JPS6118735B2 - - Google Patents
Info
- Publication number
- JPS6118735B2 JPS6118735B2 JP51130769A JP13076976A JPS6118735B2 JP S6118735 B2 JPS6118735 B2 JP S6118735B2 JP 51130769 A JP51130769 A JP 51130769A JP 13076976 A JP13076976 A JP 13076976A JP S6118735 B2 JPS6118735 B2 JP S6118735B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- silver
- carbon atoms
- substituted
- atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 2-substituted vinyl group Chemical group 0.000 claims description 85
- 239000000463 material Substances 0.000 claims description 71
- 125000004432 carbon atom Chemical group C* 0.000 claims description 51
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 40
- 239000003638 chemical reducing agent Substances 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 29
- IJAPPYDYQCXOEF-UHFFFAOYSA-N phthalazin-1(2H)-one Chemical compound C1=CC=C2C(=O)NN=CC2=C1 IJAPPYDYQCXOEF-UHFFFAOYSA-N 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 125000005843 halogen group Chemical group 0.000 claims description 17
- 239000011941 photocatalyst Substances 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 7
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- 229910052709 silver Inorganic materials 0.000 description 66
- 239000004332 silver Substances 0.000 description 65
- 238000000034 method Methods 0.000 description 29
- 150000003378 silver Chemical class 0.000 description 27
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 22
- 150000001875 compounds Chemical class 0.000 description 21
- 239000000975 dye Substances 0.000 description 20
- 238000000576 coating method Methods 0.000 description 19
- 239000000123 paper Substances 0.000 description 17
- 239000011248 coating agent Substances 0.000 description 16
- 230000018109 developmental process Effects 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000011230 binding agent Substances 0.000 description 9
- UKMSUNONTOPOIO-UHFFFAOYSA-N docosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCC(O)=O UKMSUNONTOPOIO-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000839 emulsion Substances 0.000 description 8
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- AQRYNYUOKMNDDV-UHFFFAOYSA-M silver behenate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCCCCCC([O-])=O AQRYNYUOKMNDDV-UHFFFAOYSA-M 0.000 description 8
- 238000003860 storage Methods 0.000 description 8
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 230000001235 sensitizing effect Effects 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
- 108010010803 Gelatin Proteins 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 6
- 229920000159 gelatin Polymers 0.000 description 6
- 239000008273 gelatin Substances 0.000 description 6
- 235000019322 gelatine Nutrition 0.000 description 6
- 235000011852 gelatine desserts Nutrition 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 6
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 230000007423 decrease Effects 0.000 description 5
- 230000006866 deterioration Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000004815 dispersion polymer Substances 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 4
- 235000021357 Behenic acid Nutrition 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000004372 Polyvinyl alcohol Substances 0.000 description 4
- 241001061127 Thione Species 0.000 description 4
- 235000010323 ascorbic acid Nutrition 0.000 description 4
- 229940116226 behenic acid Drugs 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 125000001624 naphthyl group Chemical group 0.000 description 4
- 150000002894 organic compounds Chemical class 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 description 4
- 238000007639 printing Methods 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 206010034972 Photosensitivity reaction Diseases 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229960005070 ascorbic acid Drugs 0.000 description 3
- 239000011668 ascorbic acid Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000004676 glycans Chemical class 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 150000004780 naphthols Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 230000036211 photosensitivity Effects 0.000 description 3
- 125000005543 phthalimide group Chemical class 0.000 description 3
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 3
- 235000013824 polyphenols Nutrition 0.000 description 3
- 229920001282 polysaccharide Polymers 0.000 description 3
- 239000005017 polysaccharide Substances 0.000 description 3
- 229910001961 silver nitrate Inorganic materials 0.000 description 3
