JPH01279872A - イミダゾール誘導体、その製法及び該化合物を含有する精神病薬 - Google Patents
イミダゾール誘導体、その製法及び該化合物を含有する精神病薬Info
- Publication number
- JPH01279872A JPH01279872A JP63313992A JP31399288A JPH01279872A JP H01279872 A JPH01279872 A JP H01279872A JP 63313992 A JP63313992 A JP 63313992A JP 31399288 A JP31399288 A JP 31399288A JP H01279872 A JPH01279872 A JP H01279872A
- Authority
- JP
- Japan
- Prior art keywords
- imidazole
- ethyl
- group
- oxadiazol
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 72
- 150000002460 imidazoles Chemical class 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 208000028017 Psychotic disease Diseases 0.000 title description 3
- 229940079593 drug Drugs 0.000 title description 3
- 239000003814 drug Substances 0.000 title description 3
- 239000002253 acid Substances 0.000 claims abstract description 21
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 8
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 7
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 7
- 150000004292 cyclic ethers Chemical group 0.000 claims abstract description 5
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- -1 1-(3,4-dimethoxyphenyl)-imidazole-4-carboxylic acid ethyl ester 1-(3 , 4-dimethoxyphenyl)-4-(3-ethyl-1,2,4-oxadiazole-5- yl)-imidazole Chemical compound 0.000 claims description 39
- 125000005843 halogen group Chemical group 0.000 claims description 18
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 17
- 239000000126 substance Substances 0.000 claims description 15
- 125000003277 amino group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000004185 ester group Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M thiocyanate group Chemical group [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 5
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 4
- 150000001540 azides Chemical class 0.000 claims description 4
- 125000006165 cyclic alkyl group Chemical group 0.000 claims description 4
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical group N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 claims description 2
- BENKMEFJDPAUOV-UHFFFAOYSA-N ethyl 1-[3-(5-bromopyridin-2-yl)oxyphenyl]imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC=2N=CC(Br)=CC=2)=C1 BENKMEFJDPAUOV-UHFFFAOYSA-N 0.000 claims description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 2
- PEGHJBGYWJLUEA-UHFFFAOYSA-N 1-(3-hydroxyphenyl)-5-methylimidazole-4-carbonitrile Chemical compound CC1=C(C#N)N=CN1C1=CC=CC(O)=C1 PEGHJBGYWJLUEA-UHFFFAOYSA-N 0.000 claims 1
- GKXUGESIBCZKPD-UHFFFAOYSA-N 1-(3-phenylmethoxyphenyl)imidazole-4-carbonitrile Chemical compound C1=NC(C#N)=CN1C1=CC=CC(OCC=2C=CC=CC=2)=C1 GKXUGESIBCZKPD-UHFFFAOYSA-N 0.000 claims 1
- ZQWHBVORQBUKDM-UHFFFAOYSA-N 2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)imidazol-1-yl]benzene-1,3-diol Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=CC=2O)O)=N1 ZQWHBVORQBUKDM-UHFFFAOYSA-N 0.000 claims 1
- IIQXIWRMFGIWKD-UHFFFAOYSA-N 3-[1-(3-cyclopentyloxyphenyl)-5-methylimidazol-4-yl]-5-ethyl-1,2,4-oxadiazole Chemical compound O1C(CC)=NC(C2=C(N(C=N2)C=2C=C(OC3CCCC3)C=CC=2)C)=N1 IIQXIWRMFGIWKD-UHFFFAOYSA-N 0.000 claims 1
