEFJIKMM-HSZRJFAPSA-N 0.000 claims description 2
- BTGHWBBTFLLGND-RUZDIDTESA-N N-[3-[1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridin-3-yl]phenyl]acetamide Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(-c3cccc(NC(C)=O)c3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 BTGHWBBTFLLGND-RUZDIDTESA-N 0.000 claims description 2
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- OZVZHIFFUVLAST-QCBOHVIISA-N ethyl 1-[[(10S)-7-[(2R)-3-cyclohexyl-2-methylpropanoyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxylate Chemical compound C1(CCCCC1)C[C@H](C(=O)N1CC2(CCCC2)[C@](CC1)(O)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)OCC)C OZVZHIFFUVLAST-QCBOHVIISA-N 0.000 claims description 2
- DWRWSNAREGLUHZ-UHFFFAOYSA-N ethyl pyrimidine-4-carboxylate Chemical compound CCOC(=O)C1=CC=NC=N1 DWRWSNAREGLUHZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- RFIOZSIHFNEKFF-UHFFFAOYSA-M piperazine-1-carboxylate Chemical compound [O-]C(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-M 0.000 claims description 2
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 2
- 150000003235 pyrrolidines Chemical class 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 150000001204 N-oxides Chemical class 0.000 claims 18
- 125000001475 halogen functional group Chemical group 0.000 claims 8
- NOYUBYNCIBZPGQ-UHFFFAOYSA-N C1CCC(CC1)CC(C(=O)N2CCC(CC2)O)O Chemical compound C1CCC(CC1)CC(C(=O)N2CCC(CC2)O)O NOYUBYNCIBZPGQ-UHFFFAOYSA-N 0.000 claims 1
- 101000644843 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 19 Proteins 0.000 abstract description 39
- 102100020728 Ubiquitin carboxyl-terminal hydrolase 19 Human genes 0.000 abstract description 39
- 230000000694 effects Effects 0.000 abstract description 9
- 239000003112 inhibitor Substances 0.000 abstract description 5
- 238000002560 therapeutic procedure Methods 0.000 abstract description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 349
- 239000000203 mixture Substances 0.000 description 194
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 182
- 235000019439 ethyl acetate Nutrition 0.000 description 171
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 159
- 239000000243 solution Substances 0.000 description 142
- 238000005481 NMR spectroscopy Methods 0.000 description 139
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 120
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 119
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 117
- 238000006243 chemical reaction Methods 0.000 description 107
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 95
- 238000003818 flash chromatography Methods 0.000 description 91
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 90
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 75
- 239000012071 phase Substances 0.000 description 64
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 54
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 54
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 45
- 229920006395 saturated elastomer Polymers 0.000 description 43
- 239000007787 solid Substances 0.000 description 42
- 150000001412 amines Chemical class 0.000 description 41
- 239000012074 organic phase Substances 0.000 description 41
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 39
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 39
- 239000012043 crude product Substances 0.000 description 38
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 37
- 239000011541 reaction mixture Substances 0.000 description 37
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 35
- 238000000746 purification Methods 0.000 description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 34
- 239000000284 extract Substances 0.000 description 32
- 150000002924 oxiranes Chemical class 0.000 description 32
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 32
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 28
- 239000012267 brine Substances 0.000 description 27
- 229910000029 sodium carbonate Inorganic materials 0.000 description 27
- 239000002904 solvent Substances 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 239000000377 silicon dioxide Substances 0.000 description 24
- 239000012044 organic layer Substances 0.000 description 23
- 238000002360 preparation method Methods 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 125000004429 atom Chemical group 0.000 description 21
- 239000000460 chlorine Substances 0.000 description 21
- 125000004432 carbon atom Chemical group C* 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- 239000007821 HATU Substances 0.000 description 19
- 150000001721 carbon Chemical group 0.000 description 19
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 16
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 15
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 14
- 239000008346 aqueous phase Substances 0.000 description 14
- 125000005843 halogen group Chemical group 0.000 description 14
- 239000010410 layer Substances 0.000 description 14
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 125000003277 amino group Chemical group 0.000 description 13
- 210000004027 cell Anatomy 0.000 description 13
- 125000004122 cyclic group Chemical group 0.000 description 13
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 13
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 12
- 238000005160 1H NMR spectroscopy Methods 0.000 description 12
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 12
- 229910000024 caesium carbonate Inorganic materials 0.000 description 12
- 201000010099 disease Diseases 0.000 description 12
- 239000006260 foam Substances 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- 239000012230 colorless oil Substances 0.000 description 11
- 239000000463 material Substances 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 10
- 125000004452 carbocyclyl group Chemical group 0.000 description 10
- 150000007942 carboxylates Chemical class 0.000 description 10
- 230000002265 prevention Effects 0.000 description 10
- 230000002829 reductive effect Effects 0.000 description 10
- 125000006413 ring segment Chemical group 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- 239000012455 biphasic mixture Substances 0.000 description 9
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 125000004404 heteroalkyl group Chemical group 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- 239000002480 mineral oil Substances 0.000 description 9
- 235000010446 mineral oil Nutrition 0.000 description 9
- 125000003367 polycyclic group Chemical group 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 8
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 239000003814 drug Substances 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 239000000546 pharmaceutical excipient Substances 0.000 description 8
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 8
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical compound CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 8
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 8
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 7
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 238000002648 combination therapy Methods 0.000 description 7
- 150000002430 hydrocarbons Chemical group 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 238000004808 supercritical fluid chromatography Methods 0.000 description 7
- 150000003509 tertiary alcohols Chemical class 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 208000025205 Mantle-Cell Lymphoma Diseases 0.000 description 6
- 208000034578 Multiple myelomas Diseases 0.000 description 6
- 206010029260 Neuroblastoma Diseases 0.000 description 6
- 206010035226 Plasma cell myeloma Diseases 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 206010060862 Prostate cancer Diseases 0.000 description 6
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 6
- 238000005516 engineering process Methods 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 208000005017 glioblastoma Diseases 0.000 description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 6
- 125000002950 monocyclic group Chemical group 0.000 description 6
- 201000000585 muscular atrophy Diseases 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- 235000018102 proteins Nutrition 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- 238000012056 up-stream process Methods 0.000 description 6
- ZZEWMYILWXCRHZ-MRVPVSSYSA-N (3r)-3-phenylbutanoic acid Chemical compound OC(=O)C[C@@H](C)C1=CC=CC=C1 ZZEWMYILWXCRHZ-MRVPVSSYSA-N 0.000 description 5
- VYXCZTGUYINUMO-UHFFFAOYSA-N 6-(2-fluorophenyl)-1h-pyrimidin-4-one Chemical compound FC1=CC=CC=C1C1=CC(=O)N=CN1 VYXCZTGUYINUMO-UHFFFAOYSA-N 0.000 description 5
- GMXANMXNFQWAJY-OAHLLOKOSA-N 6-chloro-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(Cl)cc2=O)CC1)c1ccccc1 GMXANMXNFQWAJY-OAHLLOKOSA-N 0.000 description 5
- 108091007065 BIRCs Proteins 0.000 description 5
- 108700003785 Baculoviral IAP Repeat-Containing 3 Proteins 0.000 description 5
- 102100021662 Baculoviral IAP repeat-containing protein 3 Human genes 0.000 description 5
- 108010093668 Deubiquitinating Enzymes Proteins 0.000 description 5
- 102000001477 Deubiquitinating Enzymes Human genes 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 206010021143 Hypoxia Diseases 0.000 description 5