- MNMYRUHURLPFQW-UHFFFAOYSA-M silver;dodecanoate Chemical compound [Ag+].CCCCCCCCCCCC([O-])=O MNMYRUHURLPFQW-UHFFFAOYSA-M 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 239000004408 titanium dioxide Substances 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- 239000011787 zinc oxide Substances 0.000 description 3
- UXTZUUVTGMDXNG-UHFFFAOYSA-N 1,2-benzoxazine-3,4-dione Chemical class C1=CC=C2C(=O)C(=O)NOC2=C1 UXTZUUVTGMDXNG-UHFFFAOYSA-N 0.000 description 2
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 2
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 2
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- UGWULZWUXSCWPX-UHFFFAOYSA-N 2-sulfanylideneimidazolidin-4-one Chemical class O=C1CNC(=S)N1 UGWULZWUXSCWPX-UHFFFAOYSA-N 0.000 description 2
- BOTGCZBEERTTDQ-UHFFFAOYSA-N 4-Methoxy-1-naphthol Chemical compound C1=CC=C2C(OC)=CC=C(O)C2=C1 BOTGCZBEERTTDQ-UHFFFAOYSA-N 0.000 description 2
- APOAEMIYHVGWEZ-UHFFFAOYSA-N 4-chloroisoindole-1,3-dione Chemical compound ClC1=CC=CC2=C1C(=O)NC2=O APOAEMIYHVGWEZ-UHFFFAOYSA-N 0.000 description 2
- GNYICZVGHULCHE-UHFFFAOYSA-N 5-bromoisoindole-1,3-dione Chemical compound BrC1=CC=C2C(=O)NC(=O)C2=C1 GNYICZVGHULCHE-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 229910021612 Silver iodide Inorganic materials 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000007656 barbituric acids Chemical class 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- VQIZMFAABLAEJE-UHFFFAOYSA-N benzenesulfonamide;phenol Chemical compound OC1=CC=CC=C1.NS(=O)(=O)C1=CC=CC=C1 VQIZMFAABLAEJE-UHFFFAOYSA-N 0.000 description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical class C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 2
- 239000012964 benzotriazole Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 239000008199 coating composition Substances 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N iodoform Chemical compound IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- MLFHJEHSLIIPHL-UHFFFAOYSA-N isoamyl acetate Chemical compound CC(C)CCOC(C)=O MLFHJEHSLIIPHL-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 150000002641 lithium Chemical group 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 229940100892 mercury compound Drugs 0.000 description 2
- 150000002731 mercury compounds Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000002941 palladium compounds Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000004986 phenylenediamines Chemical class 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- 150000008442 polyphenolic compounds Chemical class 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- YMROBMBMLBZRKT-UHFFFAOYSA-M potassium;dodecyl-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].CCCCCCCCCCCCS([O-])(=O)=S YMROBMBMLBZRKT-UHFFFAOYSA-M 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical class O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 2
- 150000003283 rhodium Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 2
- 229940045105 silver iodide Drugs 0.000 description 2
- OIZSSBDNMBMYFL-UHFFFAOYSA-M silver;decanoate Chemical compound [Ag+].CCCCCCCCCC([O-])=O OIZSSBDNMBMYFL-UHFFFAOYSA-M 0.000 description 2
- ORYURPRSXLUCSS-UHFFFAOYSA-M silver;octadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCC([O-])=O ORYURPRSXLUCSS-UHFFFAOYSA-M 0.000 description 2
- 125000004436 sodium atom Chemical group 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- BZHOWMPPNDKQSQ-UHFFFAOYSA-M sodium;sulfidosulfonylbenzene Chemical compound [Na+].[O-]S(=O)(=S)C1=CC=CC=C1 BZHOWMPPNDKQSQ-UHFFFAOYSA-M 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- RKSOPLXZQNSWAS-UHFFFAOYSA-N tert-butyl bromide Chemical compound CC(C)(C)Br RKSOPLXZQNSWAS-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VFJYIHQDILEQNR-UHFFFAOYSA-M trimethylsulfanium;iodide Chemical compound [I-].C[S+](C)C VFJYIHQDILEQNR-UHFFFAOYSA-M 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- PPTXVXKCQZKFBN-UHFFFAOYSA-N (S)-(-)-1,1'-Bi-2-naphthol Chemical group C1=CC=C2C(C3=C4C=CC=CC4=CC=C3O)=C(O)C=CC2=C1 PPTXVXKCQZKFBN-UHFFFAOYSA-N 0.000 description 1
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical class OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- SILNNFMWIMZVEQ-UHFFFAOYSA-N 1,3-dihydrobenzimidazol-2-one Chemical compound C1=CC=C2NC(O)=NC2=C1 SILNNFMWIMZVEQ-UHFFFAOYSA-N 0.000 description 1
- ODIRBFFBCSTPTO-UHFFFAOYSA-N 1,3-selenazole Chemical class C1=C[se]C=N1 ODIRBFFBCSTPTO-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZPANWZBSGMDWON-UHFFFAOYSA-N 1-[(2-hydroxynaphthalen-1-yl)methyl]naphthalen-2-ol Chemical compound C1=CC=C2C(CC3=C4C=CC=CC4=CC=C3O)=C(O)C=CC2=C1 ZPANWZBSGMDWON-UHFFFAOYSA-N 0.000 description 1
