JPH0544450B2 - - Google Patents
Info
- Publication number
- JPH0544450B2 JPH0544450B2 JP829885A JP829885A JPH0544450B2 JP H0544450 B2 JPH0544450 B2 JP H0544450B2 JP 829885 A JP829885 A JP 829885A JP 829885 A JP829885 A JP 829885A JP H0544450 B2 JPH0544450 B2 JP H0544450B2
- Authority
- JP
- Japan
- Prior art keywords
- carbon atoms
- formula
- dithia
- alkyl
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims description 73
- 125000004432 carbon atom Chemical group C* 0.000 claims description 65
- -1 11-dodecynyl Chemical group 0.000 claims description 46
- 239000000203 mixture Substances 0.000 claims description 38
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229960002255 azelaic acid Drugs 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000004001 thioalkyl group Chemical group 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 150000002617 leukotrienes Chemical class 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 239000008024 pharmaceutical diluent Substances 0.000 claims description 5
- 239000005557 antagonist Substances 0.000 claims description 4
- BZIQJBXFRMPKTR-UHFFFAOYSA-N 3-[1-(2-carboxyethylsulfanyl)-1-(2-undecoxyphenyl)ethyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=CC=C1C(C)(SCCC(O)=O)SCCC(O)=O BZIQJBXFRMPKTR-UHFFFAOYSA-N 0.000 claims description 3
- PNCHHOQSFSFTLA-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-undecoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O PNCHHOQSFSFTLA-UHFFFAOYSA-N 0.000 claims description 3
- DDMDMDIPQGFBED-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-[2-(8-cyclohexyloctyl)phenyl]methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC=CC=C1CCCCCCCCC1CCCCC1 DDMDMDIPQGFBED-UHFFFAOYSA-N 0.000 claims description 3
- 239000000443 aerosol Substances 0.000 claims description 3
- 238000007911 parenteral administration Methods 0.000 claims description 3
- QXRHBPIFLPGMQO-UHFFFAOYSA-N 3-[(5-bromo-2-undecoxyphenyl)-(2-carboxyethylsulfanyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=C(Br)C=C1C(SCCC(O)=O)SCCC(O)=O QXRHBPIFLPGMQO-UHFFFAOYSA-N 0.000 claims description 2
- IQQMOAWDVLGISG-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-decylphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O IQQMOAWDVLGISG-UHFFFAOYSA-N 0.000 claims description 2
- DHVCRZJQBSNOHZ-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-dodec-11-ynylphenyl)methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC=CC=C1CCCCCCCCCCC#C DHVCRZJQBSNOHZ-UHFFFAOYSA-N 0.000 claims description 2
- PEDBVGXUGSZQBG-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-dodecylphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O PEDBVGXUGSZQBG-UHFFFAOYSA-N 0.000 claims description 2
- LZZXFNNYJMJEFL-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-nonoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCOC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O LZZXFNNYJMJEFL-UHFFFAOYSA-N 0.000 claims description 2
- FDEILESHCBSGDV-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-octylphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O FDEILESHCBSGDV-UHFFFAOYSA-N 0.000 claims description 2