- 102000055031 Inhibitor of Apoptosis Proteins Human genes 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- 206010028289 Muscle atrophy Diseases 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 125000001033 ether group Chemical group 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 210000003205 muscle Anatomy 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 238000010792 warming Methods 0.000 description 5
- OJOFMLDBXPDXLQ-SECBINFHSA-N (4r)-4-benzyl-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N[C@@H]1CC1=CC=CC=C1 OJOFMLDBXPDXLQ-SECBINFHSA-N 0.000 description 4
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 4
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 4
- GWGIHIXPZNKCAS-UHFFFAOYSA-N 5-bromo-2-chloro-4-phenylpyridine Chemical compound C1=NC(Cl)=CC(C=2C=CC=CC=2)=C1Br GWGIHIXPZNKCAS-UHFFFAOYSA-N 0.000 description 4
- OXGQQTZNSOMRAD-UHFFFAOYSA-N 5-bromo-4-(2-fluorophenyl)-1H-pyridin-2-one Chemical compound BrC=1C(=CC(NC=1)=O)C1=C(C=CC=C1)F OXGQQTZNSOMRAD-UHFFFAOYSA-N 0.000 description 4
- WQKHERPPDYPMNX-UHFFFAOYSA-N 6-chloro-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(Cl)=CC=C21 WQKHERPPDYPMNX-UHFFFAOYSA-N 0.000 description 4
- VNVWBXSEHRBXMN-UHFFFAOYSA-N 7-azaspiro[4.5]decan-10-ol Chemical compound OC1CCNCC11CCCC1 VNVWBXSEHRBXMN-UHFFFAOYSA-N 0.000 description 4
- 208000030507 AIDS Diseases 0.000 description 4
- 206010003694 Atrophy Diseases 0.000 description 4
- 102000004072 Beclin-1 Human genes 0.000 description 4
- 108090000524 Beclin-1 Proteins 0.000 description 4
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- 102000001708 Protein Isoforms Human genes 0.000 description 4
- 108010029485 Protein Isoforms Proteins 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 4
- 102000044159 Ubiquitin Human genes 0.000 description 4
- 108090000848 Ubiquitin Proteins 0.000 description 4
- 102000018390 Ubiquitin-Specific Proteases Human genes 0.000 description 4
- 108010066496 Ubiquitin-Specific Proteases Proteins 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000037444 atrophy Effects 0.000 description 4
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 4
- SNRCKKQHDUIRIY-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloromethane;dichloropalladium;iron(2+) Chemical compound [Fe+2].ClCCl.Cl[Pd]Cl.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 SNRCKKQHDUIRIY-UHFFFAOYSA-L 0.000 description 4
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 4
- 239000008103 glucose Substances 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 4
- QSRRZKPKHJHIRB-UHFFFAOYSA-N methyl 4-[(2,5-dichloro-4-methylthiophen-3-yl)sulfonylamino]-2-hydroxybenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC=C1NS(=O)(=O)C1=C(Cl)SC(Cl)=C1C QSRRZKPKHJHIRB-UHFFFAOYSA-N 0.000 description 4
- 208000015122 neurodegenerative disease Diseases 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 4
- 238000011084 recovery Methods 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 4
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 4
- RYLOHTVBYHZHMN-MRVPVSSYSA-N (3r)-4,4,4-trifluoro-3-phenylbutanoic acid Chemical compound OC(=O)C[C@@H](C(F)(F)F)C1=CC=CC=C1 RYLOHTVBYHZHMN-MRVPVSSYSA-N 0.000 description 3
- XRKVQEVODHSBJF-QGZVFWFLSA-N (4r)-4-benzyl-3-(3-cyclohexylpropanoyl)-1,3-oxazolidin-2-one Chemical compound C([C@H]1CC=2C=CC=CC=2)OC(=O)N1C(=O)CCC1CCCCC1 XRKVQEVODHSBJF-QGZVFWFLSA-N 0.000 description 3
- YAYOVHRLVOHYMW-UHFFFAOYSA-N 1h-pyrimidin-6-one;hydrochloride Chemical compound Cl.O=C1C=CN=CN1 YAYOVHRLVOHYMW-UHFFFAOYSA-N 0.000 description 3
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 3
- OATNBMJACLEOTB-UHFFFAOYSA-N 6-phenyl-1h-pyrimidin-4-one Chemical compound C1=NC(O)=CC(C=2C=CC=CC=2)=N1 OATNBMJACLEOTB-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 206010006187 Breast cancer Diseases 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- 206010009944 Colon cancer Diseases 0.000 description 3
- 201000003883 Cystic fibrosis Diseases 0.000 description 3
- 206010012289 Dementia Diseases 0.000 description 3
- 230000006782 ER associated degradation Effects 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- 208000031886 HIV Infections Diseases 0.000 description 3
- 208000037357 HIV infectious disease Diseases 0.000 description 3
- 206010019280 Heart failures Diseases 0.000 description 3
- 208000008839 Kidney Neoplasms Diseases 0.000 description 3
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 3
- 208000021642 Muscular disease Diseases 0.000 description 3
- 201000009623 Myopathy Diseases 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 102000004245 Proteasome Endopeptidase Complex Human genes 0.000 description 3
- 108090000708 Proteasome Endopeptidase Complex Proteins 0.000 description 3
- 229940079156 Proteasome inhibitor Drugs 0.000 description 3
- 206010038389 Renal cancer Diseases 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000000840 anti-viral effect Effects 0.000 description 3
- 239000002246 antineoplastic agent Substances 0.000 description 3
- 238000010533 azeotropic distillation Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000033228 biological regulation Effects 0.000 description 3
- 230000005587 bubbling Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 201000007455 central nervous system cancer Diseases 0.000 description 3
- 208000029742 colonic neoplasm Diseases 0.000 description 3
- 239000002027 dichloromethane extract Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 230000008482 dysregulation Effects 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000003925 fat Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- 201000005787 hematologic cancer Diseases 0.000 description 3
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 3
- 208000033519 human immunodeficiency virus infectious disease Diseases 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 230000007954 hypoxia Effects 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 125000000842 isoxazolyl group Chemical group 0.000 description 3
- 201000010982 kidney cancer Diseases 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 201000005202 lung cancer Diseases 0.000 description 3
- 208000020816 lung neoplasm Diseases 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 201000006417 multiple sclerosis Diseases 0.000 description 3
- 230000020763 muscle atrophy Effects 0.000 description 3
- 201000001119 neuropathy Diseases 0.000 description 3
- 230000007823 neuropathy Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- 201000008968 osteosarcoma Diseases 0.000 description 3
- 230000008506 pathogenesis Effects 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- 208000033808 peripheral neuropathy Diseases 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000003207 proteasome inhibitor Substances 0.000 description 3
- 230000017854 proteolysis Effects 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 230000011664 signaling Effects 0.000 description 3
- 238000009097 single-agent therapy Methods 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 235000019345 sodium thiosulphate Nutrition 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 description 3
- 239000008158 vegetable oil Substances 0.000 description 3
- QCSLIRFWJPOENV-UHFFFAOYSA-N (2-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1F QCSLIRFWJPOENV-UHFFFAOYSA-N 0.000 description 2
- OBUKEMPWKGDRJV-GSVOUGTGSA-N (2r)-4,4,4-trifluoro-2-methylbutanoic acid Chemical compound OC(=O)[C@H](C)CC(F)(F)F OBUKEMPWKGDRJV-GSVOUGTGSA-N 0.000 description 2
- RRTQXYMVKHMNST-WOJBJXKFSA-N (4R)-4-benzyl-3-[(2R)-2-(cyclohexylmethyl)pent-4-enoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@H](CC=C)CC1CCCCC1)=O RRTQXYMVKHMNST-WOJBJXKFSA-N 0.000 description 2
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 2
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 2
- NVKGVBZZSJFQLM-UHFFFAOYSA-N 1-(2-chloroethyl)-1-nitrosourea Chemical compound NC(=O)N(N=O)CCCl NVKGVBZZSJFQLM-UHFFFAOYSA-N 0.000 description 2
- CYTBDDHRZFBCLM-UHFFFAOYSA-N 1-methyl-4-methylidenecyclohexane-1-carboxylic acid Chemical compound OC(=O)C1(C)CCC(=C)CC1 CYTBDDHRZFBCLM-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- MREVMTYHTIKKHF-UHFFFAOYSA-N 2-chloro-4-methoxypyrrolidine Chemical compound ClC1NCC(C1)OC MREVMTYHTIKKHF-UHFFFAOYSA-N 0.000 description 2
- WJZIPMQUKSTHLV-UHFFFAOYSA-N 2-ethyldecanoic acid Chemical compound CCCCCCCCC(CC)C(O)=O WJZIPMQUKSTHLV-UHFFFAOYSA-N 0.000 description 2
- VZOMLDYIAWPSDV-UHFFFAOYSA-N 2-ethylundecanoic acid Chemical compound CCCCCCCCCC(CC)C(O)=O VZOMLDYIAWPSDV-UHFFFAOYSA-N 0.000 description 2
- YCYMCMYLORLIJX-UHFFFAOYSA-N 2-propyloctanoic acid Chemical compound CCCCCCC(C(O)=O)CCC YCYMCMYLORLIJX-UHFFFAOYSA-N 0.000 description 2
- JABKKDSAYJYRIV-UHFFFAOYSA-N 3-[(4-hydroxypiperidin-4-yl)methyl]-6-prop-1-en-2-ylpyrimidin-4-one Chemical compound OC1(CCNCC1)CN1C=NC(=CC1=O)C(=C)C JABKKDSAYJYRIV-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- VNCXJXZUMVHKNG-UHFFFAOYSA-N 3-cyclobutylpropanoic acid Chemical compound OC(=O)CCC1CCC1 VNCXJXZUMVHKNG-UHFFFAOYSA-N 0.000 description 2
- JUADTOTVJUYCRQ-UHFFFAOYSA-N 3-cyclohexylpropanoyl chloride Chemical compound ClC(=O)CCC1CCCCC1 JUADTOTVJUYCRQ-UHFFFAOYSA-N 0.000 description 2
- KTEFIXBDWGIJRN-UHFFFAOYSA-N 4,6-dichloro-N-methyl-N-propan-2-ylpyridine-3-carboxamide Chemical compound ClC1=CC(=NC=C1C(=O)N(C)C(C)C)Cl KTEFIXBDWGIJRN-UHFFFAOYSA-N 0.000 description 2
