KR20010033256A - 피리딘 카르복사미드 기재의 살진균제 혼합물 - Google Patents
피리딘 카르복사미드 기재의 살진균제 혼합물 Download PDFInfo
- Publication number
- KR20010033256A KR20010033256A KR1020007006692A KR20007006692A KR20010033256A KR 20010033256 A KR20010033256 A KR 20010033256A KR 1020007006692 A KR1020007006692 A KR 1020007006692A KR 20007006692 A KR20007006692 A KR 20007006692A KR 20010033256 A KR20010033256 A KR 20010033256A
- Authority
- KR
- South Korea
- Prior art keywords
- formula
- alkyl
- methyl
- substituted
- group
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 49
- 230000000855 fungicidal effect Effects 0.000 title claims abstract description 16
- 239000000417 fungicide Substances 0.000 title description 3
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical class NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 title 1
- -1 amide compound Chemical class 0.000 claims abstract description 101
- 150000001875 compounds Chemical class 0.000 claims abstract description 52
- 239000004480 active ingredient Substances 0.000 claims abstract description 41
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000011701 zinc Substances 0.000 claims abstract description 6
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 6
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 claims abstract description 6
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000012990 dithiocarbamate Substances 0.000 claims abstract description 5
- ZTONKKHCXJTROW-UHFFFAOYSA-N n-(2-oxopropyl)benzamide Chemical compound CC(=O)CNC(=O)C1=CC=CC=C1 ZTONKKHCXJTROW-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 30
- 229910052736 halogen Inorganic materials 0.000 claims description 28
- 150000002367 halogens Chemical class 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 27
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- 239000000460 chlorine Chemical group 0.000 claims description 26
- 229910052801 chlorine Inorganic materials 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 26
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 25
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 20
- 241000233866 Fungi Species 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 125000000335 thiazolyl group Chemical group 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 125000004465 cycloalkenyloxy group Chemical group 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 5
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 5
- 125000001188 haloalkyl group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 4
- AWYFNIZYMPNGAI-UHFFFAOYSA-L ethylenebis(dithiocarbamate) Chemical compound [S-]C(=S)NCCNC([S-])=S AWYFNIZYMPNGAI-UHFFFAOYSA-L 0.000 claims description 4
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 239000011630 iodine Chemical group 0.000 claims description 3
- 229910052740 iodine Chemical group 0.000 claims description 3
- 125000002971 oxazolyl group Chemical group 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 239000002689 soil Substances 0.000 claims description 3
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims description 2
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 2
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 2
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 2
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 2
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 claims description 2
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 claims description 2
- DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical group S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 claims description 2
- YUCFVHQCAFKDQG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH] YUCFVHQCAFKDQG-UHFFFAOYSA-N 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 125000004304 oxazol-5-yl group Chemical group O1C=NC=C1* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 claims description 2
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 claims description 2
