JPH0113712B2 - - Google Patents
Info
- Publication number
- JPH0113712B2 JPH0113712B2 JP59125689A JP12568984A JPH0113712B2 JP H0113712 B2 JPH0113712 B2 JP H0113712B2 JP 59125689 A JP59125689 A JP 59125689A JP 12568984 A JP12568984 A JP 12568984A JP H0113712 B2 JPH0113712 B2 JP H0113712B2
- Authority
- JP
- Japan
- Prior art keywords
- compound
- carbon atoms
- pyrimidine
- dione
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 47
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 40
- 238000006243 chemical reaction Methods 0.000 description 35
- 238000002844 melting Methods 0.000 description 25
- 230000008018 melting Effects 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 24
- 239000013078 crystal Substances 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 238000000921 elemental analysis Methods 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 230000000202 analgesic effect Effects 0.000 description 11
- 230000003110 anti-inflammatory effect Effects 0.000 description 11
- 238000000034 method Methods 0.000 description 11
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- -1 1,3-butadienyl Chemical group 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 230000001629 suppression Effects 0.000 description 6
- KFVFSHVEAMTYFQ-UHFFFAOYSA-N 2h-pyrazolo[3,4-d]pyrimidin-3-amine Chemical class C1=NC=C2C(N)=NNC2=N1 KFVFSHVEAMTYFQ-UHFFFAOYSA-N 0.000 description 5
- XGNFUQQFEFJDON-UHFFFAOYSA-N 4-chloro-1,3-diethyl-2,6-dioxopyrimidine-5-carbonitrile Chemical compound CCN1C(Cl)=C(C#N)C(=O)N(CC)C1=O XGNFUQQFEFJDON-UHFFFAOYSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- 206010030113 Oedema Diseases 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000002994 raw material Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 229940126214 compound 3 Drugs 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940092253 ovalbumin Drugs 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 2
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 108010058846 Ovalbumin Proteins 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 230000001754 anti-pyretic effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000679 carrageenan Substances 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 229940113118 carrageenan Drugs 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 2
- RSEQDQIMVQFBSZ-UHFFFAOYSA-N 1,3-dipropyl-1,3-diazinane-2,4,6-trione Chemical compound CCCN1C(=O)CC(=O)N(CCC)C1=O RSEQDQIMVQFBSZ-UHFFFAOYSA-N 0.000 description 1
- DLDJYECWXDZLSK-UHFFFAOYSA-N 1-butyl-6-hydrazinyl-3-propylpyrimidine-2,4-dione Chemical compound CCCCN1C(NN)=CC(=O)N(CCC)C1=O DLDJYECWXDZLSK-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GBHCABUWWQUMAJ-UHFFFAOYSA-N 2-hydrazinoethanol Chemical compound NNCCO GBHCABUWWQUMAJ-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- RAFQKMGWKOTXAH-UHFFFAOYSA-N 3-(methylamino)-5,7-dipentyl-2h-pyrazolo[3,4-d]pyrimidine-4,6-dione Chemical compound O=C1N(CCCCC)C(=O)N(CCCCC)C2=C1C(NC)=NN2 RAFQKMGWKOTXAH-UHFFFAOYSA-N 0.000 description 1
- SZSKYDMKPJUUGG-UHFFFAOYSA-N 4-chloro-1,3-diethyl-2,6-dioxopyrimidine-5-carbaldehyde Chemical compound CCN1C(Cl)=C(C=O)C(=O)N(CC)C1=O SZSKYDMKPJUUGG-UHFFFAOYSA-N 0.000 description 1
- WXRUMBYQMRRTJL-UHFFFAOYSA-N 4-chloro-1,3-diethyl-2-hydroxyimino-6-oxopyrimidine-5-carbaldehyde Chemical compound CCN1C(Cl)=C(C=O)C(=O)N(CC)C1=NO WXRUMBYQMRRTJL-UHFFFAOYSA-N 0.000 description 1
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 description 1
- XBQTWXLWWKRKOM-UHFFFAOYSA-N 5,6-dipropyl-1H-pyrimidine-2,4-dione Chemical compound C(CC)C1=C(C(NC(N1)=O)=O)CCC XBQTWXLWWKRKOM-UHFFFAOYSA-N 0.000 description 1
