JPH0321566B2 - - Google Patents
Info
- Publication number
- JPH0321566B2 JPH0321566B2 JP58162708A JP16270883A JPH0321566B2 JP H0321566 B2 JPH0321566 B2 JP H0321566B2 JP 58162708 A JP58162708 A JP 58162708A JP 16270883 A JP16270883 A JP 16270883A JP H0321566 B2 JPH0321566 B2 JP H0321566B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- phosphate
- bis
- group
- polyphosphates
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920000388 Polyphosphate Polymers 0.000 claims description 62
- 239000001205 polyphosphate Substances 0.000 claims description 62
- 235000011176 polyphosphates Nutrition 0.000 claims description 62
- -1 chlorine or bromine Chemical class 0.000 claims description 57
- 238000000034 method Methods 0.000 claims description 41
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 17
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 7
- 229910052744 lithium Inorganic materials 0.000 claims description 7
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 7
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 claims description 5
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 4
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 4
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 4
- 125000001118 alkylidene group Chemical group 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000000962 organic group Chemical group 0.000 claims description 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 claims description 2
- QFUCZRGWFMYVBO-UHFFFAOYSA-N 3-(4-hydroxy-3,5-dimethylphenyl)-2,3-dihydro-1h-inden-5-ol Chemical compound CC1=C(O)C(C)=CC(C2C3=CC(O)=CC=C3CC2)=C1 QFUCZRGWFMYVBO-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 150000001341 alkaline earth metal compounds Chemical class 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical group [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 20
- 235000021317 phosphate Nutrition 0.000 description 20
- 239000003054 catalyst Substances 0.000 description 18
- 229920000642 polymer Polymers 0.000 description 18
- 230000008569 process Effects 0.000 description 17
- 239000010452 phosphate Substances 0.000 description 12
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 9
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 8
- 238000006068 polycondensation reaction Methods 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 230000007797 corrosion Effects 0.000 description 6
- 238000005260 corrosion Methods 0.000 description 6
- 230000009477 glass transition Effects 0.000 description 6
- 125000003010 ionic group Chemical group 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229920000515 polycarbonate Polymers 0.000 description 4
- 239000004417 polycarbonate Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229910001507 metal halide Inorganic materials 0.000 description 3
- 150000005309 metal halides Chemical class 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 229940031826 phenolate Drugs 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229920001169 thermoplastic Polymers 0.000 description 3
- QLORRTLBSJTMSN-UHFFFAOYSA-N tris(2,6-dimethylphenyl) phosphate Chemical compound CC1=CC=CC(C)=C1OP(=O)(OC=1C(=CC=CC=1C)C)OC1=C(C)C=CC=C1C QLORRTLBSJTMSN-UHFFFAOYSA-N 0.000 description 3
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- FJKVGQUBOHOMIC-UHFFFAOYSA-N [2,3-bis(2,6-dimethylphenyl)-4-methylphenyl] dihydrogen phosphate Chemical compound CC1=CC=CC(C)=C1C1=C(C)C=CC(OP(O)(O)=O)=C1C1=C(C)C=CC=C1C FJKVGQUBOHOMIC-UHFFFAOYSA-N 0.000 description 2
