JPH0219837B2 - - Google Patents
Info
- Publication number
- JPH0219837B2 JPH0219837B2 JP12545484A JP12545484A JPH0219837B2 JP H0219837 B2 JPH0219837 B2 JP H0219837B2 JP 12545484 A JP12545484 A JP 12545484A JP 12545484 A JP12545484 A JP 12545484A JP H0219837 B2 JPH0219837 B2 JP H0219837B2
- Authority
- JP
- Japan
- Prior art keywords
- thiophene
- sulfamoylbenzo
- hydroxy
- formula
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 233
- 229930192474 thiophene Natural products 0.000 claims description 119
- -1 oxazolidylmethyloxy Chemical group 0.000 claims description 69
- 125000001544 thienyl group Chemical group 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 40
- 239000011734 sodium Substances 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000001475 halogen functional group Chemical group 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 125000002947 alkylene group Chemical group 0.000 claims description 11
- 238000011282 treatment Methods 0.000 claims description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 8
- 125000006590 (C2-C6) alkenylene group Chemical group 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- XRZYWSVMYHEQPN-UHFFFAOYSA-N 6-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 XRZYWSVMYHEQPN-UHFFFAOYSA-N 0.000 claims description 4
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims description 3
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 claims description 3
- KQNPFQTWMSNSAP-UHFFFAOYSA-M isobutyrate Chemical compound CC(C)C([O-])=O KQNPFQTWMSNSAP-UHFFFAOYSA-M 0.000 claims description 3
- JDRMYOQETPMYQX-UHFFFAOYSA-N monomethyl succinate Chemical compound COC(=O)CCC(O)=O JDRMYOQETPMYQX-UHFFFAOYSA-N 0.000 claims description 3
- 235000019157 thiamine Nutrition 0.000 claims description 3
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 claims description 3
- 229960003495 thiamine Drugs 0.000 claims description 3
- 239000011721 thiamine Substances 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 229940077388 benzenesulfonate Drugs 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000005475 oxolanyl group Chemical group 0.000 claims description 2
- JBKPUQTUERUYQE-UHFFFAOYSA-O pralidoxime Chemical compound C[N+]1=CC=CC=C1\C=N\O JBKPUQTUERUYQE-UHFFFAOYSA-O 0.000 claims description 2
- 229960003370 pralidoxime Drugs 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 2
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 claims 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical compound NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 claims 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 150000001768 cations Chemical class 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 229940070891 pyridium Drugs 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 168
- 239000000243 solution Substances 0.000 description 106
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 104
- 239000000203 mixture Substances 0.000 description 94
- 239000007787 solid Substances 0.000 description 87
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 78
- 239000000047 product Substances 0.000 description 76
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- 238000002360 preparation method Methods 0.000 description 45
- 239000002904 solvent Substances 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 41
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 31
- 238000006243 chemical reaction Methods 0.000 description 30
- 238000003756 stirring Methods 0.000 description 30
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 29
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 29
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 28
- 238000004458 analytical method Methods 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 239000000284 extract Substances 0.000 description 27
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 238000000034 method Methods 0.000 description 26
- 238000001953 recrystallisation Methods 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 230000002829 reductive effect Effects 0.000 description 21
- 238000010992 reflux Methods 0.000 description 20
- 239000000725 suspension Substances 0.000 description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical group C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- 235000002639 sodium chloride Nutrition 0.000 description 15
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 13
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 12
- 239000012267 brine Substances 0.000 description 12
- 239000003610 charcoal Substances 0.000 description 12
- 229940079593 drug Drugs 0.000 description 12
- 239000003814 drug Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- 239000012043 crude product Substances 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- 235000019198 oils Nutrition 0.000 description 11
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- UZMQSZBTFGHLAH-UHFFFAOYSA-N 1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2SC(S(=O)(=O)N)=CC2=C1 UZMQSZBTFGHLAH-UHFFFAOYSA-N 0.000 description 9
- BKBZFJRHYSCZQA-UHFFFAOYSA-N 2-methoxy-2-methylpropanoic acid Chemical compound COC(C)(C)C(O)=O BKBZFJRHYSCZQA-UHFFFAOYSA-N 0.000 description 9