- LVFRXXAPDZDBJW-UHFFFAOYSA-N 4-(2-fluorophenyl)-6-methoxypyrimidine Chemical compound FC1=C(C=CC=C1)C1=NC=NC(=C1)OC LVFRXXAPDZDBJW-UHFFFAOYSA-N 0.000 description 2
- VBJKSPLCSMASET-LJQANCHMSA-N 4-chloro-1-[[(4S)-4-hydroxy-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-6-oxopyridine-3-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)N1CC([C@](CC1)(O)CN1C=C(C(=CC1=O)Cl)C(=O)O)(C)C VBJKSPLCSMASET-LJQANCHMSA-N 0.000 description 2
- NIWAKYKDBYNDJA-UHFFFAOYSA-N 4-chloro-N-methyl-6-oxo-N-propan-2-yl-1H-pyridine-3-carboxamide Chemical compound ClC=1C(=CNC(C=1)=O)C(=O)N(C)C(C)C NIWAKYKDBYNDJA-UHFFFAOYSA-N 0.000 description 2
- IRFMYDQDCVLEMF-UHFFFAOYSA-N 4-hydroxy-7-azaspiro[4.5]decane-7-carboxylic acid Chemical compound C1CC(C2(C1)CCCN(C2)C(=O)O)O IRFMYDQDCVLEMF-UHFFFAOYSA-N 0.000 description 2
- HWGAMKPBIMCJSG-LJQANCHMSA-N 5-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-2-phenyl-1H-pyrimidin-6-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cc2cnc([nH]c2=O)-c2ccccc2)CC1)c1ccccc1 HWGAMKPBIMCJSG-LJQANCHMSA-N 0.000 description 2
- YSKYRSRSSSJBIQ-UHFFFAOYSA-N 5-bromo-4-chloro-1h-pyridin-2-one Chemical compound OC1=CC(Cl)=C(Br)C=N1 YSKYRSRSSSJBIQ-UHFFFAOYSA-N 0.000 description 2
- ARHFBFPHRLFWCZ-UHFFFAOYSA-N 6-(2-fluorophenyl)-3-[(4-hydroxypiperidin-4-yl)methyl]pyrimidin-4-one hydrochloride Chemical compound Cl.OC1(Cn2cnc(cc2=O)-c2ccccc2F)CCNCC1 ARHFBFPHRLFWCZ-UHFFFAOYSA-N 0.000 description 2
- RATJFDLHHOWZBQ-UHFFFAOYSA-N 6-azaspiro[3.5]nonan-9-one hydrochloride Chemical compound Cl.O=C1CCNCC11CCC1 RATJFDLHHOWZBQ-UHFFFAOYSA-N 0.000 description 2
- VLDBYTQXOBVGNU-UHFFFAOYSA-N 6-benzyl-6-azaspiro[3.5]nonan-9-one Chemical compound C1C2(CCC2)C(=O)CCN1CC1=CC=CC=C1 VLDBYTQXOBVGNU-UHFFFAOYSA-N 0.000 description 2
- BLHCMGRVFXRYRN-UHFFFAOYSA-N 6-hydroxynicotinic acid Chemical compound OC(=O)C1=CC=C(O)N=C1 BLHCMGRVFXRYRN-UHFFFAOYSA-N 0.000 description 2
- 108090000433 Aurora kinases Proteins 0.000 description 2
- 101150104237 Birc3 gene Proteins 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 2
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 2
- 241000206601 Carnobacterium mobile Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 102000016755 Coronin 2A Human genes 0.000 description 2
- 108050006326 Coronin 2A Proteins 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 2
- 230000033616 DNA repair Effects 0.000 description 2
- ZBNZXTGUTAYRHI-UHFFFAOYSA-N Dasatinib Chemical compound C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1Cl ZBNZXTGUTAYRHI-UHFFFAOYSA-N 0.000 description 2
- MHZGKXUYDGKKIU-UHFFFAOYSA-N Decylamine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 102100040669 F-box only protein 32 Human genes 0.000 description 2
- 101710191029 F-box only protein 32 Proteins 0.000 description 2
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 2
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 2
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 2
- 239000002067 L01XE06 - Dasatinib Substances 0.000 description 2
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 2
- 102000009151 Luteinizing Hormone Human genes 0.000 description 2
- 108010073521 Luteinizing Hormone Proteins 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- 101150003085 Pdcl gene Proteins 0.000 description 2
- 108030005449 Polo kinases Proteins 0.000 description 2
- 101100379220 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) API2 gene Proteins 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- 229940122803 Vinca alkaloid Drugs 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229960000548 alemtuzumab Drugs 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 2
- 229960002932 anastrozole Drugs 0.000 description 2
- 239000004037 angiogenesis inhibitor Substances 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000002280 anti-androgenic effect Effects 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 230000000340 anti-metabolite Effects 0.000 description 2
- 239000000051 antiandrogen Substances 0.000 description 2
- 239000003472 antidiabetic agent Substances 0.000 description 2
- 229940125708 antidiabetic agent Drugs 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 229940045988 antineoplastic drug protein kinase inhibitors Drugs 0.000 description 2
- 239000003443 antiviral agent Substances 0.000 description 2
- 230000007416 antiviral immune response Effects 0.000 description 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- 125000005110 aryl thio group Chemical group 0.000 description 2
- 238000000065 atmospheric pressure chemical ionisation Methods 0.000 description 2
- 239000005441 aurora Substances 0.000 description 2
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 229960000397 bevacizumab Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000008236 biological pathway Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GXJABQQUPOEUTA-RDJZCZTQSA-N bortezomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C=1N=CC=NC=1)C1=CC=CC=C1 GXJABQQUPOEUTA-RDJZCZTQSA-N 0.000 description 2
- 229960001467 bortezomib Drugs 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 2
- 229940127093 camptothecin Drugs 0.000 description 2
- 229960004117 capecitabine Drugs 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 229960004562 carboplatin Drugs 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229960005395 cetuximab Drugs 0.000 description 2
- 239000013522 chelant Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- GCUVBACNBHGZRS-UHFFFAOYSA-N cyclopenta-1,3-diene cyclopenta-2,4-dien-1-yl(diphenyl)phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.c1cc[c-](c1)P(c1ccccc1)c1ccccc1 GCUVBACNBHGZRS-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 229960004397 cyclophosphamide Drugs 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 229960000684 cytarabine Drugs 0.000 description 2
- 210000000805 cytoplasm Anatomy 0.000 description 2
- 229960002448 dasatinib Drugs 0.000 description 2
- 238000013480 data collection Methods 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 125000005331 diazinyl group Chemical group N1=NC(=CC=C1)* 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 239000007884 disintegrant Substances 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 2
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 2
- 229960003668 docetaxel Drugs 0.000 description 2
- 238000000132 electrospray ionisation Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 210000002472 endoplasmic reticulum Anatomy 0.000 description 2
- 229930013356 epothilone Natural products 0.000 description 2
- HESCAJZNRMSMJG-KKQRBIROSA-N epothilone A Chemical class C/C([C@@H]1C[C@@H]2O[C@@H]2CCC[C@@H]([C@@H]([C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1)O)C)=C\C1=CSC(C)=N1 HESCAJZNRMSMJG-KKQRBIROSA-N 0.000 description 2
- 229960001433 erlotinib Drugs 0.000 description 2
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 2
- 239000000328 estrogen antagonist Substances 0.000 description 2
- LUUUIYKJHDBIQC-UHFFFAOYSA-N ethyl 6-chloro-4-phenylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=C(Cl)C=C1C1=CC=CC=C1 LUUUIYKJHDBIQC-UHFFFAOYSA-N 0.000 description 2
- 229960000390 fludarabine Drugs 0.000 description 2
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 2
- 229960002949 fluorouracil Drugs 0.000 description 2
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 2
- 229960002074 flutamide Drugs 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 2
- 229960002584 gefitinib Drugs 0.000 description 2
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 2
- 229960005277 gemcitabine Drugs 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 125000004366 heterocycloalkenyl group Chemical group 0.000 description 2
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 2
- 239000003276 histone deacetylase inhibitor Substances 0.000 description 2
- 229940088597 hormone Drugs 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- 239000003668 hormone analog Substances 0.000 description 2
- 201000009285 hypopyon Diseases 0.000 description 2
- 230000001146 hypoxic effect Effects 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 2
- 229960002411 imatinib Drugs 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 230000028993 immune response Effects 0.000 description 2
- 230000036039 immunity Effects 0.000 description 2
- 239000002955 immunomodulating agent Substances 0.000 description 2
- 229940121354 immunomodulator Drugs 0.000 description 2
- 229960003444 immunosuppressant agent Drugs 0.000 description 2
- 239000003018 immunosuppressive agent Substances 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 230000003834 intracellular effect Effects 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229940043355 kinase inhibitor Drugs 0.000 description 2
- BCFGMOOMADDAQU-UHFFFAOYSA-N lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 2
- 229960004891 lapatinib Drugs 0.000 description 2
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 2
- 229960003881 letrozole Drugs 0.000 description 2
- CALOUTPSSIXMKF-UHFFFAOYSA-M lithium 4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoate Chemical compound FC(CC(C(=O)[O-])CC(F)(F)F)(F)F.[Li+] CALOUTPSSIXMKF-UHFFFAOYSA-M 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 229940040129 luteinizing hormone Drugs 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 2