- UTWXEYMRVCKEJW-UHFFFAOYSA-N [2,4-bis(2,6-dimethylphenyl)-3-methylphenyl] dihydrogen phosphate Chemical compound CC1=CC=CC(C)=C1C1=CC=C(OP(O)(O)=O)C(C=2C(=CC=CC=2C)C)=C1C UTWXEYMRVCKEJW-UHFFFAOYSA-N 0.000 description 2
- DZEPMIPVDHPIOI-UHFFFAOYSA-N [3,4-bis(2,6-dimethylphenyl)-2-propan-2-ylphenyl] dihydrogen phosphate Chemical compound CC=1C=CC=C(C)C=1C=1C(C(C)C)=C(OP(O)(O)=O)C=CC=1C1=C(C)C=CC=C1C DZEPMIPVDHPIOI-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- NRHMSJGIJYQISI-UHFFFAOYSA-N bis(2,6-dimethylphenyl) phenyl phosphate Chemical compound CC1=CC=CC(C)=C1OP(=O)(OC=1C(=CC=CC=1C)C)OC1=CC=CC=C1 NRHMSJGIJYQISI-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 229920005669 high impact polystyrene Polymers 0.000 description 2
- 239000004797 high-impact polystyrene Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229920005992 thermoplastic resin Polymers 0.000 description 2
- 229920001187 thermosetting polymer Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- LIPMRGQQBZJCTM-UHFFFAOYSA-N tris(2-propan-2-ylphenyl) phosphate Chemical compound CC(C)C1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C(C)C)OC1=CC=CC=C1C(C)C LIPMRGQQBZJCTM-UHFFFAOYSA-N 0.000 description 2
- BOSMZFBHAYFUBJ-UHFFFAOYSA-N tris(4-methylphenyl) phosphate Chemical compound C1=CC(C)=CC=C1OP(=O)(OC=1C=CC(C)=CC=1)OC1=CC=C(C)C=C1 BOSMZFBHAYFUBJ-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- NNIJZQYSYZQFDZ-UHFFFAOYSA-N (2,3-dibutylphenyl) dihydrogen phosphate Chemical compound CCCCC1=CC=CC(OP(O)(O)=O)=C1CCCC NNIJZQYSYZQFDZ-UHFFFAOYSA-N 0.000 description 1
- IWOVRVDLJBOUCW-UHFFFAOYSA-N (2,3-didodecyl-4-methylphenyl) dihydrogen phosphate Chemical compound CCCCCCCCCCCCC1=C(C)C=CC(OP(O)(O)=O)=C1CCCCCCCCCCCC IWOVRVDLJBOUCW-UHFFFAOYSA-N 0.000 description 1
- DKXFABRKVHCBPQ-UHFFFAOYSA-N (2,3-didodecylphenyl) dihydrogen phosphate Chemical compound CCCCCCCCCCCCC1=CC=CC(OP(O)(O)=O)=C1CCCCCCCCCCCC DKXFABRKVHCBPQ-UHFFFAOYSA-N 0.000 description 1
- JFNOHUKJHAEWPT-UHFFFAOYSA-N (2,3-diethylphenyl) dihydrogen phosphate Chemical compound CCC1=CC=CC(OP(O)(O)=O)=C1CC JFNOHUKJHAEWPT-UHFFFAOYSA-N 0.000 description 1
- SPTOWKGCFHXLAN-UHFFFAOYSA-N (2,3-dioctylphenyl) dihydrogen phosphate Chemical compound CCCCCCCCC1=CC=CC(OP(O)(O)=O)=C1CCCCCCCC SPTOWKGCFHXLAN-UHFFFAOYSA-N 0.000 description 1
- WIEUBSHSTUYSSA-UHFFFAOYSA-N (2-chloro-2,2-diphenylethyl) dihydrogen phosphate Chemical compound C1=CC=C(C=C1)C(COP(=O)(O)O)(C2=CC=CC=C2)Cl WIEUBSHSTUYSSA-UHFFFAOYSA-N 0.000 description 1
- PKXORBBQFZJUIF-UHFFFAOYSA-N (3,4-diphenyl-2-propan-2-ylphenyl) dihydrogen phosphate Chemical compound C=1C=CC=CC=1C=1C(C(C)C)=C(OP(O)(O)=O)C=CC=1C1=CC=CC=C1 PKXORBBQFZJUIF-UHFFFAOYSA-N 0.000 description 1
- ZUICKKBXQDXIED-UHFFFAOYSA-N (3,5-diethyl-2,6-dimethylphenyl) dihydrogen phosphate Chemical compound CCC1=CC(=C(C(=C1C)OP(=O)(O)O)C)CC ZUICKKBXQDXIED-UHFFFAOYSA-N 0.000 description 1
- DOGHJORLHLESLL-UHFFFAOYSA-N (4-methyl-2,3-diphenylphenyl) dihydrogen phosphate Chemical compound C=1C=CC=CC=1C=1C(C)=CC=C(OP(O)(O)=O)C=1C1=CC=CC=C1 DOGHJORLHLESLL-UHFFFAOYSA-N 0.000 description 1
- IQLRMSFZKJNHJZ-UHFFFAOYSA-N (8-methyl-1,1-diphenylnonyl) dihydrogen phosphate Chemical compound C=1C=CC=CC=1C(OP(O)(O)=O)(CCCCCCC(C)C)C1=CC=CC=C1 IQLRMSFZKJNHJZ-UHFFFAOYSA-N 0.000 description 1