- NEBVIIRYKOUWOI-UHFFFAOYSA-N 3-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)-5-(methoxymethyl)imidazol-1-yl]phenol Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(O)C=CC=2)COC)=N1 NEBVIIRYKOUWOI-UHFFFAOYSA-N 0.000 claims 1
- XYSFWTVDLCFKAC-UHFFFAOYSA-N 3-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)-5-methylimidazol-1-yl]phenol Chemical compound O1C(CC)=NC(C2=C(N(C=N2)C=2C=C(O)C=CC=2)C)=N1 XYSFWTVDLCFKAC-UHFFFAOYSA-N 0.000 claims 1
- ISROYRYEUNPACE-UHFFFAOYSA-N 3-ethyl-5-[1-(2-phenylmethoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=CC=2)OCC=2C=CC=CC=2)=N1 ISROYRYEUNPACE-UHFFFAOYSA-N 0.000 claims 1
- NFOUCXIHNXBXPM-UHFFFAOYSA-N 3-ethyl-5-[1-(3-phenoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OC=3C=CC=CC=3)C=CC=2)=N1 NFOUCXIHNXBXPM-UHFFFAOYSA-N 0.000 claims 1
- QSUUNVXXUHEGPC-UHFFFAOYSA-N 3-ethyl-5-[1-(3-phenylmethoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 QSUUNVXXUHEGPC-UHFFFAOYSA-N 0.000 claims 1
- ILXILAONZCWFFZ-UHFFFAOYSA-N 3-ethyl-5-[1-(3-prop-2-enoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OCC=C)C=CC=2)=N1 ILXILAONZCWFFZ-UHFFFAOYSA-N 0.000 claims 1
- UGLLSYSSARAHGX-UHFFFAOYSA-N 3-ethyl-5-[1-(3-propan-2-yloxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OC(C)C)C=CC=2)=N1 UGLLSYSSARAHGX-UHFFFAOYSA-N 0.000 claims 1
- MPPUIYQBQSCGOY-UHFFFAOYSA-N 3-ethyl-5-[1-(4-phenylmethoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=CC(OCC=3C=CC=CC=3)=CC=2)=N1 MPPUIYQBQSCGOY-UHFFFAOYSA-N 0.000 claims 1
- RPDLTORMCLJLEA-UHFFFAOYSA-N 3-ethyl-5-[1-[2-(2-phenylethoxy)phenyl]imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=CC=2)OCCC=2C=CC=CC=2)=N1 RPDLTORMCLJLEA-UHFFFAOYSA-N 0.000 claims 1
- ZJZOMNLFQBMPPQ-UHFFFAOYSA-N 3-ethyl-5-[1-[3-(2-phenylethoxy)phenyl]imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OCCC=3C=CC=CC=3)C=CC=2)=N1 ZJZOMNLFQBMPPQ-UHFFFAOYSA-N 0.000 claims 1
- NMWYAELNKNAWSD-UHFFFAOYSA-N 3-ethyl-5-[5-(methoxymethyl)-1-(3-methoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(OC)C=CC=2)COC)=N1 NMWYAELNKNAWSD-UHFFFAOYSA-N 0.000 claims 1
- MPMIZISLZJSROI-UHFFFAOYSA-N 3-ethyl-5-[5-(methoxymethyl)-1-(3-phenylmethoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(OCC=3C=CC=CC=3)C=CC=2)COC)=N1 MPMIZISLZJSROI-UHFFFAOYSA-N 0.000 claims 1
- YDZHIJDJMBCXNL-UHFFFAOYSA-N 3-ethyl-5-[5-(methoxymethyl)-1-[3-(4-nitrophenoxy)phenyl]imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(OC=3C=CC(=CC=3)[N+]([O-])=O)C=CC=2)COC)=N1 YDZHIJDJMBCXNL-UHFFFAOYSA-N 0.000 claims 1
- AAKTVHZXLIQEOS-UHFFFAOYSA-N 3-ethyl-5-[5-methyl-1-(3-phenylmethoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(OCC=3C=CC=CC=3)C=CC=2)C)=N1 AAKTVHZXLIQEOS-UHFFFAOYSA-N 0.000 claims 1
- UQWWUKCVDZEKSQ-UHFFFAOYSA-N 4-[3-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)imidazol-1-yl]phenoxy]aniline Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OC=3C=CC(N)=CC=3)C=CC=2)=N1 UQWWUKCVDZEKSQ-UHFFFAOYSA-N 0.000 claims 1
- WMIYCFKZMYQLRJ-UHFFFAOYSA-N 5-[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C3OCOC3=CC=2)=N1 WMIYCFKZMYQLRJ-UHFFFAOYSA-N 0.000 claims 1