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical class NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 238000007792 addition Methods 0.000 description 9
- 239000000538 analytical sample Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 238000001035 drying Methods 0.000 description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 235000017557 sodium bicarbonate Nutrition 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- CHXZRHMQQRUVHF-UHFFFAOYSA-N 2-hex-5-en-1,3-diynyl-5-prop-1-ynylthiophene Chemical compound CC#CC1=CC=C(C#CC#CC=C)S1 CHXZRHMQQRUVHF-UHFFFAOYSA-N 0.000 description 8
- WGDVDMKNSDCNGB-UHFFFAOYSA-N 6-methoxy-1-benzothiophene Chemical compound COC1=CC=C2C=CSC2=C1 WGDVDMKNSDCNGB-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 208000010412 Glaucoma Diseases 0.000 description 7
- 229940006133 antiglaucoma drug and miotics carbonic anhydrase inhibitors Drugs 0.000 description 7
- 239000003489 carbonate dehydratase inhibitor Substances 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 230000004406 elevated intraocular pressure Effects 0.000 description 6
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 230000004410 intraocular pressure Effects 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000546 pharmaceutical excipient Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 6
- 239000012258 stirred mixture Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- JRTUPGWOWBPJAF-UHFFFAOYSA-N 3-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2C(O)=C(S(=O)(=O)N)SC2=C1 JRTUPGWOWBPJAF-UHFFFAOYSA-N 0.000 description 5
- 102000003846 Carbonic anhydrases Human genes 0.000 description 5
- 108090000209 Carbonic anhydrases Proteins 0.000 description 5
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 5
- 239000007832 Na2SO4 Substances 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000002024 ethyl acetate extract Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 5
- 239000008194 pharmaceutical composition Substances 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000012047 saturated solution Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- IGYDWQWQYFXSNN-UHFFFAOYSA-N 5-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 IGYDWQWQYFXSNN-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 4
- 239000012346 acetyl chloride Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000002876 beta blocker Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- QCHFTSOMWOSFHM-WPRPVWTQSA-N (+)-Pilocarpine Chemical compound C1OC(=O)[C@@H](CC)[C@H]1CC1=CN=CN1C QCHFTSOMWOSFHM-WPRPVWTQSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- WXRMVOSEIGZNPW-UHFFFAOYSA-N 3-amino-1-benzothiophene-2-sulfonamide Chemical compound NC=1C2=C(SC=1S(N)(=O)=O)C=CC=C2 WXRMVOSEIGZNPW-UHFFFAOYSA-N 0.000 description 3
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 3
- UBAJGSNHCORLER-UHFFFAOYSA-N 5-(methoxymethyl)-1-benzothiophene-2-sulfonamide Chemical compound COCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 UBAJGSNHCORLER-UHFFFAOYSA-N 0.000 description 3
- RDSIMGKJEYNNLF-UHFFFAOYSA-N 5-bromo-1-benzothiophene Chemical compound BrC1=CC=C2SC=CC2=C1 RDSIMGKJEYNNLF-UHFFFAOYSA-N 0.000 description 3
- PNLRJPAUMHTMEL-UHFFFAOYSA-N 7-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1 PNLRJPAUMHTMEL-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- QCHFTSOMWOSFHM-UHFFFAOYSA-N SJ000285536 Natural products C1OC(=O)C(CC)C1CC1=CN=CN1C QCHFTSOMWOSFHM-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 3
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 3
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- KQDJZZWCYTXUDE-UHFFFAOYSA-N hydron;thiophene;chloride Chemical compound Cl.C=1C=CSC=1 KQDJZZWCYTXUDE-UHFFFAOYSA-N 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- ZYISMPMPLDLSBP-UHFFFAOYSA-N n,n-dibenzyl-1-benzothiophen-5-amine Chemical compound C=1C=CC=CC=1CN(C=1C=C2C=CSC2=CC=1)CC1=CC=CC=C1 ZYISMPMPLDLSBP-UHFFFAOYSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 229960001416 pilocarpine Drugs 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 229940099259 vaseline Drugs 0.000 description 3
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- WFCLWJHOKCQYOQ-UHFFFAOYSA-N 1-acetylpiperidine-4-carboxylic acid Chemical compound CC(=O)N1CCC(C(O)=O)CC1 WFCLWJHOKCQYOQ-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical group ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 2
- SROMBPBDBFVWDN-UHFFFAOYSA-N 2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetic acid Chemical compound OC(=O)COC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 SROMBPBDBFVWDN-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- CETZEYFOCPZOKD-UHFFFAOYSA-N 4-chloro-5-morpholin-4-yl-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=C(Cl)C=1N1CCOCC1 CETZEYFOCPZOKD-UHFFFAOYSA-N 0.000 description 2
- YPOBRGLUEDOCKJ-UHFFFAOYSA-N 4-methoxy-1-benzothiophene Chemical compound COC1=CC=CC2=C1C=CS2 YPOBRGLUEDOCKJ-UHFFFAOYSA-N 0.000 description 2
- QFOUMNMBMUBSFP-UHFFFAOYSA-N 5,6-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 QFOUMNMBMUBSFP-UHFFFAOYSA-N 0.000 description 2