- QLCZDHMXLNJXHS-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(2-undecylsulfanylphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCSC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O QLCZDHMXLNJXHS-UHFFFAOYSA-N 0.000 claims description 2
- YPMZBKQYZDXAAD-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(3-dodecylthiophen-2-yl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCCC=1C=CSC=1C(SCCC(O)=O)SCCC(O)=O YPMZBKQYZDXAAD-UHFFFAOYSA-N 0.000 claims description 2
- PNLVUVAWZGCJHS-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(3-nonoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCOC1=CC=CC(C(SCCC(O)=O)SCCC(O)=O)=C1 PNLVUVAWZGCJHS-UHFFFAOYSA-N 0.000 claims description 2
- QXMCPJKVYIEUSQ-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(3-undecoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=CC(C(SCCC(O)=O)SCCC(O)=O)=C1 QXMCPJKVYIEUSQ-UHFFFAOYSA-N 0.000 claims description 2
- CEZOAWAOXBVCPM-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(5-hydroxy-2-undecoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=C(O)C=C1C(SCCC(O)=O)SCCC(O)=O CEZOAWAOXBVCPM-UHFFFAOYSA-N 0.000 claims description 2
- IYWIRJBMFCOWHN-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(5-methoxy-2-undecoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=C(OC)C=C1C(SCCC(O)=O)SCCC(O)=O IYWIRJBMFCOWHN-UHFFFAOYSA-N 0.000 claims description 2
- UBXFQYMXDODOLD-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(5-nitro-2-undecoxyphenyl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCOC1=CC=C([N+]([O-])=O)C=C1C(SCCC(O)=O)SCCC(O)=O UBXFQYMXDODOLD-UHFFFAOYSA-N 0.000 claims description 2
- GEZVDUJVSIHSRL-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-[2-(12,12,12-trifluorododecyl)phenyl]methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC=CC=C1CCCCCCCCCCCC(F)(F)F GEZVDUJVSIHSRL-UHFFFAOYSA-N 0.000 claims description 2
- GUJYESGGXFTPEY-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-[2-(6-phenylhexoxy)phenyl]methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC=CC=C1OCCCCCCC1=CC=CC=C1 GUJYESGGXFTPEY-UHFFFAOYSA-N 0.000 claims description 2
- HPDCVSUTOBCBFF-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-[2-(8-phenyloctyl)phenyl]methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC=CC=C1CCCCCCCCC1=CC=CC=C1 HPDCVSUTOBCBFF-UHFFFAOYSA-N 0.000 claims description 2
- USNXDIGYHYCXRZ-SDNWHVSQSA-N 3-[2-carboxyethylsulfanyl-[2-[(e)-dodec-1-enyl]phenyl]methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCC\C=C\C1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O USNXDIGYHYCXRZ-SDNWHVSQSA-N 0.000 claims description 2
- PIIPEHUZGANZAY-UHFFFAOYSA-N 3-[[2-[4-(4-butylphenyl)butyl]phenyl]-(2-carboxyethylsulfanyl)methyl]sulfanylpropanoic acid Chemical compound C1=CC(CCCC)=CC=C1CCCCC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O PIIPEHUZGANZAY-UHFFFAOYSA-N 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims description 2
- 238000011200 topical administration Methods 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 7
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims 6
