JPH0217581B2 - - Google Patents
Info
- Publication number
- JPH0217581B2 JPH0217581B2 JP60292402A JP29240285A JPH0217581B2 JP H0217581 B2 JPH0217581 B2 JP H0217581B2 JP 60292402 A JP60292402 A JP 60292402A JP 29240285 A JP29240285 A JP 29240285A JP H0217581 B2 JPH0217581 B2 JP H0217581B2
- Authority
- JP
- Japan
- Prior art keywords
- composition
- weight
- parts
- carbonate
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 54
- 229920000515 polycarbonate Polymers 0.000 claims description 40
- 239000004417 polycarbonate Substances 0.000 claims description 40
- 239000003063 flame retardant Substances 0.000 claims description 34
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 32
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 28
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 12
- -1 flame retardant compound Chemical class 0.000 claims description 12
- 229920000642 polymer Polymers 0.000 claims description 10
- 229920005989 resin Polymers 0.000 claims description 10
- 239000011347 resin Substances 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical group [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 229920001577 copolymer Polymers 0.000 claims description 6
- 239000001294 propane Substances 0.000 claims description 6
- 125000001118 alkylidene group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- YKPAABNCNAGAAJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)propane Chemical compound C=1C=C(O)C=CC=1C(CC)C1=CC=C(O)C=C1 YKPAABNCNAGAAJ-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- 238000005809 transesterification reaction Methods 0.000 claims description 3
- 150000003460 sulfonic acids Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 10
- 229920005668 polycarbonate resin Polymers 0.000 description 8
- 239000004431 polycarbonate resin Substances 0.000 description 8
- 239000000654 additive Substances 0.000 description 7
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 7
- 150000002989 phenols Chemical class 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000002485 combustion reaction Methods 0.000 description 4
- 229920001519 homopolymer Polymers 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- OMVLAGBUFPUMGQ-UHFFFAOYSA-M sodium;2,4,5-trichlorobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl OMVLAGBUFPUMGQ-UHFFFAOYSA-M 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229940077386 sodium benzenesulfonate Drugs 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- VIHUMJGEWQPWOT-UHFFFAOYSA-N 1,2,3-tribromo-4-(3-bromophenoxy)benzene Chemical compound BrC1=CC=CC(OC=2C(=C(Br)C(Br)=CC=2)Br)=C1 VIHUMJGEWQPWOT-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- BWRJIDMRILXEDW-UHFFFAOYSA-N 2,3,4-trichlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C(Cl)=C1Cl BWRJIDMRILXEDW-UHFFFAOYSA-N 0.000 description 1
- ZRWRPGGXCSSBAO-UHFFFAOYSA-N 2,4-dichloro-1-(2,4-dichlorophenoxy)benzene Chemical compound ClC1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1Cl ZRWRPGGXCSSBAO-UHFFFAOYSA-N 0.000 description 1
- RDBDKTDZDCLNLZ-UHFFFAOYSA-N 2,6-dibromo-4-[1-(3,5-dibromo-4-hydroxyphenyl)propyl]phenol Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(CC)C1=CC(Br)=C(O)C(Br)=C1 RDBDKTDZDCLNLZ-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- DTOMAXGIWFLDMR-UHFFFAOYSA-N 4-[(4-hydroxy-3-nitrophenyl)methyl]-2-nitrophenol Chemical compound C1=C([N+]([O-])=O)C(O)=CC=C1CC1=CC=C(O)C([N+]([O-])=O)=C1 DTOMAXGIWFLDMR-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- WCUDAIJOADOKAW-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCC)C1=CC=C(O)C=C1 WCUDAIJOADOKAW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920001651 Cyanoacrylate Polymers 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- SZKKRCSOSQAJDE-UHFFFAOYSA-N Schradan Chemical group CN(C)P(=O)(N(C)C)OP(=O)(N(C)C)N(C)C SZKKRCSOSQAJDE-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical group 0.000 description 1
