KR101254289B1 - 치과 도재소부용 금속 합금 및 치과 보철물 - Google Patents
치과 도재소부용 금속 합금 및 치과 보철물 Download PDFInfo
- Publication number
- KR101254289B1 KR101254289B1 KR1020100117307A KR20100117307A KR101254289B1 KR 101254289 B1 KR101254289 B1 KR 101254289B1 KR 1020100117307 A KR1020100117307 A KR 1020100117307A KR 20100117307 A KR20100117307 A KR 20100117307A KR 101254289 B1 KR101254289 B1 KR 101254289B1
- Authority
- KR
- South Korea
- Prior art keywords
- metal alloy
- weight
- dental
- group
- range
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 229910001092 metal group alloy Inorganic materials 0.000 title claims abstract description 89
- 239000002670 dental porcelain Substances 0.000 title 1
- 239000000463 material Substances 0.000 title 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims abstract description 67
- 239000010931 gold Substances 0.000 claims abstract description 55
- 229910052738 indium Inorganic materials 0.000 claims abstract description 52
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims abstract description 51
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims abstract description 39
- 229910052737 gold Inorganic materials 0.000 claims abstract description 39
- 229910052763 palladium Inorganic materials 0.000 claims abstract description 26
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims abstract description 25
- 229910052709 silver Inorganic materials 0.000 claims abstract description 25
- 239000004332 silver Substances 0.000 claims abstract description 25
- 239000011351 dental ceramic Substances 0.000 claims abstract description 20
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 18
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 18
- 239000010703 silicon Substances 0.000 claims abstract description 18
- 229910052732 germanium Inorganic materials 0.000 claims abstract description 13
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims abstract description 13
- VSZWPYCFIRKVQL-UHFFFAOYSA-N selanylidenegallium;selenium Chemical compound [Se].[Se]=[Ga].[Se]=[Ga] VSZWPYCFIRKVQL-UHFFFAOYSA-N 0.000 claims abstract description 8
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims abstract description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052796 boron Inorganic materials 0.000 claims abstract description 7
- 238000010304 firing Methods 0.000 claims description 48
- 239000000919 ceramic Substances 0.000 claims description 43
- 229910010293 ceramic material Inorganic materials 0.000 claims description 24
- 239000010949 copper Substances 0.000 claims description 23
- 229910017052 cobalt Inorganic materials 0.000 claims description 15
- 239000010941 cobalt Substances 0.000 claims description 15
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 15
- 229910052802 copper Inorganic materials 0.000 claims description 14
- 239000012535 impurity Substances 0.000 claims description 14
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 13
- 239000010955 niobium Substances 0.000 claims description 13
- 239000011651 chromium Substances 0.000 claims description 12
- 239000011777 magnesium Substances 0.000 claims description 12
- 239000010936 titanium Substances 0.000 claims description 12
- 239000010948 rhodium Substances 0.000 claims description 10
- 229910052573 porcelain Inorganic materials 0.000 claims description 7
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 7
- 229910052721 tungsten Inorganic materials 0.000 claims description 7
- 239000010937 tungsten Substances 0.000 claims description 7
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 7
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 6
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052804 chromium Inorganic materials 0.000 claims description 6
- 229910052749 magnesium Inorganic materials 0.000 claims description 6
- 229910044991 metal oxide Inorganic materials 0.000 claims description 6
- 150000004706 metal oxides Chemical class 0.000 claims description 6
- 229910052750 molybdenum Inorganic materials 0.000 claims description 6
- 239000011733 molybdenum Substances 0.000 claims description 6
- 229910052758 niobium Inorganic materials 0.000 claims description 6
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 6
- 229910052715 tantalum Inorganic materials 0.000 claims description 6
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052719 titanium Inorganic materials 0.000 claims description 6
- 229910052797 bismuth Inorganic materials 0.000 claims description 5
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 5
- 229910052746 lanthanum Inorganic materials 0.000 claims description 5
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 5
- 229910052762 osmium Inorganic materials 0.000 claims description 5
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 5
- 229910052702 rhenium Inorganic materials 0.000 claims description 5
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052703 rhodium Inorganic materials 0.000 claims description 5
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 4
- 229910052741 iridium Inorganic materials 0.000 claims description 4
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052707 ruthenium Inorganic materials 0.000 claims description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 229910017604 nitric acid Inorganic materials 0.000 claims description 2