- 229960001924 melphalan Drugs 0.000 description 2
- 229960001428 mercaptopurine Drugs 0.000 description 2
- 229960000485 methotrexate Drugs 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000000394 mitotic effect Effects 0.000 description 2
- 230000004770 neurodegeneration Effects 0.000 description 2
- 230000000926 neurological effect Effects 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 2
- 229960001756 oxaliplatin Drugs 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 229950007318 ozogamicin Drugs 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 230000001575 pathological effect Effects 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XJZXMIYTSRBQKU-UHFFFAOYSA-N phenyl 1,2-dihydropyridine-5-carboxylate Chemical compound C1(=CC=CC=C1)OC(=O)C1=CNCC=C1 XJZXMIYTSRBQKU-UHFFFAOYSA-N 0.000 description 2
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 150000003057 platinum Chemical class 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 239000003909 protein kinase inhibitor Substances 0.000 description 2
- 125000002755 pyrazolinyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 2
- 229960004622 raloxifene Drugs 0.000 description 2
- 108090000064 retinoic acid receptors Proteins 0.000 description 2
- 102000003702 retinoic acid receptors Human genes 0.000 description 2
- 229960004641 rituximab Drugs 0.000 description 2
- HNMATTJJEPZZMM-BPKVFSPJSA-N s-[(2r,3s,4s,6s)-6-[[(2r,3s,4s,5r,6r)-5-[(2s,4s,5s)-5-[acetyl(ethyl)amino]-4-methoxyoxan-2-yl]oxy-6-[[(2s,5z,9r,13e)-13-[2-[[4-[(2e)-2-[1-[4-(4-amino-4-oxobutoxy)phenyl]ethylidene]hydrazinyl]-2-methyl-4-oxobutan-2-yl]disulfanyl]ethylidene]-9-hydroxy-12-(m Chemical compound C1[C@H](OC)[C@@H](N(CC)C(C)=O)CO[C@H]1O[C@H]1[C@H](O[C@@H]2C\3=C(NC(=O)OC)C(=O)C[C@@](C/3=C/CSSC(C)(C)CC(=O)N\N=C(/C)C=3C=CC(OCCCC(N)=O)=CC=3)(O)C#C\C=C/C#C2)O[C@H](C)[C@@H](NO[C@@H]2O[C@H](C)[C@@H](SC(=O)C=3C(=C(OC)C(O[C@H]4[C@@H]([C@H](OC)[C@@H](O)[C@H](C)O4)O)=C(I)C=3C)OC)[C@@H](O)C2)[C@@H]1O HNMATTJJEPZZMM-BPKVFSPJSA-N 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- AEQFSUDEHCCHBT-UHFFFAOYSA-M sodium valproate Chemical compound [Na+].CCCC(C([O-])=O)CCC AEQFSUDEHCCHBT-UHFFFAOYSA-M 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- ULSBMKGFFFMGOI-UHFFFAOYSA-N tert-butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC11OC1 ULSBMKGFFFMGOI-UHFFFAOYSA-N 0.000 description 2
- QRYDLVFEIPIFAZ-UHFFFAOYSA-N tert-butyl 10-oxo-7-azaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(=O)C11CCCC1 QRYDLVFEIPIFAZ-UHFFFAOYSA-N 0.000 description 2
- XQMRPSPROJYUJM-UHFFFAOYSA-N tert-butyl 4-ethylidenepiperidine-1-carboxylate Chemical compound CC=C1CCN(C(=O)OC(C)(C)C)CC1 XQMRPSPROJYUJM-UHFFFAOYSA-N 0.000 description 2
- UOPYIYFCMOHHEO-UHFFFAOYSA-N tert-butyl 5-oxo-2-azaspiro[5.5]undecane-2-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(=O)C11CCCCC1 UOPYIYFCMOHHEO-UHFFFAOYSA-N 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 229960001196 thiotepa Drugs 0.000 description 2
- 229960003087 tioguanine Drugs 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 2
- 229960005267 tositumomab Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229960000575 trastuzumab Drugs 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 229940102566 valproate Drugs 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 2
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 2
- 229960002066 vinorelbine Drugs 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- TWHUPAUNRIZSBL-UHFFFAOYSA-N (1-methylindazol-7-yl)boronic acid Chemical compound C1=CC(B(O)O)=C2N(C)N=CC2=C1 TWHUPAUNRIZSBL-UHFFFAOYSA-N 0.000 description 1
- AHDDRJBFJBDEPW-RKDXNWHRSA-N (1r,2s)-2-phenylcyclopropane-1-carboxylic acid Chemical compound OC(=O)[C@@H]1C[C@@H]1C1=CC=CC=C1 AHDDRJBFJBDEPW-RKDXNWHRSA-N 0.000 description 1
- NPLZNDDFVCGRAG-UHFFFAOYSA-N (2-cyanophenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1C#N NPLZNDDFVCGRAG-UHFFFAOYSA-N 0.000 description 1
- RKRWGGNHLIPMBF-UHFFFAOYSA-N (2-fluorophenyl)boron Chemical compound [B]C1=CC=CC=C1F RKRWGGNHLIPMBF-UHFFFAOYSA-N 0.000 description 1
- ROEQGIFOWRQYHD-UHFFFAOYSA-N (2-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC=C1B(O)O ROEQGIFOWRQYHD-UHFFFAOYSA-N 0.000 description 1
- MGNBKNBEZGLHNF-UHFFFAOYSA-N (2-methylpyrazol-3-yl)boronic acid Chemical compound CN1N=CC=C1B(O)O MGNBKNBEZGLHNF-UHFFFAOYSA-N 0.000 description 1
- KFQLZBSFHUZSGA-LLVKDONJSA-N (2R)-2-(cyclohexylmethyl)pent-4-enoic acid Chemical compound C1(CCCCC1)C[C@H](C(=O)O)CC=C KFQLZBSFHUZSGA-LLVKDONJSA-N 0.000 description 1
- RHIMMZKCUKLYNJ-SNVBAGLBSA-N (2S)-2-(cyclohexylmethyl)-4-hydroxybutanoic acid Chemical compound C1(CCCCC1)C[C@H](C(=O)O)CCO RHIMMZKCUKLYNJ-SNVBAGLBSA-N 0.000 description 1
- JHUWYASFSULZHQ-OAHLLOKOSA-N (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(cyclohexylmethyl)butanoic acid Chemical compound [Si](C)(C)(C(C)(C)C)OCC[C@@H](C(=O)O)CC1CCCCC1 JHUWYASFSULZHQ-OAHLLOKOSA-N 0.000 description 1
- ZMZQVAUJTDKQGE-BYPYZUCNSA-N (2s)-2-(hydroxymethyl)butanoic acid Chemical compound CC[C@@H](CO)C(O)=O ZMZQVAUJTDKQGE-BYPYZUCNSA-N 0.000 description 1
- IBTSWKLSEOGJGJ-UHFFFAOYSA-N (3-acetamidophenyl)boronic acid Chemical compound CC(=O)NC1=CC=CC(B(O)O)=C1 IBTSWKLSEOGJGJ-UHFFFAOYSA-N 0.000 description 1
- WDGWHKRJEBENCE-UHFFFAOYSA-N (3-carbamoylphenyl)boronic acid Chemical compound NC(=O)C1=CC=CC(B(O)O)=C1 WDGWHKRJEBENCE-UHFFFAOYSA-N 0.000 description 1
- DJBYCYRCMFPFKI-CYBMUJFWSA-N (3R)-1-(1-oxa-6-azaspiro[2.5]octan-6-yl)-3-phenylbutan-1-one Chemical compound C1(=CC=CC=C1)[C@@H](CC(=O)N1CCC2(CO2)CC1)C DJBYCYRCMFPFKI-CYBMUJFWSA-N 0.000 description 1
- WPVVPHVPFDQISS-ZWKOTPCHSA-N (3S)-4-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-(cyclohexylmethyl)-4-oxobutanoic acid Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@H](CC(=O)O)CC1CCCCC1)=O WPVVPHVPFDQISS-ZWKOTPCHSA-N 0.000 description 1
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 1
- ALILUCAWFUUMQY-CZUORRHYSA-N (4R)-4-benzyl-3-[(2R)-3-cyclobutyl-2-methylpropanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@@H](CC1CCC1)C)=O ALILUCAWFUUMQY-CZUORRHYSA-N 0.000 description 1
- DVLZAGRGMDIWNA-CRAIPNDOSA-N (4R)-4-benzyl-3-[(2R)-3-cyclohexyl-2-methylpropanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@@H](CC1CCCCC1)C)=O DVLZAGRGMDIWNA-CRAIPNDOSA-N 0.000 description 1
- RRPWSVZYZBNFJQ-IUODEOHRSA-N (4R)-4-benzyl-3-[(2R)-3-cyclopropyl-2-methylpropanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@@H](CC1CC1)C)=O RRPWSVZYZBNFJQ-IUODEOHRSA-N 0.000 description 1
- YDNINKZAYUPXNH-JKSUJKDBSA-N (4R)-4-benzyl-3-[(2S)-2-(cyclobutylmethyl)-3-hydroxypropanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@@H](CC1CCC1)CO)=O YDNINKZAYUPXNH-JKSUJKDBSA-N 0.000 description 1
- XCNRCUYUTWCYDJ-ZWKOTPCHSA-N (4R)-4-benzyl-3-[(2S)-2-(cyclohexylmethyl)-3-hydroxypropanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@@H](CC1CCCCC1)CO)=O XCNRCUYUTWCYDJ-ZWKOTPCHSA-N 0.000 description 1
- LYCNJFVYUJOOJY-LOSJGSFVSA-N (4R)-4-benzyl-3-[(2S)-2-(cyclohexylmethyl)-3-phenylmethoxypropanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@H](COCC1=CC=CC=C1)CC1CCCCC1)=O LYCNJFVYUJOOJY-LOSJGSFVSA-N 0.000 description 1
- BPGHQDLXWQUURX-RTBURBONSA-N (4R)-4-benzyl-3-[(2S)-2-(cyclohexylmethyl)-4-hydroxybutanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@H](CCO)CC1CCCCC1)=O BPGHQDLXWQUURX-RTBURBONSA-N 0.000 description 1
- OSJJUUXEGJQROV-NWDGAFQWSA-N (4R)-4-benzyl-3-[(2S)-4,4,4-trifluoro-2-(hydroxymethyl)butanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@@H](CC(F)(F)F)CO)=O OSJJUUXEGJQROV-NWDGAFQWSA-N 0.000 description 1
- UVCUGZDCVKXACG-DNQXCXABSA-N (4R)-4-benzyl-3-[(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(cyclohexylmethyl)butanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@H](CCO[Si](C)(C)C(C)(C)C)CC1CCCCC1)=O UVCUGZDCVKXACG-DNQXCXABSA-N 0.000 description 1
- XHCQVCQXPWKLFH-DLBZAZTESA-N (4S)-4-benzyl-3-[(3R)-4,4-difluoro-3-phenylbutanoyl]-1,3-oxazolidin-2-one Chemical compound C(C1=CC=CC=C1)[C@@H]1N(C(OC1)=O)C(C[C@@H](C(F)F)C1=CC=CC=C1)=O XHCQVCQXPWKLFH-DLBZAZTESA-N 0.000 description 1
- FMXNWFYKXHQNAQ-OAHLLOKOSA-N (4r)-4-benzyl-3-(3-cyclobutylpropanoyl)-1,3-oxazolidin-2-one Chemical compound C([C@H]1CC=2C=CC=CC=2)OC(=O)N1C(=O)CCC1CCC1 FMXNWFYKXHQNAQ-OAHLLOKOSA-N 0.000 description 1
- SNVWYQBGGSCYPI-CQSZACIVSA-N (4r)-4-benzyl-3-(3-cyclopropylpropanoyl)-1,3-oxazolidin-2-one Chemical compound C([C@H]1CC=2C=CC=CC=2)OC(=O)N1C(=O)CCC1CC1 SNVWYQBGGSCYPI-CQSZACIVSA-N 0.000 description 1
- XPGZSCXWDAPVIM-LLVKDONJSA-N (4r)-4-benzyl-3-(4,4,4-trifluorobutanoyl)-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N(C(=O)CCC(F)(F)F)[C@@H]1CC1=CC=CC=C1 XPGZSCXWDAPVIM-LLVKDONJSA-N 0.000 description 1
- NVZAYGFXUPFBHE-ZYHUDNBSSA-N (4r)-4-benzyl-3-[(2r)-4,4,4-trifluoro-2-methylbutanoyl]-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N(C(=O)[C@@H](CC(F)(F)F)C)[C@@H]1CC1=CC=CC=C1 NVZAYGFXUPFBHE-ZYHUDNBSSA-N 0.000 description 1
- OJOFMLDBXPDXLQ-VIFPVBQESA-N (4s)-4-benzyl-1,3-oxazolidin-2-one Chemical compound C1OC(=O)N[C@H]1CC1=CC=CC=C1 OJOFMLDBXPDXLQ-VIFPVBQESA-N 0.000 description 1