- LBKGBASHFSDLKP-UHFFFAOYSA-N 5-[1-(2-chloro-5-methoxyphenyl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=C(OC)C=2)Cl)=N1 LBKGBASHFSDLKP-UHFFFAOYSA-N 0.000 claims 1
- QSBSJTBWFDBLMP-UHFFFAOYSA-N 5-[1-(3-cyclopentyloxyphenyl)-5-(methoxymethyl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(OC3CCCC3)C=CC=2)COC)=N1 QSBSJTBWFDBLMP-UHFFFAOYSA-N 0.000 claims 1
- IBAKJBJNJQKUFZ-UHFFFAOYSA-N 5-[1-(3-ethoxyphenyl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCOC1=CC=CC(N2C=C(N=C2)C=2ON=C(CC)N=2)=C1 IBAKJBJNJQKUFZ-UHFFFAOYSA-N 0.000 claims 1
- RSALVMFKYUHZAX-UHFFFAOYSA-N 5-[1-(5-chloro-2-methoxyphenyl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=C(Cl)C=2)OC)=N1 RSALVMFKYUHZAX-UHFFFAOYSA-N 0.000 claims 1
- NSXSTZMVNNWKPG-UHFFFAOYSA-N 5-[1-(5-chloro-2-phenylmethoxyphenyl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=C(Cl)C=2)OCC=2C=CC=CC=2)=N1 NSXSTZMVNNWKPG-UHFFFAOYSA-N 0.000 claims 1
- IEPXQNDUDGMPQR-UHFFFAOYSA-N 5-[1-[2,6-bis(phenylmethoxy)phenyl]imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=CC=2OCC=2C=CC=CC=2)OCC=2C=CC=CC=2)=N1 IEPXQNDUDGMPQR-UHFFFAOYSA-N 0.000 claims 1
- QOVHXHPFAORTCV-UHFFFAOYSA-N 5-[1-[2-[(4-chlorophenyl)methoxy]phenyl]imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C(=CC=CC=2)OCC=2C=CC(Cl)=CC=2)=N1 QOVHXHPFAORTCV-UHFFFAOYSA-N 0.000 claims 1
- PZIHCULCDPZVOR-UHFFFAOYSA-N 5-[1-[3-(4-chlorophenoxy)phenyl]-5-(methoxymethyl)imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C2=C(N(C=N2)C=2C=C(OC=3C=CC(Cl)=CC=3)C=CC=2)COC)=N1 PZIHCULCDPZVOR-UHFFFAOYSA-N 0.000 claims 1
- ORAMBFYYNAFDNH-UHFFFAOYSA-N 5-[1-[3-(4-chlorophenoxy)phenyl]imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OC=3C=CC(Cl)=CC=3)C=CC=2)=N1 ORAMBFYYNAFDNH-UHFFFAOYSA-N 0.000 claims 1
- ULHMAYUYGOKMHE-UHFFFAOYSA-N 5-[1-[3-[(4-chlorophenyl)methoxy]phenyl]imidazol-4-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(OCC=3C=CC(Cl)=CC=3)C=CC=2)=N1 ULHMAYUYGOKMHE-UHFFFAOYSA-N 0.000 claims 1
- KUEKYXIWRSDELZ-UHFFFAOYSA-N 5-[2-[3-(5-bromopyridin-2-yl)oxyphenyl]-1H-imidazol-5-yl]-3-ethyl-1,2,4-oxadiazole Chemical compound BrC=1C=CC(=NC1)OC=1C=C(C=CC1)C=1NC=C(N1)C1=NC(=NO1)CC KUEKYXIWRSDELZ-UHFFFAOYSA-N 0.000 claims 1
- UZUNQNYCGUATQO-UHFFFAOYSA-N 5-ethyl-3-[5-methyl-1-(3-phenoxyphenyl)imidazol-4-yl]-1,2,4-oxadiazole Chemical compound O1C(CC)=NC(C2=C(N(C=N2)C=2C=C(OC=3C=CC=CC=3)C=CC=2)C)=N1 UZUNQNYCGUATQO-UHFFFAOYSA-N 0.000 claims 1
- MICMDBVRKOUTNH-UHFFFAOYSA-N 5-methyl-1-(3-phenoxyphenyl)imidazole-4-carbonitrile Chemical compound CC1=C(C#N)N=CN1C1=CC=CC(OC=2C=CC=CC=2)=C1 MICMDBVRKOUTNH-UHFFFAOYSA-N 0.000 claims 1
- 206010011703 Cyanosis Diseases 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- IGYRDNPJDPUHOA-UHFFFAOYSA-N ethyl 1-(2,6-dihydroxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=C(O)C=CC=C1O IGYRDNPJDPUHOA-UHFFFAOYSA-N 0.000 claims 1
- ZQJOQQXBWIHMBP-UHFFFAOYSA-N ethyl 1-(3-cyclopentyloxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC2CCCC2)=C1 ZQJOQQXBWIHMBP-UHFFFAOYSA-N 0.000 claims 1