- OCAMSTDZHIWOSJ-UHFFFAOYSA-N 5-(2,3-dihydroxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound OCC(O)COC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 OCAMSTDZHIWOSJ-UHFFFAOYSA-N 0.000 description 2
- RHBMMYRKSBNETF-UHFFFAOYSA-N 5-(2-aminoethyl)-1-benzothiophene-2-sulfonamide Chemical compound NCCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 RHBMMYRKSBNETF-UHFFFAOYSA-N 0.000 description 2
- FPQDJHOZZCKJAC-UHFFFAOYSA-N 5-(2-methoxyethyl)-1-benzothiophene-2-sulfonamide Chemical compound COCCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 FPQDJHOZZCKJAC-UHFFFAOYSA-N 0.000 description 2
- JOKNIUYQJUUYLU-UHFFFAOYSA-N 5-(bromomethyl)-1-benzothiophene-2-sulfonamide Chemical compound BrCC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 JOKNIUYQJUUYLU-UHFFFAOYSA-N 0.000 description 2
- MQLGWLTZVQVWRV-UHFFFAOYSA-N 5-(methoxymethyl)-1-benzothiophene Chemical compound COCC1=CC=C2SC=CC2=C1 MQLGWLTZVQVWRV-UHFFFAOYSA-N 0.000 description 2
- UQEZXYPVQGPICM-UHFFFAOYSA-N 5-bromo-1-benzothiophene-2-sulfonamide Chemical compound BrC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 UQEZXYPVQGPICM-UHFFFAOYSA-N 0.000 description 2
- UJEXMZORGCPCOL-UHFFFAOYSA-N 5-methoxy-1-benzothiophen-6-ol Chemical compound C1=C(O)C(OC)=CC2=C1SC=C2 UJEXMZORGCPCOL-UHFFFAOYSA-N 0.000 description 2
- DOHZWDWNQFZIKH-UHFFFAOYSA-N 5-methyl-1-benzothiophene Chemical compound CC1=CC=C2SC=CC2=C1 DOHZWDWNQFZIKH-UHFFFAOYSA-N 0.000 description 2
- PKXFWRSOBUMXMT-UHFFFAOYSA-N 5-morpholin-4-yl-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1N1CCOCC1 PKXFWRSOBUMXMT-UHFFFAOYSA-N 0.000 description 2
- RTTDJPYUGSTFIA-UHFFFAOYSA-N 6-(2,3-dihydroxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound C1=C(OCC(O)CO)C=C2SC(S(=O)(=O)N)=CC2=C1 RTTDJPYUGSTFIA-UHFFFAOYSA-N 0.000 description 2
- JEMKIAVXPSNDOZ-UHFFFAOYSA-N 6-(2-methyl-1,3-dioxolan-2-yl)-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2C=C(S(N)(=O)=O)SC2=CC=1C1(C)OCCO1 JEMKIAVXPSNDOZ-UHFFFAOYSA-N 0.000 description 2
- BIRQEZHIOSQULS-UHFFFAOYSA-N 6-(2-oxopropoxy)-1-benzothiophene-2-sulfonamide Chemical compound CC(=O)COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 BIRQEZHIOSQULS-UHFFFAOYSA-N 0.000 description 2
- JMRANYLGDBTEFX-UHFFFAOYSA-N 6-(oxiran-2-ylmethoxy)-1-benzothiophene-2-sulfonamide Chemical compound C1=C2SC(S(=O)(=O)N)=CC2=CC=C1OCC1CO1 JMRANYLGDBTEFX-UHFFFAOYSA-N 0.000 description 2
- ISKVAXQBNMMJEM-UHFFFAOYSA-N 6-hydroxy-5-methoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 ISKVAXQBNMMJEM-UHFFFAOYSA-N 0.000 description 2
- IAZFVHUTOZUOMP-UHFFFAOYSA-N 7-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 IAZFVHUTOZUOMP-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 239000004264 Petrolatum Substances 0.000 description 2
- PIJVFDBKTWXHHD-UHFFFAOYSA-N Physostigmine Natural products C12=CC(OC(=O)NC)=CC=C2N(C)C2C1(C)CCN2C PIJVFDBKTWXHHD-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 229960000686 benzalkonium chloride Drugs 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 2
- 229940030611 beta-adrenergic blocking agent Drugs 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- FRJZOYQRAJDROR-UHFFFAOYSA-N cyclohexyl hydrogen carbonate Chemical compound OC(=O)OC1CCCCC1 FRJZOYQRAJDROR-UHFFFAOYSA-N 0.000 description 2
- 238000004042 decolorization Methods 0.000 description 2
- NWYYUUCSPNYMGQ-UHFFFAOYSA-N diphenylcarbamoyl 2-methoxy-2-methylpropanoate Chemical group C=1C=CC=CC=1N(C(=O)OC(=O)C(C)(C)OC)C1=CC=CC=C1 NWYYUUCSPNYMGQ-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000469 ethanolic extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 208000030533 eye disease Diseases 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 230000005865 ionizing radiation Effects 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- BVKSZCWERUSTDZ-UHFFFAOYSA-N n,n-dimethyl-1-benzothiophen-5-amine Chemical compound CN(C)C1=CC=C2SC=CC2=C1 BVKSZCWERUSTDZ-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 235000019271 petrolatum Nutrition 0.000 description 2
- 229940066842 petrolatum Drugs 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229960001697 physostigmine Drugs 0.000 description 2
- PIJVFDBKTWXHHD-HIFRSBDPSA-N physostigmine Chemical compound C12=CC(OC(=O)NC)=CC=C2N(C)[C@@H]2[C@@]1(C)CCN2C PIJVFDBKTWXHHD-HIFRSBDPSA-N 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- UORVCLMRJXCDCP-UHFFFAOYSA-M propynoate Chemical compound [O-]C(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-M 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000001954 sterilising effect Effects 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 229940014800 succinic anhydride Drugs 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 2
- 150000003577 thiophenes Chemical class 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000012384 transportation and delivery Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- SUKKOWZFPQZCMY-UHFFFAOYSA-N (2,2-dimethyl-1,3-dioxolan-4-yl)methanol;methanesulfonic acid Chemical compound CS(O)(=O)=O.CC1(C)OCC(CO)O1 SUKKOWZFPQZCMY-UHFFFAOYSA-N 0.000 description 1
