JP2011502245A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2011502245A5 JP2011502245A5 JP2010530156A JP2010530156A JP2011502245A5 JP 2011502245 A5 JP2011502245 A5 JP 2011502245A5 JP 2010530156 A JP2010530156 A JP 2010530156A JP 2010530156 A JP2010530156 A JP 2010530156A JP 2011502245 A5 JP2011502245 A5 JP 2011502245A5
- Authority
- JP
- Japan
- Prior art keywords
- electrode
- eam
- substrate
- kinase
- ligand
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003446 ligand Substances 0.000 claims description 198
- 239000000758 substrate Substances 0.000 claims description 157
- 108091000080 Phosphotransferase Proteins 0.000 claims description 88
- 102000020233 phosphotransferase Human genes 0.000 claims description 88
- 238000000034 method Methods 0.000 claims description 75
- 108090000623 proteins and genes Proteins 0.000 claims description 68
- 102000004169 proteins and genes Human genes 0.000 claims description 66
- 108091005804 Peptidases Proteins 0.000 claims description 64
- 239000004365 Protease Substances 0.000 claims description 49
- 229910052723 transition metal Inorganic materials 0.000 claims description 49
- 150000003624 transition metals Chemical class 0.000 claims description 48
- 239000013545 self-assembled monolayer Substances 0.000 claims description 45
- 239000002094 self assembled monolayer Substances 0.000 claims description 42
- 230000008859 change Effects 0.000 claims description 40
- 238000012360 testing method Methods 0.000 claims description 29
- 238000003776 cleavage reaction Methods 0.000 claims description 26
- 230000007017 scission Effects 0.000 claims description 26
- 108060006633 protein kinase Proteins 0.000 claims description 24
- 102000001253 Protein Kinase Human genes 0.000 claims description 23
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 19
- 102000005593 Endopeptidases Human genes 0.000 claims description 17
- 108010059378 Endopeptidases Proteins 0.000 claims description 17
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 17
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 claims description 13
- 229910052762 osmium Inorganic materials 0.000 claims description 13
- 239000007787 solid Substances 0.000 claims description 12
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims description 11
- 239000002581 neurotoxin Substances 0.000 claims description 11
- 231100000618 neurotoxin Toxicity 0.000 claims description 11
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 11
- 229910052707 ruthenium Inorganic materials 0.000 claims description 10
- 229910052742 iron Inorganic materials 0.000 claims description 9
- 101710138657 Neurotoxin Proteins 0.000 claims description 8
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 8
- 241001509415 Clostridium botulinum A Species 0.000 claims 2
- 241001509423 Clostridium botulinum B Species 0.000 claims 2
- 241001509506 Clostridium botulinum E Species 0.000 claims 2
- 230000000865 phosphorylative effect Effects 0.000 claims 1
- 102000004190 Enzymes Human genes 0.000 description 124
- 108090000790 Enzymes Proteins 0.000 description 124
- 229940088598 enzyme Drugs 0.000 description 124
- 239000002904 solvent Substances 0.000 description 88
- 239000000523 sample Substances 0.000 description 56
- 102000035195 Peptidases Human genes 0.000 description 54
- 235000018102 proteins Nutrition 0.000 description 54
- 238000003556 assay Methods 0.000 description 51
- 229910052751 metal Inorganic materials 0.000 description 47
- 230000027756 respiratory electron transport chain Effects 0.000 description 46
- 239000002184 metal Substances 0.000 description 44
- 239000012491 analyte Substances 0.000 description 43
- 125000004429 atom Chemical group 0.000 description 40
- 108090000765 processed proteins & peptides Proteins 0.000 description 40
- 238000006243 chemical reaction Methods 0.000 description 39
- 238000001514 detection method Methods 0.000 description 37
- 230000000694 effects Effects 0.000 description 36
- 230000008707 rearrangement Effects 0.000 description 35
- 230000027455 binding Effects 0.000 description 32
- 239000000203 mixture Substances 0.000 description 31
- 235000019419 proteases Nutrition 0.000 description 29
- 108030001720 Bontoxilysin Proteins 0.000 description 28
- 150000001875 compounds Chemical class 0.000 description 28
- 239000000386 donor Substances 0.000 description 28
- 238000012546 transfer Methods 0.000 description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 26
- 239000002356 single layer Substances 0.000 description 25