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- IZLDRXUDBMVNKB-SOFGYWHQSA-N (e)-4,4,4-trifluoro-3-phenylbut-2-enoic acid Chemical compound OC(=O)\C=C(C(F)(F)F)/C1=CC=CC=C1 IZLDRXUDBMVNKB-SOFGYWHQSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- NOPBBMMJSHZGIQ-UHFFFAOYSA-N 1,2-dihydropyridine-5-carboxylic acid Chemical compound OC(=O)C1=CNCC=C1 NOPBBMMJSHZGIQ-UHFFFAOYSA-N 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- ZWEGOVJVJZJDQJ-UHFFFAOYSA-N 1,4,2-dioxazole Chemical compound C1OC=NO1 ZWEGOVJVJZJDQJ-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- 125000000196 1,4-pentadienyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])=C([H])[H] 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- SCRABXQIJNGZRG-UHFFFAOYSA-N 1-(1-oxa-6-azaspiro[2.5]octan-6-yl)-3-phenylpropan-1-one Chemical compound C1(=CC=CC=C1)CCC(=O)N1CCC2(CO2)CC1 SCRABXQIJNGZRG-UHFFFAOYSA-N 0.000 description 1
- ZSVVFDHOQJEHJQ-UHFFFAOYSA-N 1-(3-phenylpropanoyl)piperidin-4-one Chemical compound C1CC(=O)CCN1C(=O)CCC1=CC=CC=C1 ZSVVFDHOQJEHJQ-UHFFFAOYSA-N 0.000 description 1
- KKFYWANUTABYAU-UHFFFAOYSA-N 1-(4-hydroxypiperidin-1-yl)-3-phenylbutan-1-one Chemical compound CC(CC(=O)N1CCC(O)CC1)C1=CC=CC=C1 KKFYWANUTABYAU-UHFFFAOYSA-N 0.000 description 1
- RMLFFLNRFAHMKV-UHFFFAOYSA-N 1-(6-chloro-4-phenylpyridin-3-yl)pyrrolidin-2-one Chemical compound ClC1=CC(=C(C=N1)N1C(CCC1)=O)C1=CC=CC=C1 RMLFFLNRFAHMKV-UHFFFAOYSA-N 0.000 description 1
- ZZVDPQONIJQHTC-GFCCVEGCSA-N 1-[(3R)-3-phenylbutanoyl]piperidin-4-one Chemical compound C1(=CC=CC=C1)[C@@H](CC(=O)N1CCC(CC1)=O)C ZZVDPQONIJQHTC-GFCCVEGCSA-N 0.000 description 1
- OLMBOQJPTDJTNG-UHFFFAOYSA-N 1-[(4-hydroxypiperidin-4-yl)methyl]-4-phenyl-5-(piperidine-1-carbonyl)pyridin-2-one Chemical compound OC1(Cn2cc(C(=O)N3CCCCC3)c(cc2=O)-c2ccccc2)CCNCC1 OLMBOQJPTDJTNG-UHFFFAOYSA-N 0.000 description 1
- OARLHPKZDPIJGN-SSEXGKCCSA-N 1-[[(10S)-10-hydroxy-7-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoyl]-7-azaspiro[4.5]decan-10-yl]methyl]-4-phenyl-5-(piperazine-1-carbonyl)pyridin-2-one Chemical compound O[C@]1(CCN(CC11CCCC1)C(C(CC(F)(F)F)CC(F)(F)F)=O)CN1C(C=C(C(=C1)C(=O)N1CCNCC1)C1=CC=CC=C1)=O OARLHPKZDPIJGN-SSEXGKCCSA-N 0.000 description 1
- GBQGUEYFODEDDU-RUZDIDTESA-N 1-[[(4S)-4-hydroxy-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CC[C@@](O)(Cn2cc(C(O)=O)c(cc2=O)-c2ccccc2)C(C)(C)C1 GBQGUEYFODEDDU-RUZDIDTESA-N 0.000 description 1
- IFKJQPLZJALYAQ-UHFFFAOYSA-N 1-[[10-hydroxy-7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azaspiro[4.5]decan-10-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)N1CC2(CCCC2)C(CC1)(O)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)O IFKJQPLZJALYAQ-UHFFFAOYSA-N 0.000 description 1
- NTDYGSQPQVQGEB-UHFFFAOYSA-N 1-[[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)N1CCC(CC1)(O)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)O NTDYGSQPQVQGEB-UHFFFAOYSA-N 0.000 description 1
- ZOOIZEFXRVLMLU-OAQYLSRUSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-phenylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2ccc(cc2=O)-c2ccccc2)CC1)c1ccccc1 ZOOIZEFXRVLMLU-OAQYLSRUSA-N 0.000 description 1
- USBCASUPFDRGEP-HSZRJFAPSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-5-(2-oxopyrrolidin-1-yl)-4-phenylpyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(N3CCCC3=O)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 USBCASUPFDRGEP-HSZRJFAPSA-N 0.000 description 1
- DIXNDMSCYYXFHT-AREMUKBSSA-N 1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-6-oxo-N,4-diphenylpyridine-3-carboxamide Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C(=O)N(C)c3ccccc3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 DIXNDMSCYYXFHT-AREMUKBSSA-N 0.000 description 1
- OIPAALXXEVJVLQ-UHFFFAOYSA-N 1-[[7-[1-(2,2-difluoroethyl)cyclopropanecarbonyl]-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-N,N-dimethyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound FC(CC1(CC1)C(=O)N1CC2(CCCC2)C(CC1)(O)CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)N(C)C)F OIPAALXXEVJVLQ-UHFFFAOYSA-N 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- JPJOOTWNILDNAW-UHFFFAOYSA-N 1-cyclobutylethanone Chemical compound CC(=O)C1CCC1 JPJOOTWNILDNAW-UHFFFAOYSA-N 0.000 description 1
- QRRSHRVKVLSFQS-UHFFFAOYSA-N 1-ethylcyclohexane-1-carboxylic acid Chemical compound CCC1(C(O)=O)CCCCC1 QRRSHRVKVLSFQS-UHFFFAOYSA-N 0.000 description 1
- ONQBOTKLCMXPOF-UHFFFAOYSA-N 1-ethylpyrrolidine Chemical compound CCN1CCCC1 ONQBOTKLCMXPOF-UHFFFAOYSA-N 0.000 description 1
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 description 1
- AJDXVTCUJNIISK-UHFFFAOYSA-N 1-fluorocyclohexa-3,5-diene-1,2-diamine Chemical compound NC1C=CC=CC1(N)F AJDXVTCUJNIISK-UHFFFAOYSA-N 0.000 description 1
- ZRTZZWQICVKRNU-UHFFFAOYSA-N 1-methyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound CN1C=C(C(=CC1=O)C1=CC=CC=C1)C(=O)N ZRTZZWQICVKRNU-UHFFFAOYSA-N 0.000 description 1
- REHQLKUNRPCYEW-UHFFFAOYSA-N 1-methylcyclohexane-1-carboxylic acid Chemical compound OC(=O)C1(C)CCCCC1 REHQLKUNRPCYEW-UHFFFAOYSA-N 0.000 description 1
- MNIBBVOEXUQHFF-UHFFFAOYSA-N 1-methylcyclopentanecarboxylic acid Chemical compound OC(=O)C1(C)CCCC1 MNIBBVOEXUQHFF-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- NKPMJJGLSFUOPK-UHFFFAOYSA-N 1-tert-butylpiperidin-4-one Chemical compound CC(C)(C)N1CCC(=O)CC1 NKPMJJGLSFUOPK-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- OLYKCPDTXVZOQF-UHFFFAOYSA-N 2,2-difluoro-1-phenylethanone Chemical compound FC(F)C(=O)C1=CC=CC=C1 OLYKCPDTXVZOQF-UHFFFAOYSA-N 0.000 description 1
- GDZWTZDSOFTWKE-UHFFFAOYSA-N 2-(cyclohexylmethyl)butanoic acid Chemical compound CCC(C(O)=O)CC1CCCCC1 GDZWTZDSOFTWKE-UHFFFAOYSA-N 0.000 description 1
- SDKATVAEMVYSAB-UHFFFAOYSA-N 2-ethyl-dodecanoic acid Chemical compound CCCCCCCCCCC(CC)C(O)=O SDKATVAEMVYSAB-UHFFFAOYSA-N 0.000 description 1
- NRGGMCIBEHEAIL-UHFFFAOYSA-N 2-ethylpyridine Chemical compound CCC1=CC=CC=N1 NRGGMCIBEHEAIL-UHFFFAOYSA-N 0.000 description 1
- YIDRCIOAPLVRFZ-UHFFFAOYSA-N 2-methyl-6-phenyl-1h-pyrimidin-4-one Chemical compound N1C(C)=NC(=O)C=C1C1=CC=CC=C1 YIDRCIOAPLVRFZ-UHFFFAOYSA-N 0.000 description 1
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 1
- RXGPYPPCEXISOV-UHFFFAOYSA-N 2-propylheptanoic acid Chemical compound CCCCCC(C(O)=O)CCC RXGPYPPCEXISOV-UHFFFAOYSA-N 0.000 description 1
- LZJLXDNGANKYIE-UHFFFAOYSA-N 3,4-diphenylpyridazine Chemical compound C1=CC=CC=C1C1=CC=NN=C1C1=CC=CC=C1 LZJLXDNGANKYIE-UHFFFAOYSA-N 0.000 description 1
- DATHJLQNPJUDST-UHFFFAOYSA-N 3-[[4-hydroxy-1-(3-phenylpropanoyl)piperidin-4-yl]methyl]-2-methyl-6-phenylpyrimidin-4-one Chemical compound Cc1nc(cc(=O)n1CC1(O)CCN(CC1)C(=O)CCc1ccccc1)-c1ccccc1 DATHJLQNPJUDST-UHFFFAOYSA-N 0.000 description 1
- OUSVVQVNCSMIEB-LJQANCHMSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-(2-methylpropylamino)pyrimidin-4-one Chemical compound CC(C)CNc1cc(=O)n(CC2(O)CCN(CC2)C(=O)C[C@@H](C)c2ccccc2)cn1 OUSVVQVNCSMIEB-LJQANCHMSA-N 0.000 description 1
- LBVFKHUXJFQPRG-JOCHJYFZSA-N 3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-6-naphthalen-1-ylpyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2cccc3ccccc23)CC1)c1ccccc1 LBVFKHUXJFQPRG-JOCHJYFZSA-N 0.000 description 1
- LVNPADQPUYHCOR-UHFFFAOYSA-N 3-bromo-4-phenylpyridine Chemical compound BrC1=CN=CC=C1C1=CC=CC=C1 LVNPADQPUYHCOR-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- IKMLTSXQWYWFBG-UHFFFAOYSA-N 3-cyclohexyl-1-(4-hydroxypiperidin-1-yl)-2-methylpropan-1-one Chemical compound CC(CC1CCCCC1)C(=O)N1CCC(O)CC1 IKMLTSXQWYWFBG-UHFFFAOYSA-N 0.000 description 1
- SAOPJNFYPNUPSE-UHFFFAOYSA-N 3-cyclohexyl-2-methylpropanoic acid Chemical compound OC(=O)C(C)CC1CCCCC1 SAOPJNFYPNUPSE-UHFFFAOYSA-N 0.000 description 1
- SZQVEGOXJYTLLB-UHFFFAOYSA-N 3-cyclopentylpropanoyl chloride Chemical compound ClC(=O)CCC1CCCC1 SZQVEGOXJYTLLB-UHFFFAOYSA-N 0.000 description 1
- PPZZCMKWRAVJDS-UHFFFAOYSA-N 3-cyclopropylpropanoic acid Chemical compound OC(=O)CCC1CC1 PPZZCMKWRAVJDS-UHFFFAOYSA-N 0.000 description 1
- QMYGFTJCQFEDST-UHFFFAOYSA-N 3-methoxybutyl acetate Chemical group COC(C)CCOC(C)=O QMYGFTJCQFEDST-UHFFFAOYSA-N 0.000 description 1
- PEXWJYDPDXUVSV-UHFFFAOYSA-N 3-phenylbut-2-enoic acid Chemical compound OC(=O)C=C(C)C1=CC=CC=C1 PEXWJYDPDXUVSV-UHFFFAOYSA-N 0.000 description 1
- ZZEWMYILWXCRHZ-UHFFFAOYSA-N 3-phenylbutyric acid Chemical compound OC(=O)CC(C)C1=CC=CC=C1 ZZEWMYILWXCRHZ-UHFFFAOYSA-N 0.000 description 1
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 description 1
- WTUCTMYLCMVYEX-UHFFFAOYSA-N 4,4,4-trifluorobutanoic acid Chemical compound OC(=O)CCC(F)(F)F WTUCTMYLCMVYEX-UHFFFAOYSA-N 0.000 description 1
- ATTSUIJPZMICFB-UHFFFAOYSA-N 4,4-difluoro-3-phenylbutanoic acid Chemical compound OC(=O)CC(C(F)F)C1=CC=CC=C1 ATTSUIJPZMICFB-UHFFFAOYSA-N 0.000 description 1
- ILMIEWNDXAKVNI-UHFFFAOYSA-N 4,6-dichloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=C(Cl)C=C1Cl ILMIEWNDXAKVNI-UHFFFAOYSA-N 0.000 description 1
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 1
- KINGIUVUBVMKBR-UHFFFAOYSA-N 4-(2-fluorophenyl)-1-[(4-hydroxypiperidin-4-yl)methyl]-N-methyl-6-oxo-N-propan-2-ylpyridine-3-carboxamide Chemical compound FC1=C(C=CC=C1)C=1C(=CN(C(C=1)=O)CC1(CCNCC1)O)C(=O)N(C)C(C)C KINGIUVUBVMKBR-UHFFFAOYSA-N 0.000 description 1
- XRKVQEVODHSBJF-UHFFFAOYSA-N 4-benzyl-3-(3-cyclohexylpropanoyl)-1,3-oxazolidin-2-one Chemical compound C=1C=CC=CC=1CC1COC(=O)N1C(=O)CCC1CCCCC1 XRKVQEVODHSBJF-UHFFFAOYSA-N 0.000 description 1
- HAXBARUHJFHXTI-UHFFFAOYSA-N 4-chloro-6-(2-fluorophenyl)pyrimidine Chemical compound FC1=CC=CC=C1C1=CC(Cl)=NC=N1 HAXBARUHJFHXTI-UHFFFAOYSA-N 0.000 description 1