- CSVHDBWJCYXUHS-UHFFFAOYSA-N ethyl 1-(3-hydroxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(O)=C1 CSVHDBWJCYXUHS-UHFFFAOYSA-N 0.000 claims 1
- NCDOYNBLKBYGFU-UHFFFAOYSA-N ethyl 1-(3-methoxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC)=C1 NCDOYNBLKBYGFU-UHFFFAOYSA-N 0.000 claims 1
- XNAVRNCANZAWGA-UHFFFAOYSA-N ethyl 1-(3-prop-2-enoxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OCC=C)=C1 XNAVRNCANZAWGA-UHFFFAOYSA-N 0.000 claims 1
- FKHCEBWPOLBNGR-UHFFFAOYSA-N ethyl 1-(3-propan-2-yloxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC(C)C)=C1 FKHCEBWPOLBNGR-UHFFFAOYSA-N 0.000 claims 1
- FAFDNWLNRBPIQA-UHFFFAOYSA-N ethyl 1-(4-methoxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=C(OC)C=C1 FAFDNWLNRBPIQA-UHFFFAOYSA-N 0.000 claims 1
- HHNMIWKJVPSQNR-UHFFFAOYSA-N ethyl 1-(4-phenoxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C(C=C1)=CC=C1OC1=CC=CC=C1 HHNMIWKJVPSQNR-UHFFFAOYSA-N 0.000 claims 1
- PHJSCMQOKSLNBQ-UHFFFAOYSA-N ethyl 1-[2,6-bis(phenylmethoxy)phenyl]imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C(C(=CC=C1)OCC=2C=CC=CC=2)=C1OCC1=CC=CC=C1 PHJSCMQOKSLNBQ-UHFFFAOYSA-N 0.000 claims 1
- FRRWXLAWTGXABV-UHFFFAOYSA-N ethyl 1-[3-(4-aminophenoxy)phenyl]imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC=2C=CC(N)=CC=2)=C1 FRRWXLAWTGXABV-UHFFFAOYSA-N 0.000 claims 1
- HOAWFNHMEUKPSM-UHFFFAOYSA-N ethyl 1-[3-(4-chlorophenoxy)phenyl]imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC=2C=CC(Cl)=CC=2)=C1 HOAWFNHMEUKPSM-UHFFFAOYSA-N 0.000 claims 1
- ZHARLMDZESJMOY-UHFFFAOYSA-N ethyl 1-[3-(4-nitrophenoxy)phenyl]imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OCC)=CN1C1=CC=CC(OC=2C=CC(=CC=2)[N+]([O-])=O)=C1 ZHARLMDZESJMOY-UHFFFAOYSA-N 0.000 claims 1
- 125000001841 imino group Chemical group [H]N=* 0.000 claims 1
- HZZCRKFWXILUJL-UHFFFAOYSA-N propan-2-yl 1-(3-cyclopentyloxyphenyl)imidazole-4-carboxylate Chemical compound C1=NC(C(=O)OC(C)C)=CN1C1=CC=CC(OC2CCCC2)=C1 HZZCRKFWXILUJL-UHFFFAOYSA-N 0.000 claims 1
- LTIXFXYUUCETLX-UHFFFAOYSA-N propan-2-yl 1-(3-methoxyphenyl)imidazole-4-carboxylate Chemical compound COC1=CC=CC(N2C=C(N=C2)C(=O)OC(C)C)=C1 LTIXFXYUUCETLX-UHFFFAOYSA-N 0.000 claims 1
- 239000003196 psychodysleptic agent Substances 0.000 claims 1
- 150000003567 thiocyanates Chemical class 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 11
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 3
- 230000002936 tranquilizing effect Effects 0.000 abstract description 3
- KCKWJZUKMXUCBK-UHFFFAOYSA-N 3-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)imidazol-1-yl]phenol Chemical compound CCC1=NOC(C=2N=CN(C=2)C=2C=C(O)C=CC=2)=N1 KCKWJZUKMXUCBK-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract description 2
- 239000000463 material Substances 0.000 abstract description 2
- 239000000164 antipsychotic agent Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 1
- 229940125725 tranquilizer Drugs 0.000 abstract 1
- 239000003204 tranquilizing agent Substances 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 92
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 238000002844 melting Methods 0.000 description 35
