JPS59102231A - ビジキユラ−像形成材料 - Google Patents
ビジキユラ−像形成材料Info
- Publication number
- JPS59102231A JPS59102231A JP58212299A JP21229983A JPS59102231A JP S59102231 A JPS59102231 A JP S59102231A JP 58212299 A JP58212299 A JP 58212299A JP 21229983 A JP21229983 A JP 21229983A JP S59102231 A JPS59102231 A JP S59102231A
- Authority
- JP
- Japan
- Prior art keywords
- copolymer
- chloroacrylonitrile
- monomer
- acid
- benzoic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000463 material Substances 0.000 title claims description 29
- 230000015572 biosynthetic process Effects 0.000 title description 2
- -1 poly(α-methylstyrene) Polymers 0.000 claims description 35
- 229920001577 copolymer Polymers 0.000 claims description 30
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 claims description 25
- 239000000178 monomer Substances 0.000 claims description 18
- 238000003384 imaging method Methods 0.000 claims description 17
- 150000001989 diazonium salts Chemical class 0.000 claims description 14
- YCPXWRQRBFJBPZ-UHFFFAOYSA-N 5-sulfosalicylic acid Chemical compound OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O YCPXWRQRBFJBPZ-UHFFFAOYSA-N 0.000 claims description 13
- 229920000642 polymer Polymers 0.000 claims description 11
- 150000001558 benzoic acid derivatives Chemical class 0.000 claims description 10
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 10
- 229920002554 vinyl polymer Polymers 0.000 claims description 10
- 229920001519 homopolymer Polymers 0.000 claims description 9
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 6
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 5
- 229920002301 cellulose acetate Polymers 0.000 claims description 4
- ANSRPLLZKWADRS-UHFFFAOYSA-L dipotassium;4-sulfonatobenzoate Chemical compound [K+].[K+].[O-]C(=O)C1=CC=C(S([O-])(=O)=O)C=C1 ANSRPLLZKWADRS-UHFFFAOYSA-L 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 claims description 3
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 3
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 3
- NKBASRXWGAGQDP-UHFFFAOYSA-N 5-chlorosalicylic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1O NKBASRXWGAGQDP-UHFFFAOYSA-N 0.000 claims description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 2
- 229920003251 poly(α-methylstyrene) Polymers 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 2
- 206010073306 Exposure to radiation Diseases 0.000 claims 2
- 238000000149 argon plasma sintering Methods 0.000 claims 2
- 230000002209 hydrophobic effect Effects 0.000 claims 1
- 229920006352 transparent thermoplastic Polymers 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 18
- 239000010408 film Substances 0.000 description 16
- 239000003381 stabilizer Substances 0.000 description 16
- 239000012954 diazonium Substances 0.000 description 14
- 239000003504 photosensitizing agent Substances 0.000 description 11
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical group CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 8
- 239000011347 resin Substances 0.000 description 7
- 229920005989 resin Polymers 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 229920002545 silicone oil Polymers 0.000 description 6
- 230000000007 visual effect Effects 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 5
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000005033 polyvinylidene chloride Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 2
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- STMRONSZXDBJSI-UHFFFAOYSA-L [Cl-].[Zn+2].[N+](=[N-])=CCC1=CC=C(NCCO)C=C1.[Cl-] Chemical compound [Cl-].[Zn+2].[N+](=[N-])=CCC1=CC=C(NCCO)C=C1.[Cl-] STMRONSZXDBJSI-UHFFFAOYSA-L 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- XLSMFKSTNGKWQX-UHFFFAOYSA-N hydroxyacetone Chemical compound CC(=O)CO XLSMFKSTNGKWQX-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- XLKHCFJHGIAKFX-UHFFFAOYSA-M sodium;4-chlorobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(Cl)C=C1 XLKHCFJHGIAKFX-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229920003176 water-insoluble polymer Polymers 0.000 description 2
- 108091064702 1 family Proteins 0.000 description 1