- DDWXNUFFAFBJDG-UHFFFAOYSA-N 1-acetyl-2-sulfanylideneimidazolidin-4-one Chemical compound CC(=O)N1CC(=O)NC1=S DDWXNUFFAFBJDG-UHFFFAOYSA-N 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- VFNKZQNIXUFLBC-UHFFFAOYSA-N 2',7'-dichlorofluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC(Cl)=C(O)C=C1OC1=C2C=C(Cl)C(O)=C1 VFNKZQNIXUFLBC-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- ROKOECFNTZMAGR-UHFFFAOYSA-N 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)-phenylmethyl]phenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(C(C=2C=CC=CC=2)C=2C(=C(C=C(C=2)C(C)(C)C)C(C)(C)C)O)=C1O ROKOECFNTZMAGR-UHFFFAOYSA-N 0.000 description 1
- DKCPKDPYUFEZCP-UHFFFAOYSA-N 2,6-di-tert-butylphenol Chemical group CC(C)(C)C1=CC=CC(C(C)(C)C)=C1O DKCPKDPYUFEZCP-UHFFFAOYSA-N 0.000 description 1
- QHPKIUDQDCWRKO-UHFFFAOYSA-N 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C(C)(C)C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 QHPKIUDQDCWRKO-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- RPWDFMGIRPZGTI-UHFFFAOYSA-N 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,5,5-trimethylhexyl]-4,6-dimethylphenol Chemical compound C=1C(C)=CC(C)=C(O)C=1C(CC(C)CC(C)(C)C)C1=CC(C)=CC(C)=C1O RPWDFMGIRPZGTI-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- MARXMDRWROUXMD-UHFFFAOYSA-N 2-bromoisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Br)C(=O)C2=C1 MARXMDRWROUXMD-UHFFFAOYSA-N 0.000 description 1
- DFZVZKUDBIJAHK-UHFFFAOYSA-N 2-hydroxyoctadecanoic acid silver Chemical compound [Ag].OC(C(=O)O)CCCCCCCCCCCCCCCC DFZVZKUDBIJAHK-UHFFFAOYSA-N 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- ZXLYYQUMYFHCLQ-UHFFFAOYSA-N 2-methylisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(C)C(=O)C2=C1 ZXLYYQUMYFHCLQ-UHFFFAOYSA-N 0.000 description 1
- PLZGEOPCNFFBHV-UHFFFAOYSA-N 2-naphthalen-2-ylnaphthalene-1,3-diol Chemical group C1=CC=CC2=CC(C3=C(O)C4=CC=CC=C4C=C3O)=CC=C21 PLZGEOPCNFFBHV-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- UIQPERPLCCTBGX-UHFFFAOYSA-N 2-phenylacetic acid;silver Chemical compound [Ag].OC(=O)CC1=CC=CC=C1 UIQPERPLCCTBGX-UHFFFAOYSA-N 0.000 description 1
- GCSVNNODDIEGEX-UHFFFAOYSA-N 2-sulfanylidene-1,3-oxazolidin-4-one Chemical class O=C1COC(=S)N1 GCSVNNODDIEGEX-UHFFFAOYSA-N 0.000 description 1
- LGMCUPMCALCSAQ-UHFFFAOYSA-N 2-tert-butyl-6-(2-hydroxy-5-methylphenyl)-4-methylphenol Chemical compound CC1=CC=C(O)C(C=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1 LGMCUPMCALCSAQ-UHFFFAOYSA-N 0.000 description 1
- IBWXIFXUDGADCV-UHFFFAOYSA-N 2h-benzotriazole;silver Chemical compound [Ag].C1=CC=C2NN=NC2=C1 IBWXIFXUDGADCV-UHFFFAOYSA-N 0.000 description 1
- DIUKQPZKCVGFDG-UHFFFAOYSA-N 3,5-dichlorobenzenesulfonamide;phenol Chemical compound OC1=CC=CC=C1.NS(=O)(=O)C1=CC(Cl)=CC(Cl)=C1 DIUKQPZKCVGFDG-UHFFFAOYSA-N 0.000 description 1
- DABNZWMZHPDHFD-UHFFFAOYSA-N 3-bromo-2h-1,3-oxazole Chemical compound BrN1COC=C1 DABNZWMZHPDHFD-UHFFFAOYSA-N 0.000 description 1
- AMHVHKFKFDBCTE-UHFFFAOYSA-N 3h-1,3-benzoxazole-2-thione;silver Chemical compound [Ag].C1=CC=C2OC(S)=NC2=C1 AMHVHKFKFDBCTE-UHFFFAOYSA-N 0.000 description 1
- QRFTXHFUNIFHST-UHFFFAOYSA-N 4,5,6,7-tetrabromoisoindole-1,3-dione Chemical compound BrC1=C(Br)C(Br)=C2C(=O)NC(=O)C2=C1Br QRFTXHFUNIFHST-UHFFFAOYSA-N 0.000 description 1
- LPUUYZVKCMCHLO-UHFFFAOYSA-N 4,5,6,7-tetrachloroisoindole-1,3-dione Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)NC(=O)C2=C1Cl LPUUYZVKCMCHLO-UHFFFAOYSA-N 0.000 description 1
- GXHIOZHDNIONPT-UHFFFAOYSA-N 4,5,6,7-tetrafluoroisoindole-1,3-dione Chemical compound FC1=C(F)C(F)=C2C(=O)NC(=O)C2=C1F GXHIOZHDNIONPT-UHFFFAOYSA-N 0.000 description 1
- UIKTUNJTQXTAQD-UHFFFAOYSA-N 4,7-dibromoisoindole-1,3-dione Chemical compound BrC1=CC=C(Br)C2=C1C(=O)NC2=O UIKTUNJTQXTAQD-UHFFFAOYSA-N 0.000 description 1
- BIXWQKYACRKUFW-UHFFFAOYSA-N 4,7-dichloroisoindole-1,3-dione Chemical compound ClC1=CC=C(Cl)C2=C1C(=O)NC2=O BIXWQKYACRKUFW-UHFFFAOYSA-N 0.000 description 1
- BUAZDMIOEPFIFV-UHFFFAOYSA-N 4-(2-benzylidenehydrazinyl)-2H-phthalazin-1-one Chemical compound C(C1=CC=CC=C1)=NNC1=NNC(C2=CC=CC=C12)=O BUAZDMIOEPFIFV-UHFFFAOYSA-N 0.000 description 1
- ZHLKSRYOYNILEG-UHFFFAOYSA-N 4-(4-chlorophenyl)-2h-phthalazin-1-one Chemical compound C1=CC(Cl)=CC=C1C1=NNC(=O)C2=CC=CC=C12 ZHLKSRYOYNILEG-UHFFFAOYSA-N 0.000 description 1
- HTAUVJPDFDVVHV-UHFFFAOYSA-N 4-(4-phenylphenyl)-1,3-thiazol-2-amine Chemical compound S1C(N)=NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)=C1 HTAUVJPDFDVVHV-UHFFFAOYSA-N 0.000 description 1