- 229910001038 basic metal oxide Inorganic materials 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- NLCKLZIHJQEMCU-UHFFFAOYSA-N cyano prop-2-enoate Chemical class C=CC(=O)OC#N NLCKLZIHJQEMCU-UHFFFAOYSA-N 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- FPFJTBQQZWBMAZ-UHFFFAOYSA-L disodium;2,2,3,3,4,4-hexafluoropentanedioate Chemical compound [Na+].[Na+].[O-]C(=O)C(F)(F)C(F)(F)C(F)(F)C([O-])=O FPFJTBQQZWBMAZ-UHFFFAOYSA-L 0.000 description 1
- FITANBHHCLWRKG-UHFFFAOYSA-L disodium;2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate Chemical compound [Na+].[Na+].[O-]C1=C(Cl)C(=O)C([O-])=C(Cl)C1=O FITANBHHCLWRKG-UHFFFAOYSA-L 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- HGPXWXLYXNVULB-UHFFFAOYSA-M lithium stearate Chemical compound [Li+].CCCCCCCCCCCCCCCCCC([O-])=O HGPXWXLYXNVULB-UHFFFAOYSA-M 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- KSCKTBJJRVPGKM-UHFFFAOYSA-N octan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCCCCCC[O-].CCCCCCCC[O-].CCCCCCCC[O-].CCCCCCCC[O-] KSCKTBJJRVPGKM-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- XWFVPKXJJRNIKZ-UHFFFAOYSA-N sodium;2,4,6-trichloro-3,5-bis(methoxycarbonyl)benzenesulfonic acid Chemical compound [Na].COC(=O)C1=C(Cl)C(C(=O)OC)=C(Cl)C(S(O)(=O)=O)=C1Cl XWFVPKXJJRNIKZ-UHFFFAOYSA-N 0.000 description 1
- BJARKKWOYBVMCZ-UHFFFAOYSA-M sodium;2,5-dichlorothiophene-3-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=1C=C(Cl)SC=1Cl BJARKKWOYBVMCZ-UHFFFAOYSA-M 0.000 description 1
- XMTCIMFZSPKHMH-UHFFFAOYSA-M sodium;2-bromo-5-(4-bromophenyl)benzenesulfonate Chemical compound [Na+].C1=C(Br)C(S(=O)(=O)[O-])=CC(C=2C=CC(Br)=CC=2)=C1 XMTCIMFZSPKHMH-UHFFFAOYSA-M 0.000 description 1
- WKMRINMQMSLQBI-UHFFFAOYSA-M sodium;4-iodobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(I)C=C1 WKMRINMQMSLQBI-UHFFFAOYSA-M 0.000 description 1
- MZSDGDXXBZSFTG-UHFFFAOYSA-M sodium;benzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC=C1 MZSDGDXXBZSFTG-UHFFFAOYSA-M 0.000 description 1
- PVGBHEUCHKGFQP-UHFFFAOYSA-N sodium;n-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylacetamide Chemical compound [Na+].CC(=O)NS(=O)(=O)C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 PVGBHEUCHKGFQP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BZVJOYBTLHNRDW-UHFFFAOYSA-N triphenylmethanamine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(N)C1=CC=CC=C1 BZVJOYBTLHNRDW-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/15—Heterocyclic compounds having oxygen in the ring
- C08K5/156—Heterocyclic compounds having oxygen in the ring having two oxygen atoms in the ring
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/109—Esters; Ether-esters of carbonic acid, e.g. R-O-C(=O)-O-R
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US688247 | 1985-01-02 | ||
| US06/688,247 US4579896A (en) | 1985-01-02 | 1985-01-02 | Flame retardant polycarbonate compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS61215654A JPS61215654A (ja) | 1986-09-25 |
| JPH0217581B2 true JPH0217581B2 (enExample) | 1990-04-20 |
Family
ID=24763702
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP60292402A Granted JPS61215654A (ja) | 1985-01-02 | 1985-12-26 | 難燃性ポリカ−ボネ−ト組成物 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4579896A (enExample) |
| EP (1) | EP0187640B1 (enExample) |
| JP (1) | JPS61215654A (enExample) |
| AU (1) | AU587590B2 (enExample) |
| DE (1) | DE3666448D1 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4636559A (en) * | 1985-06-12 | 1987-01-13 | General Electric Company | Bis(cyclic carbonates), precursors thereof, and polycarbonate compositions containing them |
| US4717762A (en) * | 1986-09-08 | 1988-01-05 | Honeywell Inc. | Electroactive polymers having aromatic and quinonoid bonding structures |
| US4711946A (en) * | 1986-09-08 | 1987-12-08 | Honeywell Inc. | Electroactive heterocyclic aromatic polymers |
| US5229443A (en) * | 1986-12-31 | 1993-07-20 | General Electric Company | Flame-retardant polycarbonate composition |
| US5118739A (en) * | 1990-06-20 | 1992-06-02 | Ethyl Corporation | Flame retardant macromolecular materials containing brominated aromatic sulfonic acid salts |