- 230000008018 melting Effects 0.000 description 35
- 238000006243 chemical reaction Methods 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 16
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 238000010626 work up procedure Methods 0.000 description 15
- 238000004587 chromatography analysis Methods 0.000 description 13
- 238000001953 recrystallisation Methods 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000012043 crude product Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- 235000019439 ethyl acetate Nutrition 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 8
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- IGPFOKFDBICQMC-UHFFFAOYSA-N 3-phenylmethoxyaniline Chemical compound NC1=CC=CC(OCC=2C=CC=CC=2)=C1 IGPFOKFDBICQMC-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 150000002168 ethanoic acid esters Chemical class 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 238000006254 arylation reaction Methods 0.000 description 3
- 229940049706 benzodiazepine Drugs 0.000 description 3
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- FBZVZUSVGKOWHG-UHFFFAOYSA-N 1,1-dimethoxy-n,n-dimethylethanamine Chemical compound COC(C)(OC)N(C)C FBZVZUSVGKOWHG-UHFFFAOYSA-N 0.000 description 2
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 2
- NKWCGTOZTHZDHB-UHFFFAOYSA-N 1h-imidazol-1-ium-4-carboxylate Chemical compound OC(=O)C1=CNC=N1 NKWCGTOZTHZDHB-UHFFFAOYSA-N 0.000 description 2
- ZHXUWDPHUQHFOV-UHFFFAOYSA-N 2,5-dibromopyridine Chemical compound BrC1=CC=C(Br)N=C1 ZHXUWDPHUQHFOV-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 2
- ZKKBIZXAEDFPNL-UHFFFAOYSA-N 3-(dimethylamino)prop-2-enenitrile Chemical compound CN(C)C=CC#N ZKKBIZXAEDFPNL-UHFFFAOYSA-N 0.000 description 2
- UCSYVYFGMFODMY-UHFFFAOYSA-N 3-phenoxyaniline Chemical compound NC1=CC=CC(OC=2C=CC=CC=2)=C1 UCSYVYFGMFODMY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 238000000297 Sandmeyer reaction Methods 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000001270 agonistic effect Effects 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000006575 electron-withdrawing group Chemical group 0.000 description 2
- 238000006266 etherification reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 150000002390 heteroarenes Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- WCYJQVALWQMJGE-UHFFFAOYSA-M hydroxylammonium chloride Chemical compound [Cl-].O[NH3+] WCYJQVALWQMJGE-UHFFFAOYSA-M 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 239000000052 vinegar Substances 0.000 description 2
- 235000021419 vinegar Nutrition 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- FDWYISIKXAASEG-UHFFFAOYSA-N (3-ethyl-1,2,4-oxadiazol-5-yl)methanamine Chemical compound CCC1=NOC(CN)=N1 FDWYISIKXAASEG-UHFFFAOYSA-N 0.000 description 1
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 description 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KQNBRMUBPRGXSL-UHFFFAOYSA-N 1-(bromomethyl)-4-chlorobenzene Chemical compound ClC1=CC=C(CBr)C=C1 KQNBRMUBPRGXSL-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- NWVGXXPWOYZODV-UHFFFAOYSA-N 1h-imidazole-5-carbonitrile Chemical compound N#CC1=CN=CN1 NWVGXXPWOYZODV-UHFFFAOYSA-N 0.000 description 1