- 238000001039 wet etching Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 2
- 229910045601 alloy Inorganic materials 0.000 description 54
- 239000000956 alloy Substances 0.000 description 54
- 238000002844 melting Methods 0.000 description 29
- 230000008018 melting Effects 0.000 description 29
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 20
- 239000000654 additive Substances 0.000 description 19
- 230000000996 additive effect Effects 0.000 description 19
- 230000001965 increasing effect Effects 0.000 description 19
- 238000005275 alloying Methods 0.000 description 14
- 239000002609 medium Substances 0.000 description 12
- 239000011669 selenium Substances 0.000 description 10
- 229910052697 platinum Inorganic materials 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 238000002845 discoloration Methods 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 5
- 229910052787 antimony Inorganic materials 0.000 description 5
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- 229910052711 selenium Inorganic materials 0.000 description 5
- 229920001817 Agar Polymers 0.000 description 4
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 4
- 239000008272 agar Substances 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 229910052733 gallium Inorganic materials 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- JBQYATWDVHIOAR-UHFFFAOYSA-N tellanylidenegermanium Chemical compound [Te]=[Ge] JBQYATWDVHIOAR-UHFFFAOYSA-N 0.000 description 4
- 229910052726 zirconium Inorganic materials 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 238000004383 yellowing Methods 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- VDBJCDWTNCKRTF-UHFFFAOYSA-N 6'-hydroxyspiro[2-benzofuran-3,9'-9ah-xanthene]-1,3'-dione Chemical compound O1C(=O)C2=CC=CC=C2C21C1C=CC(=O)C=C1OC1=CC(O)=CC=C21 VDBJCDWTNCKRTF-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910001020 Au alloy Inorganic materials 0.000 description 2
- 229910000846 In alloy Inorganic materials 0.000 description 2
- 229910001252 Pd alloy Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OIQPTROHQCGFEF-UHFFFAOYSA-L chembl1371409 Chemical compound [Na+].[Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 OIQPTROHQCGFEF-UHFFFAOYSA-L 0.000 description 2
- 239000000788 chromium alloy Substances 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- NJDNXYGOVLYJHP-UHFFFAOYSA-L disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzoate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C21 NJDNXYGOVLYJHP-UHFFFAOYSA-L 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000003353 gold alloy Substances 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 229910021478 group 5 element Inorganic materials 0.000 description 2
- 229910021474 group 7 element Inorganic materials 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- 239000013642 negative control Substances 0.000 description 2
- 229910000623 nickel–chromium alloy Inorganic materials 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- UJMBCXLDXJUMFB-UHFFFAOYSA-K trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4h-pyrazole-3-carboxylate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)C1=NN(C=2C=CC(=CC=2)S([O-])(=O)=O)C(=O)C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 UJMBCXLDXJUMFB-UHFFFAOYSA-K 0.000 description 2
- 229910017060 Fe Cr Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- ATRMIFNAYHCLJR-UHFFFAOYSA-N [O].CCC Chemical compound [O].CCC ATRMIFNAYHCLJR-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 231100000215 acute (single dose) toxicity testing Toxicity 0.000 description 1
- 238000011047 acute toxicity test Methods 0.000 description 1
- 208000030961 allergic reaction Diseases 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- BBKFSSMUWOMYPI-UHFFFAOYSA-N gold palladium Chemical compound [Pd].[Au] BBKFSSMUWOMYPI-UHFFFAOYSA-N 0.000 description 1
- 229910021476 group 6 element Inorganic materials 0.000 description 1
- 229910021472 group 8 element Inorganic materials 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- -1 is increased Chemical compound 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000009766 low-temperature sintering Methods 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- PGSADBUBUOPOJS-UHFFFAOYSA-N neutral red Chemical compound Cl.C1=C(C)C(N)=CC2=NC3=CC(N(C)C)=CC=C3N=C21 PGSADBUBUOPOJS-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- SWELZOZIOHGSPA-UHFFFAOYSA-N palladium silver Chemical compound [Pd].[Ag] SWELZOZIOHGSPA-UHFFFAOYSA-N 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000009290 primary effect Effects 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- IZMJMCDDWKSTTK-UHFFFAOYSA-N quinoline yellow Chemical compound C1=CC=CC2=NC(C3C(C4=CC=CC=C4C3=O)=O)=CC=C21 IZMJMCDDWKSTTK-UHFFFAOYSA-N 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C5/00—Alloys based on noble metals
- C22C5/02—Alloys based on gold
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C5/00—Alloys based on noble metals
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C5/00—Alloys based on noble metals
- C22C5/06—Alloys based on silver
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Dental Preparations (AREA)
Abstract
Description
도 2는 실험예에 따라 전처리를 거친 후 소성하여 제조한 치과 보철물을 보여주는 사진이다.