- 125000005647 linker group Chemical group 0.000 description 24
- 239000000126 substance Substances 0.000 description 24
- 238000006366 phosphorylation reaction Methods 0.000 description 23
- 125000006850 spacer group Chemical group 0.000 description 23
- 239000003795 chemical substances by application Substances 0.000 description 21
- 239000012212 insulator Substances 0.000 description 21
- -1 chlorine ions Chemical class 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000010931 gold Substances 0.000 description 19
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 19
- 229910001868 water Inorganic materials 0.000 description 19
- 102100038358 Prostate-specific antigen Human genes 0.000 description 18
- 229910052737 gold Inorganic materials 0.000 description 18
- 229910021645 metal ion Inorganic materials 0.000 description 18
- 230000026731 phosphorylation Effects 0.000 description 18
- 108010072866 Prostate-Specific Antigen Proteins 0.000 description 17
- 229910052757 nitrogen Inorganic materials 0.000 description 17
- 235000019833 protease Nutrition 0.000 description 17
- 238000005259 measurement Methods 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 102000004317 Lyases Human genes 0.000 description 15
- 108090000856 Lyases Proteins 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 102000004357 Transferases Human genes 0.000 description 14
- 108090000992 Transferases Proteins 0.000 description 14
- 210000004027 cell Anatomy 0.000 description 14
- 102000004196 processed proteins & peptides Human genes 0.000 description 14
- 241000894007 species Species 0.000 description 14
- 229910052717 sulfur Inorganic materials 0.000 description 14
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 13
- 235000001014 amino acid Nutrition 0.000 description 13
- 150000002500 ions Chemical class 0.000 description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 108030001722 Tentoxilysin Proteins 0.000 description 12
- 229940024606 amino acid Drugs 0.000 description 12
- 150000001413 amino acids Chemical class 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 125000002524 organometallic group Chemical group 0.000 description 12
- ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Polymers C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 11
- 108090000364 Ligases Proteins 0.000 description 11
- 102000003960 Ligases Human genes 0.000 description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 11
- 239000003112 inhibitor Substances 0.000 description 11
- 239000000463 material Substances 0.000 description 11
- 108020004707 nucleic acids Proteins 0.000 description 11
- 150000007523 nucleic acids Chemical class 0.000 description 11
- 102000039446 nucleic acids Human genes 0.000 description 11
- 125000004434 sulfur atom Chemical group 0.000 description 11
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 239000003053 toxin Substances 0.000 description 10
- 231100000765 toxin Toxicity 0.000 description 10
- 108700012359 toxins Proteins 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 108090000315 Protein Kinase C Proteins 0.000 description 9
- 102000003923 Protein Kinase C Human genes 0.000 description 9
- 150000001768 cations Chemical class 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 150000002739 metals Chemical class 0.000 description 9
- 229910052697 platinum Inorganic materials 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 8
- 102000004157 Hydrolases Human genes 0.000 description 8
- 108090000604 Hydrolases Proteins 0.000 description 8
- 108090000769 Isomerases Proteins 0.000 description 8
- 102000004195 Isomerases Human genes 0.000 description 8
- 229910019142 PO4 Inorganic materials 0.000 description 8
- 239000010949 copper Substances 0.000 description 8
- 125000004122 cyclic group Chemical group 0.000 description 8
- 230000007423 decrease Effects 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 238000007254 oxidation reaction Methods 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- 235000021317 phosphate Nutrition 0.000 description 8
- 238000006479 redox reaction Methods 0.000 description 8
- 230000004044 response Effects 0.000 description 8
- 239000011593 sulfur Substances 0.000 description 8
- 241000894006 Bacteria Species 0.000 description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 7
- 102000004316 Oxidoreductases Human genes 0.000 description 7
- 108090000854 Oxidoreductases Proteins 0.000 description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 229910052791 calcium Inorganic materials 0.000 description 7