- WXHLLJAMBQLULT-UHFFFAOYSA-N 2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-n-(2-methyl-6-sulfanylphenyl)-1,3-thiazole-5-carboxamide;hydrate Chemical compound O.C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1S WXHLLJAMBQLULT-UHFFFAOYSA-N 0.000 description 1
- FTEOZFXXPSAIPO-UHFFFAOYSA-N 4-acetamidobenzenediazonium;chloride Chemical compound [Cl-].CC(=O)NC1=CC=C([N+]#N)C=C1 FTEOZFXXPSAIPO-UHFFFAOYSA-N 0.000 description 1
- UGAPHQWFMMPNTH-UHFFFAOYSA-M 4-anilino-6-diazocyclohexa-2,4-diene-1-diazonium;chloride Chemical compound [Cl-].C1=CC([N+]#N)C(=[N+]=[N-])C=C1NC1=CC=CC=C1 UGAPHQWFMMPNTH-UHFFFAOYSA-M 0.000 description 1
- LWXFCZXRFBUOOR-UHFFFAOYSA-N 4-chloro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1O LWXFCZXRFBUOOR-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 1
- YTVSBURBOWIMMD-UHFFFAOYSA-M 4-morpholin-4-ylbenzenediazonium;chloride Chemical compound [Cl-].C1=CC([N+]#N)=CC=C1N1CCOCC1 YTVSBURBOWIMMD-UHFFFAOYSA-M 0.000 description 1
- HWAQOZGATRIYQG-UHFFFAOYSA-N 4-sulfobenzoic acid Chemical compound OC(=O)C1=CC=C(S(O)(=O)=O)C=C1 HWAQOZGATRIYQG-UHFFFAOYSA-N 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005615 azonium group Chemical group 0.000 description 1
- 239000013040 bath agent Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000004798 oriented polystyrene Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- MZSDGDXXBZSFTG-UHFFFAOYSA-M sodium;benzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC=C1 MZSDGDXXBZSFTG-UHFFFAOYSA-M 0.000 description 1
- 239000006076 specific stabilizer Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- LXSHJEFJEZVRMK-UHFFFAOYSA-L zinc;4-diazo-n,n-diethylcyclohexa-1,5-dien-1-amine;dichloride Chemical compound [Cl-].[Cl-].[Zn+2].CCN(CC)C1=CCC(=[N+]=[N-])C=C1 LXSHJEFJEZVRMK-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/60—Processes for obtaining vesicular images
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/440,874 US4430414A (en) | 1982-11-12 | 1982-11-12 | Image stabilizers for vesicular film |
| US440874 | 1982-11-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS59102231A true JPS59102231A (ja) | 1984-06-13 |
| JPH0433022B2 JPH0433022B2 (enExample) | 1992-06-01 |
Family
ID=23750529
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58212299A Granted JPS59102231A (ja) | 1982-11-12 | 1983-11-11 | ビジキユラ−像形成材料 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4430414A (enExample) |
| EP (1) | EP0109286B1 (enExample) |
| JP (1) | JPS59102231A (enExample) |
| DE (1) | DE3378078D1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4839872A (en) * | 1987-05-19 | 1989-06-13 | Thomson-Csf | Geophone with a sensitive element made of piezoelectric polymer |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4734378A (en) * | 1985-06-26 | 1988-03-29 | Abbott Laboratories | Precipitation of interfering proteins in fluorescence polarization immunoassay for digoxin |
| JP2527476B2 (ja) * | 1989-04-28 | 1996-08-21 | ダイセル化学工業株式会社 | 光情報記録媒体 |
| US6794107B2 (en) | 2002-10-28 | 2004-09-21 | Kodak Polychrome Graphics Llc | Thermal generation of a mask for flexography |
| US20070047420A1 (en) * | 2005-08-25 | 2007-03-01 | Fuji Photo Film Co., Ltd. | Optical information recording medium, optical information recording method and optical information reproducing method |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5032929A (enExample) * | 1973-07-23 | 1975-03-29 | ||
| JPS5129922A (en) * | 1974-09-06 | 1976-03-13 | Konishiroku Photo Ind | 2 seibunkeijiazogatasoseibutsu |
| JPS5260121A (en) * | 1975-11-11 | 1977-05-18 | Gunze Kk | Photosensitized small foam photosensitive thermosensitive recording material |
| JPS53104229A (en) * | 1977-02-22 | 1978-09-11 | Eastman Kodak Co | Photo bubble element |
| JPS54121802A (en) * | 1978-03-13 | 1979-09-21 | Tokyo Ouka Kougiyou Kk | Photosensitive printing plate |
| JPS5588049A (en) * | 1978-12-11 | 1980-07-03 | Ici Ltd | Recording material |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2703756A (en) | 1951-12-12 | 1955-03-08 | Gen Aniline & Film Corp | Vesicular prints and process of making same |