- REJKBSVCQAIWGE-PPHPATTJSA-N (2-sulfamoyl-1-benzothiophen-5-yl) (2s)-pyrrolidine-2-carboxylate;hydrochloride Chemical compound Cl.C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1OC(=O)[C@@H]1CCCN1 REJKBSVCQAIWGE-PPHPATTJSA-N 0.000 description 1
- FZJOUXBMUBKSNT-UHFFFAOYSA-N (2-sulfamoyl-1-benzothiophen-5-yl) n,n-dimethylcarbamate Chemical compound CN(C)C(=O)OC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 FZJOUXBMUBKSNT-UHFFFAOYSA-N 0.000 description 1
- UAOWORAGFAJFRU-UHFFFAOYSA-N (4-chlorophenyl)methyl hydrogen carbonate Chemical compound OC(=O)OCC1=CC=C(Cl)C=C1 UAOWORAGFAJFRU-UHFFFAOYSA-N 0.000 description 1
- YPVXJZZFSIKIDF-UHFFFAOYSA-N (4-methoxyphenyl) hydrogen carbonate Chemical compound COC1=CC=C(OC(O)=O)C=C1 YPVXJZZFSIKIDF-UHFFFAOYSA-N 0.000 description 1
- NQJCGWSRIVAROT-UHFFFAOYSA-N (4-methylphenyl) hydrogen carbonate Chemical compound CC1=CC=C(OC(O)=O)C=C1 NQJCGWSRIVAROT-UHFFFAOYSA-N 0.000 description 1
- AJTVNSRYHDVWLA-RGMNGODLSA-N (5s)-3-tert-butyl-5-(hydroxymethyl)-1,3-oxazolidin-2-one;methanesulfonic acid Chemical compound CS(O)(=O)=O.CC(C)(C)N1C[C@@H](CO)OC1=O AJTVNSRYHDVWLA-RGMNGODLSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- HXFVJCBIRYKDRY-UHFFFAOYSA-N 1,2-dichloroethane;hexane Chemical compound ClCCCl.CCCCCC HXFVJCBIRYKDRY-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- VGRVKBXVIAVIKH-UHFFFAOYSA-N 1,3-benzodioxole-4-thiol Chemical compound SC1=CC=CC2=C1OCO2 VGRVKBXVIAVIKH-UHFFFAOYSA-N 0.000 description 1
- OMOKVCNLOKBMAU-UHFFFAOYSA-N 1,3-dioxolane;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1COCO1 OMOKVCNLOKBMAU-UHFFFAOYSA-N 0.000 description 1
- DXMQCYBZTUPOFT-UHFFFAOYSA-N 1-(2,2-diethoxyethylsulfanyl)-3-methoxybenzene Chemical compound CCOC(OCC)CSC1=CC=CC(OC)=C1 DXMQCYBZTUPOFT-UHFFFAOYSA-N 0.000 description 1
- ZUPYTANKWDPRDP-UHFFFAOYSA-N 1-benzothiophen-5-amine Chemical compound NC1=CC=C2SC=CC2=C1 ZUPYTANKWDPRDP-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- YZBOZNXACBQJHI-UHFFFAOYSA-N 1-dichlorophosphoryloxyethane Chemical compound CCOP(Cl)(Cl)=O YZBOZNXACBQJHI-UHFFFAOYSA-N 0.000 description 1
- ZHCKPJGJQOPTLB-UHFFFAOYSA-N 1-methyl-4-imidazoleacetic acid Chemical compound CN1C=NC(CC(O)=O)=C1 ZHCKPJGJQOPTLB-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- PGZVFRAEAAXREB-UHFFFAOYSA-N 2,2-dimethylpropanoyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC(=O)C(C)(C)C PGZVFRAEAAXREB-UHFFFAOYSA-N 0.000 description 1
- FZHTUELUUNCLRZ-UHFFFAOYSA-N 2,4-dimethoxybenzenethiol Chemical compound COC1=CC=C(S)C(OC)=C1 FZHTUELUUNCLRZ-UHFFFAOYSA-N 0.000 description 1
- SESUUAOAUZDHHP-UHFFFAOYSA-N 2,5-dimethoxybenzenethiol Chemical compound COC1=CC=C(OC)C(S)=C1 SESUUAOAUZDHHP-UHFFFAOYSA-N 0.000 description 1
- DSZAQLDIEKUEMB-UHFFFAOYSA-N 2-(1-benzothiophen-5-yl)ethanol Chemical compound OCCC1=CC=C2SC=CC2=C1 DSZAQLDIEKUEMB-UHFFFAOYSA-N 0.000 description 1
- OQOZUXUGCIGGNG-UHFFFAOYSA-N 2-(2-sulfamoyl-1-benzothiophen-5-yl)ethyl acetate Chemical compound CC(=O)OCCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 OQOZUXUGCIGGNG-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- XXGGMMJGEHGGJW-UHFFFAOYSA-N 2-(4-ethylphenyl)ethyl hydrogen carbonate Chemical compound CCC1=CC=C(C=C1)CCOC(=O)O XXGGMMJGEHGGJW-UHFFFAOYSA-N 0.000 description 1
- DSCJETUEDFKYGN-UHFFFAOYSA-N 2-Methoxybenzenethiol Chemical compound COC1=CC=CC=C1S DSCJETUEDFKYGN-UHFFFAOYSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical group CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- ZXAHMLCCWDRTAO-UHFFFAOYSA-N 2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetamide Chemical compound NC(=O)COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 ZXAHMLCCWDRTAO-UHFFFAOYSA-N 0.000 description 1
- QVKQHWLCTCZPOP-UHFFFAOYSA-N 2-[(2-sulfamoyl-1-benzothiophen-6-yl)oxy]acetic acid Chemical compound C1=C(OCC(O)=O)C=C2SC(S(=O)(=O)N)=CC2=C1 QVKQHWLCTCZPOP-UHFFFAOYSA-N 0.000 description 1
- CXRHRXXJXVULKZ-UHFFFAOYSA-N 2-[(2-sulfamoyl-1-benzothiophen-7-yl)oxy]acetic acid Chemical compound C1=CC(OCC(O)=O)=C2SC(S(=O)(=O)N)=CC2=C1 CXRHRXXJXVULKZ-UHFFFAOYSA-N 0.000 description 1
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 1
- LDCQRJXSIHDEKI-UHFFFAOYSA-N 2-methoxy-1-benzothiophene Chemical compound C1=CC=C2SC(OC)=CC2=C1 LDCQRJXSIHDEKI-UHFFFAOYSA-N 0.000 description 1
- GTWJUDXIBMRDNK-UHFFFAOYSA-N 2-methoxybutanedioic acid Chemical compound COC(C(O)=O)CC(O)=O GTWJUDXIBMRDNK-UHFFFAOYSA-N 0.000 description 1
- GVSTYPOYHNVKHY-UHFFFAOYSA-N 2-methoxybutanoic acid Chemical compound CCC(OC)C(O)=O GVSTYPOYHNVKHY-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- MTKAJLNGIVXZIS-UHFFFAOYSA-N 3,4-dimethoxybenzenethiol Chemical compound COC1=CC=C(S)C=C1OC MTKAJLNGIVXZIS-UHFFFAOYSA-N 0.000 description 1
- MUQCDEGKKWQCAO-UHFFFAOYSA-N 3-(4-ethylphenyl)propanoic acid Chemical compound CCC1=CC=C(CCC(O)=O)C=C1 MUQCDEGKKWQCAO-UHFFFAOYSA-N 0.000 description 1
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 1
- YBJGQSNSAWZZHL-UHFFFAOYSA-N 3-chloro-2,2-dimethylpropanoic acid Chemical compound ClCC(C)(C)C(O)=O YBJGQSNSAWZZHL-UHFFFAOYSA-N 0.000 description 1
- UIZRYODUASPRQB-UHFFFAOYSA-N 3-phenylprop-2-enyl hydrogen carbonate Chemical compound OC(=O)OCC=CC1=CC=CC=C1 UIZRYODUASPRQB-UHFFFAOYSA-N 0.000 description 1