실험예I | 합금 원소 (중량%) |
물리적 특성 | |||||
Pd | Au | Ag | In | 열팽창계수 (10-6K-1) |
용융 온도 (℃) |
색상 | |
1 | 50 | 50 | 18.41 | 803 | 황색 | ||
2 | 55 | 45 | 17.75 | 867 | 황색 | ||
3 | 60 | 40 | 17.20 | 932 | 황색 | ||
4 | 62 | 38 | 16.82 | 958 | 황색 | ||
5 | 64 | 36 | 16.44 | 984 | 황색 | ||
6 | 66 | 34 | 16.06 | 1010 | 황색 | ||
7 | 68 | 32 | 15.68 | 1036 | 황색 | ||
8 | 70 | 30 | 15.36 | 1062 | 황색 | ||
9 | 35 | 3 | 35 | 27 | 18.02 | 918 | 황색 |
10 | 39 | 6 | 35 | 20 | 17.17 | 998 | 황색 |
11 | 41 | 9 | 35 | 15 | 16.58 | 1051 | 황색 |
12 | 41 | 12 | 35 | 12 | 16.26 | 1079 | 황색 |
13 | 41 | 15 | 35 | 9 | 15.93 | 1107 | 옅은 황색 |
14 | 39 | 20 | 35 | 6 | 15.65 | 1127 | 옅은 황색 |
실험예II | 합금 원소 | 물리적 특성 | ||||||||
Au | Pd | Ag | Zn | In | Si | Ge | Zr | Co | 열팽창계수 (10-6K-1) |
|
1 | 10 | 45 | 17.5 | 0.5 | 27 | 0 | 16.96 | |||
2 | 10 | 45 | 17 | 0.5 | 27 | 0.5 | 14.90 | |||
3 | 10 | 45 | 16.5 | 0.5 | 27 | 1 | 12.94 | |||
4 | 10 | 45 | 15.5 | 0.5 | 27 | 2 | 8.80 | |||
5 | 10 | 45 | 17.5 | 0.5 | 27 | 0 | 16.96 | |||
6 | 10 | 45 | 17 | 0.5 | 27 | 0.5 | 16.04 | |||
7 | 10 | 45 | 16.5 | 0.5 | 27 | 1 | 15.13 | |||
8 | 10 | 45 | 15.5 | 0.5 | 27 | 2 | 13.19 | |||
9 | 10 | 45 | 17.5 | 0.5 | 27 | 0 | 16.96 | |||
10 | 10 | 45 | 17 | 0.5 | 27 | 0.5 | 16.41 | |||
11 | 10 | 45 | 16.5 | 0.5 | 27 | 1 | 15.66 | |||
12 | 10 | 45 | 15.5 | 0.5 | 27 | 2 | 14.36 | |||
13 | 10 | 45 | 17.5 | 0.5 | 27 | 2.5 | 16.81 | |||
14 | 10 | 45 | 17 | 0.5 | 27 | 0.5 | 2.5 | 14.81 | ||
15 | 10 | 45 | 16.5 | 0.5 | 27 | 1 | 2.5 | 14.96 | ||
16 | 10 | 45 | 15.5 | 0.5 | 27 | 2 | 2.5 | 14.31 |
실험예 III |
1군 | 2군 | 3군 | 4군 | 5군 | 6군 | 7군 | 8군 | |||||||||||||
Pd | Au | Ag | In | Zn | Ga | B | Ge | Zr | Si | Fe | Cr | Nb | Mg | Ti | Co | Al | Ta | Mo | Ir | Ru | |
1 | 잔부 | 2 | 31 | 21.5 | 0.5 | 0.1 | 0.1 | ||||||||||||||
2 | 잔부 | 2 | 31 | 20.5 | 1.4 | 0.1 | 0.1 | ||||||||||||||
3 | 잔부 | 2 | 31 | 20.9 | 1.1 | 0.1 | |||||||||||||||
4 | 잔부 | 2 | 31 | 20.5 | 1.2 | 0.4 | |||||||||||||||
5 | 잔부 | 2 | 31 | 20.5 | 1 | 0.5 | 0.1 | ||||||||||||||
6 | 잔부 | 2 | 25 | 29.5 | 2.3 | 1 | 0.1 | 0.1 | |||||||||||||
