JPS56118083A - Furo(3,2-b)(1,8)naphthyridine derivative - Google Patents
Furo(3,2-b)(1,8)naphthyridine derivativeInfo
- Publication number
- JPS56118083A JPS56118083A JP2144180A JP2144180A JPS56118083A JP S56118083 A JPS56118083 A JP S56118083A JP 2144180 A JP2144180 A JP 2144180A JP 2144180 A JP2144180 A JP 2144180A JP S56118083 A JPS56118083 A JP S56118083A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- compound
- acid
- lower alkyl
- naphthyridine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- UNEKFDRTMAVLBN-UHFFFAOYSA-N furo[3,2-b][1,8]naphthyridine Chemical class C1=CC=C2C=C(OC=C3)C3=NC2=N1 UNEKFDRTMAVLBN-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 238000010438 heat treatment Methods 0.000 abstract 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 abstract 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 abstract 1
- JTLAIKFGRHDNQM-UHFFFAOYSA-N 1-bromo-2-fluoroethane Chemical compound FCCBr JTLAIKFGRHDNQM-UHFFFAOYSA-N 0.000 abstract 1
- XDIRZTLVKQQKJH-UHFFFAOYSA-N 2,3,5,8-tetrahydrofuro[3,2-b][1,8]naphthyridine-7-carboxylic acid Chemical class C1=C2CC(C(=O)O)=CNC2=NC2=C1OCC2 XDIRZTLVKQQKJH-UHFFFAOYSA-N 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000005265 dialkylamine group Chemical group 0.000 abstract 1
- 230000000855 fungicidal effect Effects 0.000 abstract 1
- 239000000417 fungicide Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 229910000027 potassium carbonate Inorganic materials 0.000 abstract 1
- 239000002516 radical scavenger Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2144180A JPS56118083A (en) | 1980-02-22 | 1980-02-22 | Furo(3,2-b)(1,8)naphthyridine derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2144180A JPS56118083A (en) | 1980-02-22 | 1980-02-22 | Furo(3,2-b)(1,8)naphthyridine derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS56118083A true JPS56118083A (en) | 1981-09-16 |
| JPS6221798B2 JPS6221798B2 (enExample) | 1987-05-14 |
Family
ID=12055045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2144180A Granted JPS56118083A (en) | 1980-02-22 | 1980-02-22 | Furo(3,2-b)(1,8)naphthyridine derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS56118083A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2008046135A1 (en) * | 2006-10-16 | 2008-04-24 | Bionomics Limited | Novel anxiolytic compounds |
| US9023848B2 (en) | 2011-03-02 | 2015-05-05 | Bionomics Limited | Small-molecules as therapeutics |
| US9133188B2 (en) | 2011-05-12 | 2015-09-15 | Bionomics Limited | Methods for preparing naphthyridines |
| US10954231B2 (en) | 2006-10-16 | 2021-03-23 | Bionomics Limited | Anxiolytic compounds |
-
1980
- 1980-02-22 JP JP2144180A patent/JPS56118083A/ja active Granted
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2008046135A1 (en) * | 2006-10-16 | 2008-04-24 | Bionomics Limited | Novel anxiolytic compounds |
| US8293737B2 (en) | 2006-10-16 | 2012-10-23 | Bionomics Limited | Anxiolytic compounds |
| US8551990B2 (en) | 2006-10-16 | 2013-10-08 | Bionomics Limited | Anxiolytic compounds |
| US8614212B2 (en) | 2006-10-16 | 2013-12-24 | Bionomics Limited | Anxiolytic compounds |
| US8906912B2 (en) | 2006-10-16 | 2014-12-09 | Bionomics Limited | Anxiolytic compounds |
| US9573945B2 (en) | 2006-10-16 | 2017-02-21 | Bionomics Limited | Anxiolytic compounds |
| JP2017105818A (ja) * | 2006-10-16 | 2017-06-15 | バイオノミクス リミテッド | 新規な抗不安薬化合物 |
| US9975892B2 (en) | 2006-10-16 | 2018-05-22 | Bionomics Limited | Anxiolytic compounds |
| US10233181B2 (en) | 2006-10-16 | 2019-03-19 | Bionomics Limited | Anxiolytic compounds |
| US10954231B2 (en) | 2006-10-16 | 2021-03-23 | Bionomics Limited | Anxiolytic compounds |
| US9023848B2 (en) | 2011-03-02 | 2015-05-05 | Bionomics Limited | Small-molecules as therapeutics |
| US9133188B2 (en) | 2011-05-12 | 2015-09-15 | Bionomics Limited | Methods for preparing naphthyridines |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6221798B2 (enExample) | 1987-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE832530L (en) | PROCESS FOR PRODUCING ß-CARBOLINE DERIVATIVES | |
| JPS56118083A (en) | Furo(3,2-b)(1,8)naphthyridine derivative | |
| JPS57109787A (en) | Pyrazoloindazole derivative | |
| JPS5549352A (en) | Cyclic iminocarboxylic acid derivative and its salt | |
| JPS56138151A (en) | Preparation of beta-chloroalanine | |
| JPS56118081A (en) | Preparation of 6-methoxy-1,8-naphthyridine | |
| JPS5748984A (en) | Pyrid 2,3-d pyrimidine-6-glyoxylic derivative and its salt | |
| JPS55120591A (en) | Phosphinoethylmalonic acid derivative, and preparation thereof | |
| JPS578222A (en) | Production of low terminal-carboxyl content polyester | |
| JPS5610135A (en) | Preparation of di-n-propylmalonic acid | |
| JPS56125386A (en) | Pyrido (2,3-d)pyrimidine derivative and its preparation | |
| JPS57106678A (en) | Preparation of dibenzothiepinpropionic acid derivative | |
| JPS55372A (en) | Preparation of dibenzoxepin derivative | |
| JPS5716882A (en) | Production of benzo-heteroring derivative | |
| JPS5721348A (en) | 2- 1-methyl-2-propenyl -3-hydroxyundecanoic derivative | |
| JPS57116048A (en) | Novel quinoline derivative | |
| JPS5610190A (en) | Preparation of benzopyranopyridine derivative | |
| JPS5759897A (en) | Thiazolineazatidinone | |
| JPS56128760A (en) | Novel pyridyl-2-oxybenzene derivative | |
| JPS5572139A (en) | Preparation of 4-allyloxy-3,5-disubstituted-phenylacetic acid | |
| JPS5479247A (en) | Para-substituted phenylacetic acid derivative and its preparation | |
| JPS5795932A (en) | Preparation of hydroquinone derivative | |
| JPS56150049A (en) | Production of d-2-amino-2- 1,4-cyclohexadienyl acetic acid | |
| JPS57158787A (en) | 1-h-4-h-pyrazolo(4',3':5,6)pyrano(2,3-b)pyridine derivative | |
| JPS5498327A (en) | Herbicidal composition |