- SPVIEWHOXUYOPN-UHFFFAOYSA-N 4-(hydroxymethyl)-2h-phthalazin-1-one Chemical compound C1=CC=C2C(CO)=NNC(=O)C2=C1 SPVIEWHOXUYOPN-UHFFFAOYSA-N 0.000 description 1
- YXJYNIUXRUTFAI-UHFFFAOYSA-N 4-(morpholin-4-ylmethyl)-2h-phthalazin-1-one Chemical compound C12=CC=CC=C2C(=O)NN=C1CN1CCOCC1 YXJYNIUXRUTFAI-UHFFFAOYSA-N 0.000 description 1
- CUGWYAVRVHQTNG-UHFFFAOYSA-N 4-[(4-methoxyphenyl)methyl]-2h-phthalazin-1-one Chemical compound C1=CC(OC)=CC=C1CC1=NNC(=O)C2=CC=CC=C12 CUGWYAVRVHQTNG-UHFFFAOYSA-N 0.000 description 1
- GOMHKKWAFSAOHR-UHFFFAOYSA-N 4-[(dimethylamino)methyl]-2h-phthalazin-1-one Chemical compound C1=CC=C2C(CN(C)C)=NNC(=O)C2=C1 GOMHKKWAFSAOHR-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- XIDJIOMKKHURHU-UHFFFAOYSA-N 4-[4-(dimethylamino)phenyl]-2h-phthalazin-1-one Chemical compound C1=CC(N(C)C)=CC=C1C1=NNC(=O)C2=CC=CC=C12 XIDJIOMKKHURHU-UHFFFAOYSA-N 0.000 description 1
- JUCCMEHWBGPJKS-UHFFFAOYSA-N 4-benzyl-2h-phthalazin-1-one Chemical compound C12=CC=CC=C2C(=O)NN=C1CC1=CC=CC=C1 JUCCMEHWBGPJKS-UHFFFAOYSA-N 0.000 description 1
- ANENLORAJJKWAA-UHFFFAOYSA-N 4-bromoisoindole-1,3-dione Chemical compound BrC1=CC=CC2=C1C(=O)NC2=O ANENLORAJJKWAA-UHFFFAOYSA-N 0.000 description 1
- QCKGMJDOJRNSMS-UHFFFAOYSA-N 4-chloro-2h-phthalazin-1-one Chemical compound C1=CC=C2C(Cl)=NNC(=O)C2=C1 QCKGMJDOJRNSMS-UHFFFAOYSA-N 0.000 description 1
- LSBFJSSWKSCGMP-UHFFFAOYSA-N 4-methoxy-2h-phthalazin-1-one Chemical compound C1=CC=C2C(OC)=NN=C(O)C2=C1 LSBFJSSWKSCGMP-UHFFFAOYSA-N 0.000 description 1
- QRNVHFPDZAZUGX-UHFFFAOYSA-N 4-methyl-2h-phthalazin-1-one Chemical compound C1=CC=C2C(C)=NNC(=O)C2=C1 QRNVHFPDZAZUGX-UHFFFAOYSA-N 0.000 description 1
- KXFRSVCWEHBKQT-UHFFFAOYSA-N 4-naphthalen-1-yl-2h-phthalazin-1-one Chemical compound C12=CC=CC=C2C(=O)NN=C1C1=CC=CC2=CC=CC=C12 KXFRSVCWEHBKQT-UHFFFAOYSA-N 0.000 description 1
- BORPCYHIBPGOII-UHFFFAOYSA-N 4-naphthalen-2-yl-2h-phthalazin-1-one Chemical compound C12=CC=CC=C2C(=O)NN=C1C1=CC=C(C=CC=C2)C2=C1 BORPCYHIBPGOII-UHFFFAOYSA-N 0.000 description 1
- XCJLBNVENUPHEA-UHFFFAOYSA-N 4-phenyl-2h-phthalazin-1-one Chemical compound C12=CC=CC=C2C(=O)NN=C1C1=CC=CC=C1 XCJLBNVENUPHEA-UHFFFAOYSA-N 0.000 description 1
- CFIUCOKDVARZGF-UHFFFAOYSA-N 5,7-dimethoxy-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C2=CC(OC)=CC(OC)=C21 CFIUCOKDVARZGF-UHFFFAOYSA-N 0.000 description 1
- CNGYZEMWVAWWOB-VAWYXSNFSA-N 5-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(e)-2-[4-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound N=1C(NC=2C=C(C(\C=C\C=3C(=CC(NC=4N=C(N=C(NC=5C=CC=CC=5)N=4)N(CCO)CCO)=CC=3)S(O)(=O)=O)=CC=2)S(O)(=O)=O)=NC(N(CCO)CCO)=NC=1NC1=CC=CC=C1 CNGYZEMWVAWWOB-VAWYXSNFSA-N 0.000 description 1
- BGJNRQSGJHVURK-UHFFFAOYSA-N 5-chloroisoindole-1,3-dione Chemical compound ClC1=CC=C2C(=O)NC(=O)C2=C1 BGJNRQSGJHVURK-UHFFFAOYSA-N 0.000 description 1
- BIANPEOCBJDOEM-UHFFFAOYSA-N 5-methoxyisoindole-1,3-dione Chemical compound COC1=CC=C2C(=O)NC(=O)C2=C1 BIANPEOCBJDOEM-UHFFFAOYSA-N 0.000 description 1
- UKRUJPIJOJHCOB-UHFFFAOYSA-N 5-methylisoindole-1,3-dione Chemical compound CC1=CC=C2C(=O)NC(=O)C2=C1 UKRUJPIJOJHCOB-UHFFFAOYSA-N 0.000 description 1
- YPXQSGWOGQPLQO-UHFFFAOYSA-N 5-nitro-1,3-dihydrobenzimidazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2N=C(S)NC2=C1 YPXQSGWOGQPLQO-UHFFFAOYSA-N 0.000 description 1
- ZDRVCGZEWGFKSV-UHFFFAOYSA-N 5-nitro-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C2=C1C([N+](=O)[O-])=CC=C2 ZDRVCGZEWGFKSV-UHFFFAOYSA-N 0.000 description 1
- OORIFUHRGQKYEV-UHFFFAOYSA-N 6-bromo-1-(6-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol Chemical group BrC1=CC=C2C(C3=C4C=CC(Br)=CC4=CC=C3O)=C(O)C=CC2=C1 OORIFUHRGQKYEV-UHFFFAOYSA-N 0.000 description 1
- QMONLZVJOOMKRW-UHFFFAOYSA-N 6-bromo-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C=2C1=CC(Br)=CC=2 QMONLZVJOOMKRW-UHFFFAOYSA-N 0.000 description 1
- XDECIMXTYLBMFQ-UHFFFAOYSA-N 6-chloro-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C=2C1=CC(Cl)=CC=2 XDECIMXTYLBMFQ-UHFFFAOYSA-N 0.000 description 1
- DZWTXWPRWRLHIL-UHFFFAOYSA-N 6-methyl-1,3-benzothiazol-2-amine Chemical compound CC1=CC=C2N=C(N)SC2=C1 DZWTXWPRWRLHIL-UHFFFAOYSA-N 0.000 description 1
- SLAZSGHXIAZWIQ-UHFFFAOYSA-N 8-amino-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C2=C1C=CC=C2N SLAZSGHXIAZWIQ-UHFFFAOYSA-N 0.000 description 1
- NYQISUFSMLBUFT-UHFFFAOYSA-N 8-hydroxy-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C2=C1C=CC=C2O NYQISUFSMLBUFT-UHFFFAOYSA-N 0.000 description 1
- GNXAXTIOBXCSDE-UHFFFAOYSA-N 8-methyl-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C2=C1C=CC=C2C GNXAXTIOBXCSDE-UHFFFAOYSA-N 0.000 description 1