- YAUCKEPYKXHCFF-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;manganese Chemical compound [Mn].NC(=S)SCCSC(N)=S YAUCKEPYKXHCFF-UHFFFAOYSA-N 0.000 claims 2
- 239000007788 liquid Substances 0.000 claims 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 claims 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 claims 1
- 230000002538 fungal effect Effects 0.000 claims 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 abstract description 5
- IDHQFHGMLUZXPQ-UHFFFAOYSA-M C(CNC([S-])=S)NC([S-])=S.[NH4+].[Zn+] Chemical compound C(CNC([S-])=S)NC([S-])=S.[NH4+].[Zn+] IDHQFHGMLUZXPQ-UHFFFAOYSA-M 0.000 abstract 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- 235000013339 cereals Nutrition 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 8
- 240000006365 Vitis vinifera Species 0.000 description 7
- 235000014787 Vitis vinifera Nutrition 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000005507 spraying Methods 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 230000002195 synergetic effect Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 235000013312 flour Nutrition 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 235000013311 vegetables Nutrition 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 239000004359 castor oil Substances 0.000 description 4
- 235000019438 castor oil Nutrition 0.000 description 4
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- 244000070406 Malus silvestris Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 241000233622 Phytophthora infestans Species 0.000 description 3
- 240000000111 Saccharum officinarum Species 0.000 description 3
- 235000007201 Saccharum officinarum Nutrition 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 230000003032 phytopathogenic effect Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000002351 wastewater Substances 0.000 description 3
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 2
- 125000006060 1,1-dimethyl-3-butenyl group Chemical group 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000006050 3-methyl-2-pentenyl group Chemical group 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241001465180 Botrytis Species 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 2
- 235000005983 Crescentia cujete Nutrition 0.000 description 2
- 206010017533 Fungal infection Diseases 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 240000007741 Lagenaria siceraria Species 0.000 description 2
- 235000009797 Lagenaria vulgaris Nutrition 0.000 description 2
- 240000005561 Musa balbisiana Species 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000008055 alkyl aryl sulfonates Chemical group 0.000 description 2
- 235000021016 apples Nutrition 0.000 description 2
- 235000021015 bananas Nutrition 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 2
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 2
- RWRIWBAIICGTTQ-UHFFFAOYSA-N difluoromethane Chemical compound FCF RWRIWBAIICGTTQ-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 2
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229940044654 phenolsulfonic acid Drugs 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 125000006079 1,1,2-trimethyl-2-propenyl group Chemical group 0.000 description 1
- 125000006059 1,1-dimethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006033 1,1-dimethyl-2-propenyl group Chemical group 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000006062 1,2-dimethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006035 1,2-dimethyl-2-propenyl group Chemical group 0.000 description 1
- 125000006063 1,2-dimethyl-3-butenyl group Chemical group 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- 125000006065 1,3-dimethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006066 1,3-dimethyl-3-butenyl group Chemical group 0.000 description 1
- CMCBDXRRFKYBDG-UHFFFAOYSA-N 1-dodecoxydodecane Chemical class CCCCCCCCCCCCOCCCCCCCCCCCC CMCBDXRRFKYBDG-UHFFFAOYSA-N 0.000 description 1