- KXQFGOARSZQMFY-UHFFFAOYSA-N 2,2-diphenylethyl dihydrogen phosphate Chemical compound C=1C=CC=CC=1C(COP(O)(=O)O)C1=CC=CC=C1 KXQFGOARSZQMFY-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- SVQKHBGNKRDACZ-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]sulfanylphenol Chemical compound CC1=CC(C)=CC(C=2C(=CC=C(O)C=2)SC=2C(=CC(O)=CC=2)C=2C=C(C)C=C(C)C=2)=C1 SVQKHBGNKRDACZ-UHFFFAOYSA-N 0.000 description 1
- 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical group C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- PNDJPSHYIFYPHP-UHFFFAOYSA-N 4,4-diphenylbutyl dihydrogen phosphate Chemical compound C=1C=CC=CC=1C(CCCOP(O)(=O)O)C1=CC=CC=C1 PNDJPSHYIFYPHP-UHFFFAOYSA-N 0.000 description 1
- AZZWZMUXHALBCQ-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1 AZZWZMUXHALBCQ-UHFFFAOYSA-N 0.000 description 1
- RIBPTGQSXYJRBQ-UHFFFAOYSA-N 4-[2,5-di(propan-2-yl)phenyl]phenol Chemical compound CC(C)C1=CC=C(C(C)C)C(C=2C=CC(O)=CC=2)=C1 RIBPTGQSXYJRBQ-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- OFRZVLSSMBOEKM-UHFFFAOYSA-N 8,8-diphenyloctyl dihydrogen phosphate Chemical compound C=1C=CC=CC=1C(CCCCCCCOP(O)(=O)O)C1=CC=CC=C1 OFRZVLSSMBOEKM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- GIXXQTYGFOHYPT-UHFFFAOYSA-N Bisphenol P Chemical compound C=1C=C(C(C)(C)C=2C=CC(O)=CC=2)C=CC=1C(C)(C)C1=CC=C(O)C=C1 GIXXQTYGFOHYPT-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- KGOLOUQANMVNMA-UHFFFAOYSA-N CC(C)(C)CC1=C(C(=CC=C1)OP(=O)(O)O)CC(C)(C)C Chemical compound CC(C)(C)CC1=C(C(=CC=C1)OP(=O)(O)O)CC(C)(C)C KGOLOUQANMVNMA-UHFFFAOYSA-N 0.000 description 1
- PGKQTQYBCFKFNU-UHFFFAOYSA-N CC1=C(C(=C(C=C1)OP(=O)(O)O)CC(C)CCC(C)(C)C)CC(C)CCC(C)(C)C Chemical compound CC1=C(C(=C(C=C1)OP(=O)(O)O)CC(C)CCC(C)(C)C)CC(C)CCC(C)(C)C PGKQTQYBCFKFNU-UHFFFAOYSA-N 0.000 description 1
- ZAFQXVPORMOILE-UHFFFAOYSA-N CC1=C(C(=CC=C1)C)C2=C(C(=C(C=C2)OP(=O)(O)O)C)C3=C(C=CC=C3C)C Chemical compound CC1=C(C(=CC=C1)C)C2=C(C(=C(C=C2)OP(=O)(O)O)C)C3=C(C=CC=C3C)C ZAFQXVPORMOILE-UHFFFAOYSA-N 0.000 description 1
- WISGDVJLNKTUTC-UHFFFAOYSA-N CCCCC(CC)C(C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)OP(=O)(O)O Chemical compound CCCCC(CC)C(C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)OP(=O)(O)O WISGDVJLNKTUTC-UHFFFAOYSA-N 0.000 description 1
- LFXLFOXOUULNDN-UHFFFAOYSA-N CCCCC(CC)CC1=C(C)C=CC(OP(O)(O)=O)=C1CC(CC)CCCC Chemical compound CCCCC(CC)CC1=C(C)C=CC(OP(O)(O)=O)=C1CC(CC)CCCC LFXLFOXOUULNDN-UHFFFAOYSA-N 0.000 description 1
- 101100219382 Caenorhabditis elegans cah-2 gene Proteins 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- FUJCRWPEOMXPAD-UHFFFAOYSA-N Li2O Inorganic materials [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- NICFFUUHSILOBQ-UHFFFAOYSA-N P(=O)(O)(O)OC1=CC=C(C(=C1C)C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound P(=O)(O)(O)OC1=CC=C(C(=C1C)C1=CC=CC=C1)C1=CC=CC=C1 NICFFUUHSILOBQ-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229920007962 Styrene Methyl Methacrylate Polymers 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- RGMIJYNHIFBBPY-UHFFFAOYSA-N [4-tert-butyl-2,3-bis(2,6-dimethylphenyl)phenyl] dihydrogen phosphate Chemical compound CC1=CC=CC(C)=C1C1=C(OP(O)(O)=O)C=CC(C(C)(C)C)=C1C1=C(C)C=CC=C1C RGMIJYNHIFBBPY-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Inorganic materials [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- IEPIYXWWJPPIEM-UHFFFAOYSA-N benzene-1,3-diol;benzene-1,4-diol Chemical compound OC1=CC=C(O)C=C1.OC1=CC=CC(O)=C1 IEPIYXWWJPPIEM-UHFFFAOYSA-N 0.000 description 1
- IZDFRICNRCPQQZ-UHFFFAOYSA-N benzhydryl dihydrogen phosphate Chemical compound C=1C=CC=CC=1C(OP(O)(=O)O)C1=CC=CC=C1 IZDFRICNRCPQQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- ZXZYMQCBRZBVIC-UHFFFAOYSA-N bis(2-ethylhexyl) phenyl phosphate Chemical compound CCCCC(CC)COP(=O)(OCC(CC)CCCC)OC1=CC=CC=C1 ZXZYMQCBRZBVIC-UHFFFAOYSA-N 0.000 description 1