- PTDNTBDFVXKLCO-UHFFFAOYSA-N 8-tert-butyl-2h-phthalazin-1-one Chemical compound C1=NNC(=O)C2=C1C=CC=C2C(C)(C)C PTDNTBDFVXKLCO-UHFFFAOYSA-N 0.000 description 1
- BKGOEKOJWMSNRX-UHFFFAOYSA-L C(C1(C)C(C)(C)C(C(=O)[O-])CC1)(=O)[O-].[Ag+2] Chemical compound C(C1(C)C(C)(C)C(C(=O)[O-])CC1)(=O)[O-].[Ag+2] BKGOEKOJWMSNRX-UHFFFAOYSA-L 0.000 description 1
- SOPOWMHJZSPMBC-UHFFFAOYSA-L C(C1=CC=C(C(=O)[O-])C=C1)(=O)[O-].[Ag+2] Chemical compound C(C1=CC=C(C(=O)[O-])C=C1)(=O)[O-].[Ag+2] SOPOWMHJZSPMBC-UHFFFAOYSA-L 0.000 description 1
- AXVCDCGTJGNMKM-UHFFFAOYSA-L C(C=1C(C(=O)[O-])=CC=CC1)(=O)[O-].[Ag+2] Chemical compound C(C=1C(C(=O)[O-])=CC=CC1)(=O)[O-].[Ag+2] AXVCDCGTJGNMKM-UHFFFAOYSA-L 0.000 description 1
- DYYHUAGAPAAERQ-UHFFFAOYSA-L C(CCCCC(=O)[O-])(=O)[O-].[Ag+2] Chemical compound C(CCCCC(=O)[O-])(=O)[O-].[Ag+2] DYYHUAGAPAAERQ-UHFFFAOYSA-L 0.000 description 1
- IVNAZOGVWDHYGU-UHFFFAOYSA-L C(CCCCCCCCC(=O)[O-])(=O)[O-].[Ag+2] Chemical compound C(CCCCCCCCC(=O)[O-])(=O)[O-].[Ag+2] IVNAZOGVWDHYGU-UHFFFAOYSA-L 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 150000000996 L-ascorbic acids Chemical class 0.000 description 1
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- 229920002253 Tannate Polymers 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- RZESOXIJGKVAAX-UHFFFAOYSA-L [Ag++].[O-]C(=O)CCC([O-])=O Chemical compound [Ag++].[O-]C(=O)CCC([O-])=O RZESOXIJGKVAAX-UHFFFAOYSA-L 0.000 description 1
- JXFDPVZHNNCRKT-TYYBGVCCSA-L [Ag+2].[O-]C(=O)\C=C\C([O-])=O Chemical compound [Ag+2].[O-]C(=O)\C=C\C([O-])=O JXFDPVZHNNCRKT-TYYBGVCCSA-L 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- HOLVRJRSWZOAJU-UHFFFAOYSA-N [Ag].ICl Chemical compound [Ag].ICl HOLVRJRSWZOAJU-UHFFFAOYSA-N 0.000 description 1
- NZHXEWZGTQSYJM-UHFFFAOYSA-N [bromo(diphenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Br)C1=CC=CC=C1 NZHXEWZGTQSYJM-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- WRYNUJYAXVDTCB-UHFFFAOYSA-M acetyloxymercury Chemical compound CC(=O)O[Hg] WRYNUJYAXVDTCB-UHFFFAOYSA-M 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- UUZYBYIOAZTMGC-UHFFFAOYSA-M benzyl(trimethyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)CC1=CC=CC=C1 UUZYBYIOAZTMGC-UHFFFAOYSA-M 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical group [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000001785 cerium compounds Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000002508 contact lithography Methods 0.000 description 1
- 238000007766 curtain coating Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940120503 dihydroxyacetone Drugs 0.000 description 1
- 229940071221 dihydroxybenzoate Drugs 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- OPTDDWCXQQYKGU-UHFFFAOYSA-N diphenyldichloromethane Chemical compound C=1C=CC=CC=1C(Cl)(Cl)C1=CC=CC=C1 OPTDDWCXQQYKGU-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- VUFOSBDICLTFMS-UHFFFAOYSA-M ethyl-hexadecyl-dimethylazanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)CC VUFOSBDICLTFMS-UHFFFAOYSA-M 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- MIJRFWVFNKQQDK-UHFFFAOYSA-N furoin Chemical compound C=1C=COC=1C(O)C(=O)C1=CC=CO1 MIJRFWVFNKQQDK-UHFFFAOYSA-N 0.000 description 1
- LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- MNQZXJOMYWMBOU-UHFFFAOYSA-N glyceraldehyde Chemical compound OCC(O)C=O MNQZXJOMYWMBOU-UHFFFAOYSA-N 0.000 description 1
- 150000002344 gold compounds Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910001502 inorganic halide Inorganic materials 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229940117955 isoamyl acetate Drugs 0.000 description 1
- DEGPIRUPAKWDBU-UHFFFAOYSA-N isoindole-1,3-dione;sodium Chemical compound [Na].C1=CC=C2C(=O)NC(=O)C2=C1 DEGPIRUPAKWDBU-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940049918 linoleate Drugs 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- GVFMVCKXFOAOHE-UHFFFAOYSA-M lithium;benzyl-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [Li+].[O-]S(=O)(=S)CC1=CC=CC=C1 GVFMVCKXFOAOHE-UHFFFAOYSA-M 0.000 description 1
- NDBCAABUVNJYQP-UHFFFAOYSA-M lithium;oxido-oxo-phenyl-sulfanylidene-$l^{6}-sulfane Chemical compound [Li+].[O-]S(=O)(=S)C1=CC=CC=C1 NDBCAABUVNJYQP-UHFFFAOYSA-M 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- GPSDUZXPYCFOSQ-UHFFFAOYSA-M m-toluate Chemical compound CC1=CC=CC(C([O-])=O)=C1 GPSDUZXPYCFOSQ-UHFFFAOYSA-M 0.000 description 1
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical class N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical compound [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- OTVPURYEWXIAKH-UHFFFAOYSA-N n,n-dibromobenzenesulfonamide Chemical compound BrN(Br)S(=O)(=O)C1=CC=CC=C1 OTVPURYEWXIAKH-UHFFFAOYSA-N 0.000 description 1