- 125000006080 1-ethyl-1-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006074 1-ethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006082 1-ethyl-2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006037 1-ethyl-2-propenyl group Chemical group 0.000 description 1
- 125000006075 1-ethyl-3-butenyl group Chemical group 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006219 1-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006028 1-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006048 1-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006021 1-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006030 1-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006052 1-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000006055 1-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000006067 2,2-dimethyl-3-butenyl group Chemical group 0.000 description 1
- KBLAMUYRMZPYLS-UHFFFAOYSA-N 2,3-bis(2-methylpropyl)naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(CC(C)C)C(CC(C)C)=CC2=C1 KBLAMUYRMZPYLS-UHFFFAOYSA-N 0.000 description 1
- LMCBYQIBQXKCLN-UHFFFAOYSA-N 2,3-dibutylnaphthalene-1-sulfonic acid;naphthalene Chemical compound C1=CC=CC2=CC=CC=C21.C1=CC=C2C(S(O)(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 LMCBYQIBQXKCLN-UHFFFAOYSA-N 0.000 description 1
- 125000006069 2,3-dimethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006070 2,3-dimethyl-3-butenyl group Chemical group 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000006077 2-ethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006078 2-ethyl-3-butenyl group Chemical group 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006049 2-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006053 2-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000006056 2-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- FOGYNLXERPKEGN-UHFFFAOYSA-N 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid Chemical compound COC1=CC=CC(CC(CS(O)(=O)=O)OC=2C(=CC(CCCS(O)(=O)=O)=CC=2)OC)=C1O FOGYNLXERPKEGN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006054 3-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000006057 3-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000006051 4-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006058 4-methyl-4-pentenyl group Chemical group 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000223600 Alternaria Species 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 235000003276 Apios tuberosa Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000010744 Arachis villosulicarpa Nutrition 0.000 description 1
- 241000239223 Arachnida Species 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 240000007154 Coffea arabica Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 244000024469 Cucumis prophetarum Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241000928110 Glassella Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241001330975 Magnaporthe oryzae Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000005802 Mancozeb Substances 0.000 description 1
- 239000005809 Metiram Substances 0.000 description 1
- 241000131448 Mycosphaerella Species 0.000 description 1
- 241001281801 Mycosphaerella arachidis Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001668536 Oculimacula yallundae Species 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 244000133018 Panax trifolius Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 241000736122 Parastagonospora nodorum Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241001281803 Plasmopara viticola Species 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000005821 Propamocarb Substances 0.000 description 1