7 | 잔부 | 2 | 26 | 29.1 | 2.5 | 0.2 | 0.5 | ||||||||||||||
8 | 잔부 | 5 | 21 | 23.4 | 2 | 0.1 | 3 | 0.5 | 3.9 | 0.1 | 1 | ||||||||||
9 | 잔부 | 5 | 18 | 24.8 | 2 | 3 | 1.8 | 0.1 | 0.1 | 3.4 | 1.5 | 0.2 | 0.1 | ||||||||
10 | 잔부 | 10 | 20 | 26.0 | 2 | 1.5 | 0.4 | 0.1 | |||||||||||||
11 | 잔부 | 10 | 24 | 15.2 | 2 | 2 | 1.5 | 0.7 | 3.9 | 0.1 | 1.5 | 0.1 | |||||||||
12 | 잔부 | 5 | 30 | 17.3 | 2 | 1 | 1 | 0.1 | 2.5 | 2 | 0.1 | ||||||||||
13 | 잔부 | 3 | 29 | 19 | 2 | 0.5 | 1 | 2.0 | 0.1 | 0.5 | 0.8 | 0.1 | |||||||||
14 | 잔부 | 20 | 18 | 14 | 1.5 | 0.1 | 0.5 | 4 | 0.8 | 0.1 | |||||||||||
15 | 잔부 | 20 | 18 | 13.8 | 1 | 0.2 | 0.8 | 0.1 | 0.5 | 3.5 | 1 | 0.1 | |||||||||
16 | 잔부 | 12 | 16 | 16.8 | 1 | 4 | 1 | 0.2 | 4.0 | 2.0 | 1.8 | 0.1 | 0.1 | ||||||||
17 | 잔부 | 10 | 16 | 15 | 2 | 5 | 1.5 | 1 | 3.9 | 0.1 | 0.4 | 0.1 |
실험예 III |
물리적 특성 | ||
열팽창계수 (10-6K-1) |
용융 온도(℃) | 색상 | |
1 | 17.2 | 1013 | 황색 |
2 | 16.3 | 1021 | 황색 |
3 | 16.5 | 1026 | 황색 |
4 | 16.2 | 1030 | 황색 |
5 | 15.9 | 1035 | 황색 |
6 | 16.4 | 950 | 황색 |
7 | 16.8 | 945 | 황색 |
8 | 15.6 | 965 | 황색 |
9 | 16.2 | 951 | 황색 |
10 | 15.8 | 1037 | 황색 |
11 | 14.7 | 1037 | 황색 |
12 | 14.1 | 1033 | 황색 |
13 | 15.2 | 1047 | 황색 |
14 | 13.5 | 1129 | 황색 |
15 | 14.2 | 1124 | 황색 |
16 | 12.1 | 1140 | 황색 |
17 | 13.1 | 1098 | 황색 |
실험예IV | 1군 | 2군 | 3군 | 4군 | 5군 | 6군 | 7군 | 물리적 특성 | ||||||||
Pd | Au | Pt | Ag | In | Zn | Cu | Ga | Ge | Si | Co | 열팽창계수 (10-6K-1) |
용융온도(℃) | 소성범위 | 황색정도 | 소성변형 | |
1 | 50 | 2 | 23 | 21 | 2 | 2 | 17.03 | 1030 | 저온 | 하 | X | |||||
2 | 40 | 2 | 25 | 30 | 3 | 18.05 | 943 | X | 중 | X | ||||||
3 | 40 | 2 | 24.6 | 30 | 3 | 0.4 | 16.20 | 945 | 저온 | 중 | X | |||||
4 | 40 | 2 | 24 | 30 | 3 | 1 | 16.40 | 943 | 저온 | 중 | X | |||||
5 | 45 | 15 | 16.5 | 21 | 2 | 0.5 | 14.4 | 1070 | 고온 | 중 | O | |||||
6 | 43.8 | 10 | 0.8 | 15.7 | 24 | 0.7 | 0.6 | 3.2 | 13.90 | 1180 | 고온 | 하 | X | |||
7 | 38 | 10 | 1 | 16.6 | 28 | 0.5 | 0.5 | 2.5 | 14.90 | 1100 | 고온 | 중하 | X | |||
8 | 45 | 15 | 14.5 | 21 | 2 | 0.5 | 2 | 14.1 | 1180 | 고온 | 중하 | X | ||||