- DVNYDODOESWBJY-UHFFFAOYSA-N n-bromo-n-methylbenzenesulfonamide Chemical compound CN(Br)S(=O)(=O)C1=CC=CC=C1 DVNYDODOESWBJY-UHFFFAOYSA-N 0.000 description 1
- FWLGGSWAIHNLLW-UHFFFAOYSA-N n-bromo-n-phenylacetamide Chemical compound CC(=O)N(Br)C1=CC=CC=C1 FWLGGSWAIHNLLW-UHFFFAOYSA-N 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 150000001475 oxazolidinediones Chemical class 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical class N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YSZIOXAEADAJLX-UHFFFAOYSA-N phthalazine-1,4-dione Chemical class C1=CC=C2C(=O)N=NC(=O)C2=C1 YSZIOXAEADAJLX-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920006289 polycarbonate film Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- HTFIGMKSPOJGFO-UHFFFAOYSA-M potassium;(3-chlorophenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[O-]S(=O)(=S)C1=CC=CC(Cl)=C1 HTFIGMKSPOJGFO-UHFFFAOYSA-M 0.000 description 1
- COTNENVISLFZOB-UHFFFAOYSA-M potassium;(3-tert-butylphenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].CC(C)(C)C1=CC=CC(S([O-])(=O)=S)=C1 COTNENVISLFZOB-UHFFFAOYSA-M 0.000 description 1
- FPDWLVZFJRPOOE-UHFFFAOYSA-M potassium;(4-ethoxyphenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].CCOC1=CC=C(S([O-])(=O)=S)C=C1 FPDWLVZFJRPOOE-UHFFFAOYSA-M 0.000 description 1
- JTUZJIHMALPELJ-UHFFFAOYSA-M potassium;(4-methoxyphenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].COC1=CC=C(S([O-])(=O)=S)C=C1 JTUZJIHMALPELJ-UHFFFAOYSA-M 0.000 description 1
- NRVIAJKZOJKWMB-UHFFFAOYSA-M potassium;1-(3-oxidosulfonothioylphenyl)ethanone Chemical compound [K+].CC(=O)C1=CC=CC(S([O-])(=O)=S)=C1 NRVIAJKZOJKWMB-UHFFFAOYSA-M 0.000 description 1
- KDEUFMRDDGXWAE-UHFFFAOYSA-M potassium;2-ethoxyethyl-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].CCOCCS([O-])(=O)=S KDEUFMRDDGXWAE-UHFFFAOYSA-M 0.000 description 1
- FIECKMHIWKSVGD-UHFFFAOYSA-M potassium;hexadecyl-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].CCCCCCCCCCCCCCCCS([O-])(=O)=S FIECKMHIWKSVGD-UHFFFAOYSA-M 0.000 description 1
- ZIZWJGGAMHFNNR-UHFFFAOYSA-M potassium;oxido-oxo-phenyl-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[S-]S(=O)(=O)C1=CC=CC=C1 ZIZWJGGAMHFNNR-UHFFFAOYSA-M 0.000 description 1
- MLHQHZASXCSQBX-UHFFFAOYSA-M potassium;oxido-oxo-sulfanylidene-tetradecyl-$l^{6}-sulfane Chemical compound [K+].CCCCCCCCCCCCCCS([O-])(=O)=S MLHQHZASXCSQBX-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical class O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- 150000003219 pyrazolines Chemical class 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- CWMRFSSMSXQUJC-UHFFFAOYSA-N pyrrole-2-thione Chemical class S=C1C=CC=N1 CWMRFSSMSXQUJC-UHFFFAOYSA-N 0.000 description 1
- 150000003236 pyrrolines Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006479 redox reaction Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical group [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229920006298 saran Polymers 0.000 description 1
- 238000010187 selection method Methods 0.000 description 1
- IZXSLAZMYLIILP-ODZAUARKSA-M silver (Z)-4-hydroxy-4-oxobut-2-enoate Chemical compound [Ag+].OC(=O)\C=C/C([O-])=O IZXSLAZMYLIILP-ODZAUARKSA-M 0.000 description 1
- NBYLLBXLDOPANK-UHFFFAOYSA-M silver 2-carboxyphenolate hydrate Chemical compound C1=CC=C(C(=C1)C(=O)O)[O-].O.[Ag+] NBYLLBXLDOPANK-UHFFFAOYSA-M 0.000 description 1
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 1
- 229940071536 silver acetate Drugs 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- 229940100890 silver compound Drugs 0.000 description 1
- 150000003379 silver compounds Chemical class 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- YRSQDSCQMOUOKO-KVVVOXFISA-M silver;(z)-octadec-9-enoate Chemical compound [Ag+].CCCCCCCC\C=C/CCCCCCCC([O-])=O YRSQDSCQMOUOKO-KVVVOXFISA-M 0.000 description 1
- RUVFQTANUKYORF-UHFFFAOYSA-M silver;2,4-dichlorobenzoate Chemical compound [Ag+].[O-]C(=O)C1=CC=C(Cl)C=C1Cl RUVFQTANUKYORF-UHFFFAOYSA-M 0.000 description 1
- OEVSPXPUUSCCIH-UHFFFAOYSA-M silver;2-acetamidobenzoate Chemical compound [Ag+].CC(=O)NC1=CC=CC=C1C([O-])=O OEVSPXPUUSCCIH-UHFFFAOYSA-M 0.000 description 1
- JRTHUBNDKBQVKY-UHFFFAOYSA-M silver;2-methylbenzoate Chemical compound [Ag+].CC1=CC=CC=C1C([O-])=O JRTHUBNDKBQVKY-UHFFFAOYSA-M 0.000 description 1
- CPXGFFUFUXXZGC-UHFFFAOYSA-M silver;4-methylbenzenesulfinate Chemical compound [Ag+].CC1=CC=C(S([O-])=O)C=C1 CPXGFFUFUXXZGC-UHFFFAOYSA-M 0.000 description 1
- RDZTZLBPUKUEIM-UHFFFAOYSA-M silver;4-phenylbenzoate Chemical compound [Ag+].C1=CC(C(=O)[O-])=CC=C1C1=CC=CC=C1 RDZTZLBPUKUEIM-UHFFFAOYSA-M 0.000 description 1