- 125000002071 phenylalkoxy group Chemical group 0.000 claims 6
- 229910052799 carbon Inorganic materials 0.000 claims 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 4
- 229930192474 thiophene Natural products 0.000 claims 3
- NHNMQZGEZGQBBW-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-[2-(8-phenyloctyl)-5-(trifluoromethyl)phenyl]methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC(C(F)(F)F)=CC=C1CCCCCCCCC1=CC=CC=C1 NHNMQZGEZGQBBW-UHFFFAOYSA-N 0.000 claims 1
- ZEWCLTWIGFQTFS-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-[3-(8-phenyloctyl)phenyl]methyl]sulfanylpropanoic acid Chemical compound OC(=O)CCSC(SCCC(O)=O)C1=CC=CC(CCCCCCCCC=2C=CC=CC=2)=C1 ZEWCLTWIGFQTFS-UHFFFAOYSA-N 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- 239000008174 sterile solution Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 85
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 69
- 239000000243 solution Substances 0.000 description 64
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 52
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- 239000000047 product Substances 0.000 description 38
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- 239000011541 reaction mixture Substances 0.000 description 32
- 239000003921 oil Substances 0.000 description 30
- 235000019198 oils Nutrition 0.000 description 30
- 238000002844 melting Methods 0.000 description 26
- 230000008018 melting Effects 0.000 description 26
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 25
- 238000000921 elemental analysis Methods 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000012044 organic layer Substances 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 238000003818 flash chromatography Methods 0.000 description 18
- 239000007787 solid Substances 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- 239000012300 argon atmosphere Substances 0.000 description 17
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 150000001299 aldehydes Chemical class 0.000 description 14
- 238000000034 method Methods 0.000 description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- 239000007788 liquid Substances 0.000 description 13
- 238000007429 general method Methods 0.000 description 12
- 239000003039 volatile agent Substances 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000012267 brine Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 9
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Substances FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 7
- 239000011777 magnesium Substances 0.000 description 7
- 229910052749 magnesium Inorganic materials 0.000 description 7
- 239000002243 precursor Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- ZGDUNGBWVZKWGE-UHFFFAOYSA-N 2-(2-methoxyphenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound COC1=CC=CC=C1C1=NC(C)(C)CO1 ZGDUNGBWVZKWGE-UHFFFAOYSA-N 0.000 description 5
- 229910015900 BF3 Inorganic materials 0.000 description 5
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 210000001519 tissue Anatomy 0.000 description 5