9 | 21.8 | 40 | 1 | 15.4 | 18 | 0.5 | 1 | 1 | 0.6 | 1.5 | 14.14 | 11.5 | 고온 | 상 | X | |
10 | 24.8 | 35 | 1 | 16.5 | 19 | 0.5 | 1 | 1 | 0.6 | 1.5 | 14.22 | 1110 | 고온 | 상 | X | |
11 | 24 | 30 | 1 | 20 | 20 | 0.6 | 1.6 | 1.6 | 0.6 | 2 | 14.54 | 1096 | 고온 | 중상 | X | |
12 | 35 | 17 | 0.5 | 15.5 | 27 | 0.5 | 1.6 | 1.6 | 0.6 | 2.2 | 14.89 | 1082 | 고온 | 중상 | X | |
13 | 33 | 15 | 1 | 21.9 | 24 | 0.5 | 2 | 2 | 0.6 | 1.8 | 14.86 | 1101 | 고온 | 중 | X | |
14 | 35 | 13 | 1 | 21 | 25 | 0.5 | 2 | 2 | 0.6 | 1.8 | 14.87 | 1102 | 고온 | 중 | X | |
15 | 38 | 10 | 1 | 16.6 | 28 | 0.5 | 2 | 2 | 0.6 | 2.5 | 14.90 | 1100 | 고온 | 증 | X | |
16 | 35 | 10 | 1 | 21 | 26 | 0.5 | 2.6 | 2.6 | 0.6 | 3 | 14.89 | 1099 | 고온 | 중 | X | |
17 | 38 | 6 | 1.4 | 19.2 | 28 | 0.5 | 3 | 3 | 0.6 | 3 | 14.95 | 1100 | 고온 | 중하 | X | |
18 | 14 | 60 | 1 | 6.6 | 15 | 0.5 | 2 | 0.2 | 2 | 14.98 | 1095 | 고온 | 상 | X | ||
19 | 5.8 | 84 | 0.7 | 0.5 | 8.2 | 0.3 | 0.2 | 0.03 | 0.18 | 15.03 | 1073 | 고온 | 상 | X |
Claims (20)
- 삭제
- 삭제
- 삭제
- 삭제
- 삭제
- 삭제
- 삭제
- 삭제
- 2 초과 40 중량% 이하의 금(Au);
5 내지 35 중량%의 은(Ag);
12.0 내지 28.0 중량%의 인듐(In);
0 초과 10.0 중량% 이하의 구리(Cu);
합계 0 초과 10.0 중량% 이하이고, 붕소(B), 게르마늄(Ge), 지르코늄(Zr), 실리콘(Si) 및 철(Fe)로 이루어진 군에서 선택된 적어도 하나의 원소;
합계 0 초과 10.0 중량% 이하이고, 크롬(Cr), 니오븀(Nb), 마그네슘(Mg), 티타늄(Ti), 코발트(Co), 알루미늄(Al), 바나듐(V), 탄탈륨(Ta), 몰리브덴(Mo) 및 텅스텐(W)으로 이루어진 군에서 선택된 적어도 하나의 원소;
합계 0 초과 2 중량% 이하이고, 이리듐(Ir), 레늄(Re), 로듐(Rh), 루테늄(Ru), 란탄(La), 오스뮴(Os) 및 비스무스(Bi)로 이루어진 군에서 선택된 적어도 하나의 원소; 및
잔부의 팔라듐(Pd) 및 불가피 분순물로 이루어지고,
그 열팽창계수가 13.0 x 10-6 ~ 15.2 x 10-6 K-1 범위인, 치과 도재소부용 금속 합금. - 삭제
- 삭제
- 2 초과 40 중량% 이하의 금(Au);
0 초과 35 중량% 이하의 은(Ag);
12.0 내지 28.0 중량%의 인듐(In);
5 내지 70 중량%의 팔라듐(Pd);
0 초과 10.0 중량% 이하의 구리(Cu);
합계 0 초과 5.0 중량% 이하이고, 붕소(B), 게르마늄(Ge), 지르코늄(Zr), 실리콘(Si) 및 철(Fe)로 이루어진 군에서 선택된 적어도 하나의 제 1 원소;
합계 0 초과 10.0 중량% 이하이고, 크롬(Cr), 니오븀(Nb), 마그네슘(Mg), 티타늄(Ti), 코발트(Co), 알루미늄(Al), 바나듐(V), 탄탈륨(Ta), 몰리브덴(Mo) 및 텅스텐(W)으로 이루어진 군에서 선택된 적어도 하나의 제 2 원소를 포함하고
그 열팽창계수가 13.0 x 10-6 ~ 15.2 x 10-6 K-1 범위인, 치과 도재소부용 금속 합금. - 제 12 항에 있어서, 상기 적어도 하나의 제 1 원소는 0 초과 내지 1.0 중량% 미만의 실리콘(Si)을 포함하는, 치과 도재소부용 금속 합금.