- 241000221300 Puccinia Species 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical class [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 241000221566 Ustilago Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical compound [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- ZGBSOTLWHZQNLH-UHFFFAOYSA-N [Mg].S(O)(O)(=O)=O Chemical compound [Mg].S(O)(O)(=O)=O ZGBSOTLWHZQNLH-UHFFFAOYSA-N 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229960004909 aminosalicylic acid Drugs 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000007931 coated granule Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 235000012055 fruits and vegetables Nutrition 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229920000940 maneb Polymers 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 229920000257 metiram Polymers 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- WZZLDXDUQPOXNW-UHFFFAOYSA-N propamocarb Chemical compound CCCOC(=O)NCCCN(C)C WZZLDXDUQPOXNW-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 235000021012 strawberries Nutrition 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
Description
실시예 | 활성 성분 | 분무액내의 활성성분의 농도(ppm) | 비처리된 대조군의 효능(%) |
1C | 대조군(비처리) | 0 (99% 감염) | 0 |
2C | 화합물 I.1 | 10050 | 00 |
3C | 화합물 I.2 | 502512.5 | 000 |
4C | 화합물 IIa | 12.5 | 70 |
5C | 화합물 VI | 1005025 | 807070 |
실시예 | 본 발명에 따른 혼합물(ppm) | 관찰된 효능 | 계산된 효능*) |
6 | 12.5ppm I.2 + 12.5ppm IIa | 90 | 70 |
7 | 100ppm I.1 + 100ppm VI | 95 | 80 |
8 | 50ppm I.1 + 50ppm VI | 85 | 70 |
9 | 50ppm I.2 + 50ppm VI | 90 | 70 |
10 | 25ppm I.2 + 25ppm VI | 90 | 70 |
*) 콜비식을 사용하여 계산함 |
Claims (10)
- 활성 성분으로서 a) 하기 화학식 I의 아미드 화합물과, b) 망간 에틸렌비스(디티오카르바메이트)(아연 착물)(IIa), 망간 에틸렌비스(디티오카르바메이트)(IIb) , 아연 암모니에이트 에틸렌비스(디티오카르바메이트)(IIc) 및 아연 에틸렌비스(디티오카르바메이트)(IId)로 이루어진 군 중에서 선택된 디티오카르바메이트 II 및(또는) c) 하기 화학식 III의 카르바메이트 및(또는) d) 하기 화학식 IV의 N-아세토닐벤즈아미드 또는 그의 염 또는 부가물 및(또는) e) 화합물 V의 활성 성분 및(또는) f) 화학식 VI의 활성 성분 및(또는) g) 화학식 VII의 활성 성분을 상승작용 유효량으로 포함하는 살진균성 혼합물.〈화학식 I〉A-CO-NR1R2〈화학식 III〉(CH3)2N-CH2CH2CH2-NH-CO2-CH2CH2CH3〈화학식 IV〉〈화학식 V〉〈화학식 VI〉〈화학식 VII〉상기 식에서,A는 아릴기이거나 또는 O, N 및 S 중에서 선택된 1 내지 3개의 헤테로 원자를 갖는 방향족 또는 비방향족의 5 또는 6원 헤테로환이고, 이때 아릴기 또는 헤테로환은 알킬, 할로겐, CHF2, CF3, 알콕시, 할로알콕시, 알킬티오, 알킬술피닐 및 알킬술포닐 중에서 서로 독립적으로 선택된 1, 2 또는 3개의 치환체를 가지거나 갖지 않을 수 있고;R1은 수소 원자이고;R2는 알킬, 알케닐, 알키닐, 알콕시, 알케닐옥시, 알키닐옥시, 시클로알킬, 시클로알케닐, 시클로알킬옥시, 시클로알케닐옥시, 페닐 및 할로겐 중에서 선택된 1, 2 또는 3개의 치환체를 가지거나 갖지 않을 수 있는 페닐 또는 시클로알킬기이고, 이때 지방족 및 지환식 라디칼은 부분적으로 또는 전부 할로겐화될 수 있고(있거나) 지환식 라디칼은 1 내지 3개의 알킬기로 치환될 수 있고, 페닐기는 1 내지 5개의 할로겐 원자 및(또는) 알킬, 할로알킬, 알콕시, 할로알콕시, 알킬티오 및 할로알킬티오 중에서 서로 독립적으로 선택된 1 내지 3개의 치환체를 가질 수 있으며, 아미드 페닐기는 1개 이상의 알킬기로 치환되거나 치환되지 않을 수 있고(있거나) O 및 S 중에서 선택된 헤테로 원자를 가질 수 있는 포화 5원 고리와 축합되거나 축합되지 않을 수 있고,R12, R14는 서로 독립적으로 할로겐 또는 C1-C4-알킬이고;R13은 시아노, C1-C4-알킬, C2-C4-알케닐, C2-C4-알키닐 또는 C1-C4-알콕시이고;R15는 수소 또는 C2-C4-알킬이고;R16은 C2-C4-알킬이고;R17은 티오시아나토, 이소티오시아나토 또는 할로겐이고,Y는 수소, 주기율표 1A 내지 3A족의 금속 원자 또는 NR19R20R21R22기이고;R18은 수소이거나 또는 할로겐 또는 니트로기로 치환될 수 있는 C1-C18-알킬기, 할로겐 또는 니트로기로 치환될 수 있는 C2-C8-알케닐 또는 C2-C8-알키닐기, C1-C8-알콕시-C1-C8-알킬 또는 C2-C8-알케닐-C1-C8-알킬기, 탄소수 6 내지 14의 비치환 또는 치환된 아릴기, C3-C7-시클로알킬기, C1-C4-알킬아릴기 또는 5개 또는 6개의 고리 원자 및 N, O 또는 S로 이루어진 군 중에서 선택된 헤테로 원자를 갖는 헤테로환기(여기서, 헤테로환기는 직접 또는 지방족 쇄를 통해 산소 원자에 결합됨)이고;R19내지 R22는 서로 독립적으로 C1-C4-알킬기 또는 C1-C4-히드록시알킬기이고;R23내지 R26은 H, C1-C6-알킬, C1-C6-할로알킬, C2-C6-알케닐, C2-C6-알키닐, C1-C4-알콕시카르보닐, C1-C4-알킬카르보닐, 포르밀, C3-C7-시클로알킬, C6-C10-아릴, 비치환되거나 C1-C4-알킬-, C1-C4-알콕시-, 니트로- 또는 할로겐-치환된, C1-C6-알콕시, C2-C6-알콕시알킬, C2-C6-알킬티오알킬, 디-C1-C4-알킬아미노알킬, 피리딜, 티아졸릴, 푸릴 또는 티에닐이고;W는 O, S 또는 S=O이다.
- 제1항에 있어서, 화학식 I에서 라디칼 A가 페닐, 피리딜, 디히드로피라닐, 디히드로옥사티이닐, 디히드로옥사티이닐옥사이드, 디히드로옥사티이닐디옥사이드, 푸릴, 티아졸릴, 피라졸릴 또는 옥사졸릴 기 중 하나이고, 이들 기가 알킬, 할로겐, 디플루오로메틸 및 트리플루오로메틸 중에서 서로 독립적으로 선택된 1, 2 또는 3개의 치환체를 가질 수 있는 살진균성 혼합물.
- 제1항에 있어서, 화학식 I에서 라디칼 A가 2-위치에서 할로겐, 메틸, 디플루오로메틸, 트리플루오로메틸, 메톡시, 메틸티오, 메틸술피닐 또는 메틸술포닐로 치환되거나 치환되지 않을 수 있는 피리딘-3-일; 2-위치에서 메틸, 트리플루오로메틸, 염소, 브롬 또는 요오드로 치환되거나 치환되지 않을 수 있는 페닐; 2-메틸-5,6-디히드로피란-3-일; 2-메틸-5,6-디히드로-1,4-옥사티인-3-일 또는 그의 4-옥사이드 또는 4,4-디옥사이드; 4-위치 및(또는) 5-위치에서 메틸로 치환되거나 치환되지 않을 수 있는 2-메틸푸란-3-일; 2-위치 및(또는) 4-위치에서 메틸, 염소, 디플루오로메틸 또는 트리플루오로메틸로 치환되거나 치환되지 않을 수 있는 티아졸-5-일; 2-위치 및(또는) 5-위치에서 메틸, 염소, 디플루오로메틸 또는 트리플루오로메틸로 치환되거나 치환되지 않을 수 있는 티아졸-4-일; 3-위치 및(또는) 5-위치에서 메틸, 염소, 디플루오로메틸 또는 트리플루오로메틸로 치환되거나 치환되지 않을 수 있는 1-메틸피라졸-4-일; 또는 2-위치 및(또는) 4-위치에서 메틸 또는 염소로 치환되거나 치환되지 않을 수 있는 옥사졸-5-일 기 중 하나인 살진균성 혼합물.