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- 241000700199 Cavia porcellus Species 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 208000006673 asthma Diseases 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 230000008602 contraction Effects 0.000 description 4
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 206010020751 Hypersensitivity Diseases 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical class CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical compound [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 3
- 229960004484 carbachol Drugs 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- GWNVDXQDILPJIG-NXOLIXFESA-N leukotriene C4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@@H](C(=O)NCC(O)=O)NC(=O)CC[C@H](N)C(O)=O GWNVDXQDILPJIG-NXOLIXFESA-N 0.000 description 3
- LTEFPBDFUVJVGU-UHFFFAOYSA-N octa-1,7-diynylbenzene Chemical compound C#CCCCCC#CC1=CC=CC=C1 LTEFPBDFUVJVGU-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- PBLNBZIONSLZBU-UHFFFAOYSA-N 1-bromododecane Chemical compound CCCCCCCCCCCCBr PBLNBZIONSLZBU-UHFFFAOYSA-N 0.000 description 2
- IKPSIIAXIDAQLG-UHFFFAOYSA-N 1-bromoundecane Chemical compound CCCCCCCCCCCBr IKPSIIAXIDAQLG-UHFFFAOYSA-N 0.000 description 2
- QZIRCKPSTFRSCC-UHFFFAOYSA-N 2-(8-phenyloctyl)-5-(trifluoromethyl)benzaldehyde Chemical compound O=CC1=CC(C(F)(F)F)=CC=C1CCCCCCCCC1=CC=CC=C1 QZIRCKPSTFRSCC-UHFFFAOYSA-N 0.000 description 2
- JRXDMDTWEUAEFE-UHFFFAOYSA-N 2-(8-phenyloctyl)benzaldehyde Chemical compound O=CC1=CC=CC=C1CCCCCCCCC1=CC=CC=C1 JRXDMDTWEUAEFE-UHFFFAOYSA-N 0.000 description 2
- NDOPHXWIAZIXPR-UHFFFAOYSA-N 2-bromobenzaldehyde Chemical compound BrC1=CC=CC=C1C=O NDOPHXWIAZIXPR-UHFFFAOYSA-N 0.000 description 2
- QTPWUSMWWCBLJE-UHFFFAOYSA-N 2-dodec-11-ynylbenzaldehyde Chemical compound O=CC1=CC=CC=C1CCCCCCCCCCC#C QTPWUSMWWCBLJE-UHFFFAOYSA-N 0.000 description 2
- ODUDOTSTODFTPO-UHFFFAOYSA-N 2-undecoxybenzaldehyde Chemical compound CCCCCCCCCCCOC1=CC=CC=C1C=O ODUDOTSTODFTPO-UHFFFAOYSA-N 0.000 description 2
- MDPYOXSQCZJLPM-UHFFFAOYSA-N 3-[2-carboxyethylsulfanyl-(4-dodecylthiophen-2-yl)methyl]sulfanylpropanoic acid Chemical compound CCCCCCCCCCCCC1=CSC(C(SCCC(O)=O)SCCC(O)=O)=C1 MDPYOXSQCZJLPM-UHFFFAOYSA-N 0.000 description 2
- JFAPQDFYYCZVAU-UHFFFAOYSA-N 3-[[2-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]phenyl]-(2-carboxyethylsulfanyl)methyl]sulfanylpropanoic acid Chemical compound C1=CC(C(C)=O)=C(O)C(CCC)=C1OCCCCCOC1=CC=CC=C1C(SCCC(O)=O)SCCC(O)=O JFAPQDFYYCZVAU-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- QMBWVOVSDICIOY-UHFFFAOYSA-N 5-(2-carboxyethylsulfanyl)-5-(2-dodecylphenyl)-4-sulfinylpentanoic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1C(SCCC(O)=O)C(CCC(O)=O)=S=O QMBWVOVSDICIOY-UHFFFAOYSA-N 0.000 description 2