- 제 12 항에 있어서, 상기 적어도 하나의 제 2 원소는 0 내지 5.0 중량% 범위의 코발트(Co)를 포함하고, 상기 금속 합금과 세라믹 도재의 소성 온도는 900 내지 980℃ 범위를 갖는, 치과 도재소부용 금속 합금.
- 제 12 항에 있어서, 상기 적어도 하나의 제 1 원소는 0 초과 내지 1.0 중량% 미만의 실리콘(Si)을 포함하고, 상기 적어도 하나의 제 2 원소는 0 내지 5.0 중량% 범위의 코발트(Co)를 포함하는, 치과 도재소부용 금속 합금.
- 삭제
- 제 12 항에 있어서, 상기 구리(Cu)는 0 초과 내지 5.0 중량% 이하의 범위를 갖는, 치과 도재소부용 금속 합금.
- 제 9 항, 제 12 항 내지 제 15 항 및 제 17 항 중의 어느 한 항에 따른 치과 도재소부용 금속 합금을 이용하여 제조된 치과 보철물.
- 제 9 항, 제 12 항 내지 제 15 항 및 제 17 항 중의 어느 한 항에 따른 치과 도재 소부용 금속 합금을 제공하는 단계;
상기 금속 합금을 전처리하여 표면의 금속 산화물을 제거하는 단계; 및
상기 금속 합금 상에 세라믹 도재를 900 내지 980℃ 범위의 소성 온도 범위에서 접합하는 단계를 포함하는 치과 보철물의 제조방법. - 제 19 항에 있어서, 상기 금속 산화물을 제거하는 단계에서 전처리는 질산 및 불산의 수용액에서 습식 에칭법으로 진행하는, 치과 보철물의 제조방법.
Priority Applications (6)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020100117307A KR101254289B1 (ko) | 2010-11-24 | 2010-11-24 | 치과 도재소부용 금속 합금 및 치과 보철물 |
EP11786922.2A EP2578202A2 (en) | 2010-05-27 | 2011-05-26 | Metal alloy for fusion of dental ceramics, and dental prosthesis |
US13/700,363 US20130071285A1 (en) | 2010-05-27 | 2011-05-26 | Metal alloy for fusion of dental ceramics, and dental prosthesis |
JP2013512544A JP2013533377A (ja) | 2010-05-27 | 2011-05-26 | 歯科陶材焼付用金属合金及び歯科補綴物 |
PCT/KR2011/003875 WO2011149290A2 (ko) | 2010-05-27 | 2011-05-26 | 치과 도재소부용 금속 합금 및 치과 보철물 |
CN2011800353205A CN103002858A (zh) | 2010-05-27 | 2011-05-26 | 牙瓷料熔附用金属合金和牙假体 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR1020100117307A KR101254289B1 (ko) | 2010-11-24 | 2010-11-24 | 치과 도재소부용 금속 합금 및 치과 보철물 |
Publications (2)
Publication Number | Publication Date |
---|---|
KR20120055873A KR20120055873A (ko) | 2012-06-01 |
KR101254289B1 true KR101254289B1 (ko) | 2013-04-12 |
Family
ID=46608168
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1020100117307A Expired - Fee Related KR101254289B1 (ko) | 2010-05-27 | 2010-11-24 | 치과 도재소부용 금속 합금 및 치과 보철물 |
Country Status (1)
Country | Link |
---|---|
KR (1) | KR101254289B1 (ko) |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5462437A (en) * | 1993-11-10 | 1995-10-31 | Jeneric/Pentron Incorporated | Dental alloys for composite and porcelain overlays |
JP2007063630A (ja) * | 2005-08-31 | 2007-03-15 | Ishifuku Metal Ind Co Ltd | 歯科陶材焼付用銀パラジウム合金 |
-
2010
- 2010-11-24 KR KR1020100117307A patent/KR101254289B1/ko not_active Expired - Fee Related
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5462437A (en) * | 1993-11-10 | 1995-10-31 | Jeneric/Pentron Incorporated | Dental alloys for composite and porcelain overlays |
JP2007063630A (ja) * | 2005-08-31 | 2007-03-15 | Ishifuku Metal Ind Co Ltd | 歯科陶材焼付用銀パラジウム合金 |
Also Published As
Publication number | Publication date |
---|---|
KR20120055873A (ko) | 2012-06-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