- 239000011575 calcium Substances 0.000 description 7
- 229910052802 copper Inorganic materials 0.000 description 7
- 238000010586 diagram Methods 0.000 description 7
- 230000006870 function Effects 0.000 description 7
- 125000000524 functional group Chemical group 0.000 description 7
- 230000007246 mechanism Effects 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 239000010452 phosphate Substances 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 150000003573 thiols Chemical class 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 6
- 239000002262 Schiff base Substances 0.000 description 6
- 150000004753 Schiff bases Chemical class 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 230000003197 catalytic effect Effects 0.000 description 6
- 238000006555 catalytic reaction Methods 0.000 description 6
- 238000011534 incubation Methods 0.000 description 6
- 230000003993 interaction Effects 0.000 description 6
- 229910052759 nickel Inorganic materials 0.000 description 6
- 229910052698 phosphorus Inorganic materials 0.000 description 6
- 239000011574 phosphorus Substances 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- 239000010948 rhodium Substances 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 229910052725 zinc Inorganic materials 0.000 description 6
- XKMLYUALXHKNFT-UUOKFMHZSA-N Guanosine-5'-triphosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XKMLYUALXHKNFT-UUOKFMHZSA-N 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 5
- 239000012190 activator Substances 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 230000001580 bacterial effect Effects 0.000 description 5
- 231100001103 botulinum neurotoxin Toxicity 0.000 description 5
- 210000000080 chela (arthropods) Anatomy 0.000 description 5
- 229910017052 cobalt Inorganic materials 0.000 description 5
- 239000010941 cobalt Substances 0.000 description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 238000011835 investigation Methods 0.000 description 5
- 229910052741 iridium Inorganic materials 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 210000002569 neuron Anatomy 0.000 description 5
- 230000009871 nonspecific binding Effects 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 5
- 230000003518 presynaptic effect Effects 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 229910052702 rhenium Inorganic materials 0.000 description 5
- 229910052703 rhodium Inorganic materials 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- 229910052713 technetium Inorganic materials 0.000 description 5
- 150000007944 thiolates Chemical class 0.000 description 5
- 238000004832 voltammetry Methods 0.000 description 5
- 239000011701 zinc Substances 0.000 description 5
- MDAXKAUIABOHTD-UHFFFAOYSA-N 1,4,8,11-tetraazacyclotetradecane Chemical compound C1CNCCNCCCNCCNC1 MDAXKAUIABOHTD-UHFFFAOYSA-N 0.000 description 4
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- VEUMANXWQDHAJV-UHFFFAOYSA-N 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCN=CC1=CC=CC=C1O VEUMANXWQDHAJV-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 102000030431 Asparaginyl endopeptidase Human genes 0.000 description 4
- 238000000018 DNA microarray Methods 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 102000003843 Metalloendopeptidases Human genes 0.000 description 4
- 108090000131 Metalloendopeptidases Proteins 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- 108010038807 Oligopeptides Proteins 0.000 description 4
- 102000015636 Oligopeptides Human genes 0.000 description 4
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 4
- 108010005730 R-SNARE Proteins Proteins 0.000 description 4
- 102000005917 R-SNARE Proteins Human genes 0.000 description 4
- 229910019854 Ru—N Inorganic materials 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- 108010055066 asparaginylendopeptidase Proteins 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 239000002800 charge carrier Substances 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 150000004696 coordination complex Chemical class 0.000 description 4
- 230000001419 dependent effect Effects 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 229940066758 endopeptidases Drugs 0.000 description 4
- 238000006911 enzymatic reaction Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 description 4
- 230000000977 initiatory effect Effects 0.000 description 4
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 4
- 238000000021 kinase assay Methods 0.000 description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 4
- 229910044991 metal oxide Inorganic materials 0.000 description 4
