JPS56113768A - Compound - Google Patents
CompoundInfo
- Publication number
- JPS56113768A JPS56113768A JP1727280A JP1727280A JPS56113768A JP S56113768 A JPS56113768 A JP S56113768A JP 1727280 A JP1727280 A JP 1727280A JP 1727280 A JP1727280 A JP 1727280A JP S56113768 A JPS56113768 A JP S56113768A
- Authority
- JP
- Japan
- Prior art keywords
- reacted
- compound
- afford
- resultant
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title abstract 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 abstract 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 2
- OXPDQFOKSZYEMJ-UHFFFAOYSA-N 2-phenylpyrimidine Chemical class C1=CC=CC=C1C1=NC=CC=N1 OXPDQFOKSZYEMJ-UHFFFAOYSA-N 0.000 abstract 1
- NHQUJEQINIHXMP-UHFFFAOYSA-N 4-(5-propylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCC)=CN=C1C1=CC=C(C#N)C=C1 NHQUJEQINIHXMP-UHFFFAOYSA-N 0.000 abstract 1
- ADCUEPOHPCPMCE-UHFFFAOYSA-N 4-cyanobenzoic acid Chemical compound OC(=O)C1=CC=C(C#N)C=C1 ADCUEPOHPCPMCE-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- YQLMHXJICJZZFV-UHFFFAOYSA-N [amino-(4-ethoxycarbonylphenyl)methylidene]azanium;chloride Chemical compound [Cl-].CCOC(=O)C1=CC=C(C([NH3+])=N)C=C1 YQLMHXJICJZZFV-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- JLSSWDFCYXSLQX-UHFFFAOYSA-N ethyl 4-cyanobenzoate Chemical compound CCOC(=O)C1=CC=C(C#N)C=C1 JLSSWDFCYXSLQX-UHFFFAOYSA-N 0.000 abstract 1
- 239000007789 gas Substances 0.000 abstract 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 abstract 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 239000004973 liquid crystal related substance Substances 0.000 abstract 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 abstract 1
- 239000000395 magnesium oxide Substances 0.000 abstract 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
Landscapes
- Liquid Crystal (AREA)
- Liquid Crystal Substances (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1727280A JPS56113768A (en) | 1980-02-15 | 1980-02-15 | Compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1727280A JPS56113768A (en) | 1980-02-15 | 1980-02-15 | Compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS56113768A true JPS56113768A (en) | 1981-09-07 |
| JPH0223596B2 JPH0223596B2 (enExample) | 1990-05-24 |
Family
ID=11939327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP1727280A Granted JPS56113768A (en) | 1980-02-15 | 1980-02-15 | Compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS56113768A (enExample) |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53114788A (en) * | 1974-10-25 | 1978-10-06 | Hoffmann La Roche | Nematic liquid crystal matter mixture |
| JPS5495986A (en) * | 1977-12-08 | 1979-07-28 | Bueruku Fuyua Fuerunzeerekutor | Nematic liquid crystal mixture |
-
1980
- 1980-02-15 JP JP1727280A patent/JPS56113768A/ja active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53114788A (en) * | 1974-10-25 | 1978-10-06 | Hoffmann La Roche | Nematic liquid crystal matter mixture |
| JPS5495986A (en) * | 1977-12-08 | 1979-07-28 | Bueruku Fuyua Fuerunzeerekutor | Nematic liquid crystal mixture |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0223596B2 (enExample) | 1990-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5668636A (en) | Phenyl cyclohexane derivative | |
| JPS54109949A (en) | Trans-(equatorial-equatorial) 1,4-disubstituted cyclohexane derivative | |
| JPS56113768A (en) | Compound | |
| JPS56164170A (en) | Liquid crystal compound | |
| JPS57165326A (en) | Trans-4-alkyl-(4'-fluorobiphenyl-4)cyclohexane | |
| JPS57165334A (en) | Halogenobenzene derivative having optical active 2- methylbutyloxyphenyl group | |
| JPS559012A (en) | Liquid crystal compound | |
| JPS57140737A (en) | Colorless liquid crystal substance, colorless liquid crystal composition, and display element of liquid crystal | |
| GEP20033119B (en) | Novel Octahydro-6, 10-Dioxo-6H-Pyridazino {1,2-a}{1 Carboxylic Acid Derivatives, Method for Preparation and Use Thereof | |
| JPS5770851A (en) | Cinnamoyl nitrile | |
| JPS56104844A (en) | Carboxylic ester derivative of 4-fluorophenol | |
| JPS56150030A (en) | 4'-alkyl-4-fluorobiphenyl | |
| JPS56164169A (en) | Liquid crystal compound | |
| JPS577457A (en) | Ester | |
| JPS5711935A (en) | 4'-alkyl-1'-cyclohexene-1'-yl-4-methoxybenzene | |
| JPS5646855A (en) | Liquid crystal substance | |
| JPS55311A (en) | Liquid crystal compound | |
| JPS6466161A (en) | 2-phenylpyridine derivative | |
| JPS57139074A (en) | P-(trans-5-alkyl-1,3-dioxane-2-yl)phenyl p- halogenobenzoate | |
| JPS56110777A (en) | Ester derivative of 4-fluorobenzoic acid | |
| JPS56140944A (en) | Cyclohexylmethyl phenyl ether derivative | |
| JPS5683449A (en) | Cyclohexanecarboxylic acid cyclohexyl ester derivative | |
| JPS5735552A (en) | Cinnamonitrile compound | |
| JPS5679647A (en) | Liquid crystalline compound | |
| JPS5781440A (en) | 4-fluorophenol cinnamic acid ester derivative |