JP2013533377A (ja) | 歯科陶材焼付用金属合金及び歯科補綴物 | |
EP1842934B1 (en) | Heat-resistant superalloy | |
EP2503013B1 (en) | Heat-resistant superalloy | |
EP2826877B1 (en) | Hot-forgeable Nickel-based superalloy excellent in high temperature strength | |
EP2778241B1 (en) | Heat-resistant nickel-based superalloy | |
EP1867740B1 (en) | Low thermal expansion Ni-base superalloy | |
EP2430204B1 (en) | Nickel based alloy useful for valve seat inserts | |
EP2045345B1 (en) | A nickel based superalloy | |
KR101434583B1 (ko) | 치과 주조용 금속 합금 및 치과 보철물 | |
KR20000029801A (ko) | 경질소결합금 | |
EP3719152B1 (en) | Ni-based alloy for hot working die, and hot forging die using same | |
EP3561093B1 (en) | Ni-based heat-resistant alloy | |
EP3031938A1 (en) | Cobalt - nickel alloy | |
CN116888288B (zh) | 具有奥氏体组织结构的钢以及这种钢在人类或动物口腔中的应用 | |
KR101254289B1 (ko) | 치과 도재소부용 금속 합금 및 치과 보철물 | |
KR101911280B1 (ko) | Co-Cr-Nb계 치과용 주조 합금 | |
KR101191987B1 (ko) | 치과 도재소부용 금속 합금 및 치과 보철물 | |
CN103205594B (zh) | 牙科用钯银合金材料 | |
KR101346808B1 (ko) | 기계적 성질이 개선된 티타늄 합금 및 이의 제조방법 | |
KR101634132B1 (ko) | 분말 야금법(pm)에 대한 치과용 보철물 성형재료 제조방법 | |
KR100329822B1 (ko) | 금속-자기질용 치과 귀금속 합금 | |
KR20170002067A (ko) | 접합 특성이 우수한 니켈-크롬-코발트계 치과주조용 합금 | |
EP3561094B1 (en) | Ni-based heat-resistant alloy | |
KR100592523B1 (ko) | 치과보철용 합금조성물 | |
KR101181491B1 (ko) | 치과 보철물용 합금 조성물 및 치과 보철물의 제조방법 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
A201 | Request for examination | ||
PA0109 | Patent application |
Patent event code: PA01091R01D Comment text: Patent Application Patent event date: 20101124 |
|
PA0201 | Request for examination | ||
PG1501 | Laying open of application | ||
E902 | Notification of reason for refusal | ||
PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20120702 Patent event code: PE09021S01D |
|
E701 | Decision to grant or registration of patent right | ||
PE0701 | Decision of registration |
Patent event code: PE07011S01D Comment text: Decision to Grant Registration Patent event date: 20130304 |
|
GRNT | Written decision to grant | ||
PR0701 | Registration of establishment |
Comment text: Registration of Establishment Patent event date: 20130408 Patent event code: PR07011E01D |
|
PR1002 | Payment of registration fee |
Payment date: 20130409 End annual number: 3 Start annual number: 1 |
|
PG1601 | Publication of registration | ||
FPAY | Annual fee payment |
Payment date: 20131205 Year of fee payment: 5 |
|
PR1001 | Payment of annual fee |
Payment date: 20131205 Start annual number: 4 End annual number: 5 |
|
LAPS | Lapse due to unpaid annual fee | ||
PC1903 | Unpaid annual fee |
Termination category: Default of registration fee Termination date: 20190119 |