JPS57140028A - Avita circuit - Google Patents
Avita circuitInfo
- Publication number
- JPS57140028A JPS57140028A JP57005501A JP550182A JPS57140028A JP S57140028 A JPS57140028 A JP S57140028A JP 57005501 A JP57005501 A JP 57005501A JP 550182 A JP550182 A JP 550182A JP S57140028 A JPS57140028 A JP S57140028A
- Authority
- JP
- Japan
- Prior art keywords
- avita
- circuit
- avita circuit
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 title 2
- 239000011717 all-trans-retinol Substances 0.000 title 1
- 235000019169 all-trans-retinol Nutrition 0.000 title 1
- 229940058140 avita Drugs 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K3/00—Circuits for generating electric pulses; Monostable, bistable or multistable circuits
- H03K3/02—Generators characterised by the type of circuit or by the means used for producing pulses
- H03K3/027—Generators characterised by the type of circuit or by the means used for producing pulses by the use of logic circuits, with internal or external positive feedback
- H03K3/037—Bistable circuits
- H03K3/0375—Bistable circuits provided with means for increasing reliability; for protection; for ensuring a predetermined initial state when the supply voltage has been applied; for storing the actual state when the supply voltage fails
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K5/00—Manipulating of pulses not covered by one of the other main groups of this subclass
- H03K5/22—Circuits having more than one input and one output for comparing pulses or pulse trains with each other according to input signal characteristics, e.g. slope, integral
- H03K5/26—Circuits having more than one input and one output for comparing pulses or pulse trains with each other according to input signal characteristics, e.g. slope, integral the characteristic being duration, interval, position, frequency, or sequence
Landscapes
- Physics & Mathematics (AREA)
- Nonlinear Science (AREA)
- Manipulation Of Pulses (AREA)
- Logic Circuits (AREA)
- Electronic Switches (AREA)
- Lock And Its Accessories (AREA)
- Bus Control (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/227,514 US4398105A (en) | 1981-01-22 | 1981-01-22 | Arbiter circuit |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57140028A true JPS57140028A (en) | 1982-08-30 |
| JPH033964B2 JPH033964B2 (enExample) | 1991-01-21 |
Family
ID=22853402
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP57005501A Granted JPS57140028A (en) | 1981-01-22 | 1982-01-19 | Avita circuit |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4398105A (enExample) |
| JP (1) | JPS57140028A (enExample) |
| KR (1) | KR900005229B1 (enExample) |
| CA (1) | CA1176715A (enExample) |
| DE (1) | DE3200894A1 (enExample) |
| FR (1) | FR2498396B1 (enExample) |
| GB (1) | GB2091965B (enExample) |
| IE (1) | IE52515B1 (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4620118A (en) * | 1982-10-01 | 1986-10-28 | At&T Bell Laboratories | Dual port access circuit with automatic asynchronous contention resolving capability |
| US4502014A (en) * | 1982-11-24 | 1985-02-26 | Rca Corporation | Coincident pulse cancelling circuit |
| US5144158A (en) * | 1984-11-19 | 1992-09-01 | Fujitsu Limited | ECL latch circuit having a noise resistance circuit in only one feedback path |
| DE3788360T2 (de) * | 1986-09-03 | 1994-03-17 | Renishaw Plc | Signalverarbeitung für Berührungstastkopf. |
| US4800296A (en) * | 1987-05-05 | 1989-01-24 | Texas Instruments Incorporated | Metastable defeating fli-flop |
| EP0308294A3 (en) * | 1987-09-18 | 1991-04-03 | STMicroelectronics, Inc. | Noise-resistant arbiter circuit |
| US4820939A (en) * | 1987-11-24 | 1989-04-11 | National Semiconductor Corporation | Finite metastable time synchronizer |
| US4841178A (en) * | 1988-02-23 | 1989-06-20 | Northern Telecom Limited | Asynchronous processor arbitration circuit |
| US4894565A (en) * | 1988-08-11 | 1990-01-16 | American Microsystems, Inc. | Asynchronous digital arbiter |
| US4963772A (en) * | 1989-02-07 | 1990-10-16 | North American Philips Corp., Signetics Div. | Metastable-immune flip-flop arrangement |
| US5038059A (en) * | 1990-02-20 | 1991-08-06 | Vlsi Technology, Inc. | Status register with asynchronous set and reset signals |
| EP0464237A1 (en) * | 1990-07-03 | 1992-01-08 | International Business Machines Corporation | Bus arbitration scheme |
| US5081377A (en) * | 1990-09-21 | 1992-01-14 | At&T Bell Laboratories | Latch circuit with reduced metastability |
| US5138189A (en) * | 1990-09-27 | 1992-08-11 | National Semiconductor | Asynchronous state machine synchronization circuit and method |
| US5266844A (en) * | 1991-07-15 | 1993-11-30 | Hewlett-Packard Company | Timing discriminator circuit and method for determining the arrival order of input signals |
| US5289060A (en) * | 1992-09-16 | 1994-02-22 | Texas Instruments Incorporated | Programmable glitch filter |