| DE4132629A1 (de) * | 1991-10-01 | 1993-04-08 | Bayer Ag | Verwendung von kern-aromatischen sulfonsaeureestern zur stabilisierung von thermoplastischen polycarbonaten gegen einwirkung von gammastrahlen |
| DE19545330A1 (de) * | 1995-12-05 | 1997-06-12 | Bayer Ag | Verwendung von Carbonaten als Entformungsmittel für thermoplastische Polycarbonate |
| US20170247539A1 (en) | 2014-10-22 | 2017-08-31 | Sabic Global Technologies B.V. | Polycarbonate/polyester composition and article prepared therefrom |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1283432B (de) * | 1963-04-11 | 1968-11-21 | Bayer Ag | Verfahren zur Herstellung von Faeden oder Filmen durch Verformen von hochmolekularenlinearen Polycarbonaten |
| US4174359A (en) * | 1977-09-06 | 1979-11-13 | Mobay Chemical Corporation | Flame retardant polycarbonate polyblends |
| US4263201A (en) * | 1978-12-07 | 1981-04-21 | General Electric Company | Flame retardant polycarbonate composition |
| US4409349A (en) * | 1982-04-22 | 1983-10-11 | The Dow Chemical Company | Stabilized polycarbonate compositions |
| US4407995A (en) * | 1982-07-28 | 1983-10-04 | The Dow Chemical Company | Stabilized polycarbonate compositions containing cyclic carbonates and organophosphorous compounds |
| US4469833A (en) * | 1983-05-27 | 1984-09-04 | General Electric Company | Flame retardant polycarbonate compositions |
| EP0131639B1 (en) * | 1983-07-13 | 1987-06-10 | General Electric Company | Method for promoting and enhancing the optical transparency of a polycarbonate resin prepared by the transesterification of a diaryl carbonate and a dihydric phenol |
-
1985
- 1985-01-02 US US06/688,247 patent/US4579896A/en not_active Expired - Fee Related
- 1985-12-24 AU AU51659/85A patent/AU587590B2/en not_active Ceased
- 1985-12-26 JP JP60292402A patent/JPS61215654A/ja active Granted
-
1986
- 1986-01-02 DE DE8686100026T patent/DE3666448D1/de not_active Expired
- 1986-01-02 EP EP86100026A patent/EP0187640B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS61215654A (ja) | 1986-09-25 |
| AU587590B2 (en) | 1989-08-24 |
| EP0187640A1 (en) | 1986-07-16 |
| DE3666448D1 (en) | 1989-11-23 |
| US4579896A (en) | 1986-04-01 |
| AU5165985A (en) | 1986-07-10 |
| EP0187640B1 (en) | 1989-10-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100385286B1 (ko) | 난연성수지, 그것의 조성물 및 그 제조법 | |
| US4391935A (en) | Flame retardant polycarbonate composition | |
| JPS6310190B2 (enExample) | ||
| JP3645910B2 (ja) | カーボネートポリマー組成物 | |
| WO1994007956A1 (en) | Flame resistant thermoplastic blends having reduced drippage | |
| EP1188792A1 (en) | Flame-retardant polycarbonate resin composition | |
| US4222910A (en) | Fire-retardant polycarbonate composition | |
| JP2002537464A (ja) | 耐燃性熱可塑性成型用組成物 | |
| JPS6038418B2 (ja) | 難燃性ポリカ−ボネ−ト組成物 | |
| EP0342696B1 (en) | Flame-retardant polycarbonate resin composition | |
| JPH0217581B2 (enExample) | ||
| US4197232A (en) | Flame retardant polycarbonate composition | |
| US4113695A (en) | Non-opaque flame-retardant polycarbonate composition | |
| JP3605719B2 (ja) | 難燃性ポリカーボネート樹脂組成物及び成形体 | |
| US4403087A (en) | Polycarbonates chain terminated with sulfonic acid salt containing phenols | |
| JP3135175B2 (ja) | 耐燃性ポリカーボネート成型材料 | |
| EP0133910A2 (en) | Flame retardant non-dripping polycarbonate compositions exhibiting improved thick section impact | |
| CA1189529A (en) | Flame retardant polycarbonates | |
| US4636559A (en) | Bis(cyclic carbonates), precursors thereof, and polycarbonate compositions containing them | |
| AU734417B2 (en) | Method for preparing brominated polycarbonates, and process obtained thereby | |
| US4033930A (en) | Flame retardant polycarbonate composition | |
| US4425456A (en) | Copolycarbonates based on bis(4-hydroxyphenyl)biphenyl disulfone | |
| EP1285027B1 (en) | Branched carbonate polymer composition | |
| JPS59117554A (ja) | 難燃性の熱可塑性ポリカ−ボネ−ト組成物 | |
| WO1984004312A1 (en) | Composition comprising flame retardant end-capped polycarbonate |