- XSRQYQRFQNGZKR-UHFFFAOYSA-N bis(2-methylphenyl) phenyl phosphate Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1 XSRQYQRFQNGZKR-UHFFFAOYSA-N 0.000 description 1
- NVMHZSCMWYZDCC-UHFFFAOYSA-N bis(4-methylphenyl) phenyl phosphate Chemical compound C1=CC(C)=CC=C1OP(=O)(OC=1C=CC(C)=CC=1)OC1=CC=CC=C1 NVMHZSCMWYZDCC-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- XHOBAHOLCPTDRT-UHFFFAOYSA-N cyclohexanolate Chemical compound [O-]C1CCCCC1 XHOBAHOLCPTDRT-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- XUCJHNOBJLKZNU-UHFFFAOYSA-M dilithium;hydroxide Chemical compound [Li+].[Li+].[OH-] XUCJHNOBJLKZNU-UHFFFAOYSA-M 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000007786 electrostatic charging Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910001504 inorganic chloride Inorganic materials 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- ADFPJHOAARPYLP-UHFFFAOYSA-N methyl 2-methylprop-2-enoate;styrene Chemical compound COC(=O)C(C)=C.C=CC1=CC=CC=C1 ADFPJHOAARPYLP-UHFFFAOYSA-N 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- RMNODSGCFHVNDC-UHFFFAOYSA-N phenyl bis(2-propan-2-ylphenyl) phosphate Chemical compound CC(C)C1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C(C)C)OC1=CC=CC=C1 RMNODSGCFHVNDC-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006393 polyether sulfone Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920001955 polyphenylene ether Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- NOTVAPJNGZMVSD-UHFFFAOYSA-N potassium monoxide Inorganic materials [K]O[K] NOTVAPJNGZMVSD-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007348 radical reaction Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- FSDYDBAXNANUQE-UHFFFAOYSA-N tris(2,4-dichlorophenyl) phosphate Chemical compound ClC1=CC(Cl)=CC=C1OP(=O)(OC=1C(=CC(Cl)=CC=1)Cl)OC1=CC=C(Cl)C=C1Cl FSDYDBAXNANUQE-UHFFFAOYSA-N 0.000 description 1
- HQUQLFOMPYWACS-UHFFFAOYSA-N tris(2-chloroethyl) phosphate Chemical compound ClCCOP(=O)(OCCCl)OCCCl HQUQLFOMPYWACS-UHFFFAOYSA-N 0.000 description 1
- OOZBTDPWFHJVEK-UHFFFAOYSA-N tris(2-nonylphenyl) phosphate Chemical compound CCCCCCCCCC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)CCCCCCCCC)OC1=CC=CC=C1CCCCCCCCC OOZBTDPWFHJVEK-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G79/00—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule
- C08G79/02—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule a linkage containing phosphorus
- C08G79/04—Phosphorus linked to oxygen or to oxygen and carbon
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L85/00—Compositions of macromolecular compounds obtained by reactions forming a linkage in the main chain of the macromolecule containing atoms other than silicon, sulfur, nitrogen, oxygen and carbon; Compositions of derivatives of such polymers
- C08L85/02—Compositions of macromolecular compounds obtained by reactions forming a linkage in the main chain of the macromolecule containing atoms other than silicon, sulfur, nitrogen, oxygen and carbon; Compositions of derivatives of such polymers containing phosphorus
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3233615.2 | 1982-09-10 | ||
| DE3233615 | 1982-09-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5978237A JPS5978237A (ja) | 1984-05-07 |
| JPH0321566B2 true JPH0321566B2 (en:Method) | 1991-03-25 |
Family