- LKSDDVCOLMJDNV-UHFFFAOYSA-L silver;bromosilver;docosanoate Chemical class [Ag+].[Ag]Br.CCCCCCCCCCCCCCCCCCCCCC([O-])=O LKSDDVCOLMJDNV-UHFFFAOYSA-L 0.000 description 1
- JKOCEVIXVMBKJA-UHFFFAOYSA-M silver;butanoate Chemical compound [Ag+].CCCC([O-])=O JKOCEVIXVMBKJA-UHFFFAOYSA-M 0.000 description 1
- GURNTNKIRDSILY-UHFFFAOYSA-M silver;ethanesulfonate Chemical compound [Ag+].CCS([O-])(=O)=O GURNTNKIRDSILY-UHFFFAOYSA-M 0.000 description 1
- GXBIBRDOPVAJRX-UHFFFAOYSA-M silver;furan-2-carboxylate Chemical compound [Ag+].[O-]C(=O)C1=CC=CO1 GXBIBRDOPVAJRX-UHFFFAOYSA-M 0.000 description 1
- LTYHQUJGIQUHMS-UHFFFAOYSA-M silver;hexadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCC([O-])=O LTYHQUJGIQUHMS-UHFFFAOYSA-M 0.000 description 1
- ZYPJJPHRTZPKKY-UHFFFAOYSA-M silver;octanoate Chemical compound [Ag+].CCCCCCCC([O-])=O ZYPJJPHRTZPKKY-UHFFFAOYSA-M 0.000 description 1
- FNCXHMHRNUNEMO-UHFFFAOYSA-M silver;propane-1-sulfonate Chemical compound [Ag+].CCCS([O-])(=O)=O FNCXHMHRNUNEMO-UHFFFAOYSA-M 0.000 description 1
- HSBZZLSGRPRUSR-UHFFFAOYSA-M sodium;(4-nitrophenyl)-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [Na+].[O-][N+](=O)C1=CC=C(S([O-])(=O)=S)C=C1 HSBZZLSGRPRUSR-UHFFFAOYSA-M 0.000 description 1
- CVYDEWKUJFCYJO-UHFFFAOYSA-M sodium;docosanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCCCCCC([O-])=O CVYDEWKUJFCYJO-UHFFFAOYSA-M 0.000 description 1
- PVDVRZVOIACFTC-UHFFFAOYSA-M sodium;naphthalen-2-yl-oxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [Na+].C1=CC=CC2=CC(S(=O)(=O)[S-])=CC=C21 PVDVRZVOIACFTC-UHFFFAOYSA-M 0.000 description 1
- BMZFJZLUYLUNSW-UHFFFAOYSA-M sodium;oxido-oxo-sulfanylidene-undecyl-$l^{6}-sulfane Chemical compound [Na+].CCCCCCCCCCCS([O-])(=O)=S BMZFJZLUYLUNSW-UHFFFAOYSA-M 0.000 description 1
- JOUUTMVGJVCAFU-UHFFFAOYSA-M sodium;sulfidosulfonylmethylbenzene Chemical compound [Na+].[S-]S(=O)(=O)CC1=CC=CC=C1 JOUUTMVGJVCAFU-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- MBDNRNMVTZADMQ-UHFFFAOYSA-N sulfolene Chemical compound O=S1(=O)CC=CC1 MBDNRNMVTZADMQ-UHFFFAOYSA-N 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- LIXPXSXEKKHIRR-UHFFFAOYSA-M tetraethylphosphanium;bromide Chemical compound [Br-].CC[P+](CC)(CC)CC LIXPXSXEKKHIRR-UHFFFAOYSA-M 0.000 description 1
- DGQOCLATAPFASR-UHFFFAOYSA-N tetrahydroxy-1,4-benzoquinone Chemical compound OC1=C(O)C(=O)C(O)=C(O)C1=O DGQOCLATAPFASR-UHFFFAOYSA-N 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000001467 thiazolidinediones Chemical class 0.000 description 1
- 150000003549 thiazolines Chemical class 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- RLGKSXCGHMXELQ-ZRDIBKRKSA-N trans-2-styrylquinoline Chemical compound C=1C=C2C=CC=CC2=NC=1\C=C\C1=CC=CC=C1 RLGKSXCGHMXELQ-ZRDIBKRKSA-N 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- GNMJFQWRASXXMS-UHFFFAOYSA-M trimethyl(phenyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)C1=CC=CC=C1 GNMJFQWRASXXMS-UHFFFAOYSA-M 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000001018 xanthene dye Substances 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/494—Silver salt compositions other than silver halide emulsions; Photothermographic systems ; Thermographic systems using noble metal compounds
- G03C1/498—Photothermographic systems, e.g. dry silver
- G03C1/49836—Additives
- G03C1/49845—Active additives, e.g. toners, stabilisers, sensitisers
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/166—Toner containing
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13076976A JPS5355115A (en) | 1976-10-29 | 1976-10-29 | Thermodevelopment photosensitive material |
| US05/844,858 US4144072A (en) | 1976-10-29 | 1977-10-25 | Thermally developable light-sensitive material |
| GB44868/77A GB1586588A (en) | 1976-10-29 | 1977-10-27 | Thermally developable light-sensitive materials |
| DE19772748472 DE2748472A1 (de) | 1976-10-29 | 1977-10-28 | Thermisch-entwicklungsfaehiges lichtempfindliches material |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13076976A JPS5355115A (en) | 1976-10-29 | 1976-10-29 | Thermodevelopment photosensitive material |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5355115A JPS5355115A (en) | 1978-05-19 |
| JPS6118735B2 true JPS6118735B2 (enExample) | 1986-05-14 |
Family
ID=15042211
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13076976A Granted JPS5355115A (en) | 1976-10-29 | 1976-10-29 | Thermodevelopment photosensitive material |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4144072A (enExample) |
| JP (1) | JPS5355115A (enExample) |
| DE (1) | DE2748472A1 (enExample) |