| US3408192A (en) | 1964-06-10 | 1968-10-29 | Ibm | Light-sensitive diazotype compositions and elements |
| US3620743A (en) | 1969-12-15 | 1971-11-16 | Norman T Notley | Vehicles for vesicular photographic materials |
| US3622336A (en) | 1970-01-27 | 1971-11-23 | Norman Thomas Notley | Vesicular light-sensitive materials comprising a copolymer of chloroacrylonitrile and methacrylonitrile |
| US3661589A (en) | 1970-02-18 | 1972-05-09 | Norman T Notley | Interfacial vesicular print materials and methods of preparation |
| FR2288993A1 (fr) * | 1974-08-23 | 1976-05-21 | Kalvar Corp | Melanges de resines pour ameliorer les systemes vesiculaires |
| US4152156A (en) | 1974-10-15 | 1979-05-01 | Xidex Corporation | Duplication-proof photographic film |
-
1982
- 1982-11-12 US US06/440,874 patent/US4430414A/en not_active Expired - Lifetime
-
1983
- 1983-11-11 JP JP58212299A patent/JPS59102231A/ja active Granted
- 1983-11-11 DE DE8383306910T patent/DE3378078D1/de not_active Expired
- 1983-11-11 EP EP83306910A patent/EP0109286B1/en not_active Expired
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5032929A (enExample) * | 1973-07-23 | 1975-03-29 | ||
| JPS5129922A (en) * | 1974-09-06 | 1976-03-13 | Konishiroku Photo Ind | 2 seibunkeijiazogatasoseibutsu |
| JPS5260121A (en) * | 1975-11-11 | 1977-05-18 | Gunze Kk | Photosensitized small foam photosensitive thermosensitive recording material |
| JPS53104229A (en) * | 1977-02-22 | 1978-09-11 | Eastman Kodak Co | Photo bubble element |
| JPS54121802A (en) * | 1978-03-13 | 1979-09-21 | Tokyo Ouka Kougiyou Kk | Photosensitive printing plate |
| JPS5588049A (en) * | 1978-12-11 | 1980-07-03 | Ici Ltd | Recording material |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4839872A (en) * | 1987-05-19 | 1989-06-13 | Thomson-Csf | Geophone with a sensitive element made of piezoelectric polymer |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0109286A3 (en) | 1986-03-12 |
| DE3378078D1 (en) | 1988-10-27 |
| JPH0433022B2 (enExample) | 1992-06-01 |
| EP0109286B1 (en) | 1988-09-21 |
| EP0109286A2 (en) | 1984-05-23 |
| US4430414A (en) | 1984-02-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3032414A (en) | System of photographic reproduction | |
| US3076707A (en) | Heat developable copy sheet and compositions useful therefor | |
| US4373020A (en) | Decolorizable imaging system | |
| US4916011A (en) | Element having improved antistatic layer | |
| JPS597362A (ja) | フオトサ−モグラフイツク積層感材 | |
| US3871887A (en) | Photothermographic composition, element and process | |
| US3884697A (en) | Photographic process utilizing spiropyran compound dispersed in nitrocellulose films with high nitrogen content | |
| US3355295A (en) | Nucleated vesicular film | |
| JPS6335964B2 (enExample) | ||
| DE2153628A1 (de) | Verwendung von Silbersalzkristallen zur Herstellung photographischer Aufzeichnungsmaterialien | |
| JPS59102231A (ja) | ビジキユラ−像形成材料 | |
| US3661589A (en) | Interfacial vesicular print materials and methods of preparation | |
| JPH0660993B2 (ja) | 帯電防止写真ベ−ス | |
| US3653902A (en) | Photographic materials | |
| US4587211A (en) | Photothermographic stabilizers for syringaldazine leuco dyes | |
| US3620743A (en) | Vehicles for vesicular photographic materials | |
| US4215191A (en) | Light-sensitive vesicular recording materials and process of using | |
| US5318874A (en) | O-naphthoquinone diazide photosensitive coating composition containing a polyvinyl pyrrolidone compound and a stannic halide | |
| US3622336A (en) | Vesicular light-sensitive materials comprising a copolymer of chloroacrylonitrile and methacrylonitrile | |
| EP0002323A1 (en) | Vesicular recording materials | |
| US3485631A (en) | Vesicular photographic materials | |
| US3251690A (en) | Vesicular materials and the use of such to produce photographic reproductions | |
| DE2840634A1 (de) | Aufzeichnungsmaterial fuer die herstellung von bildern | |
| US3208850A (en) | Vesicular type photographic materials comprising a polyurethane resin containing light decomposable compounds | |
| US3622335A (en) | Copolymers of an alpha acrylonitrile and a styrene used as vehicles in vesicular materials |