- CAARDVKATXZGKP-UHFFFAOYSA-N 4-ethyloxane Chemical compound CCC1CCOCC1 CAARDVKATXZGKP-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- RGMWYXHWDOAXLC-UHFFFAOYSA-N 5-(2-oxopyrrolidin-1-yl)-4-phenyl-1H-pyridin-2-one Chemical compound O=C1N(CCC1)C=1C(=CC(NC=1)=O)C1=CC=CC=C1 RGMWYXHWDOAXLC-UHFFFAOYSA-N 0.000 description 1
- LSQDYMLOIUTZEG-LJQANCHMSA-N 5-bromo-1-[[1-[(2R)-3-cyclohexyl-2-methylpropanoyl]-4-hydroxypiperidin-4-yl]methyl]-4-(2-fluorophenyl)pyridin-2-one Chemical compound BrC=1C(=CC(N(C=1)CC1(CCN(CC1)C([C@@H](CC1CCCCC1)C)=O)O)=O)C1=C(C=CC=C1)F LSQDYMLOIUTZEG-LJQANCHMSA-N 0.000 description 1
- LMQJHYGYYIKQIS-UHFFFAOYSA-N 5-bromo-2-chloro-4-(2-fluorophenyl)pyridine Chemical compound BrC=1C(=CC(=NC=1)Cl)C1=C(C=CC=C1)F LMQJHYGYYIKQIS-UHFFFAOYSA-N 0.000 description 1
- WJQBACAWUOMIRS-UHFFFAOYSA-N 5-bromo-4-(2-fluorophenyl)-1-[(4-hydroxypiperidin-4-yl)methyl]pyridin-2-one hydrochloride Chemical compound Cl.OC1(Cn2cc(Br)c(cc2=O)-c2ccccc2F)CCNCC1 WJQBACAWUOMIRS-UHFFFAOYSA-N 0.000 description 1
- HZSQHTKCGJBYMJ-OAHLLOKOSA-N 5-bromo-4-chloro-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyridin-2-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(Br)c(Cl)cc2=O)CC1)c1ccccc1 HZSQHTKCGJBYMJ-OAHLLOKOSA-N 0.000 description 1
- ZIKDWTKUUMKETF-UHFFFAOYSA-N 5-bromo-4-phenyl-1H-pyridin-2-one Chemical compound BrC=1C(=CC(NC=1)=O)C1=CC=CC=C1 ZIKDWTKUUMKETF-UHFFFAOYSA-N 0.000 description 1
- WJIQDUCSNGZIMY-UHFFFAOYSA-N 6-(2-fluorophenyl)-3-[[4-hydroxy-1-(1-methyl-4-methylidenecyclohexanecarbonyl)piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound CC1(CCC(=C)CC1)C(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccccc2F)CC1 WJIQDUCSNGZIMY-UHFFFAOYSA-N 0.000 description 1
- HWCKXWZXXYZBIA-LJQANCHMSA-N 6-(2-fluorophenyl)-3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]pyrimidin-4-one Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cnc(cc2=O)-c2ccccc2F)CC1)c1ccccc1 HWCKXWZXXYZBIA-LJQANCHMSA-N 0.000 description 1
- AXFABVAPHSWFMD-UHFFFAOYSA-N 6-chloro-1h-pyrimidin-4-one Chemical compound OC1=CC(Cl)=NC=N1 AXFABVAPHSWFMD-UHFFFAOYSA-N 0.000 description 1
- DZGDAGLYKGRTIQ-UHFFFAOYSA-N 6-chloro-4-phenylpyridine-3-carbaldehyde Chemical compound C1=NC(Cl)=CC(C=2C=CC=CC=2)=C1C=O DZGDAGLYKGRTIQ-UHFFFAOYSA-N 0.000 description 1
- QKPTURNZCJJQTP-UHFFFAOYSA-N 6-oxo-4-phenyl-1H-pyridine-3-carbaldehyde Chemical compound O=C1C=C(C(=CN1)C=O)C1=CC=CC=C1 QKPTURNZCJJQTP-UHFFFAOYSA-N 0.000 description 1
- HMPMGWACXIZKLE-UHFFFAOYSA-N 6-oxo-4-phenyl-1H-pyridine-3-carboxylic acid Chemical compound O=C1C=C(C(=CN1)C(=O)O)C1=CC=CC=C1 HMPMGWACXIZKLE-UHFFFAOYSA-N 0.000 description 1
- XQBJWLCODGWPER-UHFFFAOYSA-N 7-azaspiro[4.5]decane-7-carboxylic acid Chemical compound OC(=O)N1CCCC2(CCCC2)C1 XQBJWLCODGWPER-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical class [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 229940088872 Apoptosis inhibitor Drugs 0.000 description 1
- 102000007371 Ataxin-3 Human genes 0.000 description 1
- 108010032947 Ataxin-3 Proteins 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229940126074 CDK kinase inhibitor Drugs 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102000011727 Caspases Human genes 0.000 description 1
- 108010076667 Caspases Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 238000006273 Corey-Chaykovsky epoxidation reaction Methods 0.000 description 1
- 102100034770 Cyclin-dependent kinase inhibitor 3 Human genes 0.000 description 1
- 102000005927 Cysteine Proteases Human genes 0.000 description 1
- 108010005843 Cysteine Proteases Proteins 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- 102100034116 E3 ubiquitin-protein ligase RNF123 Human genes 0.000 description 1
- 102100025014 E3 ubiquitin-protein ligase TRIM63 Human genes 0.000 description 1
- 101710164910 E3 ubiquitin-protein ligase TRIM63 Proteins 0.000 description 1
- 102100028890 E3 ubiquitin-protein ligase synoviolin Human genes 0.000 description 1
- 241000463291 Elga Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical group CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- IFTRQJLVEBNKJK-UHFFFAOYSA-N Ethylcyclopentane Chemical compound CCC1CCCC1 IFTRQJLVEBNKJK-UHFFFAOYSA-N 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- ATTSUIJPZMICFB-MRVPVSSYSA-N FC([C@H](CC(=O)O)C1=CC=CC=C1)F Chemical compound FC([C@H](CC(=O)O)C1=CC=CC=C1)F ATTSUIJPZMICFB-MRVPVSSYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000463109 Haloprofundus marisrubri Species 0.000 description 1
- 102100039996 Histone deacetylase 1 Human genes 0.000 description 1
- 102100039999 Histone deacetylase 2 Human genes 0.000 description 1
- 101000945639 Homo sapiens Cyclin-dependent kinase inhibitor 3 Proteins 0.000 description 1
- 101000978676 Homo sapiens E3 ubiquitin-protein ligase MARCHF6 Proteins 0.000 description 1
- 101000711573 Homo sapiens E3 ubiquitin-protein ligase RNF123 Proteins 0.000 description 1
- 101000838967 Homo sapiens E3 ubiquitin-protein ligase synoviolin Proteins 0.000 description 1
- 101001035024 Homo sapiens Histone deacetylase 1 Proteins 0.000 description 1
- 101001035011 Homo sapiens Histone deacetylase 2 Proteins 0.000 description 1
- 101001039199 Homo sapiens Low-density lipoprotein receptor-related protein 6 Proteins 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 108010050904 Interferons Proteins 0.000 description 1
- 102000014150 Interferons Human genes 0.000 description 1
- 238000000023 Kugelrohr distillation Methods 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 208000017170 Lipid metabolism disease Diseases 0.000 description 1
- 102100040704 Low-density lipoprotein receptor-related protein 6 Human genes 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 102000008934 Muscle Proteins Human genes 0.000 description 1
- 108010074084 Muscle Proteins Proteins 0.000 description 1
- GBQYTZTZHCIGIZ-HHHXNRCGSA-N N-benzyl-1-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-N-methyl-6-oxo-4-phenylpyridine-3-carboxamide Chemical compound C[C@H](CC(=O)N1CCC(O)(Cn2cc(C(=O)N(C)Cc3ccccc3)c(cc2=O)-c2ccccc2)CC1)c1ccccc1 GBQYTZTZHCIGIZ-HHHXNRCGSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 102000048850 Neoplasm Genes Human genes 0.000 description 1
- 108700019961 Neoplasm Genes Proteins 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 108091030071 RNAI Proteins 0.000 description 1
- 108091007354 SIAHs Proteins 0.000 description 1
- 208000026214 Skeletal muscle atrophy Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- 102000004399 TNF receptor-associated factor 3 Human genes 0.000 description 1
- 108090000922 TNF receptor-associated factor 3 Proteins 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 101150006083 USP19 gene Proteins 0.000 description 1
- 102000006275 Ubiquitin-Protein Ligases Human genes 0.000 description 1
- 108010083111 Ubiquitin-Protein Ligases Proteins 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 238000007295 Wittig olefination reaction Methods 0.000 description 1
- 230000004156 Wnt signaling pathway Effects 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- AIJCNTOYZPKURP-UHFFFAOYSA-N [2-(trifluoromethoxy)phenyl]boronic acid Chemical compound OB(O)C1=CC=CC=C1OC(F)(F)F AIJCNTOYZPKURP-UHFFFAOYSA-N 0.000 description 1
- GLYOPNLBKCBTMI-UHFFFAOYSA-N [2-chloro-2-(1-chloro-2-phenylethoxy)ethyl]benzene Chemical compound C=1C=CC=CC=1CC(Cl)OC(Cl)CC1=CC=CC=C1 GLYOPNLBKCBTMI-UHFFFAOYSA-N 0.000 description 1
- YHAQUGOSDQZIMA-UHFFFAOYSA-N [3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=CC(B(O)O)=C1 YHAQUGOSDQZIMA-UHFFFAOYSA-N 0.000 description 1
- LRPCTXPDGKIPQS-UHFFFAOYSA-N [Br-].CS[PH2+]C1=CC=CC=C1 Chemical compound [Br-].CS[PH2+]C1=CC=CC=C1 LRPCTXPDGKIPQS-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 102000003802 alpha-Synuclein Human genes 0.000 description 1
- 108090000185 alpha-Synuclein Proteins 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 238000000218 anomalous X-ray scattering Methods 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000000158 apoptosis inhibitor Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000004900 autophagic degradation Effects 0.000 description 1
- 230000002886 autophagic effect Effects 0.000 description 1
- 230000004908 autophagic flux Effects 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004602 benzodiazinyl group Chemical group N1=NC(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004599 benzpyrazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- BEFBXRPJLRZLJE-KHZPMNTOSA-N bis[3,5-bis(trifluoromethyl)phenyl]-[(1r)-1-[2-(2-dicyclohexylphosphanylphenyl)cyclopenta-2,4-dien-1-yl]ethyl]phosphane;cyclopenta-1,3-diene;iron(2+) Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C(C(F)(F)F)=CC(C(F)(F)F)=CC=1P([C@H](C)[C-]1C(=CC=C1)C=1C(=CC=CC=1)P(C1CCCCC1)C1CCCCC1)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 BEFBXRPJLRZLJE-KHZPMNTOSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000001925 catabolic effect Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000002875 cyclin dependent kinase inhibitor Substances 0.000 description 1
- 229940043378 cyclin-dependent kinase inhibitor Drugs 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- HJZLEGIHUQOJBA-UHFFFAOYSA-N cyclohexane propionic acid Chemical compound OC(=O)CCC1CCCCC1 HJZLEGIHUQOJBA-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- USVZFSNDGFNNJT-UHFFFAOYSA-N cyclopenta-1,4-dien-1-yl(diphenyl)phosphane (2,3-dichlorocyclopenta-1,4-dien-1-yl)-diphenylphosphane iron(2+) Chemical compound [Fe++].c1cc[c-](c1)P(c1ccccc1)c1ccccc1.Clc1c(cc[c-]1Cl)P(c1ccccc1)c1ccccc1 USVZFSNDGFNNJT-UHFFFAOYSA-N 0.000 description 1