- BZKOZYWGZKRTIB-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-6-amine Chemical compound O1CCOC2=CC(N)=CC=C21 BZKOZYWGZKRTIB-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- GBOUQGUQUUPGLO-UHFFFAOYSA-N 2-chloro-5-methoxyaniline Chemical compound COC1=CC=C(Cl)C(N)=C1 GBOUQGUQUUPGLO-UHFFFAOYSA-N 0.000 description 1
- DZLUPKIRNOCKJB-UHFFFAOYSA-N 2-methoxy-n,n-dimethylacetamide Chemical compound COCC(=O)N(C)C DZLUPKIRNOCKJB-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ATJUNEXOAIZXKR-UHFFFAOYSA-N 3-(4-chlorophenoxy)aniline Chemical compound NC1=CC=CC(OC=2C=CC(Cl)=CC=2)=C1 ATJUNEXOAIZXKR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NYPYPOZNGOXYSU-UHFFFAOYSA-N 3-bromopyridine Chemical compound BrC1=CC=CN=C1 NYPYPOZNGOXYSU-UHFFFAOYSA-N 0.000 description 1
- YSWBFLWKAIRHEI-UHFFFAOYSA-N 4,5-dimethyl-1h-imidazole Chemical compound CC=1N=CNC=1C YSWBFLWKAIRHEI-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- FIIDVVUUWRJXLF-UHFFFAOYSA-N 4-phenylmethoxyaniline Chemical compound C1=CC(N)=CC=C1OCC1=CC=CC=C1 FIIDVVUUWRJXLF-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 238000007045 Balz-Schiemann reaction Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DXDNEDKSDWKHCO-UHFFFAOYSA-N CN(C)C=O.c1c[nH]cn1 Chemical compound CN(C)C=O.c1c[nH]cn1 DXDNEDKSDWKHCO-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 102000004300 GABA-A Receptors Human genes 0.000 description 1
- 108090000839 GABA-A Receptors Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229940059260 amidate Drugs 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003613 bile acid Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- NDTCXABJQNJPCF-UHFFFAOYSA-N chlorocyclopentane Chemical compound ClC1CCCC1 NDTCXABJQNJPCF-UHFFFAOYSA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- PQZTVWVYCLIIJY-UHFFFAOYSA-N diethyl(propyl)amine Chemical group CCCN(CC)CC PQZTVWVYCLIIJY-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- NPUKDXXFDDZOKR-LLVKDONJSA-N etomidate Chemical compound CCOC(=O)C1=CN=CN1[C@H](C)C1=CC=CC=C1 NPUKDXXFDDZOKR-LLVKDONJSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 150000007928 imidazolide derivatives Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- OINDCHZMTRULBK-UHFFFAOYSA-N n'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-n,n-dimethylmethanimidamide Chemical compound CCC1=NOC(CN=CN(C)C)=N1 OINDCHZMTRULBK-UHFFFAOYSA-N 0.000 description 1
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical compound C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003335 secondary amines Chemical group 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Neurology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Biomedical Technology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Psychiatry (AREA)
- Pharmacology & Pharmacy (AREA)
- Neurosurgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3742716.4 | 1987-12-14 | ||