- 제1항 내지 제3항 중 어느 한 항에 있어서, R2가 제1항에 언급된 치환체 1, 2 또는 3개로 치환되거나 치환되지 않을 수 있는 페닐기인 화학식 I의 화합물을 포함하는 살진균성 혼합물.
- 제4항에 있어서, R2가 2-위치에, 1, 2 또는 3개의 C1-C4-알킬기로 치환될 수 있는 C3-C6-알킬, C5-C6-시클로알케닐, C5-C6-시클로알킬옥시, 시클로알케닐옥시; 또는 1 내지 5개의 할로겐 원자 및(또는) C1-C4-알킬, C1-C4-할로알킬, C1-C4-알콕시, C1-C4-할로알콕시, C1-C4-알킬티오 및 C1-C4-할로알킬티오 중에서 서로 독립적으로 선택된 1 내지 3개의 기로 치환된 페닐 치환체 중 하나를 갖는 페닐기이거나, 또는 R2가 1, 2 또는 3개의 C1-C4-알킬기로 치환되거나 치환되지 않을 수 있는 인다닐 또는 옥사인다닐인 살진균성 혼합물.
- 제1항 내지 제5항 중 어느 한 항에 있어서, 하기 화학식 Ia의 아미드 화합물을 포함하는 살진균성 혼합물.〈화학식 Ia〉〈화학식 A1〉 〈화학식 A2〉 〈화학식 A3〉〈화학식 A4〉 〈화학식 A5〉 〈화학식 A6〉〈화학식 A7〉 〈화학식 A8〉상기 식에서,A는 상기 화학식 A1, A2, A3, A4, A5, A6, A7 또는 A8이고;X는 메틸렌, 황, 술피닐 또는 술포닐(SO2)이고,R3은 메틸, 디플루오로메틸, 트리플루오로메틸, 염소, 브롬 또는 요오드이고,R4는 트리플루오로메틸 또는 염소이고,R5는 수소 또는 메틸이고,R6은 메틸, 디플루오로메틸, 트리플루오로메틸 또는 염소이고,R7은 수소, 메틸 또는 염소이고,R8은 메틸, 디플루오로메틸 또는 트리플루오로메틸이고,R9는 수소, 메틸, 디플루오로메틸, 트리플루오로메틸 또는 염소이고,R10은 C1-C4-알킬, C1-C4-알콕시, C1-C4-알킬티오 또는 할로겐이다.
- 제1항 내지 제5항 중 어느 한 항에 있어서, 아미드 화합물로서 하기 화학식 Ib의 화합물을 포함하는 살진균성 혼합물.〈화학식 Ib〉상기 식에서,R4는 할로겐이고,R11은 할로겐으로 치환된 페닐이다.
- 제1항에 있어서, 아미드 화합물로서 하기 화학식의 화합물을 포함하는 살진균성 혼합물.
- 제1항 내지 제8항 중 어느 한 항에 있어서, 고상 또는 액상 담체내에 아미드 화합물 I을 포함하는 한 부분 및 고상 또는 액상 담체내에 화합물 II 및(또는) III 내지 VII 중 1종 이상을 포함하는 다른 부분으로 이루어진 두 부분으로 조절되는 살진균성 혼합물.
