JPS5829731A - 酸化防止剤の製造方法 - Google Patents
酸化防止剤の製造方法Info
- Publication number
- JPS5829731A JPS5829731A JP57080298A JP8029882A JPS5829731A JP S5829731 A JPS5829731 A JP S5829731A JP 57080298 A JP57080298 A JP 57080298A JP 8029882 A JP8029882 A JP 8029882A JP S5829731 A JPS5829731 A JP S5829731A
- Authority
- JP
- Japan
- Prior art keywords
- alcohol
- trialkylbenzene
- hydroxybenzyl
- formaldehyde
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000003963 antioxidant agent Substances 0.000 title description 7
- 230000003078 antioxidant effect Effects 0.000 title description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 41
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 17
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 12
- 229920002866 paraformaldehyde Polymers 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 11
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 claims description 10
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 claims description 10
- 239000007983 Tris buffer Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- -1 alkyl carboxylic acid Chemical class 0.000 claims description 7
- 150000001735 carboxylic acids Chemical class 0.000 claims description 7
- 239000000243 solution Substances 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims 3
- 235000019445 benzyl alcohol Nutrition 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 230000008569 process Effects 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 5
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 241000861718 Chloris <Aves> Species 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WIHMGGWNMISDNJ-UHFFFAOYSA-N 1,1-dichloropropane Chemical compound CCC(Cl)Cl WIHMGGWNMISDNJ-UHFFFAOYSA-N 0.000 description 1
- FQERLIOIVXPZKH-UHFFFAOYSA-N 1,2,4-trioxane Chemical compound C1COOCO1 FQERLIOIVXPZKH-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- ZEOVXNVKXIPWMS-UHFFFAOYSA-N 2,2-dichloropropane Chemical compound CC(C)(Cl)Cl ZEOVXNVKXIPWMS-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- 241001272720 Medialuna californiensis Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- LGRLWUINFJPLSH-UHFFFAOYSA-N methanide Chemical compound [CH3-] LGRLWUINFJPLSH-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/16—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by condensation involving hydroxy groups of phenols or alcohols or the ether or mineral ester group derived therefrom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/263,768 US4340767A (en) | 1981-05-14 | 1981-05-14 | Antioxidant process using formaldehyde |
| US263768 | 1994-06-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5829731A true JPS5829731A (ja) | 1983-02-22 |
| JPS6222974B2 JPS6222974B2 (enExample) | 1987-05-20 |
Family
ID=23003154
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP57080298A Granted JPS5829731A (ja) | 1981-05-14 | 1982-05-14 | 酸化防止剤の製造方法 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4340767A (enExample) |
| EP (1) | EP0065289B1 (enExample) |
| JP (1) | JPS5829731A (enExample) |
| CA (1) | CA1167069A (enExample) |
| DE (1) | DE3262022D1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1187102A (en) * | 1982-12-16 | 1985-05-14 | George L. Mina | Antioxidant synthesis |
| JP2761822B2 (ja) * | 1992-02-12 | 1998-06-04 | 富士写真フイルム株式会社 | ポジ型フオトレジスト組成物 |
| US8766016B2 (en) | 2009-07-10 | 2014-07-01 | Albermarle Corporation | Green and atom-economical processes for producing phenolic antioxidants |
| US20210293913A1 (en) | 2020-03-18 | 2021-09-23 | Ricoh Company, Ltd. | Magnetic measuring system and magnetic measuring device |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3925488A (en) * | 1971-05-24 | 1975-12-09 | Ethyl Corp | Process for the production of 1,3,5-trimethy-2,4,6-tris(3,5-di-tert-alkyl-4-hydroxybenzyl)benzene |