- KQWNWIDOUDKIKQ-UHFFFAOYSA-N 5,7-diethyl-3-(ethylamino)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-dione Chemical compound CCN1C(=O)N(CC)C(=O)C2=C1N(C)N=C2NCC KQWNWIDOUDKIKQ-UHFFFAOYSA-N 0.000 description 1
- YTPSMQFZMOTSQT-UHFFFAOYSA-N 5,7-diethyl-3-(ethylamino)-2h-pyrazolo[3,4-d]pyrimidine-4,6-dione Chemical compound CCN1C(=O)N(CC)C(=O)C2=C(NCC)NN=C21 YTPSMQFZMOTSQT-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- LKEYMSMYZYHTEQ-UHFFFAOYSA-N 6-chloro-1,3-dipropylpyrimidine-2,4-dione Chemical compound CCCN1C(Cl)=CC(=O)N(CCC)C1=O LKEYMSMYZYHTEQ-UHFFFAOYSA-N 0.000 description 1
- XDRPODAKNBYJMU-UHFFFAOYSA-N 6-chloro-3-propyl-1h-pyrimidine-2,4-dione Chemical compound CCCN1C(=O)C=C(Cl)NC1=O XDRPODAKNBYJMU-UHFFFAOYSA-N 0.000 description 1
- BRLHQKRQUANWJL-UHFFFAOYSA-N 6-hydrazinyl-1,3-dipropylpyrimidine-2,4-dione Chemical compound CCCN1C(NN)=CC(=O)N(CCC)C1=O BRLHQKRQUANWJL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 208000000104 Arthus reaction Diseases 0.000 description 1
- 208000008035 Back Pain Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 208000008930 Low Back Pain Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 206010053614 Type III immune complex mediated reaction Diseases 0.000 description 1
- DDJRBTANSYPPCR-UHFFFAOYSA-N [4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-phenylmethanone Chemical compound C1CN(C)CCN1C1CCC(N2C3=NC=NC(N)=C3C(C=3C=CC(=CC=3)C(=O)C=3C=CC=CC=3)=N2)CC1 DDJRBTANSYPPCR-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960002319 barbital Drugs 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 1
- KNZYMKYLCIPERV-UHFFFAOYSA-N dichloromethanimine;hydrochloride Chemical compound [Cl-].ClC(Cl)=[NH2+] KNZYMKYLCIPERV-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- POSKBMFKCKRKCF-UHFFFAOYSA-N ethyl 5,7-dibutyl-3-(methylamino)-4,6-dioxopyrazolo[3,4-d]pyrimidine-2-carboxylate Chemical compound O=C1N(CCCC)C(=O)N(CCCC)C2=NN(C(=O)OCC)C(NC)=C21 POSKBMFKCKRKCF-UHFFFAOYSA-N 0.000 description 1
- RVSRWJJKJDYIPV-UHFFFAOYSA-N ethyl 5-butyl-7-ethyl-3-(methylamino)-4,6-dioxopyrazolo[3,4-d]pyrimidine-2-carboxylate Chemical compound O=C1N(CCCC)C(=O)N(CC)C2=NN(C(=O)OCC)C(NC)=C21 RVSRWJJKJDYIPV-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- PTSWJHSIGVQQNJ-UHFFFAOYSA-N methyl 3-amino-5,7-dibutyl-4,6-dioxopyrazolo[3,4-d]pyrimidine-2-carboxylate Chemical compound O=C1N(CCCC)C(=O)N(CCCC)C2=NN(C(=O)OC)C(N)=C21 PTSWJHSIGVQQNJ-UHFFFAOYSA-N 0.000 description 1
- WFJRIDQGVSJLLH-UHFFFAOYSA-N methyl n-aminocarbamate Chemical compound COC(=O)NN WFJRIDQGVSJLLH-UHFFFAOYSA-N 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12568984A JPS615082A (ja) | 1984-06-18 | 1984-06-18 | ３−アミノピラゾロ〔３，４−ｄ〕ピリミジン誘導体 |
| US06/678,479 US4603203A (en) | 1983-12-14 | 1984-12-05 | 3-aminopyrazolo[3,4-d]pyrimidine derivatives and production thereof |
| DK584284A DK165409C (da) | 1983-12-14 | 1984-12-07 | 3-aminopyrazolooe3,4-daapyrimidinderivater |
| CA000469761A CA1263386A (en) | 1983-12-14 | 1984-12-11 | 3-aminopyrazolo[3,4-d]pyrimidine derivatives and production thereof |
| ES538518A ES8608520A1 (es) | 1983-12-14 | 1984-12-12 | Un procedimiento para preparar derivados de 3-aminopirazolo-(3,4-d)-pirimidina |
| GR81241A GR81241B (en) | 1983-12-14 | 1984-12-12 | 3-aminopyrazolo (3,4-d) pyrimidine derivatives and production thereof |
| EP84308690A EP0166054B1 (en) | 1983-12-14 | 1984-12-13 | 3-aminopyrazolo(3,4-d)pyrimidine derivatives and production thereof |
| KR1019840007920A KR910006866B1 (ko) | 1983-12-14 | 1984-12-13 | 3-아미노피라졸로[3,4-d]피리미딘 유도체 및 그 염의 제조방법 |
| PT79667A PT79667B (en) | 1983-12-14 | 1984-12-13 | 3-aminopyrazolo<3,4-d>pyrimidine derivatives and production thereof |