- 진균, 그의 서식지, 또는 진균 공격을 방지해야 하는 물질, 식물, 종자, 토양, 지면 또는 공간을 제1항 내지 제9항 중 어느 한 항에 따른 살진균성 혼합물로 처리함을 포함하고, 활성 성분인 아미드 화합물 I 및 화합물 II 및(또는) III 내지 VII 중 1종 이상을 함께든 또는 따로따로든 동시에 또는 연이어 시용할 수 있는, 유해 진균의 방제 방법.
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19756378.3 | 1997-12-18 | ||
DE19756378 | 1997-12-18 | ||
PCT/EP1998/008225 WO1999031951A2 (de) | 1997-12-18 | 1998-12-15 | Fungizide mischungen auf der basis von pyridincarboxamiden |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20010033256A true KR20010033256A (ko) | 2001-04-25 |
KR100539046B1 KR100539046B1 (ko) | 2005-12-27 |
Family
ID=7852426
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR10-2000-7006692A KR100539046B1 (ko) | 1997-12-18 | 1998-12-15 | 피리딘 카르복사미드 기재의 살진균제 혼합물 |
Country Status (26)
Country | Link |
---|---|
US (1) | US6407126B1 (ko) |
EP (2) | EP1039805B1 (ko) |
JP (2) | JP4336453B2 (ko) |
KR (1) | KR100539046B1 (ko) |
CN (1) | CN100337543C (ko) |
AR (1) | AR014142A1 (ko) |
AT (1) | ATE227080T1 (ko) |
AU (1) | AU753485B2 (ko) |
BR (1) | BR9813664B1 (ko) |
CA (2) | CA2704256A1 (ko) |
CZ (1) | CZ295592B6 (ko) |
DE (1) | DE59806215D1 (ko) |
DK (1) | DK1039805T3 (ko) |
EA (1) | EA004958B1 (ko) |
ES (1) | ES2187077T3 (ko) |
HU (1) | HUP0100935A3 (ko) |
IL (2) | IL136474A0 (ko) |
NL (1) | NL350020I2 (ko) |
NZ (1) | NZ505624A (ko) |
PL (1) | PL191155B1 (ko) |
PT (1) | PT1039805E (ko) |
SK (1) | SK285473B6 (ko) |
TW (1) | TW433980B (ko) |
UA (1) | UA65600C2 (ko) |
WO (1) | WO1999031951A2 (ko) |
ZA (1) | ZA9811561B (ko) |
Families Citing this family (20)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
AU664392B2 (en) * | 1991-10-18 | 1995-11-16 | Monsanto Technology Llc | Fungicides for the control of take-all disease of plants |
TW464471B (en) * | 1997-12-18 | 2001-11-21 | Basf Ag | Fungicidal mixtures based on amide compounds and pyridine derivatives |
CZ296907B6 (cs) * | 2000-12-18 | 2006-07-12 | Basf Aktiengesellschaft | Fungicidní smes a zpusob potírání skodlivých hub temito fungicidními smesmi a jejich pouzití |
WO2002056688A1 (de) * | 2001-01-18 | 2002-07-25 | Basf Aktiengesellschaft | Fungizide mischungen aus benzophenonen und n-biphenylnikotinamiden |
TW200306159A (en) * | 2002-03-19 | 2003-11-16 | Du Pont | Bicyclic fused pyridinyl amides and advantageous compositions thereof for use as fungicides |
TW200407075A (en) * | 2002-03-19 | 2004-05-16 | Du Pont | Pyridinyl amides and advantageous compositions thereof for use as fungicides |
TW200306782A (en) * | 2002-03-19 | 2003-12-01 | Du Pont | Pyridinyl amides and advantageous compositions thereof for use as fungicides |
TW200306155A (en) * | 2002-03-19 | 2003-11-16 | Du Pont | Benzamides and advantageous compositions thereof for use as fungicides |
DE10347090A1 (de) * | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
EP1813151A1 (de) * | 2006-01-26 | 2007-08-01 | BASF Aktiengesellschaft | Fungizide Mischungen auf der Basis von 1-Methyl-pyrazol-4-yl-carbonsäureaniliden |