| DE19873742716 DE3742716A1 (de) | 1987-12-14 | 1987-12-14 | Imidazolderivate ii |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPH01279872A true JPH01279872A (ja) | 1989-11-10 |
Family
ID=6342780
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP63313992A Pending JPH01279872A (ja) | 1987-12-14 | 1988-12-14 | イミダゾール誘導体、その製法及び該化合物を含有する精神病薬 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US5179111A (enExample) |
| EP (1) | EP0323799B1 (enExample) |
| JP (1) | JPH01279872A (enExample) |
| AT (1) | ATE82285T1 (enExample) |
| CA (1) | CA1330341C (enExample) |
| DE (2) | DE3742716A1 (enExample) |
| ES (1) | ES2052768T3 (enExample) |
| GR (1) | GR3006948T3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999038829A1 (en) * | 1998-01-28 | 1999-08-05 | Shionogi & Co., Ltd. | Novel tricyclic compound |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3824658A1 (de) * | 1988-07-15 | 1990-01-18 | Schering Ag | N-hetaryl-imidazolderivate |
| AU6157190A (en) * | 1989-08-19 | 1991-04-03 | Boehringer Ingelheim International Gmbh | Substituted n-heterocycles, their preparation and their use |
| DE4112451A1 (de) * | 1991-04-12 | 1992-10-15 | Schering Ag | Isoxazolylimidazolderivate, verfahren zu deren herstellung und deren verwendung in arzneimitteln |
| US5502072A (en) * | 1993-11-26 | 1996-03-26 | Pfizer Inc. | Substituted oxindoles |
| DE4432391A1 (de) * | 1994-09-02 | 1996-03-07 | Schering Ag | Neues Verfahren zur Herstellung von I-Phenyl-imidazolderivaten |
| WO2007042545A1 (en) * | 2005-10-14 | 2007-04-19 | Neurosearch A/S | Imidazole derivatives and their use for modulating the gaba-a receptor complex |
| EP1940829A2 (en) * | 2005-10-14 | 2008-07-09 | NeuroSearch A/S | Imidazole derivatives and their use for modulating the gabaa receptor complex |
| EP1940801A2 (en) * | 2005-10-14 | 2008-07-09 | NeuroSearch A/S | Imidazole derivatives and their use for modulating the gaba-a receptor complex |
| AU2015319834A1 (en) | 2014-09-25 | 2017-04-20 | University Of Notre Dame Du Lac | Non-beta lactam antibiotics |
| WO2018049404A1 (en) | 2016-09-12 | 2018-03-15 | University Of Notre Dame Du Lac | Compounds for the treatment of clostridium difficile infection |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3444918A1 (de) * | 1984-12-08 | 1986-06-12 | Hoechst Ag, 6230 Frankfurt | 1-phenyl-imidazol-5-carbonsaeure-derivate, ein verfahren zu ihrer herstellung und ihre verwendung als wachstumsregulatoren |
| US4771051A (en) * | 1985-05-17 | 1988-09-13 | A/S Ferrosan | 3-substituted-4,5-dihydro-5-oxo imidazoquinazolines, their preparation, and their use in treating benzodiazepin receptor-related ailments |
| US4852132A (en) * | 1985-08-30 | 1989-07-25 | Yokogawa Medical Systems | Method of collecting data for x-ray tomograph |
| DE3627155A1 (de) * | 1986-08-11 | 1988-02-18 | Schering Ag | Imidazol-derivate |
| EP0284277A1 (en) * | 1987-03-21 | 1988-09-28 | AgrEvo UK Limited | Cyanoimidazole fungicides |
-
1987
- 1987-12-14 DE DE19873742716 patent/DE3742716A1/de not_active Withdrawn
-
1988
- 1988-12-13 CA CA000585771A patent/CA1330341C/en not_active Expired - Fee Related