- AWAVPNGXIOESIV-UHFFFAOYSA-N 4,5-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1O AWAVPNGXIOESIV-UHFFFAOYSA-N 0.000 description 1
- ZCHGXTDHLWAFGN-UHFFFAOYSA-N 4,5-dimethoxy-1-benzothiophene Chemical compound COC1=CC=C2SC=CC2=C1OC ZCHGXTDHLWAFGN-UHFFFAOYSA-N 0.000 description 1
- WQIPUSSEWROJPT-UHFFFAOYSA-N 4,5-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1OC WQIPUSSEWROJPT-UHFFFAOYSA-N 0.000 description 1
- NCNWCNXPSWANMM-UHFFFAOYSA-N 4,7-dimethoxy-1-benzothiophene Chemical compound COC1=CC=C(OC)C2=C1C=CS2 NCNWCNXPSWANMM-UHFFFAOYSA-N 0.000 description 1
- ZCIZYKUGKUABPV-UHFFFAOYSA-N 4,7-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C(OC)C2=C1C=C(S(N)(=O)=O)S2 ZCIZYKUGKUABPV-UHFFFAOYSA-N 0.000 description 1
- LQAHMHGUCXRYFL-UHFFFAOYSA-N 4-(1-benzothiophen-5-yl)morpholine Chemical compound C1COCCN1C1=CC=C(SC=C2)C2=C1 LQAHMHGUCXRYFL-UHFFFAOYSA-N 0.000 description 1
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical compound CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 description 1
- MYMVKNAWBMSZOU-UHFFFAOYSA-N 4-[(2-sulfamoyl-1-benzothiophen-6-yl)oxy]butanoic acid Chemical compound C1=C(OCCCC(O)=O)C=C2SC(S(=O)(=O)N)=CC2=C1 MYMVKNAWBMSZOU-UHFFFAOYSA-N 0.000 description 1
- NXNBLCGRBRNZDJ-UHFFFAOYSA-N 4-[(2-sulfamoyl-1-benzothiophen-7-yl)oxy]butanoic acid Chemical compound C1=CC(OCCCC(O)=O)=C2SC(S(=O)(=O)N)=CC2=C1 NXNBLCGRBRNZDJ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 1
- XSHKFYGDAYFRCI-UHFFFAOYSA-N 4-chloro-5-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1Cl XSHKFYGDAYFRCI-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-M 4-chlorobenzoate Chemical compound [O-]C(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-M 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- ACJCKSYUUNLSAT-UHFFFAOYSA-N 4-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=CC2=C1C=C(S(N)(=O)=O)S2 ACJCKSYUUNLSAT-UHFFFAOYSA-N 0.000 description 1
- XVITXHRHLDUBTA-UHFFFAOYSA-N 4-methoxy-3-methylbenzenethiol Chemical compound COC1=CC=C(S)C=C1C XVITXHRHLDUBTA-UHFFFAOYSA-N 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- KLQSAAONLQIKDE-UHFFFAOYSA-N 5,6-dimethoxy-1-benzothiophene Chemical compound C1=C(OC)C(OC)=CC2=C1SC=C2 KLQSAAONLQIKDE-UHFFFAOYSA-N 0.000 description 1
- IQXTXLLJSBDWKH-UHFFFAOYSA-N 5,6-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(OC)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 IQXTXLLJSBDWKH-UHFFFAOYSA-N 0.000 description 1
- CJHWGLBDSDKVIH-UHFFFAOYSA-N 5,7-dimethoxy-1-benzothiophene Chemical compound COC1=CC(OC)=C2SC=CC2=C1 CJHWGLBDSDKVIH-UHFFFAOYSA-N 0.000 description 1
- XONQNKZFMRFPIM-UHFFFAOYSA-N 5,7-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC(OC)=C2SC(S(N)(=O)=O)=CC2=C1 XONQNKZFMRFPIM-UHFFFAOYSA-N 0.000 description 1
- KVTARXNGZCWKHL-UHFFFAOYSA-N 5-(2-azidoethyl)-1-benzothiophene-2-sulfonamide Chemical compound [N-]=[N+]=NCCC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 KVTARXNGZCWKHL-UHFFFAOYSA-N 0.000 description 1
- NGOMTBOJACJCOH-UHFFFAOYSA-N 5-(2-bromoethyl)-1-benzothiophene-2-sulfonamide Chemical compound BrCCC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 NGOMTBOJACJCOH-UHFFFAOYSA-N 0.000 description 1
- PNBNNCUIBFUUMY-UHFFFAOYSA-N 5-(2-hydroxyethoxy)-1-benzothiophene-2-sulfonamide Chemical compound OCCOC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 PNBNNCUIBFUUMY-UHFFFAOYSA-N 0.000 description 1
- OZQBGSWJCOYWEX-UHFFFAOYSA-N 5-(2-methoxyethoxy)-1-benzothiophene-2-sulfonamide Chemical compound COCCOC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 OZQBGSWJCOYWEX-UHFFFAOYSA-N 0.000 description 1
- NALFZLKVEHBIGT-UHFFFAOYSA-N 5-(2-methoxyethyl)-1-benzothiophene Chemical compound COCCC1=CC=C2SC=CC2=C1 NALFZLKVEHBIGT-UHFFFAOYSA-N 0.000 description 1
- GLUFKRZPRQMUDH-UHFFFAOYSA-N 5-(2-phenylmethoxyethyl)-1-benzothiophene Chemical compound C=1C=C2SC=CC2=CC=1CCOCC1=CC=CC=C1 GLUFKRZPRQMUDH-UHFFFAOYSA-N 0.000 description 1
- RSPGAMGRZURHHP-UHFFFAOYSA-N 5-(2-phenylmethoxyethyl)-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1CCOCC1=CC=CC=C1 RSPGAMGRZURHHP-UHFFFAOYSA-N 0.000 description 1
- QJEJNQRVXIMNGF-UHFFFAOYSA-N 5-(2-propan-2-yloxyethoxymethyl)-1-benzothiophene-2-sulfonamide Chemical compound CC(C)OCCOCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 QJEJNQRVXIMNGF-UHFFFAOYSA-N 0.000 description 1
- JNOSIMVHMLTEDU-UHFFFAOYSA-N 5-(dimethylamino)-1-benzothiophene-2-sulfonamide Chemical compound CN(C)C1=CC=C2SC(S(N)(=O)=O)=CC2=C1 JNOSIMVHMLTEDU-UHFFFAOYSA-N 0.000 description 1
- JHJQEKRNDZGXDG-UHFFFAOYSA-N 5-(hydroxymethyl)-1-benzothiophene-2-sulfonamide Chemical compound OCC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 JHJQEKRNDZGXDG-UHFFFAOYSA-N 0.000 description 1
- OWXPWWRBBBGOLO-UHFFFAOYSA-N 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound C1=C(O)C(OC)=CC(C=C2C(NC(=S)S2)=O)=C1 OWXPWWRBBBGOLO-UHFFFAOYSA-N 0.000 description 1
- IXRGFPJRHKYWPP-UHFFFAOYSA-N 5-[(dimethylamino)methyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 IXRGFPJRHKYWPP-UHFFFAOYSA-N 0.000 description 1
- OAUQUGVZOQCTBI-UHFFFAOYSA-N 5-[2-(dimethylamino)ethoxy]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCOC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 OAUQUGVZOQCTBI-UHFFFAOYSA-N 0.000 description 1
