JPS6229422B2 - - Google Patents
Info
- Publication number
- JPS6229422B2 JPS6229422B2 JP52046689A JP4668977A JPS6229422B2 JP S6229422 B2 JPS6229422 B2 JP S6229422B2 JP 52046689 A JP52046689 A JP 52046689A JP 4668977 A JP4668977 A JP 4668977A JP S6229422 B2 JPS6229422 B2 JP S6229422B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- phenoxybenzyl
- acid
- groups
- cyclopropyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 methylenedioxy group Chemical group 0.000 claims description 31
- 150000002148 esters Chemical class 0.000 claims description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000002917 insecticide Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000218 acetic acid group Chemical class C(C)(=O)* 0.000 claims description 4
- 229960003424 phenylacetic acid Drugs 0.000 claims description 4
- 239000003279 phenylacetic acid Substances 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000000524 functional group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 21
- 239000002253 acid Substances 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000000034 method Methods 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 241000238631 Hexapoda Species 0.000 description 12
- 230000000749 insecticidal effect Effects 0.000 description 11
- 241001608567 Phaedon cochleariae Species 0.000 description 10
- 231100000419 toxicity Toxicity 0.000 description 10
- 230000001988 toxicity Effects 0.000 description 10
- 231100000916 relative toxicity Toxicity 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 241000251468 Actinopterygii Species 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 235000011054 acetic acid Nutrition 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 241000255925 Diptera Species 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 231100000331 toxic Toxicity 0.000 description 4
- 230000002588 toxic effect Effects 0.000 description 4
- OPSFCTBBDIDFJM-UHFFFAOYSA-N (4-chlorophenyl)-cyclopropylmethanone Chemical compound C1=CC(Cl)=CC=C1C(=O)C1CC1 OPSFCTBBDIDFJM-UHFFFAOYSA-N 0.000 description 3
- NPJNVZMBQOIXFG-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-cyclopropylacetaldehyde Chemical compound C1=CC(Cl)=CC=C1C(C=O)C1CC1 NPJNVZMBQOIXFG-UHFFFAOYSA-N 0.000 description 3
- FCBCYACIDMQJTN-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-cyclopropylacetic acid Chemical compound C=1C=C(Cl)C=CC=1C(C(=O)O)C1CC1 FCBCYACIDMQJTN-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- PJRHFTYXYCVOSJ-UHFFFAOYSA-N cyclopropyl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1CC1 PJRHFTYXYCVOSJ-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- ZCVAOQKBXKSDMS-AQYZNVCMSA-N (+)-trans-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-AQYZNVCMSA-N 0.000 description 2
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 description 2
- OTUUNQCLWRFRSL-UHFFFAOYSA-N 2-cyclopropyl-2-phenylacetaldehyde Chemical compound C=1C=CC=CC=1C(C=O)C1CC1 OTUUNQCLWRFRSL-UHFFFAOYSA-N 0.000 description 2
- PYBNWSBTADSMIW-UHFFFAOYSA-N 2-cyclopropyl-2-phenylacetic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)C1CC1 PYBNWSBTADSMIW-UHFFFAOYSA-N 0.000 description 2
- 241000254032 Acrididae Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000252212 Danio rerio Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229940024113 allethrin Drugs 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000000039 congener Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 150000004694 iodide salts Chemical group 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- ZWWGZYWBHPVKBP-UHFFFAOYSA-N (2-bromophenyl)-cyclopropylmethanone Chemical compound BrC1=CC=CC=C1C(=O)C1CC1 ZWWGZYWBHPVKBP-UHFFFAOYSA-N 0.000 description 1
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical group OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 1
- BEZHHWRIYIFYCE-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)-2-cyclopropylacetic acid Chemical compound C=1C=C2OCOC2=CC=1C(C(=O)O)C1CC1 BEZHHWRIYIFYCE-UHFFFAOYSA-N 0.000 description 1
- HWVVDKCGEPNFRN-UHFFFAOYSA-N 2-(4-bromophenyl)-2-cyclopropylacetic acid Chemical compound C=1C=C(Br)C=CC=1C(C(=O)O)C1CC1 HWVVDKCGEPNFRN-UHFFFAOYSA-N 0.000 description 1