- XGBMCFCZEKCCDJ-UHFFFAOYSA-N 8-bromooctylbenzene Chemical compound BrCCCCCCCCC1=CC=CC=C1 XGBMCFCZEKCCDJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical compound [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 101100545004 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) YSP2 gene Proteins 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 208000030961 allergic reaction Diseases 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- OCKPCBLVNKHBMX-UHFFFAOYSA-N butylbenzene Chemical compound CCCCC1=CC=CC=C1 OCKPCBLVNKHBMX-UHFFFAOYSA-N 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- GOQJMMHTSOQIEI-UHFFFAOYSA-N hex-5-yn-1-ol Chemical compound OCCCCC#C GOQJMMHTSOQIEI-UHFFFAOYSA-N 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 210000004731 jugular vein Anatomy 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 2
- OTZRAYGBFWZKMX-JUDRUQEKSA-N leukotriene E4 Chemical compound CCCCCC=CCC=C\C=C\C=C\[C@@H](SC[C@H](N)C(O)=O)[C@@H](O)CCCC(O)=O OTZRAYGBFWZKMX-JUDRUQEKSA-N 0.000 description 2
- 239000003199 leukotriene receptor blocking agent Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- MBHQEXPGNCWWBP-UHFFFAOYSA-M magnesium;dodecane;bromide Chemical compound [Mg+2].[Br-].CCCCCCCCCCC[CH2-] MBHQEXPGNCWWBP-UHFFFAOYSA-M 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000002685 pulmonary effect Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 2
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- QGGRBWUQXAFYEC-UHFFFAOYSA-N 1-(2,4-dihydroxy-3-propylphenyl)ethanone Chemical compound CCCC1=C(O)C=CC(C(C)=O)=C1O QGGRBWUQXAFYEC-UHFFFAOYSA-N 0.000 description 1
- BOFUHEUJGRAHGC-UHFFFAOYSA-N 1-(4-bromobutyl)-4-butylbenzene Chemical compound CCCCC1=CC=C(CCCCBr)C=C1 BOFUHEUJGRAHGC-UHFFFAOYSA-N 0.000 description 1
- JRRDISHSXWGFRF-UHFFFAOYSA-N 1-[2-(2-ethoxyethoxy)ethoxy]-2-methoxyethane Chemical compound CCOCCOCCOCCOC JRRDISHSXWGFRF-UHFFFAOYSA-N 0.000 description 1
- CGHIBGNXEGJPQZ-UHFFFAOYSA-N 1-hexyne Chemical compound CCCCC#C CGHIBGNXEGJPQZ-UHFFFAOYSA-N 0.000 description 1
- IFWCEOASBLRDGW-UHFFFAOYSA-N 12-bromododec-1-ynyl(trimethyl)silane Chemical compound C[Si](C)(C)C#CCCCCCCCCCCBr IFWCEOASBLRDGW-UHFFFAOYSA-N 0.000 description 1
- GTZDKVMINMEEHS-UHFFFAOYSA-N 2-(12-trimethylsilyldodec-11-ynyl)benzaldehyde Chemical compound C[Si](C)(C)C#CCCCCCCCCCCC1=CC=CC=C1C=O GTZDKVMINMEEHS-UHFFFAOYSA-N 0.000 description 1
- MSVILKWLCBBYFL-UHFFFAOYSA-N 2-(2-dodecylphenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CCCCCCCCCCCCC1=CC=CC=C1C1=NC(C)(C)CO1 MSVILKWLCBBYFL-UHFFFAOYSA-N 0.000 description 1
- MCNALTWNRIHQQX-UHFFFAOYSA-N 2-(6-phenylhexoxy)benzaldehyde Chemical compound O=CC1=CC=CC=C1OCCCCCCC1=CC=CC=C1 MCNALTWNRIHQQX-UHFFFAOYSA-N 0.000 description 1
- VEGQIFXITNIHJG-UHFFFAOYSA-N 2-(8-cyclohexyloct-1-ynyl)benzaldehyde Chemical compound O=CC1=CC=CC=C1C#CCCCCCCC1CCCCC1 VEGQIFXITNIHJG-UHFFFAOYSA-N 0.000 description 1
- AZDWENCZNLMMSA-UHFFFAOYSA-N 2-(8-cyclohexyloctyl)benzaldehyde Chemical compound O=CC1=CC=CC=C1CCCCCCCCC1CCCCC1 AZDWENCZNLMMSA-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- CYXIKYKBLDZZNW-UHFFFAOYSA-N 2-Chloro-1,1,1-trifluoroethane Chemical compound FC(F)(F)CCl CYXIKYKBLDZZNW-UHFFFAOYSA-N 0.000 description 1
- WBHICGUNLPWXAJ-SDNWHVSQSA-N 2-[(e)-dodec-1-enyl]benzaldehyde Chemical compound CCCCCCCCCC\C=C\C1=CC=CC=C1C=O WBHICGUNLPWXAJ-SDNWHVSQSA-N 0.000 description 1
- AMXIGQQWAKCGOI-UHFFFAOYSA-N 2-[2-[4-(4-butylphenyl)butyl]phenyl]-4,4-dimethyl-5h-1,3-oxazole Chemical compound C1=CC(CCCC)=CC=C1CCCCC1=CC=CC=C1C1=NC(C)(C)CO1 AMXIGQQWAKCGOI-UHFFFAOYSA-N 0.000 description 1