ID=6172914
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58162708A Granted JPS5978237A (ja) | 1982-09-10 | 1983-09-06 | ポリホスフェートの製造法 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4482693A (en:Method) |
| EP (1) | EP0106082B1 (en:Method) |
| JP (1) | JPS5978237A (en:Method) |
| DE (1) | DE3368427D1 (en:Method) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6713598B2 (en) * | 2002-08-28 | 2004-03-30 | General Electric Company | Method to make a solid polymeric phosphate and resinous compositions containing it |
| US20060182975A1 (en) * | 2005-02-17 | 2006-08-17 | Reichhold, Inc. | Thermoset polymer substrates |
| US12091501B2 (en) * | 2018-11-15 | 2024-09-17 | Dalian Institute Of Chemical Physics, Chinese Academy Of Sciences | Method for preparing polyester polyol |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL158378B (nl) * | 1950-01-12 | Philips Nv | Stofzuiger. | |
| US3271329A (en) * | 1958-09-19 | 1966-09-06 | Eastman Kodak Co | Method for producing polymers derived from phosphites and glycols |
| BE802298A (fr) * | 1973-07-13 | 1973-11-05 | Labofina Sa | Fluides fonctionnels |
| GB1564708A (en) * | 1976-01-16 | 1980-04-10 | Ici Ltd | Linear polyester compositions and products which contain phenol phosphates as flame retardant additives |
| DE2615038C3 (de) * | 1976-04-07 | 1980-08-21 | Bayer Ag, 5090 Leverkusen | l,lA4,6-Pentamethyl-3-(3^-dimethyl-4-hydroxyphenyl)- indan-5-ol - Polycarbonate |
| DE2901665A1 (de) * | 1979-01-17 | 1980-07-24 | Bayer Ag | Verfahren zur herstellung von polycarbonaten |
| DE2925207A1 (de) * | 1979-06-22 | 1981-01-29 | Bayer Ag | Thermoplastische, verzweigte, aromatische polyphosphonate, ihre verwendung und ein verfahren zu ihrer herstellung |
| DE2944093A1 (de) * | 1979-10-31 | 1981-05-14 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von thermoplastischen aromatischen polyphosphonaten verbesserter thermischer alterungsbestaendigkeit und deren verwendung |
| GB2095171A (en) * | 1981-02-27 | 1982-09-29 | Ushio Electric Inc | Apparatus for heat-laminating a sheet |
-
1983
- 1983-08-29 EP EP83108490A patent/EP0106082B1/de not_active Expired
- 1983-08-29 DE DE8383108490T patent/DE3368427D1/de not_active Expired
- 1983-08-31 US US06/528,156 patent/US4482693A/en not_active Expired - Fee Related
- 1983-09-06 JP JP58162708A patent/JPS5978237A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4482693A (en) | 1984-11-13 |
| EP0106082B1 (de) | 1986-12-17 |
| EP0106082A1 (de) | 1984-04-25 |
| DE3368427D1 (en) | 1987-01-29 |
| JPS5978237A (ja) | 1984-05-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5964651A (ja) | 難燃性ポリマ−混合物 | |
| JP6506893B2 (ja) | ホスホン酸オリゴマーおよびこれを含む組成物 | |
| US7816486B2 (en) | Branched polyphosphonates | |
| US4280951A (en) | Flame retardants | |
| EP2181141B1 (en) | Insoluble and branched polyphosphonates and methods related thereto | |
| JPS6349692B2 (en:Method) | ||
| US4481338A (en) | Flame-resistant polymer mixtures | |
| JPS6354010B2 (en:Method) | ||
| US8389664B2 (en) | High molecular weight, random, bisphenol based copoly(phosphonate carbonate)s | |
| JPS60156724A (ja) | 芳香族ポリエステル−カ−ボネ−トの製造法 | |
| US4491656A (en) | Polyphosphates and process of preparation | |
| US4482693A (en) | Polyphosphates and the production thereof | |
| US5777009A (en) | Flame retardant low Tg polyestercarbonate | |
| JP3102597B2 (ja) | ポリカーボネートの製造方法 | |
| JPS5853936A (ja) | 難燃性ポリフエニレンエ−テル−スチレン熱可塑性樹脂組成物 | |
| JPH0220552A (ja) | ポリカーボネート樹脂組成物 | |
| JPS6135225B2 (en:Method) |