JP2009502747A (ja) * | 2005-07-14 | 2009-01-29 | ビーエーエスエフ ソシエタス・ヨーロピア | 1−メチル−ピラゾール−4−イルカルボキシアニリド類に基づく殺菌性混合物 |
BRPI0716712B1 (pt) * | 2006-09-12 | 2016-06-28 | Nippon Soda Co | agente para o controle de infestações na forma de suspensão estável |
RU2487132C1 (ru) * | 2012-07-23 | 2013-07-10 | Общество с ограниченной ответственностью "Метаген" | Производные циклических 5-нитропиридин-2-ил-тиоалкенил-4-дитиокарбаматов, обладающие противогрибковой активностью, и их применение |
EP2826367A1 (en) | 2013-07-18 | 2015-01-21 | Basf Se | Fungicidal mixtures comprising boscalid and zoxamide |
CN104292156A (zh) * | 2014-10-15 | 2015-01-21 | 江苏耕耘化学有限公司 | 啶酰菌胺同系物、其非偶联法合成方法及其在制备防治病菌药物中的应用 |
CN104430389A (zh) * | 2014-11-10 | 2015-03-25 | 江苏丰登作物保护股份有限公司 | 一种含噁唑菌酮和啶酰菌胺的杀菌组合物及其应用 |
CN104488887A (zh) * | 2014-12-03 | 2015-04-08 | 广东中迅农科股份有限公司 | 一种含有噁唑菌酮和啶酰菌胺的杀菌组合物 |
CN106135229A (zh) * | 2015-04-13 | 2016-11-23 | 南京华洲药业有限公司 | 一种含啶酰菌胺和噁唑菌酮的杀菌组合物及其应用 |
CN107771833A (zh) * | 2016-08-29 | 2018-03-09 | 南京华洲药业有限公司 | 一种含啶酰菌胺和霜霉威的杀菌组合物及其应用 |
CN116138260B (zh) * | 2021-07-22 | 2024-03-15 | 青岛海利尔生物科技有限公司 | 一种含氟茚唑菌胺与苄啶菌酯的杀菌组合物 |
Family Cites Families (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US476774A (en) * | 1892-06-14 | aechee | ||
HU193172B (en) | 1983-07-21 | 1987-08-28 | Eszakmagyar Vegyimuevek | Multi-agent fungicide preparation of sinergetic effect |
IL78825A0 (en) | 1985-06-05 | 1986-09-30 | Uniroyal Ltd | Fungicidal compositions containing carboxamidothiazoles and a method for protecting plants utilizing same |
ES2011602T3 (es) * | 1986-08-12 | 1994-07-16 | Mitsubishi Chem Ind | Derivados de piridinacarboxamida y su uso como fungicidas. |
US4957933A (en) * | 1989-04-21 | 1990-09-18 | E. I. Du Pont De Nemours And Company | Fungicidal oxazolidinones |
IL103614A (en) | 1991-11-22 | 1998-09-24 | Basf Ag | Carboxamides for controlling botrytis and certain novel such compounds |
HU229710B1 (en) * | 1995-07-12 | 2014-05-28 | Du Pont | Fungicidal mixtures |
TW349094B (en) | 1995-09-05 | 1999-01-01 | Basf Ag | Compositions and methods for controlling harmful fungi |
TW384208B (en) * | 1995-09-22 | 2000-03-11 | Basf Ag | Compositions and methods for controlling harmful fungi |
DE19615977A1 (de) | 1996-04-22 | 1997-10-23 | Basf Ag | Mittel und Verfahren zur Bekämpfung von Schadpilzen |
-
1998
- 1998-12-15 CA CA2704256A patent/CA2704256A1/en not_active Abandoned
- 1998-12-15 HU HU0100935A patent/HUP0100935A3/hu unknown
- 1998-12-15 CZ CZ20002224A patent/CZ295592B6/cs not_active IP Right Cessation
- 1998-12-15 CN CNB988123460A patent/CN100337543C/zh not_active Expired - Lifetime
- 1998-12-15 ES ES98964520T patent/ES2187077T3/es not_active Expired - Lifetime
- 1998-12-15 AT AT98964520T patent/ATE227080T1/de active
- 1998-12-15 KR KR10-2000-7006692A patent/KR100539046B1/ko not_active IP Right Cessation
- 1998-12-15 BR BRPI9813664-0A patent/BR9813664B1/pt not_active IP Right Cessation