- SYWVDGIQIAMGDG-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 SYWVDGIQIAMGDG-UHFFFAOYSA-N 0.000 description 1
- GOMOMNRVFUXCOU-UHFFFAOYSA-N 5-[2-(dimethylamino)ethylsulfinylmethyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCS(=O)CC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 GOMOMNRVFUXCOU-UHFFFAOYSA-N 0.000 description 1
- HJRBYFGTRWIKBP-UHFFFAOYSA-N 5-[2-(dimethylamino)ethylsulfonylmethyl]-1-benzothiophene-2-sulfonamide Chemical compound CN(C)CCS(=O)(=O)CC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 HJRBYFGTRWIKBP-UHFFFAOYSA-N 0.000 description 1
- UIUNXRQQDMTNNI-UHFFFAOYSA-N 5-[5-(trifluoromethyl)-1h-imidazol-2-yl]-1-benzothiophene-2-sulfonamide Chemical compound C=1C=C2SC(S(=O)(=O)N)=CC2=CC=1C1=NC(C(F)(F)F)=CN1 UIUNXRQQDMTNNI-UHFFFAOYSA-N 0.000 description 1
- GSPGECZEALQGLT-UHFFFAOYSA-N 5-ethenyl-1-benzothiophene-2-sulfonamide Chemical compound C=CC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 GSPGECZEALQGLT-UHFFFAOYSA-N 0.000 description 1
- SSVLPEOHQGTJMO-UHFFFAOYSA-N 5-hydroxy-6-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(C)=CC2=C1C=C(S(N)(=O)=O)S2 SSVLPEOHQGTJMO-UHFFFAOYSA-N 0.000 description 1
- JPCWACUXSHAWEC-UHFFFAOYSA-N 5-methoxy-6-methyl-1-benzothiophene Chemical compound C1=C(C)C(OC)=CC2=C1SC=C2 JPCWACUXSHAWEC-UHFFFAOYSA-N 0.000 description 1
- FRZJACQZZZQLEU-UHFFFAOYSA-N 5-methoxy-6-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(C)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 FRZJACQZZZQLEU-UHFFFAOYSA-N 0.000 description 1
- INUDYDDLDMVJEN-UHFFFAOYSA-N 6-(1-hydroxyethyl)-1-benzothiophene-2-sulfonamide Chemical compound CC(O)C1=CC=C2C=C(S(N)(=O)=O)SC2=C1 INUDYDDLDMVJEN-UHFFFAOYSA-N 0.000 description 1
- HGJUAMMNZFMHGB-UHFFFAOYSA-N 6-(2-hydroxy-3-methoxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound COCC(O)COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 HGJUAMMNZFMHGB-UHFFFAOYSA-N 0.000 description 1
- GNLCMXPOUCBOTH-LLVKDONJSA-N 6-[(5S)-3-tert-butyl-2-oxo-1,3-oxazolidin-5-yl]-3-methoxy-1-benzothiophene-2-sulfonamide Chemical compound CC(C)(C)N1C(O[C@H](C1)C=1C=CC2=C(SC(=C2OC)S(N)(=O)=O)C=1)=O GNLCMXPOUCBOTH-LLVKDONJSA-N 0.000 description 1
- JMPHWIMWWNULNT-VIFPVBQESA-N 6-[[(5s)-2-oxo-1,3-oxazolidin-5-yl]methoxy]-1-benzothiophene-2-sulfonamide Chemical compound C1=C2SC(S(=O)(=O)N)=CC2=CC=C1OC[C@@H]1CNC(=O)O1 JMPHWIMWWNULNT-VIFPVBQESA-N 0.000 description 1
- BAXDQXBRPAMCRX-UHFFFAOYSA-N 6-amino-1-benzothiophene-2-sulfonamide Chemical compound NC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 BAXDQXBRPAMCRX-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- DISMIMAAXONKGD-UHFFFAOYSA-N 6-hydroxy-5-methoxy-1-benzothiophene-2-carboxylic acid Chemical compound C1=C(O)C(OC)=CC2=C1SC(C(O)=O)=C2 DISMIMAAXONKGD-UHFFFAOYSA-N 0.000 description 1
- GEVSDYHAXHDFKL-UHFFFAOYSA-N 6-hydroxy-5-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(C)=CC2=C1SC(S(N)(=O)=O)=C2 GEVSDYHAXHDFKL-UHFFFAOYSA-N 0.000 description 1
- OUTXDOFZXSHHAY-UHFFFAOYSA-N 6-hydroxy-n-methoxy-1-benzothiophene-5-sulfonamide Chemical compound C1=C(O)C(S(=O)(=O)NOC)=CC2=C1SC=C2 OUTXDOFZXSHHAY-UHFFFAOYSA-N 0.000 description 1
- XQQVPVSVESNUHO-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonamide Chemical class COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 XQQVPVSVESNUHO-UHFFFAOYSA-N 0.000 description 1
- QWAWVUNLIVQYBA-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonyl chloride Chemical compound COC1=CC=C2C=C(S(Cl)(=O)=O)SC2=C1 QWAWVUNLIVQYBA-UHFFFAOYSA-N 0.000 description 1
- PTLHTECLFJRDRX-UHFFFAOYSA-N 6-methoxy-5-methyl-1-benzothiophene Chemical compound C1=C(C)C(OC)=CC2=C1C=CS2 PTLHTECLFJRDRX-UHFFFAOYSA-N 0.000 description 1
- PXDSGQSTTDJZRV-UHFFFAOYSA-N 6-methoxy-5-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(C)C(OC)=CC2=C1C=C(S(N)(=O)=O)S2 PXDSGQSTTDJZRV-UHFFFAOYSA-N 0.000 description 1
- LQTZOLOKWURTOT-UHFFFAOYSA-N 7-(2,3-dihydroxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(OCC(O)CO)=C2SC(S(=O)(=O)N)=CC2=C1 LQTZOLOKWURTOT-UHFFFAOYSA-N 0.000 description 1
- DGQXQJTVNMJJNS-UHFFFAOYSA-N 7-(2-hydroxy-3-methoxypropoxy)-1-benzothiophene-2-sulfonamide Chemical compound COCC(O)COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 DGQXQJTVNMJJNS-UHFFFAOYSA-N 0.000 description 1
- ZSVBFALLOFMZOP-UHFFFAOYSA-N 7-[(2-oxo-1,3-oxazolidin-5-yl)methoxy]-1-benzothiophene-2-sulfonamide Chemical compound C=12SC(S(=O)(=O)N)=CC2=CC=CC=1OCC1CNC(=O)O1 ZSVBFALLOFMZOP-UHFFFAOYSA-N 0.000 description 1
- YEGARBALSIYLGP-UHFFFAOYSA-N 7-[(3-tert-butyl-2-oxo-1,3-oxazolidin-5-yl)methoxy]-1-benzothiophene-2-sulfonamide Chemical compound O1C(=O)N(C(C)(C)C)CC1COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 YEGARBALSIYLGP-UHFFFAOYSA-N 0.000 description 1
- POOUWGQVPPOLFU-UHFFFAOYSA-N 7-[3-(tert-butylamino)-2-hydroxypropoxy]-1-benzothiophene-2-sulfonamide Chemical compound CC(C)(C)NCC(O)COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 POOUWGQVPPOLFU-UHFFFAOYSA-N 0.000 description 1