- FGQFSAGCUXICDD-UHFFFAOYSA-N 2-[4-(4-butylphenyl)butyl]benzaldehyde Chemical compound C1=CC(CCCC)=CC=C1CCCCC1=CC=CC=C1C=O FGQFSAGCUXICDD-UHFFFAOYSA-N 0.000 description 1
- QDJYPDRMZZRIEM-UHFFFAOYSA-N 2-[5-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]benzaldehyde Chemical compound CCCC1=C(O)C(C(C)=O)=CC=C1OCCCCCOC1=CC=CC=C1C=O QDJYPDRMZZRIEM-UHFFFAOYSA-N 0.000 description 1
- WWQFMCKPIBAFRI-UHFFFAOYSA-N 2-[carboxymethylsulfanyl-(2-dodecylphenyl)methyl]sulfanylacetic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1C(SCC(O)=O)SCC(O)=O WWQFMCKPIBAFRI-UHFFFAOYSA-N 0.000 description 1
- CSOBJYGHQOLWOD-UHFFFAOYSA-N 2-bromo-5-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(Br)C(C=O)=C1 CSOBJYGHQOLWOD-UHFFFAOYSA-N 0.000 description 1
- ICEINTPQBJRYDE-UHFFFAOYSA-N 2-bromo-5-(trifluoromethyl)benzonitrile Chemical compound FC(F)(F)C1=CC=C(Br)C(C#N)=C1 ICEINTPQBJRYDE-UHFFFAOYSA-N 0.000 description 1
- HXKXBCBZXXQPPD-UHFFFAOYSA-N 2-bromododecanoic acid Chemical compound CCCCCCCCCCC(Br)C(O)=O HXKXBCBZXXQPPD-UHFFFAOYSA-N 0.000 description 1
- JRQAAYVLPPGEHT-UHFFFAOYSA-N 2-bromoethylcyclohexane Chemical compound BrCCC1CCCCC1 JRQAAYVLPPGEHT-UHFFFAOYSA-N 0.000 description 1
- DHTNZHWLPYTNNT-UHFFFAOYSA-N 2-dodec-1-ynylbenzaldehyde Chemical compound CCCCCCCCCCC#CC1=CC=CC=C1C=O DHTNZHWLPYTNNT-UHFFFAOYSA-N 0.000 description 1
- WXXNHDGYIVVILR-UHFFFAOYSA-N 2-dodecylbenzaldehyde Chemical compound CCCCCCCCCCCCC1=CC=CC=C1C=O WXXNHDGYIVVILR-UHFFFAOYSA-N 0.000 description 1
- MSVZNJGVRJXGOY-UHFFFAOYSA-M 3,4,4-trimethyl-5h-1,3-oxazol-3-ium;iodide Chemical compound [I-].C[N+]1=COCC1(C)C MSVZNJGVRJXGOY-UHFFFAOYSA-M 0.000 description 1
- HFLKYKLWYRPYAL-UHFFFAOYSA-N 3-(8-phenyloctyl)benzaldehyde Chemical compound O=CC1=CC=CC(CCCCCCCCC=2C=CC=CC=2)=C1 HFLKYKLWYRPYAL-UHFFFAOYSA-N 0.000 description 1
- SUISZCALMBHJQX-UHFFFAOYSA-N 3-bromobenzaldehyde Chemical compound BrC1=CC=CC(C=O)=C1 SUISZCALMBHJQX-UHFFFAOYSA-N 0.000 description 1
- XCMISAPCWHTVNG-UHFFFAOYSA-N 3-bromothiophene Chemical compound BrC=1C=CSC=1 XCMISAPCWHTVNG-UHFFFAOYSA-N 0.000 description 1
- RFKWIEFTBMACPZ-UHFFFAOYSA-N 3-dodecylthiophene Chemical compound CCCCCCCCCCCCC=1C=CSC=1 RFKWIEFTBMACPZ-UHFFFAOYSA-N 0.000 description 1
- HKFGSESJCHINGM-UHFFFAOYSA-N 3-dodecylthiophene-2-carbaldehyde Chemical compound CCCCCCCCCCCCC=1C=CSC=1C=O HKFGSESJCHINGM-UHFFFAOYSA-N 0.000 description 1
- OEEJDYAQDKSUFB-UHFFFAOYSA-N 4,4-dimethyl-2-[2-(12,12,12-trifluorododecyl)phenyl]-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C(=CC=CC=2)CCCCCCCCCCCC(F)(F)F)=N1 OEEJDYAQDKSUFB-UHFFFAOYSA-N 0.000 description 1
- KKSIRQHXZKAMDI-UHFFFAOYSA-N 4,4-dimethyl-2-[2-(8-phenyloctyl)phenyl]-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C(=CC=CC=2)CCCCCCCCC=2C=CC=CC=2)=N1 KKSIRQHXZKAMDI-UHFFFAOYSA-N 0.000 description 1
- CQXSYJVVDLNUAJ-UHFFFAOYSA-N 4-(4-butylphenyl)-4-oxobutanoic acid Chemical compound CCCCC1=CC=C(C(=O)CCC(O)=O)C=C1 CQXSYJVVDLNUAJ-UHFFFAOYSA-N 0.000 description 1
- QFHKWCIYNATDDP-UHFFFAOYSA-N 4-(4-butylphenyl)butan-1-ol Chemical compound CCCCC1=CC=C(CCCCO)C=C1 QFHKWCIYNATDDP-UHFFFAOYSA-N 0.000 description 1