- 1988-12-14 AT AT88730278T patent/ATE82285T1/de not_active IP Right Cessation
- 1988-12-14 ES ES88730278T patent/ES2052768T3/es not_active Expired - Lifetime
- 1988-12-14 JP JP63313992A patent/JPH01279872A/ja active Pending
- 1988-12-14 US US07/284,223 patent/US5179111A/en not_active Expired - Fee Related
- 1988-12-14 EP EP88730278A patent/EP0323799B1/de not_active Expired - Lifetime
- 1988-12-14 DE DE8888730278T patent/DE3875945D1/de not_active Expired - Lifetime
-
1993
- 1993-01-29 GR GR920402866T patent/GR3006948T3/el unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999038829A1 (en) * | 1998-01-28 | 1999-08-05 | Shionogi & Co., Ltd. | Novel tricyclic compound |
| US6562817B1 (en) | 1998-01-28 | 2003-05-13 | Shionogi & Co., Ltd. | Tricyclic compound |
| JP3929700B2 (ja) * | 1998-01-28 | 2007-06-13 | 塩野義製薬株式会社 | 新規三環式化合物 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3875945D1 (de) | 1992-12-17 |
| DE3742716A1 (de) | 1989-06-22 |
| ATE82285T1 (de) | 1992-11-15 |
| EP0323799B1 (de) | 1992-11-11 |
| CA1330341C (en) | 1994-06-21 |
| US5179111A (en) | 1993-01-12 |
| EP0323799A1 (de) | 1989-07-12 |
| GR3006948T3 (enExample) | 1993-06-30 |
| ES2052768T3 (es) | 1994-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0486666B1 (en) | Therapeutic heterocyclic compounds | |
| JP4838121B2 (ja) | 5員ヘテロ環を基礎とするp38キナーゼ阻害剤 | |
| DE69208868T2 (de) | 5-heteroyl indol derivate | |
| US4886803A (en) | Benzimidazole derivatives | |
| US9073911B2 (en) | Pyrazole derivatives | |
| US4616024A (en) | Dihydropyridine anti-ischaemic and antihypertensive agents | |
| US20030149089A1 (en) | Antibacterial compounds | |
| US5011849A (en) | Compounds for treating and preventing cognitive diseases and depression and methods of making same | |
| HK1000534B (en) | Therapeutic heterocyclic compounds | |
| CN1203589A (zh) | 新的化合物 | |
| JPH04257570A (ja) | ピペラジン誘導体 | |
| JPH1072445A (ja) | 置換インダゾール誘導体 | |
| US4987146A (en) | N-hetaryl imidazole derivatives | |
| JPH01279872A (ja) | イミダゾール誘導体、その製法及び該化合物を含有する精神病薬 | |
| ZA200100418B (en) | Aryl alkanoylpyridazines. | |
| US4515799A (en) | Dihydropyridine anti-ischaemic and antihypertensive agents | |
| CA2007127A1 (fr) | Piperidines, procedes de preparation et medicaments les contenant | |
| US5204482A (en) | Compounds for treating and preventing cognitive diseases and depression and methods of making same | |
| CS274405B2 (en) | Method of 4-cyanopyridazines preparation | |
| DK165951B (da) | Imidazolderivater, fremgangsmaade til fremstilling heraf samt laegemidler indeholdende disse | |
| US4151169A (en) | Process for preparing substituted 1,2,4-triazole derivatives | |
| EP0502110B1 (fr) | Derives d'(hetero) arylmethyloxy-4 phenyl diazole, leur procede de preparation et leur application en therapeutique | |
| US4985427A (en) | Triazine derivatives | |
| HUT54125A (en) | Process for producing triazine derivatives and pharmaceutical compositions comprising same | |
| Singh et al. | Synthesis and Evaluation of Heterocyclic Derivatives of Morpholino-N-Acetyl Indoles for Central Nervous System Depressant Activity |