- LOZRFZWVKPDJLH-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-(2-methylcyclopropyl)acetic acid Chemical compound CC1CC1C(C(O)=O)C1=CC=C(Cl)C=C1 LOZRFZWVKPDJLH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- KVQJVAOMYWTLEO-UHFFFAOYSA-N 2-chlorobutanoyl chloride Chemical compound CCC(Cl)C(Cl)=O KVQJVAOMYWTLEO-UHFFFAOYSA-N 0.000 description 1
- QPBNENYEHUQVDF-UHFFFAOYSA-N 2-cyclopropyl-2-(3,4-dimethylphenyl)acetic acid Chemical compound C1=C(C)C(C)=CC=C1C(C(O)=O)C1CC1 QPBNENYEHUQVDF-UHFFFAOYSA-N 0.000 description 1
- UPGCYEWIYDIICX-UHFFFAOYSA-N 2-cyclopropyl-2-(4-ethylphenyl)acetic acid Chemical compound C1=CC(CC)=CC=C1C(C(O)=O)C1CC1 UPGCYEWIYDIICX-UHFFFAOYSA-N 0.000 description 1
- QTCCKBVMVULFQI-UHFFFAOYSA-N 2-cyclopropyl-2-(4-fluorophenyl)acetic acid Chemical compound C=1C=C(F)C=CC=1C(C(=O)O)C1CC1 QTCCKBVMVULFQI-UHFFFAOYSA-N 0.000 description 1
- WBFXOVCUTNVXQE-UHFFFAOYSA-N 2-cyclopropyl-2-(4-methylphenyl)acetic acid Chemical compound C1=CC(C)=CC=C1C(C(O)=O)C1CC1 WBFXOVCUTNVXQE-UHFFFAOYSA-N 0.000 description 1
- KVVDRQDTODKIJD-UHFFFAOYSA-N 2-cyclopropylacetic acid Chemical compound OC(=O)CC1CC1 KVVDRQDTODKIJD-UHFFFAOYSA-N 0.000 description 1
- GXUQMKBQDGPMKZ-UHFFFAOYSA-N 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile Chemical group N#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GXUQMKBQDGPMKZ-UHFFFAOYSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- XNRCGJVOJYKMSA-UHFFFAOYSA-N 5-[bis[2-(2-butoxyethoxy)ethoxy]methyl]-1,3-benzodioxole Chemical compound CCCCOCCOCCOC(OCCOCCOCCCC)C1=CC=C2OCOC2=C1 XNRCGJVOJYKMSA-UHFFFAOYSA-N 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- LUMDPGWEAWOYRY-UHFFFAOYSA-N [cyano-(3-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-2-cyclopropylacetate Chemical compound C1=CC(Cl)=CC=C1C(C(=O)OC(C#N)C=1C=C(OC=2C=CC=CC=2)C=CC=1)C1CC1 LUMDPGWEAWOYRY-UHFFFAOYSA-N 0.000 description 1
- OWZREIFADZCYQD-UHFFFAOYSA-N [cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical class CC1(C)C(C=C(Br)Br)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-UHFFFAOYSA-N 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 150000003998 acyclic ketones Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000010441 alabaster Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical group OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical group CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- VTIRXONSPGSLQR-UHFFFAOYSA-N cyclopropyl-(2-ethylphenyl)methanone Chemical compound CCC1=CC=CC=C1C(=O)C1CC1 VTIRXONSPGSLQR-UHFFFAOYSA-N 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- DKWOHBPRFZIUQL-UHFFFAOYSA-N dimethyl-methylidene-oxo-$l^{6}-sulfane Chemical compound C[S+](C)([CH2-])=O DKWOHBPRFZIUQL-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- BPLKQGGAXWRFOE-UHFFFAOYSA-M trimethylsulfoxonium iodide Chemical compound [I-].C[S+](C)(C)=O BPLKQGGAXWRFOE-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/57—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom
- C07C45/58—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom in three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/08—Compounds containing oxirane rings with hydrocarbon radicals, substituted by halogen atoms, nitro radicals or nitroso radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/48—Compounds containing oxirane rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB16234/76A GB1580193A (en) | 1976-04-22 | 1976-04-22 | Phenyl acetic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52131563A JPS52131563A (en) | 1977-11-04 |
| JPS6229422B2 true JPS6229422B2 (US07714131-20100511-C00038.png) | 1987-06-25 |
Family
ID=10073617
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4668977A Granted JPS52131563A (en) | 1976-04-22 | 1977-04-21 | Phenyl acetate derivatives |
Country Status (8)
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4220591A (en) * | 1975-11-26 | 1980-09-02 | Commonwealth Scientific And Industrial Research Organization | Insecticidal esters |
| US4215138A (en) * | 1977-12-27 | 1980-07-29 | Nissan Chemical Industries, Ltd. | Insecticidal compounds of phenylcyclopropane carboxylic acid esters |
| DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
| US4264624A (en) * | 1978-06-26 | 1981-04-28 | Ciba-Geigy Corporation | Pesticidal 3-phenoxybenzyl α-cyclopropyl α-phenyl-acetates |