- VHBIJXQXRXBVTO-UHFFFAOYSA-N 4-(4-butylphenyl)butanoic acid Chemical compound CCCCC1=CC=C(CCCC(O)=O)C=C1 VHBIJXQXRXBVTO-UHFFFAOYSA-N 0.000 description 1
- IHWJQNJAFYVQGI-UHFFFAOYSA-N 4-dodecylthiophene-2-carbaldehyde Chemical compound CCCCCCCCCCCCC1=CSC(C=O)=C1 IHWJQNJAFYVQGI-UHFFFAOYSA-N 0.000 description 1
- RAOLIGFNQJMMKW-UHFFFAOYSA-N 6-bromohexylbenzene Chemical compound BrCCCCCCC1=CC=CC=C1 RAOLIGFNQJMMKW-UHFFFAOYSA-N 0.000 description 1
- FDXBUMXUJRZANT-UHFFFAOYSA-N 6-phenylhexan-1-ol Chemical compound OCCCCCCC1=CC=CC=C1 FDXBUMXUJRZANT-UHFFFAOYSA-N 0.000 description 1
- JTXZPQIXIXYMDY-UHFFFAOYSA-N 6-phenylhexanoic acid Chemical compound OC(=O)CCCCCC1=CC=CC=C1 JTXZPQIXIXYMDY-UHFFFAOYSA-N 0.000 description 1
- MGIGATOGROSKNW-UHFFFAOYSA-N 8-phenyloctan-1-ol Chemical compound OCCCCCCCCC1=CC=CC=C1 MGIGATOGROSKNW-UHFFFAOYSA-N 0.000 description 1
- 206010027654 Allergic conditions Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- WSTHCGBQCYWEAS-UHFFFAOYSA-N C1=CC=PC=C1.Cl Chemical compound C1=CC=PC=C1.Cl WSTHCGBQCYWEAS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- ZUKPVRWZDMRIEO-VKHMYHEASA-N L-cysteinylglycine Chemical compound SC[C@H]([NH3+])C(=O)NCC([O-])=O ZUKPVRWZDMRIEO-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 102000003820 Lipoxygenases Human genes 0.000 description 1
- 108090000128 Lipoxygenases Proteins 0.000 description 1
- SBDNJUWAMKYJOX-UHFFFAOYSA-N Meclofenamic Acid Chemical compound CC1=CC=C(Cl)C(NC=2C(=CC=CC=2)C(O)=O)=C1Cl SBDNJUWAMKYJOX-UHFFFAOYSA-N 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- MSNZYWKIOPOWPF-UHFFFAOYSA-M [Br-].CCCCC1=CC=C(CCCC[Mg+])C=C1 Chemical compound [Br-].CCCCC1=CC=C(CCCC[Mg+])C=C1 MSNZYWKIOPOWPF-UHFFFAOYSA-M 0.000 description 1
- FGABSGXXBXTVNP-UHFFFAOYSA-M [Br-].FC(F)(F)CCCCCCCCCCC[Mg+] Chemical compound [Br-].FC(F)(F)CCCCCCCCCCC[Mg+] FGABSGXXBXTVNP-UHFFFAOYSA-M 0.000 description 1
- NWUTVFAUXDEIQS-UHFFFAOYSA-N [Ni].CC Chemical compound [Ni].CC NWUTVFAUXDEIQS-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 210000005091 airway smooth muscle Anatomy 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000000304 alkynyl group Chemical class 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- MMHBKVIGDJUDTD-UHFFFAOYSA-K aluminum;1,2-dichloroethane;trichloride Chemical compound [Al+3].[Cl-].[Cl-].[Cl-].ClCCCl MMHBKVIGDJUDTD-UHFFFAOYSA-K 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000007503 antigenic stimulation Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229940114079 arachidonic acid Drugs 0.000 description 1
- 235000021342 arachidonic acid Nutrition 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 210000003651 basophil Anatomy 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000004044 bronchoconstricting agent Substances 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- 230000003435 bronchoconstrictive effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 108010016616 cysteinylglycine Proteins 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 150000004252 dithioacetals Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- CKJWLEMTYAEICI-UHFFFAOYSA-N hex-5-ynyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCCC#C)C=C1 CKJWLEMTYAEICI-UHFFFAOYSA-N 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- QUPSOZWOBFTHSF-UHFFFAOYSA-M magnesium;octylbenzene;bromide Chemical compound [Mg+2].[Br-].[CH2-]CCCCCCCC1=CC=CC=C1 QUPSOZWOBFTHSF-UHFFFAOYSA-M 0.000 description 1