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 230000009504 deubiquitination Effects 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000004639 dihydroindenyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- KZNICNPSHKQLFF-UHFFFAOYSA-N dihydromaleimide Natural products O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- ZJIIKCIAHLMNJB-UHFFFAOYSA-N ethyl 1-[(4-hydroxy-3,3-dimethylpiperidin-1-ium-4-yl)methyl]-6-oxo-4-phenylpyridine-3-carboxylate chloride Chemical compound [Cl-].C(C)OC(=O)C=1C(=CC(N(C=1)CC1(C(C[NH2+]CC1)(C)C)O)=O)C1=CC=CC=C1 ZJIIKCIAHLMNJB-UHFFFAOYSA-N 0.000 description 1
- ZJIIKCIAHLMNJB-VZYDHVRKSA-N ethyl 1-[[(4S)-4-hydroxy-3,3-dimethylpiperidin-1-ium-4-yl]methyl]-6-oxo-4-phenylpyridine-3-carboxylate chloride Chemical compound [Cl-].C(C)OC(=O)C=1C(=CC(N(C=1)C[C@]1(C(C[NH2+]CC1)(C)C)O)=O)C1=CC=CC=C1 ZJIIKCIAHLMNJB-VZYDHVRKSA-N 0.000 description 1
- XJWQOZHCVMKZLX-UHFFFAOYSA-N ethyl 1-methyl-4-methylidenecyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(C)CCC(=C)CC1 XJWQOZHCVMKZLX-UHFFFAOYSA-N 0.000 description 1
- GYDKHYAZKCAMAS-UHFFFAOYSA-N ethyl 1-methyl-4-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(C)CCC(=O)CC1 GYDKHYAZKCAMAS-UHFFFAOYSA-N 0.000 description 1
- DTKPGWDFGMRCBN-UHFFFAOYSA-N ethyl 4,4-difluoro-3-phenylbut-2-enoate Chemical compound CCOC(=O)C=C(C(F)F)C1=CC=CC=C1 DTKPGWDFGMRCBN-UHFFFAOYSA-N 0.000 description 1
- ZXOUEUVDLLFLIX-UHFFFAOYSA-N ethyl 4,4-difluoro-3-phenylbutanoate Chemical compound CCOC(=O)CC(C(F)F)C1=CC=CC=C1 ZXOUEUVDLLFLIX-UHFFFAOYSA-N 0.000 description 1
- OJQGUWAYWRQPCW-XMMPIXPASA-N ethyl 4-(2-fluorophenyl)-1-[[(10S)-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-6-oxopyridine-3-carboxylate Chemical compound FC1=C(C=CC=C1)C=1C(=CN(C(C=1)=O)C[C@@]1(CCNCC11CCCC1)O)C(=O)OCC OJQGUWAYWRQPCW-XMMPIXPASA-N 0.000 description 1
- PVTUIPSYTNVKSA-UHFFFAOYSA-N ethyl 4-chloro-6-oxo-1h-pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CNC(=O)C=C1Cl PVTUIPSYTNVKSA-UHFFFAOYSA-N 0.000 description 1
- FIVNQCCRBCHOIN-OAQYLSRUSA-N ethyl 4-cyclopropyl-1-[[(10S)-10-hydroxy-7-azaspiro[4.5]decan-10-yl]methyl]-6-oxopyridine-3-carboxylate Chemical compound C1(CC1)C=1C(=CN(C(C=1)=O)C[C@@]1(CCNCC11CCCC1)O)C(=O)OCC FIVNQCCRBCHOIN-OAQYLSRUSA-N 0.000 description 1
- UZAMQNYLUUSISG-FSRHSHDFSA-N ethyl 4-cyclopropyl-1-[[(4S)-4-hydroxy-3,3-dimethylpiperidin-1-ium-4-yl]methyl]-6-oxopyridine-3-carboxylate chloride Chemical compound [Cl-].C1(CC1)C1=CC(N(C=C1C(=O)OCC)C[C@]1(C(C[NH2+]CC1)(C)C)O)=O UZAMQNYLUUSISG-FSRHSHDFSA-N 0.000 description 1
- MPBFSYFQZDJOSW-UHFFFAOYSA-N ethyl 6-oxo-4-phenyl-1h-pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CNC(=O)C=C1C1=CC=CC=C1 MPBFSYFQZDJOSW-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical group CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- SLAFUPJSGFVWPP-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 SLAFUPJSGFVWPP-UHFFFAOYSA-M 0.000 description 1
- 150000005194 ethylbenzenes Chemical class 0.000 description 1
- NEZRFXZYPAIZAD-UHFFFAOYSA-N ethylcyclobutane Chemical compound CCC1CCC1 NEZRFXZYPAIZAD-UHFFFAOYSA-N 0.000 description 1
- ITZHTNFXLDFAPB-UHFFFAOYSA-N ethylcycloheptane Chemical compound CCC1CCCCCC1 ITZHTNFXLDFAPB-UHFFFAOYSA-N 0.000 description 1
- FOTXAJDDGPYIFU-UHFFFAOYSA-N ethylcyclopropane Chemical compound CCC1CC1 FOTXAJDDGPYIFU-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical group C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 235000011194 food seasoning agent Nutrition 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000030279 gene silencing Effects 0.000 description 1
- 230000009368 gene silencing by RNA Effects 0.000 description 1
- 238000012812 general test Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000008011 inorganic excipient Substances 0.000 description 1
- 229940079322 interferon Drugs 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 150000008040 ionic compounds Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000000622 irritating effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000005969 isothiazolinyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 208000030159 metabolic disease Diseases 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- PYFSLJVSCGXYAJ-UHFFFAOYSA-N methyl 2-hydroxy-4-[[3-(2-hydroxyphenyl)phenyl]sulfonylamino]benzoate Chemical compound C1=C(O)C(C(=O)OC)=CC=C1NS(=O)(=O)C1=CC=CC(C=2C(=CC=CC=2)O)=C1 PYFSLJVSCGXYAJ-UHFFFAOYSA-N 0.000 description 1
- DVRUIOSVQBUGTF-UHFFFAOYSA-N methyl 4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanoate Chemical compound COC(=O)C(CC(F)(F)F)CC(F)(F)F DVRUIOSVQBUGTF-UHFFFAOYSA-N 0.000 description 1
- YGDGZDGRCWHDOU-UHFFFAOYSA-N methyl 4-[[5-chloro-4-(2-hydroxyphenyl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoate Chemical compound C1=C(O)C(C(=O)OC)=CC=C1NS(=O)(=O)C1=CC(C=2C(=CC=CC=2)O)=C(Cl)S1 YGDGZDGRCWHDOU-UHFFFAOYSA-N 0.000 description 1
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 239000003226 mitogen Substances 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000035407 negative regulation of cell proliferation Effects 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-M oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC([O-])=O ZQPPMHVWECSIRJ-KTKRTIGZSA-M 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000008012 organic excipient Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 150000002926 oxygen Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- GJQNVZVOTKFLIU-UHFFFAOYSA-N piperidin-1-ium-4-one;chloride Chemical compound Cl.O=C1CCNCC1 GJQNVZVOTKFLIU-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920000155 polyglutamine Polymers 0.000 description 1
- 108010040003 polyglutamine Proteins 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000004481 post-translational protein modification Effects 0.000 description 1
- 230000001323 posttranslational effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000008844 regulatory mechanism Effects 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 229920003987 resole Polymers 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 230000025185 skeletal muscle atrophy Effects 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 230000004960 subcellular localization Effects 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000004426 substituted alkynyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- BTAIXZBHFCPKSP-GDLZYMKVSA-N tert-butyl (10S)-10-[(5-ethoxycarbonyl-2-oxo-4-phenylpyridin-1-yl)methyl]-10-hydroxy-7-azaspiro[4.5]decane-7-carboxylate Chemical compound C(C)OC(=O)C=1C(=CC(N(C=1)C[C@@]1(CCN(CC11CCCC1)C(=O)OC(C)(C)C)O)=O)C1=CC=CC=C1 BTAIXZBHFCPKSP-GDLZYMKVSA-N 0.000 description 1
- JVPYVKWCKGFUQG-LEWJYISDSA-N tert-butyl (3S)-4-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-(cyclohexylmethyl)-4-oxobutanoate Chemical compound C(C1=CC=CC=C1)[C@H]1N(C(OC1)=O)C([C@H](CC(=O)OC(C)(C)C)CC1CCCCC1)=O JVPYVKWCKGFUQG-LEWJYISDSA-N 0.000 description 1
- HDRDGYAJAYXKEM-HHHXNRCGSA-N tert-butyl (4S)-4-[[5-(dimethylcarbamoyl)-2-oxo-4-phenylpyridin-1-yl]methyl]-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate Chemical compound CN(C(=O)C=1C(=CC(N(C=1)C[C@]1(C(CN(CC1)C(=O)OC(C)(C)C)(C)C)O)=O)C1=CC=CC=C1)C HDRDGYAJAYXKEM-HHHXNRCGSA-N 0.000 description 1
- BTAIXZBHFCPKSP-UHFFFAOYSA-N tert-butyl 10-[(5-ethoxycarbonyl-2-oxo-4-phenylpyridin-1-yl)methyl]-10-hydroxy-7-azaspiro[4.5]decane-7-carboxylate Chemical compound C(C)OC(=O)C=1C(=CC(N(C=1)CC1(CCN(CC11CCCC1)C(=O)OC(C)(C)C)O)=O)C1=CC=CC=C1 BTAIXZBHFCPKSP-UHFFFAOYSA-N 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- SAMLQGOCTVOODD-UHFFFAOYSA-N tert-butyl 2-methyl-1-oxa-6-azaspiro[2.5]octane-6-carboxylate Chemical compound C(C)(C)(C)OC(=O)N1CCC2(C(O2)C)CC1 SAMLQGOCTVOODD-UHFFFAOYSA-N 0.000 description 1
- HDRDGYAJAYXKEM-UHFFFAOYSA-N tert-butyl 4-[[5-(dimethylcarbamoyl)-2-oxo-4-phenylpyridin-1-yl]methyl]-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate Chemical compound CN(C(=O)C=1C(=CC(N(C=1)CC1(C(CN(CC1)C(=O)OC(C)(C)C)(C)C)O)=O)C1=CC=CC=C1)C HDRDGYAJAYXKEM-UHFFFAOYSA-N 0.000 description 1
- RSUABHNEPZUTOZ-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[[2-oxo-4-phenyl-5-(piperidine-1-carbonyl)pyridin-1-yl]methyl]piperidine-1-carboxylate Chemical compound OC1(CCN(CC1)C(=O)OC(C)(C)C)CN1C(C=C(C(=C1)C(=O)N1CCCCC1)C1=CC=CC=C1)=O RSUABHNEPZUTOZ-UHFFFAOYSA-N 0.000 description 1
- PWQLFIKTGRINFF-UHFFFAOYSA-N tert-butyl 4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)CC1 PWQLFIKTGRINFF-UHFFFAOYSA-N 0.000 description 1
- SOQAHGHRBIWAPF-UHFFFAOYSA-N tert-butyl 4-propylidenepiperidine-1-carboxylate Chemical compound CCC=C1CCN(C(=O)OC(C)(C)C)CC1 SOQAHGHRBIWAPF-UHFFFAOYSA-N 0.000 description 1
- XCABBJCQOZYZKD-UHFFFAOYSA-N tert-butyl 9-oxo-6-azaspiro[3.5]nonane-6-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(=O)C11CCC1 XCABBJCQOZYZKD-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- NLLZTRMHNHVXJJ-UHFFFAOYSA-J titanium tetraiodide Chemical compound I[Ti](I)(I)I NLLZTRMHNHVXJJ-UHFFFAOYSA-J 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000440 toxicity profile Toxicity 0.000 description 1
