JPS6349689B2 - - Google Patents
Info
- Publication number
- JPS6349689B2 JPS6349689B2 JP54044422A JP4442279A JPS6349689B2 JP S6349689 B2 JPS6349689 B2 JP S6349689B2 JP 54044422 A JP54044422 A JP 54044422A JP 4442279 A JP4442279 A JP 4442279A JP S6349689 B2 JPS6349689 B2 JP S6349689B2
- Authority
- JP
- Japan
- Prior art keywords
- acrylic
- small amounts
- methacrylic acid
- copolymerized
- ethyl acrylate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000178 monomer Substances 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 17
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 11
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 229920000058 polyacrylate Polymers 0.000 claims description 10
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 9
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 9
- 229920000800 acrylic rubber Polymers 0.000 claims description 9
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 9
- 238000006116 polymerization reaction Methods 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 claims description 5
- 150000001735 carboxylic acids Chemical class 0.000 claims description 5
- 125000003700 epoxy group Chemical group 0.000 claims description 5
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- DNJRKFKAFWSXSE-UHFFFAOYSA-N 1-chloro-2-ethenoxyethane Chemical compound ClCCOC=C DNJRKFKAFWSXSE-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- VMBJJCDVORDOCF-UHFFFAOYSA-N prop-2-enyl 2-chloroacetate Chemical compound ClCC(=O)OCC=C VMBJJCDVORDOCF-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 description 17
- 238000004073 vulcanization Methods 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 229920001971 elastomer Polymers 0.000 description 6
- 239000000806 elastomer Substances 0.000 description 6
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- 150000004291 polyenes Chemical class 0.000 description 4
- WHBAYNMEIXUTJV-UHFFFAOYSA-N 2-chloroethyl prop-2-enoate Chemical compound ClCCOC(=O)C=C WHBAYNMEIXUTJV-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- LEJBBGNFPAFPKQ-UHFFFAOYSA-N 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOC(=O)C=C LEJBBGNFPAFPKQ-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 241001441571 Hiodontidae Species 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Chemical compound CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical compound C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- -1 vinyl alpha chloropropionate Chemical compound 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- PPUZXOKAOIOPIE-UHFFFAOYSA-N 1-bromo-2-ethenoxyethane Chemical compound BrCCOC=C PPUZXOKAOIOPIE-UHFFFAOYSA-N 0.000 description 1
- LQZDDWKUQKQXGC-UHFFFAOYSA-N 2-(2-methylprop-2-enoxymethyl)oxirane Chemical compound CC(=C)COCC1CO1 LQZDDWKUQKQXGC-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- JJRUAPNVLBABCN-UHFFFAOYSA-N 2-(ethenoxymethyl)oxirane Chemical compound C=COCC1CO1 JJRUAPNVLBABCN-UHFFFAOYSA-N 0.000 description 1
- DUERRGNERQTBAB-UHFFFAOYSA-N 2-(oxiran-2-ylmethyl)prop-2-enoic acid Chemical compound OC(=O)C(=C)CC1CO1 DUERRGNERQTBAB-UHFFFAOYSA-N 0.000 description 1
- OXSSBGISRIDMME-UHFFFAOYSA-N 3-bromopropyl prop-2-enoate Chemical compound BrCCCOC(=O)C=C OXSSBGISRIDMME-UHFFFAOYSA-N 0.000 description 1
- KWCPPCKBBRBYEE-UHFFFAOYSA-N 3-chloropropyl prop-2-enoate Chemical compound ClCCCOC(=O)C=C KWCPPCKBBRBYEE-UHFFFAOYSA-N 0.000 description 1