- 229960003803 meclofenamic acid Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- GYDQHLMWSZGMIC-UHFFFAOYSA-N oct-3-ynylcyclohexane Chemical compound CCCCC#CCCC1CCCCC1 GYDQHLMWSZGMIC-UHFFFAOYSA-N 0.000 description 1
- CWZWTODCFPWBOK-UHFFFAOYSA-N oct-7-ynylcyclohexane Chemical compound C#CCCCCCCC1CCCCC1 CWZWTODCFPWBOK-UHFFFAOYSA-N 0.000 description 1
- ATBIPMKXEODDBH-UHFFFAOYSA-N octa-1,3-diyne Chemical compound CCCCC#CC#C ATBIPMKXEODDBH-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 206010034674 peritonitis Diseases 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 229960002816 potassium chloride Drugs 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 210000005092 tracheal tissue Anatomy 0.000 description 1
- MDRLTFRKHMWZBI-UHFFFAOYSA-M trimethyl-[12-[2-(3,4,4-trimethyl-5h-1,3-oxazol-3-ium-2-yl)phenyl]dodec-1-ynyl]silane;iodide Chemical compound [I-].O1CC(C)(C)[N+](C)=C1C1=CC=CC=C1CCCCCCCCCCC#C[Si](C)(C)C MDRLTFRKHMWZBI-UHFFFAOYSA-M 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US57202184A | 1984-01-19 | 1984-01-19 | |
| US572021 | 1984-01-19 | ||
| US630500 | 2003-07-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS60161965A JPS60161965A (ja) | 1985-08-23 |
| JPH0544450B2 true JPH0544450B2 (OSRAM) | 1993-07-06 |
Family
ID=24286018
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP829885A Granted JPS60161965A (ja) | 1984-01-19 | 1985-01-19 | ロイコトリエン拮抗剤 |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS60161965A (OSRAM) |
| IE (1) | IE850118L (OSRAM) |
| ZA (1) | ZA85419B (OSRAM) |
-
1985
- 1985-01-18 ZA ZA85419A patent/ZA85419B/xx unknown
- 1985-01-18 IE IE850118A patent/IE850118L/xx unknown
- 1985-01-19 JP JP829885A patent/JPS60161965A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60161965A (ja) | 1985-08-23 |
| ZA85419B (en) | 1986-09-24 |
| IE850118L (en) | 1985-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0322004B1 (en) | Cyclic anti-inflammatory derivatives of di-tert-butylphenol compounds | |
| EP0202759B1 (en) | Leukotriene antagonists | |
| US4874792A (en) | Thiophenyl Alkanoic acids useful as leukotriene antagonists | |
| CA1334200C (en) | Leukotriene antagonists | |
| US4730005A (en) | Leukotriene antagonist | |
| JPH0544450B2 (OSRAM) | ||
| KR900000683B1 (ko) | 류코트리엔 길항제 | |
| JP2677382B2 (ja) | ロイコトリエン拮抗剤 | |
| CA2005349A1 (en) | Leukotriene antagonists | |
| JPS60161964A (ja) | ロイコトリエン拮抗剤 | |
| AU610528B2 (en) | Leukotriene antagonists | |
| US4871771A (en) | Leukotriene antagonists | |
| US5143931A (en) | Leukotriene antagonists containing tetrazolyl groups | |
| JPS6112673A (ja) | ロイコトリエン拮抗剤 | |
| AU7902991A (en) | Five-membered ring alkanoic acid leukotriene antagonists | |
| CA1314654C (en) | Leukotriene antagonists | |
| EP0532674A1 (en) | Leukotriene antagonists |