- RWWDZFRDYYQTFJ-UHFFFAOYSA-N 7-methoxy-1-benzothiophene Chemical compound COC1=CC=CC2=C1SC=C2 RWWDZFRDYYQTFJ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical class OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 201000004569 Blindness Diseases 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- BDRLXNJGDSHBTQ-UHFFFAOYSA-N COC(=O)CCC(=O)O.C(C=CC1=CC=CC=C1)(=O)O Chemical compound COC(=O)CCC(=O)O.C(C=CC1=CC=CC=C1)(=O)O BDRLXNJGDSHBTQ-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 206010030043 Ocular hypertension Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 206010047555 Visual field defect Diseases 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- IKEJDPUACFHKIZ-UHFFFAOYSA-N acetic acid;cyclopentane Chemical compound CC(O)=O.C1CCCC1 IKEJDPUACFHKIZ-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical group 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical group 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- NMPVEAUIHMEAQP-UHFFFAOYSA-N alpha-bromo-acetaldehyde Natural products BrCC=O NMPVEAUIHMEAQP-UHFFFAOYSA-N 0.000 description 1
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000004509 aqueous humor production Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229940097320 beta blocking agent Drugs 0.000 description 1
- FSTRGOSTJXVFGV-UHFFFAOYSA-N bis(4-chlorophenyl) carbonate Chemical compound C1=CC(Cl)=CC=C1OC(=O)OC1=CC=C(Cl)C=C1 FSTRGOSTJXVFGV-UHFFFAOYSA-N 0.000 description 1
- JKJWYKGYGWOAHT-UHFFFAOYSA-N bis(prop-2-enyl) carbonate Chemical compound C=CCOC(=O)OCC=C JKJWYKGYGWOAHT-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- ITVPBBDAZKBMRP-UHFFFAOYSA-N chloro-dioxido-oxo-$l^{5}-phosphane;hydron Chemical compound OP(O)(Cl)=O ITVPBBDAZKBMRP-UHFFFAOYSA-N 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-M cyclohexanecarboxylate Chemical compound [O-]C(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-M 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 238000010520 demethylation reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- PIZLBWGMERQCOC-UHFFFAOYSA-N dibenzyl carbonate Chemical compound C=1C=CC=CC=1COC(=O)OCC1=CC=CC=C1 PIZLBWGMERQCOC-UHFFFAOYSA-N 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- ISCACRDMGTYTHJ-UHFFFAOYSA-N dichlorophosphoryloxymethylbenzene Chemical compound ClP(Cl)(=O)OCC1=CC=CC=C1 ISCACRDMGTYTHJ-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- VFACLMGMVGKKIM-UHFFFAOYSA-N ethyl 2-[(2-sulfamoyl-1-benzothiophen-6-yl)oxy]acetate Chemical compound CCOC(=O)COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 VFACLMGMVGKKIM-UHFFFAOYSA-N 0.000 description 1
- KFKOCHQLPZSPLZ-UHFFFAOYSA-N ethyl 2-[(2-sulfamoyl-1-benzothiophen-7-yl)oxy]acetate Chemical compound CCOC(=O)COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 KFKOCHQLPZSPLZ-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-M ethyl carbonate Chemical compound CCOC([O-])=O CQDGTJPVBWZJAZ-UHFFFAOYSA-M 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 229960004667 ethyl cellulose Drugs 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000004941 influx Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- NRVFDGZJTPCULU-UHFFFAOYSA-N meda Chemical compound Cl.CN(C)CCS NRVFDGZJTPCULU-UHFFFAOYSA-N 0.000 description 1
- 230000000936 membranestabilizing effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-M methoxyacetate Chemical compound COCC([O-])=O RMIODHQZRUFFFF-UHFFFAOYSA-M 0.000 description 1
- CXHHBNMLPJOKQD-UHFFFAOYSA-M methyl carbonate Chemical compound COC([O-])=O CXHHBNMLPJOKQD-UHFFFAOYSA-M 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- PJUIMOJAAPLTRJ-UHFFFAOYSA-N monothioglycerol Chemical compound OCC(O)CS PJUIMOJAAPLTRJ-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PUGXRWDHZKPHCO-UHFFFAOYSA-N n,n-dimethyl-2-[(2-sulfamoyl-1-benzothiophen-5-yl)oxy]acetamide Chemical compound CN(C)C(=O)COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 PUGXRWDHZKPHCO-UHFFFAOYSA-N 0.000 description 1
- LQFZXWQIQHYQEZ-UHFFFAOYSA-N n-(2-sulfamoyl-1-benzothiophen-6-yl)acetamide Chemical compound CC(=O)NC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 LQFZXWQIQHYQEZ-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 231100000957 no side effect Toxicity 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000008217 ophthalmic excipient Substances 0.000 description 1
- 229940054534 ophthalmic solution Drugs 0.000 description 1
- 239000002997 ophthalmic solution Substances 0.000 description 1
- 229940100654 ophthalmic suspension Drugs 0.000 description 1
- 210000003733 optic disk Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-M p-toluate Chemical compound CC1=CC=C(C([O-])=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-M 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- QIIPQYDSKRYMFG-UHFFFAOYSA-M phenyl carbonate Chemical compound [O-]C(=O)OC1=CC=CC=C1 QIIPQYDSKRYMFG-UHFFFAOYSA-M 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 229960003456 pralidoxime chloride Drugs 0.000 description 1