- MSZCRKZKNKSJNU-UHFFFAOYSA-N 4-chlorobutyl prop-2-enoate Chemical compound ClCCCCOC(=O)C=C MSZCRKZKNKSJNU-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- 241000357292 Monodactylus Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- STZUMARNGFQGPH-UHFFFAOYSA-N chloromethoxyethene Chemical compound ClCOC=C STZUMARNGFQGPH-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- DFEHSFZILGOAJK-UHFFFAOYSA-N ethenyl 2-bromoacetate Chemical compound BrCC(=O)OC=C DFEHSFZILGOAJK-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229940114930 potassium stearate Drugs 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- ANBFRLKBEIFNQU-UHFFFAOYSA-M potassium;octadecanoate Chemical compound [K+].CCCCCCCCCCCCCCCCCC([O-])=O ANBFRLKBEIFNQU-UHFFFAOYSA-M 0.000 description 1
- MUWVIMJPXKIXJK-UHFFFAOYSA-N prop-2-enyl 2-bromoacetate Chemical compound BrCC(=O)OCC=C MUWVIMJPXKIXJK-UHFFFAOYSA-N 0.000 description 1
- LYBIZMNPXTXVMV-UHFFFAOYSA-N propan-2-yl prop-2-enoate Chemical compound CC(C)OC(=O)C=C LYBIZMNPXTXVMV-UHFFFAOYSA-N 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 102220047090 rs6152 Human genes 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F220/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride ester, amide, imide or nitrile thereof
- C08F220/02—Monocarboxylic acids having less than ten carbon atoms; Derivatives thereof
- C08F220/10—Esters
- C08F220/12—Esters of monohydric alcohols or phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT22324/78A IT1095389B (it) | 1978-04-14 | 1978-04-14 | Procedimento per la preparazione di elastomeri acrilici vulcanizzaeili |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS54138093A JPS54138093A (en) | 1979-10-26 |
| JPS6349689B2 true JPS6349689B2 (enExample) | 1988-10-05 |
Family
ID=11194681
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4442279A Granted JPS54138093A (en) | 1978-04-14 | 1979-04-13 | Preparation of vulcanizable acrylelastomer * and vulcanizablacrylelastomers therefrom |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4237258A (enExample) |
| JP (1) | JPS54138093A (enExample) |
| BE (1) | BE875568A (enExample) |
| CA (1) | CA1130497A (enExample) |
| DE (1) | DE2914841A1 (enExample) |
| ES (1) | ES479523A1 (enExample) |
| FR (1) | FR2422693A1 (enExample) |
| GB (1) | GB2018787B (enExample) |
| IT (1) | IT1095389B (enExample) |
| NL (1) | NL185719C (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59168013A (ja) * | 1983-03-15 | 1984-09-21 | Nippon Zeon Co Ltd | アクリルゴム及びその製造方法 |
| CA1260194A (en) * | 1984-03-28 | 1989-09-26 | Japan Synthetic Rubber Co Ltd | MULTI-COMPONENT COPOLYMER RUBBER, ITS PRODUCTION, AND PRODUCT SO OBTAINED |
| US9550842B2 (en) * | 2012-11-21 | 2017-01-24 | Denka Company Limited | Acrylic elastomer, acrylic elastomer composition, laminate, crosslinked product, and molded article |
| CN108794692B (zh) * | 2018-07-05 | 2020-11-17 | 南京林业大学 | 一种制备高断裂伸长率丙烯酸酯弹性体的方法 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1042754A (enExample) * | 1962-06-19 | |||
| US3288763A (en) * | 1963-06-04 | 1966-11-29 | American Cyanamid Co | Alkyl halides in vulcanization of elastomers |
| US3317491A (en) * | 1964-06-05 | 1967-05-02 | Thiokol Chemical Corp | Novel crude rubbers containing metal oxide cure agents, process for curing such compositions, and vulcanizates obtained thereby |
| CA868993A (en) * | 1966-01-17 | 1971-04-20 | Polymer Corporation Limited | Rubbery polymer composition |
| US3488331A (en) * | 1968-05-06 | 1970-01-06 | Goodrich Co B F | Polymers of alkoxy alkyl acrylates,alkyl acrylates and vinyl or allyl chloroacetate |
| US3624058A (en) * | 1968-05-06 | 1971-11-30 | Goodrich Co B F | Polymers of vulcanizable alkyl esters of acrylic acid and allyl chloroacetate |
| DE1795185A1 (de) * | 1968-08-20 | 1972-01-20 | Bayer Ag | Waermevulkanisierbare Acrylatcopolymerisate |
| BE758148A (fr) * | 1969-10-29 | 1971-04-28 | American Cyanamid Co | Composition vulcanisable d'elastomere acrylique |
| BE795347A (fr) * | 1972-03-29 | 1973-05-29 | Mona Industries Inc | Bain d'attaque de cliches d'impression |
| US4056497A (en) * | 1972-05-15 | 1977-11-01 | Hoechst Aktiengesellschaft | Acrylic ester copolymers capable of being cross-linked |