- 150000004706 metal oxides Chemical class 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000011160 research Methods 0.000 description 4
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 4
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 4
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 3
- DIXRLQJYISYSEL-UHFFFAOYSA-N 11-aminoundecane-1-thiol Chemical compound NCCCCCCCCCCCS DIXRLQJYISYSEL-UHFFFAOYSA-N 0.000 description 3
- GWOLZNVIRIHJHB-UHFFFAOYSA-N 11-mercaptoundecanoic acid Chemical compound OC(=O)CCCCCCCCCCS GWOLZNVIRIHJHB-UHFFFAOYSA-N 0.000 description 3
- JFJNVIPVOCESGZ-UHFFFAOYSA-N 2,3-dipyridin-2-ylpyridine Chemical class N1=CC=CC=C1C1=CC=CN=C1C1=CC=CC=N1 JFJNVIPVOCESGZ-UHFFFAOYSA-N 0.000 description 3
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 3
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- IPLQXRPBZUNSMR-UHFFFAOYSA-N C1(C=CC(N1C=1C=C(C(=O)NCCCCCCCCCCCSSCCCCCCCCCCC(NC[C-]2C=CC=C2)=O)C=CC1)=O)=O.[CH-]1C=CC=C1.[Fe+2] Chemical compound C1(C=CC(N1C=1C=C(C(=O)NCCCCCCCCCCCSSCCCCCCCCCCC(NC[C-]2C=CC=C2)=O)C=CC1)=O)=O.[CH-]1C=CC=C1.[Fe+2] IPLQXRPBZUNSMR-UHFFFAOYSA-N 0.000 description 3
- 102000005600 Cathepsins Human genes 0.000 description 3
- 108010084457 Cathepsins Proteins 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- 238000002965 ELISA Methods 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- QGWNDRXFNXRZMB-UUOKFMHZSA-N GDP Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O QGWNDRXFNXRZMB-UUOKFMHZSA-N 0.000 description 3
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 3
- 108010052285 Membrane Proteins Proteins 0.000 description 3
- 108090000284 Pepsin A Proteins 0.000 description 3
- 102000057297 Pepsin A Human genes 0.000 description 3
- 206010060862 Prostate cancer Diseases 0.000 description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 3
- 108010010469 Qa-SNARE Proteins Proteins 0.000 description 3
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 3
- 102000012479 Serine Proteases Human genes 0.000 description 3
- 108010022999 Serine Proteases Proteins 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003275 alpha amino acid group Chemical group 0.000 description 3
- 150000001408 amides Chemical group 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 238000004082 amperometric method Methods 0.000 description 3
- 230000003321 amplification Effects 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 108010089934 carbohydrase Proteins 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 239000002738 chelating agent Substances 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- XGIBLEBJVMIPPF-UHFFFAOYSA-N cyclopenta-1,3-diene cyclopenta-1,3-dien-1-ylmethanamine iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.NCc1ccc[cH-]1 XGIBLEBJVMIPPF-UHFFFAOYSA-N 0.000 description 3
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 3
- 230000030609 dephosphorylation Effects 0.000 description 3
- 238000006209 dephosphorylation reaction Methods 0.000 description 3
- 238000009792 diffusion process Methods 0.000 description 3
- 229940000406 drug candidate Drugs 0.000 description 3
- 238000000835 electrochemical detection Methods 0.000 description 3
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 3
- 230000007613 environmental effect Effects 0.000 description 3
- 235000019439 ethyl acetate Nutrition 0.000 description 3
- 235000013922 glutamic acid Nutrition 0.000 description 3
- 239000004220 glutamic acid Substances 0.000 description 3
- QGWNDRXFNXRZMB-UHFFFAOYSA-N guanidine diphosphate Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O QGWNDRXFNXRZMB-UHFFFAOYSA-N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 235000014304 histidine Nutrition 0.000 description 3
- 238000009396 hybridization Methods 0.000 description 3
- 230000003301 hydrolyzing effect Effects 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 230000033001 locomotion Effects 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 238000003199 nucleic acid amplification method Methods 0.000 description 3
- 239000013110 organic ligand Substances 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- 229940111202 pepsin Drugs 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 229920001184 polypeptide Polymers 0.000 description 3
- 230000017854 proteolysis Effects 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 210000002504 synaptic vesicle Anatomy 0.000 description 3
- 238000006276 transfer reaction Methods 0.000 description 3