| IE320784A IE58160B1 (en) | 1983-12-14 | 1984-12-13 | 3-Aminopyrazolo[3,4-d] pyrimidine derivatives and production thereof |
| DE8484308690T DE3477783D1 (en) | 1983-12-14 | 1984-12-13 | 3-aminopyrazolo(3,4-d)pyrimidine derivatives and production thereof |
| AT84308690T ATE42293T1 (de) | 1983-12-14 | 1984-12-13 | 3-aminopyrazolo(3,4-d>pyrimidinderivate und deren herstellung. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP12568984A JPS615082A (ja) | 1984-06-18 | 1984-06-18 | ３−アミノピラゾロ〔３，４−ｄ〕ピリミジン誘導体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS615082A JPS615082A (ja) | 1986-01-10 |
| JPH0113712B2 true JPH0113712B2 (no) | 1989-03-07 |
Family
ID=14916249
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP12568984A Granted JPS615082A (ja) | 1983-12-14 | 1984-06-18 | ３−アミノピラゾロ〔３，４−ｄ〕ピリミジン誘導体 |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS615082A (no) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005077959A1 (en) * | 2004-02-11 | 2005-08-25 | Smithkline Beecham Corporation | Pth agonists |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5331694A (en) * | 1976-09-01 | 1978-03-25 | Takeda Chem Ind Ltd | 3-aminopyrazolo(3,4- )pyrimidine derivatives and their preparation |
-
1984
- 1984-06-18 JP JP12568984A patent/JPS615082A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5331694A (en) * | 1976-09-01 | 1978-03-25 | Takeda Chem Ind Ltd | 3-aminopyrazolo(3,4- )pyrimidine derivatives and their preparation |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS615082A (ja) | 1986-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0166054B1 (en) | 3-aminopyrazolo(3,4-d)pyrimidine derivatives and production thereof | |
| EP0028833B1 (en) | Imidazole derivatives, their production and use | |
| US4225591A (en) | 2,6-Diaminonebularines | |
| US3995039A (en) | Pyrazolo [1,5-a] [1,3,5] triazines | |
| WO1983003250A1 (en) | 4-chloro-2-phenylimidazole-5-acetic acid derivatives | |
| JPS6364428B2 (no) | ||
| JPH054983A (ja) | イソキノリノン誘導体、その製造方法およびその誘導体を有効成分として含有する５−ｈｔ３ レセプター拮抗剤 | |
| CA2211669A1 (en) | 6-substituted pyrazolo [3,4-d¦ pyrimidin-4-ones and compositions and methods of use thereof | |
| RU2105764C1 (ru) | Ацилалы имидазол-5-карбоновой кислоты, способ их получения и фармацевтическая композиция, проявляющая свойства антагониста ангиотензина ii рецептора | |
| CA2305307C (en) | Tricyclic triazolobenzazepine derivatives, process for producing the same, and antiallergic agents | |
| PL92086B1 (no) | ||
| CA1248103A (en) | Substituted 5-phenyl-2- (1h)-pyridimidinone compounds | |
| GB2073752A (en) | 2,6-diaminobularines | |
| US4432990A (en) | 5-Aminoimidazoles as immunoregulants | |
| CA1112641A (en) | 2,6-diaminonebularines | |
| US4535084A (en) | Certain 4-(2-hydroxyethylthiomethyl)pyridines and derivatives thereof having immunoregulatory activity | |
| JPH0113712B2 (no) | ||
| US3836658A (en) | Tri-substituted imidazoles in the treatment of gout | |
| CA1220214A (en) | .beta.-OXO-.alpha.-CARBAMOYL-PYRROLEPROPIONITRILES | |
| KR910002838B1 (ko) | 4.7-디히드로피라졸로[3,4-b]피리딘 유도체의 제조방법 | |
| US4734414A (en) | Anti-inflammatory and anti-arthritic pyrazolo-[1,5-a]-1,3,5-triazine derivatives, compositions, and method of use therefor | |
| CA1164862A (en) | Indol acetic derivates, process for producing the same and pharmaceutical compositions comprising the same | |
| IE58497B1 (en) | New process for the preparation of derivatives of 4h-1, 2,4-triazole, the new triazoles so obtained, their use as medicaments and the pharmaceutical compositions containing them | |
| JPH0753730B2 (ja) | イミダゾピラゾール誘導体 | |
| NZ198215A (en) | Immunoregulatory compositions containing pyridine derivatives |