| JPS54160352A (en) * | 1978-06-05 | 1979-12-19 | Cincinnati Milacron Chem | Multiinuclear hindadophenol |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2905737A (en) * | 1955-07-05 | 1959-09-22 | Firestone Tire & Rubber Co | Sulfur vulcanized rubber composition containing phenol reaction product as an oxidation inhibitor, and method of making same |
| US2929849A (en) * | 1959-06-11 | 1960-03-22 | Firestone Tire & Rubber Co | Reaction products of 2, 6-bishydroxymethyl-4-phenylphenol and alkyl phenols |
| NL131910C (enExample) * | 1960-07-11 | |||
| NL275312A (enExample) * | 1961-04-22 | |||
| US3309339A (en) * | 1963-11-12 | 1967-03-14 | Allied Chem | New trisphenols and epoxide resins prepared therefrom |
| US3644538A (en) * | 1967-08-22 | 1972-02-22 | Exxon Research Engineering Co | Hindered trisphenols |
| DE1910793A1 (de) * | 1969-03-04 | 1970-09-17 | F Raschig Gmbh Dr | Verfahren zur Herstellung von substituierten 1,3,5-Trimethyl-2,4,6-tris-(4-hydroxybenzyl)-benzolen |
| US3845142A (en) * | 1972-01-28 | 1974-10-29 | Y Gurvich | Process for producing polycyclic alkylphenols |
| PT67131A (en) * | 1976-10-12 | 1977-11-01 | Nii R I Latexnykh Izdely | Method for the production of 2,4,6-tri-(3,5-ditertiary butyl-4-hydroxybenzyl)mesitylene |
-
1981
- 1981-05-14 US US06/263,768 patent/US4340767A/en not_active Expired - Fee Related
-
1982
- 1982-05-07 CA CA000402486A patent/CA1167069A/en not_active Expired
- 1982-05-13 EP EP82104202A patent/EP0065289B1/en not_active Expired
- 1982-05-13 DE DE8282104202T patent/DE3262022D1/de not_active Expired
- 1982-05-14 JP JP57080298A patent/JPS5829731A/ja active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3925488A (en) * | 1971-05-24 | 1975-12-09 | Ethyl Corp | Process for the production of 1,3,5-trimethy-2,4,6-tris(3,5-di-tert-alkyl-4-hydroxybenzyl)benzene |
| JPS54160352A (en) * | 1978-06-05 | 1979-12-19 | Cincinnati Milacron Chem | Multiinuclear hindadophenol |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0065289B1 (en) | 1985-01-23 |
| CA1167069A (en) | 1984-05-08 |
| JPS6222974B2 (enExample) | 1987-05-20 |
| DE3262022D1 (en) | 1985-03-07 |
| EP0065289A1 (en) | 1982-11-24 |
| US4340767A (en) | 1982-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2342101A (en) | Preparation of dihydro mucononitrile and product | |
| US2462433A (en) | Preparation of organic thiocyanates and isothiocyanates | |
| US1926068A (en) | Oxidation of alcohols | |
| JPS5829731A (ja) | 酸化防止剤の製造方法 | |
| Mason et al. | β, β', β ″-Trichlorotriethylamine | |
| US2361259A (en) | Cyanoethylated nitro compounds and process for preparing same | |
| US2992269A (en) | Manufacture of cycloalkyl esters | |
| US3043880A (en) | Process for preparing 1, 2-ethanedithiol | |
| US2293969A (en) | Manufacture of cyanoacrylic acid esters | |
| US2382085A (en) | Synthesis of vitamin a | |
| US2178099A (en) | Organic mercury compound and a method of producing the same | |
| US3282931A (en) | Dibenzylidene-benzenediacetonitriles | |
| US1998750A (en) | Salicylic acid derivative | |
| US2819291A (en) | Halogenated nitriles | |
| US2205395A (en) | 2-chloroallyl ethers of phenols | |
| US6093857A (en) | Preparation of cyclopentanols | |
| Hatch et al. | Allylic Chlorides. VI. Preparation of the 1, 3-Dichloro-2-butenes | |
| US3157668A (en) | Production of 5-vinyl-2-oxazolidone | |
| US3118953A (en) | 1, 3-di-(p-cyclopenten-2-yl-phenoxy)-propanol-2 | |
| US3256309A (en) | Preparation of cyanformimide esters | |
| JPS62263194A (ja) | テトラアセチルアルブチンの製造法 | |
| US3448155A (en) | Process for the hydrolysis of 7,7-dihalobicyclo - (3.2.0) - 2 - heptene - 6 - ones to tropolones | |
| US3642867A (en) | Process for the preparation of a 1 2-bis(4-carboalkoxyphenoxy)ethane | |
| US3259647A (en) | Phenylalkanoates | |
| US2895927A (en) | Synthesis of thyronine compounds |