| EP0006630A1 (de) * | 1978-07-03 | 1980-01-09 | Ciba-Geigy Ag | Alpha-phenyl-alpha-cyclopropylacetate, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung |
| US4284643A (en) * | 1978-08-28 | 1981-08-18 | Bayer Aktiengesellschaft | Combating arthropods with novel fluorine-containing phenylacetic acid esters |
| JPS57106617A (en) * | 1980-12-23 | 1982-07-02 | Sankyo Co Ltd | Analgesic and anti-inflammatory agent |
| EP0291626A3 (en) | 1982-11-22 | 1989-05-31 | E.I. Du Pont De Nemours And Company | Process for the preparation of optically-active cyanomethyl esters |
| US5194636A (en) * | 1990-06-13 | 1993-03-16 | Bayer Aktiengesellschaft | Preparation of benzyl ketones and an oxirane |
| US6770463B2 (en) | 2000-08-03 | 2004-08-03 | Basf Aktiengesellschaft | Process for the preparation of chiral isofluoroenes |
| JP7220954B2 (ja) * | 2019-06-07 | 2023-02-13 | 大日本除蟲菊株式会社 | エステル化合物及びその用途 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3786085A (en) * | 1969-09-17 | 1974-01-15 | Ciba Geigy Corp | Aryl substituted cycloaliphatic acids |
| US3880916A (en) * | 1969-09-17 | 1975-04-29 | Ciba Geigy Corp | Cycloaliphatic acids |
| US4016179A (en) * | 1972-07-11 | 1977-04-05 | Sumitomo Chemical Co | Certain esters of 2-substituted-4-hydroxy-cyclopent-2-enones |
| EG11383A (en) * | 1972-07-11 | 1979-03-31 | Sumitomo Chemical Co | Novel composition for controlling nixious insects and process for preparing thereof |
| GB1437987A (US07714131-20100511-C00038.png) * | 1973-10-08 | 1976-06-03 |
-
1976
- 1976-04-22 GB GB16234/76A patent/GB1580193A/en not_active Expired
-
1977
- 1977-04-19 NL NL7704252A patent/NL7704252A/xx not_active Application Discontinuation
- 1977-04-20 US US05/789,226 patent/US4137324A/en not_active Expired - Lifetime
- 1977-04-20 EG EG234/77A patent/EG17593A/xx active
- 1977-04-20 DE DE19772717414 patent/DE2717414A1/de active Granted
- 1977-04-21 FR FR7712082A patent/FR2348919A1/fr active Granted
- 1977-04-21 TR TR19900A patent/TR19900A/xx unknown
- 1977-04-21 JP JP4668977A patent/JPS52131563A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52131563A (en) | 1977-11-04 |
| EG17593A (en) | 1990-12-30 |
| FR2348919B1 (US07714131-20100511-C00038.png) | 1982-07-16 |
| US4137324A (en) | 1979-01-30 |
| NL7704252A (nl) | 1977-10-25 |
| DE2717414A1 (de) | 1977-11-03 |
| TR19900A (tr) | 1980-04-21 |
| GB1580193A (en) | 1980-11-26 |
| FR2348919A1 (fr) | 1977-11-18 |
| DE2717414C2 (US07714131-20100511-C00038.png) | 1987-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0355442B2 (US07714131-20100511-C00038.png) | ||
| US4024163A (en) | Insecticides | |
| DE2547534C2 (de) | Cyclopropancarbonsäureester, Verfahren zu deren Herstellung und deren Verwendung | |
| JPH0212942B2 (US07714131-20100511-C00038.png) | ||
| US3981903A (en) | Cyclopropane carboxylic acid esters | |
| JP3286323B2 (ja) | 農薬用フルオロオレフィン類 | |
| JPS6229422B2 (US07714131-20100511-C00038.png) | ||
| RU1811368C (ru) | Способ борьбы с вредными насекомыми | |
| US4000181A (en) | α-Cyano-phenoxybenzyl cyclopropane carboxylate insecticides | |
| US4622337A (en) | 2,2-dimethyl-3-(2-halovinyl)cyclopropane carboxlic acid ester pesticides | |
| JPH036122B2 (US07714131-20100511-C00038.png) | ||
| JPH0372053B2 (US07714131-20100511-C00038.png) | ||
| US4464391A (en) | Pesticides | |
| US4522749A (en) | Process for augmenting or enhancing the aroma of a fragrance by adding a vinylcyclopropane compound | |
| JPS5851922B2 (ja) | サツチユウザイ オヨビ ソノセイゾウホウ | |
| JPS63132860A (ja) | シクロプロパン化合物、その製造法及びそれを含有する殺虫組成物 | |
| KR820000803B1 (ko) | 2,2-디메틸-시클로프로판 카복실산의 에스테르의 제조방법 | |
| BE883271R (fr) | Nouveaux pyrethroides | |
| GB1602646A (en) | Cyclopropane carboxylic acid derivatives | |
| FI65229C (fi) | Mellanprodukt foer framstaellning av en ester av cyklopropankarboxylsyra anvaendning av denna produkt och foerfarande foerdess framstaellning | |
| GB2157694A (en) | Benzyl alcohol derivatives useful in the preparation of pesticidal esters | |
| JPS5823646A (ja) | 殺虫剤に関する改良 | |
| JPH0122254B2 (US07714131-20100511-C00038.png) | ||
| CH507896A (fr) | Procédé de préparation d'esters d'acides cyclopropane-carboxyliques | |
| GB2034301A (en) | 3-Phenoxybenzyl 1R, cis-2,2- dimethyl-3-(2-chloro-prop-1- enyl)cyclopropane Carboxylate |