- HIGSLXSBYYMVKI-UHFFFAOYSA-N pralidoxime chloride Chemical compound [Cl-].C[N+]1=CC=CC=C1\C=N\O HIGSLXSBYYMVKI-UHFFFAOYSA-N 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- KTZUEEIBRDOPPX-UHFFFAOYSA-N prop-2-ynyl hydrogen carbonate Chemical compound OC(=O)OCC#C KTZUEEIBRDOPPX-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- FOWDZVNRQHPXDO-UHFFFAOYSA-M propyl carbonate Chemical compound CCCOC([O-])=O FOWDZVNRQHPXDO-UHFFFAOYSA-M 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- QDCOOMOMJAXUJR-UHFFFAOYSA-N pyridine thiophene hydrochloride Chemical compound Cl.N1=CC=CC=C1.S1C=CC=C1 QDCOOMOMJAXUJR-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- JDVPQXZIJDEHAN-UHFFFAOYSA-M succinamate Chemical compound NC(=O)CCC([O-])=O JDVPQXZIJDEHAN-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-M succinate(1-) Chemical compound OC(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-M 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000012385 systemic delivery Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XKXIQBVKMABYQJ-UHFFFAOYSA-N tert-butyl hydrogen carbonate Chemical compound CC(C)(C)OC(O)=O XKXIQBVKMABYQJ-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- FCYXZQGDTGMGOE-UHFFFAOYSA-N thieno[2,3-f][1,3]benzodioxole Chemical compound C1=C2OCOC2=CC2=C1SC=C2 FCYXZQGDTGMGOE-UHFFFAOYSA-N 0.000 description 1
- PCUXEURMCAQJJX-UHFFFAOYSA-N thieno[2,3-f][1,3]benzodioxole-6-sulfonamide Chemical compound C1=C2SC(S(=O)(=O)N)=CC2=CC2=C1OCO2 PCUXEURMCAQJJX-UHFFFAOYSA-N 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 229940033663 thimerosal Drugs 0.000 description 1
- QSELGEUCFNFITD-UHFFFAOYSA-N thiophene-2-carboximidamide Chemical compound NC(=N)C1=CC=CS1 QSELGEUCFNFITD-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 239000003860 topical agent Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 230000004382 visual function Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US50609283A | 1983-06-20 | 1983-06-20 | |
US506.092 | 1983-06-20 | ||
US547.191 | 1983-10-31 |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS6036481A JPS6036481A (ja) | 1985-02-25 |
JPH0219837B2 true JPH0219837B2 (hu) | 1990-05-07 |
Family
ID=24013144
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP12545484A Granted JPS6036481A (ja) | 1983-06-20 | 1984-06-20 | 上昇した眼圧治療のための2−スルフアモイルベンゾ〔b〕チオフエン誘導体 |
Country Status (2)
Country | Link |
---|---|
JP (1) | JPS6036481A (hu) |
ZA (1) | ZA844616B (hu) |
Families Citing this family (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US6140143A (en) * | 1992-02-10 | 2000-10-31 | Lucas Novasensor Inc. | Method of producing a buried boss diaphragm structure in silicon |
EP1864978A4 (en) * | 2005-03-28 | 2009-07-01 | Toyama Chemical Co Ltd | PROCESS FOR PRODUCING 1- (3- (2- (1-BENZOTHIOPHEN-5-YL) -ETHOXY) PROPYL) AZETIDIN-3-OL OR ITS SALTS |
JP4902247B2 (ja) * | 2005-04-08 | 2012-03-21 | 富山化学工業株式会社 | 2−(1−ベンゾチオフェン−5−イル)エタノールの新規製造法およびその中間体 |
ZA200805284B (en) * | 2005-12-22 | 2009-11-25 | Sumitomo Chemical Co | Tetrafluorotoluene compound, method for producing same and use thereof |
JP5082424B2 (ja) * | 2005-12-22 | 2012-11-28 | 住友化学株式会社 | 4−アルコキシメチル−2,3,5,6−テトラフルオロトルエン、その製造方法およびその利用 |
-
1984
- 1984-06-19 ZA ZA844616A patent/ZA844616B/xx unknown
- 1984-06-20 JP JP12545484A patent/JPS6036481A/ja active Granted
Also Published As
Publication number | Publication date |
---|---|
ZA844616B (en) | 1986-02-26 |
JPS6036481A (ja) | 1985-02-25 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4668697A (en) | Elevated intraocular pressure lowering benzo-[b]-thiophene-2-sulfonamide derivatives, compositions, and method of use therefor | |
US6028085A (en) | Indole derivatives as 5-HT receptor antagonist | |
AU2007304880B9 (en) | Novel benzofuran potassium channel blockers and uses thereof | |
FR2477542A1 (fr) | Derives de carbostyrile, leurs procedes de preparation et leur application en therapeutique | |
KR20080102181A (ko) | 스핑고신-1-포스페이트 (에스1피) 수용체 길항제 생물학적 활성을 갖는 아릴 또는 헤테로아릴기를 포함하는 인돌-3-카르보실산 아미드, 에스테르, 티오아미드 및 티올 에스테르 화합물 | |
US4847289A (en) | Thiophene sulfonamide antiglaucoma agents | |
KR890000386B1 (ko) | 2-설파모일벤조[b]티오펜 유도체 및 이의 제조방법 | |
PL187490B1 (pl) | Zastosowanie pochodnej 1,2-etanodiolu lub jej soli do wytwarzania środka wzmacniającego aktywność czynnika wzrostowego nerwu | |
JP2010024243A (ja) | 緑内障および近視を処置するためのベンゾ[g]キノリン誘導体 | |
EP0152340B1 (en) | 2-Sulfamoylbenzo[b]furan derivatives and ophtalmic composition for the treatment of elevated intraocular pressure | |
US4840963A (en) | 2-Sulfamoyl-1H-indole derivatives for the treatment of elevated intraocular pressure | |
JPH0219837B2 (hu) | ||
HU195962B (en) | Process for producing pyrimidinyl-methyl-thio-benzimidazole derivatives and pharmaceutics comprising the same | |
US4678855A (en) | Substituted benzenesulfonamides | |
EP0182691B1 (en) | Substituted thiophene-2-sulfonamides and their preparation | |
US4788192A (en) | 2-Sulfamoylbenzo(b)thiophene derivatives pharmaceutical compositions and use | |
US4505923A (en) | Ethers of hydroxybenzothiazole-2-sulfonamide for the topical treatment of elevated intraocular pressure | |
EP0543497A1 (en) | Tricyclic thienothiopyrans as antiglancoma agents | |
US5175284A (en) | Tricyclic thienothiopyrans as pharmaceutical intermediates | |
US4721794A (en) | Substituted thiophene-2-sulfonamide antiglaucoma agents | |
EP0155214B1 (en) | 2-sulfamoyl-1h-indole derivatives for the treatment of elevated intraocular pressure |