| US5789945A (en) * | 1996-02-27 | 1998-08-04 | Philips Electronics North America Corporation | Method and circuit for improving metastable resolving time in low-power multi-state devices |
| US6188249B1 (en) * | 1998-06-30 | 2001-02-13 | Sun Microsystems, Inc. | Asymmetric arbiter with fast signal path |
| US6512397B1 (en) * | 2001-08-20 | 2003-01-28 | International Business Machines Corporation | Circuit structures and methods for high-speed low-power select arbitration |
| US6781418B1 (en) | 2001-09-21 | 2004-08-24 | Cypress Semiconductor Corp. | Arbiter/pulse discriminator circuits with improved metastable failure rate by delayed balance point adjustment |
| US6744151B2 (en) * | 2002-09-13 | 2004-06-01 | Analog Devices, Inc. | Multi-channel power supply selector |
| US7225283B1 (en) * | 2003-12-23 | 2007-05-29 | Cypress Semiconductor Corporation | Asynchronous arbiter with bounded resolution time and predictable output state |
| US7383370B1 (en) | 2005-03-31 | 2008-06-03 | Cypress Semiconductor Corporation | Arbiter circuit and signal arbitration method |
| FR2888017B1 (fr) * | 2005-07-01 | 2007-08-31 | Atmel Nantes Sa Sa | Dispositif d'arbitrage asynchrone et microcontroleur comprenant un tel dispositif d'arbitrage |
| US7839179B2 (en) * | 2007-06-13 | 2010-11-23 | Micron Technology, Inc. | Balanced phase detector |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3219845A (en) * | 1964-12-07 | 1965-11-23 | Rca Corp | Bistable electrical circuit utilizing nor circuits without a.c. coupling |
| US3646455A (en) * | 1970-10-08 | 1972-02-29 | Mohawk Data Sciences Corp | Phase-detecting circuit |
| US3764902A (en) * | 1972-04-24 | 1973-10-09 | Hewlett Packard Co | Phasemeter employing means for preventing errors in the phase reading produced by noise |
| US3824409A (en) * | 1972-06-12 | 1974-07-16 | Massachusetts Inst Technology | Arbiter circuits |
| US3761739A (en) * | 1972-06-23 | 1973-09-25 | Ibm | Non-metastable asynchronous latch |
| GB1461330A (en) * | 1974-04-16 | 1977-01-13 | Ferranti Ltd | Pulse circuits |
| US4093878A (en) * | 1976-11-29 | 1978-06-06 | Ncr Corporation | De-glitchablenon-metastable flip-flop circuit |
| CS203304B1 (cs) * | 1978-02-02 | 1981-02-27 | Miroslav Pechoucek | Klopný obvod spouštěný a ošetřený proti metastabilním stavům |
| US4339731A (en) * | 1980-06-05 | 1982-07-13 | Rockwell International Corporation | Stable, fast slew, phase locked loop |
| DE3036170A1 (de) * | 1980-09-25 | 1982-04-29 | Siemens AG, 1000 Berlin und 8000 München | Digital gesteuerte halbleiterschaltung |
-
1981
- 1981-01-22 US US06/227,514 patent/US4398105A/en not_active Expired - Lifetime
-
1982
- 1982-01-14 DE DE19823200894 patent/DE3200894A1/de active Granted
- 1982-01-18 FR FR8200685A patent/FR2498396B1/fr not_active Expired
- 1982-01-18 GB GB8201252A patent/GB2091965B/en not_active Expired
- 1982-01-19 JP JP57005501A patent/JPS57140028A/ja active Granted
- 1982-01-19 KR KR8200209A patent/KR900005229B1/ko not_active Expired
- 1982-01-19 IE IE103/82A patent/IE52515B1/en not_active IP Right Cessation
- 1982-01-21 CA CA000394622A patent/CA1176715A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2498396A1 (fr) | 1982-07-23 |
| CA1176715A (en) | 1984-10-23 |
| FR2498396B1 (fr) | 1988-10-14 |
| US4398105A (en) | 1983-08-09 |
| IE820103L (en) | 1982-07-22 |
| DE3200894A1 (de) | 1982-09-02 |
| KR900005229B1 (ko) | 1990-07-21 |
| GB2091965A (en) | 1982-08-04 |
| DE3200894C2 (enExample) | 1987-05-21 |
| GB2091965B (en) | 1984-08-01 |
| JPH033964B2 (enExample) | 1991-01-21 |
| KR830009695A (ko) | 1983-12-22 |
| IE52515B1 (en) | 1987-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2102602B (en) | Interface circuit | |
| GB2101374B (en) | Interface circuit | |
| GB2097590B (en) | Circuit breaker | |
| JPS57140028A (en) | Avita circuit | |
| JPS57138256A (en) | Substriber line circuit | |
| JPS57152627A (en) | Circuit breaker unit | |
| GB8333133D0 (en) | Sample-&-hold circuit | |
| DE3265756D1 (en) | Hyperfrequency circuit | |
| DE3276990D1 (en) | Josephson-junction logic circuit | |
| GB2095039B (en) | Circuit assembly | |
| DE3268213D1 (en) | Circuit breaker | |
| GB2100543B (en) | Chatter-prevention circuit | |
| JPS57174936A (en) | Potential selecting circuit | |
| DE3268425D1 (en) | Circuit utilizing josephson effect | |
| JPS57207430A (en) | Logic circuit | |
| DE3279793D1 (en) | Electrical circuits | |
| DE3273549D1 (en) | Restructurable integrated circuit | |
| YU100382A (en) | Direction circuit | |
| DE3277434D1 (en) | Reference time-detecting circuit | |
| GB2097565B (en) | Synchronising circuit | |
| DE3268138D1 (en) | Circuit utilizing josephson effect | |
| JPS57176839A (en) | Switching circuit | |
| EP0061097A3 (en) | Circuit breaker | |
| GB2096368B (en) | Circuit design | |
| GB2112972B (en) | Logic circuit |