| GB (1) | GB1586588A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1590678A (en) * | 1976-08-18 | 1981-06-03 | Canon Kk | Image-forming member |
| JPS6043318B2 (ja) * | 1978-07-18 | 1985-09-27 | 富士写真フイルム株式会社 | 感熱記録紙 |
| JPS5527253A (en) * | 1978-08-18 | 1980-02-27 | Fuji Photo Film Co Ltd | Heat sensitizing recording sheet |
| JPS5821251B2 (ja) * | 1978-08-28 | 1983-04-28 | 旭化成株式会社 | 乾式画像形成材料 |
| JPS58189628A (ja) * | 1982-04-28 | 1983-11-05 | Konishiroku Photo Ind Co Ltd | 熱現像画像記録材料 |
| US4504575A (en) * | 1983-10-31 | 1985-03-12 | E. I. Du Pont De Nemours And Company | Heat-developable film containing silver sulfonate physical developer |
| US4510236A (en) * | 1983-12-20 | 1985-04-09 | Minnesota Mining And Manufacturing Company | Thermally generated toning agent system for photothermographic imaging compositions |
| US4585734A (en) * | 1985-02-01 | 1986-04-29 | Minnesota Mining And Manufacturing Company | Photothermographic toners |
| US5288011A (en) * | 1990-03-02 | 1994-02-22 | Hamada Shashin Kogeisha | Picture post card |
| US5358843A (en) * | 1993-08-20 | 1994-10-25 | Minnesota Mining And Manufacturing Company | Photothermographic elements containing silyl blocking groups |
| US5439790A (en) * | 1994-06-24 | 1995-08-08 | Minnesota Mining And Manufacturing Company | Phthalimide blocked post-processing stabilizers for photothermography |
| JP3794706B2 (ja) | 1995-07-18 | 2006-07-12 | アグフア−ゲヴエルト・ナームローゼ・フエンノートシヤツプ | フォトサーモグラフィ記録材料 |
| US6280913B1 (en) | 2000-06-13 | 2001-08-28 | Eastman Kodak Company | Photographic element comprising an ion exchanged photographically useful compound |
| US6599685B1 (en) * | 2002-01-08 | 2003-07-29 | Eastman Kodak Company | Thermally developable imaging materials having improved shelf stability and stabilizing compositions |
| US20040137389A1 (en) * | 2002-12-19 | 2004-07-15 | Kouta Fukui | Heat-developable light-sensitive material |
| US20230159469A1 (en) * | 2020-05-08 | 2023-05-25 | Txinno Bioscience Inc. | Novel phthalazine derivative having ectonucloeotide pyrophosphatase/phosphodieste rase inhibitory activity, and use thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS513223A (en) * | 1974-06-26 | 1976-01-12 | Fuji Photo Film Co Ltd | Netsugenzokankozairyo |
| US3985565A (en) * | 1974-07-12 | 1976-10-12 | Eastman Kodak Company | Photothermographic, composition using a phenolic leuco dye as a reducing agent |
| DE2440678C2 (de) * | 1974-08-24 | 1983-10-20 | Agfa-Gevaert Ag, 5090 Leverkusen | Thermophotographisches Aufzeichnungsmmaterial |
-
1976
- 1976-10-29 JP JP13076976A patent/JPS5355115A/ja active Granted
-
1977
- 1977-10-25 US US05/844,858 patent/US4144072A/en not_active Expired - Lifetime
- 1977-10-27 GB GB44868/77A patent/GB1586588A/en not_active Expired
- 1977-10-28 DE DE19772748472 patent/DE2748472A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| DE2748472A1 (de) | 1978-05-03 |
| GB1586588A (en) | 1981-03-18 |
| JPS5355115A (en) | 1978-05-19 |
| US4144072A (en) | 1979-03-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5836764B2 (ja) | 熱現像感光材料 | |
| JP3647944B2 (ja) | 光熱写真および感熱写真成分 | |
| US4170480A (en) | Thermally developable light-sensitive material | |
| JPS6118735B2 (enExample) | ||
| US4002479A (en) | 2-Thiouracil in heat-developable light-sensitive materials | |
| EP0904565B1 (en) | Photothermographic recording material | |
| US4211839A (en) | Method of producing light-sensitive composition for use in thermally developable light-sensitive elements and elements so produced | |
| US4030931A (en) | Heat developable light-sensitive material | |
| JPS5859439A (ja) | 熱現像感光材料 | |
| US6274297B1 (en) | Photothermographic recording material with in-situ and ex-situ photosensitive silver halide and a substantially light-insensitive organic salt | |
| US4207112A (en) | Heat developable light-sensitive materials | |
| JPS6045413B2 (ja) | 熱現像感光材料 | |
| EP0904564B1 (en) | Production method for a photothermographic material and a recording process | |
| JP2004046192A (ja) | フォトサーモグラフィ材料及び可視像の形成方法 | |
| US4152162A (en) | Thermally developable light-sensitive materials | |
| GB1565043A (en) | Dry processing type recording elemnts | |
| US4125403A (en) | Heat developable light sensitive material | |
| JPS588495B2 (ja) | ネツゲンゾウカンコウザイリヨウ | |
| JPS6228455B2 (enExample) | ||
| US4102312A (en) | Thermally developable light-sensitive materials | |
| JPS6025776B2 (ja) | 熱現像感光材料 | |
| EP0764878B1 (en) | Photothermographic elements comprising hydroxamic acid developers | |
| JP4068696B2 (ja) | 感光性熱的現像可能写真材料のための感度向上記録法 | |
| JPS6037454B2 (ja) | 熱現像感光材料 | |
| JPS6025775B2 (ja) | 熱現像感光材料 |