JPH0363973B2 - - Google Patents
Info
- Publication number
- JPH0363973B2 JPH0363973B2 JP26011884A JP26011884A JPH0363973B2 JP H0363973 B2 JPH0363973 B2 JP H0363973B2 JP 26011884 A JP26011884 A JP 26011884A JP 26011884 A JP26011884 A JP 26011884A JP H0363973 B2 JPH0363973 B2 JP H0363973B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- segment
- molecular weight
- polyether
- segments
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001778 nylon Polymers 0.000 claims description 64
- 239000004677 Nylon Substances 0.000 claims description 63
- 150000001412 amines Chemical class 0.000 claims description 63
- 229920001400 block copolymer Polymers 0.000 claims description 59
- 239000000463 material Substances 0.000 claims description 54
- 229920000642 polymer Polymers 0.000 claims description 37
- 229920000570 polyether Chemical group 0.000 claims description 30
- -1 polysiloxane Polymers 0.000 claims description 28
- 239000004721 Polyphenylene oxide Chemical group 0.000 claims description 26
- 229930195733 hydrocarbon Natural products 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 23
- 150000002430 hydrocarbons Chemical class 0.000 claims description 21
- 239000004215 Carbon black (E152) Substances 0.000 claims description 19
- 150000003951 lactams Chemical group 0.000 claims description 17
- 229920000768 polyamine Polymers 0.000 claims description 17
- 229920000728 polyester Polymers 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 15
- 229920001577 copolymer Polymers 0.000 claims description 11
- 229920001971 elastomer Polymers 0.000 claims description 10
- 239000000806 elastomer Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 238000012693 lactam polymerization Methods 0.000 claims description 8
- 229920001296 polysiloxane Polymers 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 150000003141 primary amines Chemical class 0.000 claims description 7
- 239000002685 polymerization catalyst Substances 0.000 claims description 6
- 238000006116 polymerization reaction Methods 0.000 claims description 6
- 150000003335 secondary amines Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims 3
- 229910052736 halogen Inorganic materials 0.000 claims 3
- 150000002367 halogens Chemical class 0.000 claims 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims 3
- 229920001198 elastomeric copolymer Polymers 0.000 claims 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 35
- 238000006243 chemical reaction Methods 0.000 description 19
- DVPHDWQFZRBFND-DMHDVGBCSA-N 1-o-[2-[(3ar,5r,6s,6ar)-2,2-dimethyl-6-prop-2-enoyloxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[4-[(2s,3r)-1-butan-2-ylsulfanyl-2-(2-chlorophenyl)-4-oxoazetidin-3-yl]oxy-4-oxobutanoyl]oxyethyl] 4-o-[(2s,3r)-1-butan-2-ylsulfanyl-2-(2-chloropheny Chemical group C1([C@H]2[C@H](C(N2SC(C)CC)=O)OC(=O)CCC(=O)OC(COC(=O)CCC(=O)O[C@@H]2[C@@H](N(C2=O)SC(C)CC)C=2C(=CC=CC=2)Cl)[C@@H]2[C@@H]([C@H]3OC(C)(C)O[C@H]3O2)OC(=O)C=C)=CC=CC=C1Cl DVPHDWQFZRBFND-DMHDVGBCSA-N 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 16
- 238000004132 cross linking Methods 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000011084 recovery Methods 0.000 description 10
- 239000008204 material by function Substances 0.000 description 9
- 229920005862 polyol Polymers 0.000 description 9
- 150000003077 polyols Chemical class 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 229920001451 polypropylene glycol Polymers 0.000 description 7
- 239000004952 Polyamide Substances 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- 150000004985 diamines Chemical class 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- BOQJOCGCWDUQOA-UHFFFAOYSA-L magnesium;3,4,5,6-tetrahydro-2h-azepin-7-olate;bromide Chemical compound [Mg+2].[Br-].O=C1CCCCC[N-]1 BOQJOCGCWDUQOA-UHFFFAOYSA-L 0.000 description 5
- 150000002894 organic compounds Chemical class 0.000 description 5
- 239000004594 Masterbatch (MB) Substances 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 4