- 1998-12-15 PT PT98964520T patent/PT1039805E/pt unknown
- 1998-12-15 EP EP98964520A patent/EP1039805B1/de not_active Expired - Lifetime
- 1998-12-15 SK SK818-2000A patent/SK285473B6/sk not_active IP Right Cessation
- 1998-12-15 UA UA2000074341A patent/UA65600C2/uk unknown
- 1998-12-15 EA EA200000680A patent/EA004958B1/ru not_active IP Right Cessation
- 1998-12-15 DE DE59806215T patent/DE59806215D1/de not_active Expired - Lifetime
- 1998-12-15 EP EP02010311A patent/EP1228691A3/de not_active Withdrawn
- 1998-12-15 CA CA002313333A patent/CA2313333C/en not_active Expired - Fee Related
- 1998-12-15 JP JP2000524966A patent/JP4336453B2/ja not_active Expired - Fee Related
- 1998-12-15 US US09/581,905 patent/US6407126B1/en not_active Expired - Lifetime
- 1998-12-15 DK DK98964520T patent/DK1039805T3/da active
- 1998-12-15 IL IL13647498A patent/IL136474A0/xx active IP Right Grant
- 1998-12-15 PL PL341738A patent/PL191155B1/pl unknown
- 1998-12-15 WO PCT/EP1998/008225 patent/WO1999031951A2/de active IP Right Grant
- 1998-12-15 NZ NZ505624A patent/NZ505624A/xx unknown
- 1998-12-15 AU AU19684/99A patent/AU753485B2/en not_active Ceased
- 1998-12-17 ZA ZA9811561A patent/ZA9811561B/xx unknown
- 1998-12-18 AR ARP980106489A patent/AR014142A1/es active IP Right Grant
- 1998-12-18 TW TW087121220A patent/TW433980B/zh not_active IP Right Cessation
-
2000
- 2000-05-31 IL IL136474A patent/IL136474A/en not_active IP Right Cessation
-
2004
- 2004-08-19 NL NL350020C patent/NL350020I2/nl unknown
-
2009
- 2009-04-28 JP JP2009108776A patent/JP2009197017A/ja not_active Withdrawn
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR100534510B1 (ko) | 피리딘 아미드 및 클로로탈로닐 기재의 살진균제 혼합물 | |
KR100539046B1 (ko) | 피리딘 카르복사미드 기재의 살진균제 혼합물 | |
KR100558793B1 (ko) | 피리딘 카르복사미드 기재의 살진균제 혼합물 | |
KR100536150B1 (ko) | 아미드 화합물 및 아졸 기재의 살진균성 혼합물 | |
KR100558794B1 (ko) | 피리딘 카르복사미드 기재의 살진균성 혼합물 | |
KR100536148B1 (ko) | 피리딘 카르복스아미드 및 벤즈이미다졸 또는 그의 전구체기재의 살진균제 혼합물 | |
KR100536151B1 (ko) | 피리딘 아미드 및 페나리몰 기재의 살진균성 혼합물 | |
KR100536149B1 (ko) | 피리딘 아미드 및 모르폴린 유도체 또는 피페리딘 유도체기재의 살진균제 혼합물 | |
KR100534509B1 (ko) | 피리딘 카르복사미드 기재의 살진균제 혼합물 | |
MXPA00005388A (en) | Fungicide mixtures based on amide compounds and pyridine derivatives |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
E902 | Notification of reason for refusal | ||
E701 | Decision to grant or registration of patent right | ||
GRNT | Written decision to grant | ||
FPAY | Annual fee payment |
Payment date: 20121129 Year of fee payment: 8 |
|
FPAY | Annual fee payment |
Payment date: 20131127 Year of fee payment: 9 |
|
FPAY | Annual fee payment |
Payment date: 20141126 Year of fee payment: 10 |
|
FPAY | Annual fee payment |
Payment date: 20151208 Year of fee payment: 11 |
|
FPAY | Annual fee payment |
Payment date: 20161215 Year of fee payment: 12 |
|
FPAY | Annual fee payment |
Payment date: 20171204 Year of fee payment: 13 |
|
EXPY | Expiration of term |