| US3912672A (en) * | 1972-07-18 | 1975-10-14 | Goodrich Co B F | Acrylate rubber vulcanizable compositions |
| US3976610A (en) * | 1974-03-21 | 1976-08-24 | The B. F. Goodrich Company | Acrylate rubber vulcanizable compositions |
| JPS5341335A (en) * | 1976-09-28 | 1978-04-14 | Nippon Synthetic Chem Ind Co Ltd:The | Emulsion for tackifier |
-
1978
- 1978-04-14 IT IT22324/78A patent/IT1095389B/it active
-
1979
- 1979-04-10 NL NLAANVRAGE7902827,A patent/NL185719C/xx not_active IP Right Cessation
- 1979-04-11 ES ES479523A patent/ES479523A1/es not_active Expired
- 1979-04-11 DE DE19792914841 patent/DE2914841A1/de active Granted
- 1979-04-12 GB GB7913105A patent/GB2018787B/en not_active Expired
- 1979-04-12 CA CA325,468A patent/CA1130497A/en not_active Expired
- 1979-04-12 FR FR7909321A patent/FR2422693A1/fr active Granted
- 1979-04-13 BE BE0/194593A patent/BE875568A/xx not_active IP Right Cessation
- 1979-04-13 JP JP4442279A patent/JPS54138093A/ja active Granted
- 1979-04-13 US US06/029,940 patent/US4237258A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2914841A1 (de) | 1979-10-25 |
| ES479523A1 (es) | 1980-01-16 |
| FR2422693B1 (enExample) | 1983-12-23 |
| US4237258A (en) | 1980-12-02 |
| NL185719C (nl) | 1990-07-02 |
| FR2422693A1 (fr) | 1979-11-09 |
| NL7902827A (nl) | 1979-10-16 |
| JPS54138093A (en) | 1979-10-26 |
| BE875568A (fr) | 1979-10-15 |
| DE2914841C2 (enExample) | 1989-06-01 |
| GB2018787B (en) | 1982-07-21 |
| CA1130497A (en) | 1982-08-24 |
| GB2018787A (en) | 1979-10-24 |
| IT7822324A0 (it) | 1978-04-14 |
| IT1095389B (it) | 1985-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3201373A (en) | Synthetic chlorine containing rubberacrylate type polymers | |
| US2431374A (en) | Copolymers of diallyl maleate and saturated monohydric alcohol esters of maleic and fumaric acids | |
| US2529867A (en) | Copolymers of vinyl esters of aliphatic acids with dialkenylcarbonate esters of alkylene bis-phenols | |
| US3141870A (en) | Heterogeneous copolymers of ethylene-acrylic esters | |
| JPS6349689B2 (enExample) | ||
| US3230203A (en) | Process for the manufacture of copolymers of vinyl chloride | |
| CA2047967C (en) | Crosslinkable acrylic rubber and method for producing the same | |
| US4746705A (en) | Vinyl chloride polymer composition containing (meth)acrylate-alpha methyl styrene copolymer | |
| US2514786A (en) | Diallyloxyalkyl maleates | |
| US4129714A (en) | Ethylene copolymers and terpolymers containing vinyl esters of tertiary acids | |
| US2877208A (en) | Acrylate monomers and polymers of tetrahydropyran methyl alcohol | |
| US3312677A (en) | Interpolymers of lower alkyl acrylate esters, olefin-epoxide monomers and polyene monomers | |
| RU2385326C2 (ru) | Применение функционализованных кислотными группами твердых смол на основе сополимеров винилацетата в качестве добавки для снижения усадки | |
| US2579079A (en) | Interpolymers of mono-2-alkenyl ethers of saturated monohydric alcohols or phenols with esters of saturated monohydric alcohols or phenols and alpha-unsat-urated aliphatic carboxylic acids | |
| US2419122A (en) | Copolymers of alkyl aconitates and vinyl chloride | |
| JP3156403B2 (ja) | アクリル系共重合ゴムの製造法およびその組成物 | |
| US3442844A (en) | Terpolymer latex and process | |
| EP0343525A2 (en) | Elastomer composition | |
| US3268485A (en) | Polymers of 3-(2-hydroxyalkyl) oxazolidinone acrylates and methacrylates | |
| US4284740A (en) | Acrylate copolymers grafted onto a polar, water-soluble backbone polymer | |
| US3335118A (en) | Crude rubbers, vulcanizates and process | |
| KR100260374B1 (ko) | 가공성이 우수한 염화비닐계 수지의 제조 방법 | |
| JP3877855B2 (ja) | 酢酸ビニル系樹脂エマルジョンの製造方法 | |
| US3047549A (en) | Binary vinyl chloride copolymers | |
| US3022278A (en) | Vinylidene halide polymer synthesis |