- 230000037426 transcriptional repression Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical class C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 230000034512 ubiquitination Effects 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 125000005500 uronium group Chemical group 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
- DYWSVUBJGFTOQC-UHFFFAOYSA-N xi-2-Ethylheptanoic acid Chemical compound CCCCCC(CC)C(O)=O DYWSVUBJGFTOQC-UHFFFAOYSA-N 0.000 description 1
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/08—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing alicyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4412—Non condensed pyridines; Hydrogenated derivatives thereof having oxo groups directly attached to the heterocyclic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/444—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a six-membered ring with nitrogen as a ring heteroatom, e.g. amrinone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4523—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems
- A61K31/4545—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems containing a six-membered ring with nitrogen as a ring hetero atom, e.g. pipamperone, anabasine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/513—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim having oxo groups directly attached to the heterocyclic ring, e.g. cytosine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Epidemiology (AREA)
- Psychology (AREA)
- Physical Education & Sports Medicine (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1612938.9 | 2016-07-26 | ||
| GBGB1612938.9A GB201612938D0 (en) | 2016-07-26 | 2016-07-26 | Pharmaceutical compounds |
| PCT/GB2017/052178 WO2018020242A1 (en) | 2016-07-26 | 2017-07-26 | Pharmaceutical compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20190034564A true KR20190034564A (ko) | 2019-04-02 |
Family
ID=56894331
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020197004797A Ceased KR20190034564A (ko) | 2016-07-26 | 2017-07-26 | 약학적 화합물 |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US11053213B2 (enExample) |
| EP (1) | EP3490982B1 (enExample) |
| JP (1) | JP6986065B2 (enExample) |
| KR (1) | KR20190034564A (enExample) |
| CN (1) | CN109790146B (enExample) |
| AU (1) | AU2017304761C1 (enExample) |
| BR (1) | BR112019001253A2 (enExample) |
| CA (1) | CA3031036A1 (enExample) |
| ES (1) | ES2914677T3 (enExample) |
| GB (1) | GB201612938D0 (enExample) |
| IL (1) | IL264415B (enExample) |
| MX (1) | MX382624B (enExample) |
| SG (1) | SG11201900545TA (enExample) |
| WO (1) | WO2018020242A1 (enExample) |
| ZA (1) | ZA201900540B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD1031463S1 (en) | 2020-10-17 | 2024-06-18 | Honeywell International Inc. | Modular aspirated smoke, gas, and air quality monitoring system device |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB201612938D0 (en) * | 2016-07-26 | 2016-09-07 | Almac Discovery Ltd | Pharmaceutical compounds |
| GB201617758D0 (en) * | 2016-10-20 | 2016-12-07 | Almac Discovery Limited | Pharmaceutical compounds |
| WO2019067503A1 (en) * | 2017-09-26 | 2019-04-04 | Dana-Farber Cancer Institute, Inc. | NEW USP7 INHIBITORS FOR THE TREATMENT OF MULTIPLE MYELOMA |
| GB201801562D0 (en) * | 2018-01-31 | 2018-03-14 | Almac Diagnostics Ltd | Pharmaceutical compounds |
| UY38291A (es) * | 2018-07-05 | 2020-06-30 | Servier Lab | Nuevos derivados de amino-pirimidonilo un proceso para su preparación y composiciones farmacéuticas |
| KR20210100127A (ko) | 2018-12-06 | 2021-08-13 | 알막 디스커버리 리미티드 | 치료용 usp19 억제제 |
| US20220033397A1 (en) * | 2018-12-06 | 2022-02-03 | Almac Discovery Limited | Pharmaceutical compounds and their use as inhibitors of ubiquitin specific protease 19 (usp19) |
| AU2020267757B2 (en) * | 2019-05-06 | 2025-03-27 | Valo Health, Inc. | Inhibiting USP19 |
| JP2023501576A (ja) * | 2019-11-13 | 2023-01-18 | テンプル・ユニバーシティ-オブ・ザ・コモンウェルス・システム・オブ・ハイアー・エデュケイション | 5-ヒドロキシトリプタミン受容体7の調節因子としての新規官能化ラクトンおよびその使用方法 |
| CN111039860B (zh) * | 2019-12-02 | 2022-09-13 | 河北科技大学 | 2-羟基-n-(4’-氯联苯-2-基)烟酰胺的合成方法及应用 |
| GB202001980D0 (en) * | 2020-02-13 | 2020-04-01 | Almac Discovery Ltd | Therapeutic mentods |
| GB202104097D0 (en) | 2021-03-24 | 2021-05-05 | Almac Discovery Ltd | Pharmaceutical compounds |
| GB202311227D0 (en) | 2023-07-21 | 2023-09-06 | Almac Discovery Ltd | Pharmaceutical compounds |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AUPO111096A0 (en) | 1996-07-18 | 1996-08-08 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| IL146824A0 (en) | 1999-06-02 | 2002-07-25 | Janssen Pharmaceutica Nv | Pyrrolidinyl, piperidinyl or homopiperidinyl substituted (benzodioxan, benzofuran or benzopyran) derivatives |
| EP2552013A1 (en) * | 2011-07-27 | 2013-01-30 | Siemens Aktiengesellschaft | Reduction of noise and vibrations of an electromechanical transducer by using a modified stator coil drive signal comprising harmonic components |
| GB201114448D0 (en) * | 2011-08-22 | 2011-10-05 | Takeda Pharmaceutical | Compounds and their use |
| EP2565186A1 (en) * | 2011-09-02 | 2013-03-06 | Hybrigenics S.A. | Selective and reversible inhibitors of ubiquitin specific protease 7 |
| JP6535007B2 (ja) | 2013-12-20 | 2019-06-26 | インスティテュート オブ ファーマコロジー アンド トキシコロジー アカデミー オブ ミリタリー メディカル サイエンシズ ピー.エル.エー.チャイナ | 新規ピペリジンカルボキサミド化合物、その調製方法及び使用 |
| TWI698436B (zh) * | 2014-12-30 | 2020-07-11 | 美商佛瑪治療公司 | 作為泛素特異性蛋白酶7抑制劑之吡咯并及吡唑并嘧啶 |
| GB201612938D0 (en) * | 2016-07-26 | 2016-09-07 | Almac Discovery Ltd | Pharmaceutical compounds |
| GB201617758D0 (en) | 2016-10-20 | 2016-12-07 | Almac Discovery Limited | Pharmaceutical compounds |
-
2016
- 2016-07-26 GB GBGB1612938.9A patent/GB201612938D0/en not_active Ceased
-
2017
- 2017-07-26 WO PCT/GB2017/052178 patent/WO2018020242A1/en not_active Ceased
- 2017-07-26 ES ES17748875T patent/ES2914677T3/es active Active
- 2017-07-26 BR BR112019001253A patent/BR112019001253A2/pt not_active IP Right Cessation
- 2017-07-26 AU AU2017304761A patent/AU2017304761C1/en not_active Ceased
- 2017-07-26 MX MX2019001011A patent/MX382624B/es unknown
- 2017-07-26 CA CA3031036A patent/CA3031036A1/en active Pending
- 2017-07-26 KR KR1020197004797A patent/KR20190034564A/ko not_active Ceased
- 2017-07-26 JP JP2019503928A patent/JP6986065B2/ja active Active
- 2017-07-26 CN CN201780057475.6A patent/CN109790146B/zh not_active Expired - Fee Related
- 2017-07-26 SG SG11201900545TA patent/SG11201900545TA/en unknown
- 2017-07-26 US US16/319,961 patent/US11053213B2/en active Active
- 2017-07-26 EP EP17748875.6A patent/EP3490982B1/en active Active
-
2019
- 2019-01-22 IL IL264415A patent/IL264415B/en unknown
- 2019-01-25 ZA ZA2019/00540A patent/ZA201900540B/en unknown
-
2021
- 2021-07-06 US US17/368,290 patent/US12466805B2/en active Active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD1031463S1 (en) | 2020-10-17 | 2024-06-18 | Honeywell International Inc. | Modular aspirated smoke, gas, and air quality monitoring system device |
Also Published As
| Publication number | Publication date |
|---|---|
| CN109790146B (zh) | 2022-08-23 |
| GB201612938D0 (en) | 2016-09-07 |
| RU2019105179A3 (enExample) | 2020-10-19 |
| ZA201900540B (en) | 2022-07-27 |
| MX382624B (es) | 2025-03-13 |
| AU2017304761A1 (en) | 2019-01-31 |
| EP3490982B1 (en) | 2022-04-20 |
| US20220002264A1 (en) | 2022-01-06 |
| SG11201900545TA (en) | 2019-02-27 |
| JP6986065B2 (ja) | 2021-12-22 |
| JP2019523266A (ja) | 2019-08-22 |
| ES2914677T3 (es) | 2022-06-15 |
| US20190233394A1 (en) | 2019-08-01 |
| WO2018020242A1 (en) | 2018-02-01 |
| US11053213B2 (en) | 2021-07-06 |
| CA3031036A1 (en) | 2018-02-01 |
| EP3490982A1 (en) | 2019-06-05 |
| AU2017304761C1 (en) | 2021-12-09 |
| AU2017304761B2 (en) | 2021-06-03 |
| RU2019105179A (ru) | 2020-08-27 |
| MX2019001011A (es) | 2019-05-23 |
| CN109790146A (zh) | 2019-05-21 |
| BR112019001253A2 (pt) | 2019-05-07 |
| IL264415A (en) | 2019-02-28 |
| US12466805B2 (en) | 2025-11-11 |
| IL264415B (en) | 2022-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US12466805B2 (en) | Pharmaceutical compounds | |
| US10766903B2 (en) | Piperidine derivatives as inhibitors of ubiquitin specific protease 7 | |
| KR20220102156A (ko) | Bcl6 표적화 모이어티에 연결된 e3 유비퀴틴 리가아제 결합 모이어티를 함유하는 이기능성 분자 | |
| KR20230171979A (ko) | Bcl6 단백질 분해의 조절제 및 관련 사용 방법 | |
| EA039783B1 (ru) | ПРОИЗВОДНЫЕ ТИРОЗИНАМИДА В КАЧЕСТВЕ ИНГИБИТОРОВ Rho-КИНАЗЫ | |
| EP3746432B1 (en) | 4-hydroxypiperidine derivatives and their use as inhibitors of ubiquitin specific protease 19 (usp19) | |
| KR20230142745A (ko) | Cdk2 억제제 및 그의 사용 방법 | |
| US20240327382A1 (en) | Pharmaceutical compounds as inhibitors of ubiquitin specific protease 19 | |
| US20220033397A1 (en) | Pharmaceutical compounds and their use as inhibitors of ubiquitin specific protease 19 (usp19) | |
| RU2776482C2 (ru) | Фармацевтические соединения | |
| OA21863A (en) | Indazole based compounds and associated methods of use. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20190218 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20200724 Comment text: Request for Examination of Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20220711 Patent event code: PE09021S01D |
|
| E601 | Decision to refuse application | ||
| PE0601 | Decision on rejection of patent |
Patent event date: 20230419 Comment text: Decision to Refuse Application Patent event code: PE06012S01D Patent event date: 20220711 Comment text: Notification of reason for refusal Patent event code: PE06011S01I |