- 239000004809 Teflon Substances 0.000 description 3
- 229920006362 Teflon® Polymers 0.000 description 3
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000005452 bending Methods 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 239000003999 initiator Substances 0.000 description 3
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000006880 cross-coupling reaction Methods 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 229920002857 polybutadiene Polymers 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical compound C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- BNZLTPCWOLWBNJ-UHFFFAOYSA-M Br[Mg] Chemical compound Br[Mg] BNZLTPCWOLWBNJ-UHFFFAOYSA-M 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000004687 Nylon copolymer Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- NWFNSTOSIVLCJA-UHFFFAOYSA-L copper;diacetate;hydrate Chemical compound O.[Cu+2].CC([O-])=O.CC([O-])=O NWFNSTOSIVLCJA-UHFFFAOYSA-L 0.000 description 1
- 238000007278 cyanoethylation reaction Methods 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 239000004205 dimethyl polysiloxane Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Polyamides (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US56071483A | 1983-12-12 | 1983-12-12 | |
| US560714 | 1983-12-12 | ||
| US623257 | 1984-06-21 | ||
| US670188 | 1984-11-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS60168724A JPS60168724A (ja) | 1985-09-02 |
| JPH0363973B2 true JPH0363973B2 (da) | 1991-10-03 |
Family
ID=24239036
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP26011884A Granted JPS60168724A (ja) | 1983-12-12 | 1984-12-11 | 交叉結合型ナイロンブロツク共重合体 |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS60168724A (da) |
| DD (1) | DD233850A5 (da) |
| ZA (1) | ZA849641B (da) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR910003646B1 (ko) * | 1986-04-10 | 1991-06-08 | 몬산토 캄파니 | 폴리아실락탐 |
-
1984
- 1984-12-11 ZA ZA849641A patent/ZA849641B/xx unknown
- 1984-12-11 DD DD27060584A patent/DD233850A5/de unknown
- 1984-12-11 JP JP26011884A patent/JPS60168724A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60168724A (ja) | 1985-09-02 |
| ZA849641B (en) | 1985-10-30 |
| DD233850A5 (de) | 1986-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4617355A (en) | Cross-linked nylon block copolymers | |
| EP0067695B1 (en) | Process for the preparaton of nylon block polymers | |
| EP0149986B1 (en) | Cross-linked nylon block copolymers and process of their preparation | |
| EP0067693B1 (en) | Acid halide and acyllactam functional materials | |
| US4590243A (en) | Process for the preparation of nylon block polymers | |
| JPS6218568B2 (da) | ||
| EP0151911B1 (en) | Process for preparing nylon block copolymers and composition for use in the same | |
| JPH0363973B2 (da) | ||
| US4595747A (en) | Viscosified lactam polymerization initiator solutions | |
| EP0067694A1 (en) | Acid halide and acyllactam functional materials and process for the preparation of nylon block polymers therewith | |
| JPH0248021B2 (da) | ||
| US3553289A (en) | Polyoxamides from 3-aminomethyl-3,5,5-trimethyl cyclohexylamine | |
| US4581419A (en) | Acyllactam functional materials | |
| KR920001042B1 (ko) | 나일론 블록공중합체 및 그 제조방법 | |
| KR910003646B1 (ko) | 폴리아실락탐 | |
| Kajiyama et al. | Synthesis and properties of multiblock copolymers based on polydimethylsiloxane and piperazine‐aromatic polyamides | |
| JPS60240727A (ja) | ポリアミドブロツク共重合体 | |
| CS257265B2 (cs) | Způsob přípravy blokového polyamidového kopolymeru | |
| US4645800A (en) | Acyllactam functional materials | |
| US4590244A (en) | Acid halide functional materials | |
| JPS60168723A (ja) | ナイロンブロツク共重合体の製法 | |
| US4628075A (en) | Acid halide functional materials | |
| JPH0471930B2 (da) | ||
| CS207463B2 (cs) | Způsob výroby termoplastického elastomeru | |
| Massey | THE SYNTHESIS AND CHARACTERIZATION OF POLYAMIDES FROM SILICON-CONTAINING PRECURSORS. |