- 229910001428 transition metal ion Inorganic materials 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- LLXVXPPXELIDGQ-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)benzoate Chemical compound C=1C=CC(N2C(C=CC2=O)=O)=CC=1C(=O)ON1C(=O)CCC1=O LLXVXPPXELIDGQ-UHFFFAOYSA-N 0.000 description 2
- ITWBWJFEJCHKSN-UHFFFAOYSA-N 1,4,7-triazonane Chemical compound C1CNCCNCCN1 ITWBWJFEJCHKSN-UHFFFAOYSA-N 0.000 description 2
- VMJNTFXCTXAXTC-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-5-carbonitrile Chemical group C1=C(C#N)C=C2OC(F)(F)OC2=C1 VMJNTFXCTXAXTC-UHFFFAOYSA-N 0.000 description 2
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 2
- SXGZJKUKBWWHRA-UHFFFAOYSA-N 2-(N-morpholiniumyl)ethanesulfonate Chemical compound [O-]S(=O)(=O)CC[NH+]1CCOCC1 SXGZJKUKBWWHRA-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- KRHAHEQEKNJCSD-UHFFFAOYSA-N 3-mercapto-2-mercaptomethylpropanoic acid Chemical compound OC(=O)C(CS)CS KRHAHEQEKNJCSD-UHFFFAOYSA-N 0.000 description 2
- XDAGWYXSNXPGHC-UHFFFAOYSA-N 3h-1,2,5-dithiazepine Chemical compound C1SSC=CN=C1 XDAGWYXSNXPGHC-UHFFFAOYSA-N 0.000 description 2
- JIVLDFFWTQYGSR-UHFFFAOYSA-N 4,7-dimethyl-[1,10]phenanthroline Chemical compound C1=CC2=C(C)C=CN=C2C2=C1C(C)=CC=N2 JIVLDFFWTQYGSR-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 208000003508 Botulism Diseases 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 102000000584 Calmodulin Human genes 0.000 description 2
- 108010041952 Calmodulin Proteins 0.000 description 2
- 208000005623 Carcinogenesis Diseases 0.000 description 2
- 108090000317 Chymotrypsin Proteins 0.000 description 2
- 241000193155 Clostridium botulinum Species 0.000 description 2
- PHEDXBVPIONUQT-UHFFFAOYSA-N Cocarcinogen A1 Natural products CCCCCCCCCCCCCC(=O)OC1C(C)C2(O)C3C=C(C)C(=O)C3(O)CC(CO)=CC2C2C1(OC(C)=O)C2(C)C PHEDXBVPIONUQT-UHFFFAOYSA-N 0.000 description 2
- 102000004654 Cyclic GMP-Dependent Protein Kinases Human genes 0.000 description 2
- 108010003591 Cyclic GMP-Dependent Protein Kinases Proteins 0.000 description 2
- 102000003950 Cysteine Endopeptidases Human genes 0.000 description 2
- 108090000395 Cysteine Endopeptidases Proteins 0.000 description 2
- 102000005927 Cysteine Proteases Human genes 0.000 description 2
- 108010005843 Cysteine Proteases Proteins 0.000 description 2
- 108020004414 DNA Proteins 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- 241000206602 Eukaryota Species 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 239000007995 HEPES buffer Substances 0.000 description 2
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 2
- 241000725303 Human immunodeficiency virus Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 102000001399 Kallikrein Human genes 0.000 description 2
- 108060005987 Kallikrein Proteins 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- 102000004882 Lipase Human genes 0.000 description 2
- 108090001060 Lipase Proteins 0.000 description 2
- 239000004367 Lipase Substances 0.000 description 2
- 102000000380 Matrix Metalloproteinase 1 Human genes 0.000 description 2
- 108010016113 Matrix Metalloproteinase 1 Proteins 0.000 description 2
- 102000018697 Membrane Proteins Human genes 0.000 description 2
- 108060004795 Methyltransferase Proteins 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 101000822797 Naja naja Long neurotoxin 5 Proteins 0.000 description 2
- 101710163270 Nuclease Proteins 0.000 description 2
- 108091034117 Oligonucleotide Proteins 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- 108700019535 Phosphoprotein Phosphatases Proteins 0.000 description 2
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 2
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 2
- 108090001066 Racemases and epimerases Proteins 0.000 description 2
- 102000004879 Racemases and epimerases Human genes 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 102000003667 Serine Endopeptidases Human genes 0.000 description 2
- 108090000083 Serine Endopeptidases Proteins 0.000 description 2
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 2
- 108090000787 Subtilisin Proteins 0.000 description 2
- 102000050389 Syntaxin Human genes 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 108090001109 Thermolysin Proteins 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- 101710182223 Toxin B Proteins 0.000 description 2
- 108010057266 Type A Botulinum Toxins Proteins 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- HAXFWIACAGNFHA-UHFFFAOYSA-N aldrithiol Chemical compound C=1C=CC=NC=1SSC1=CC=CC=N1 HAXFWIACAGNFHA-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- RASZIXQTZOARSV-BDPUVYQTSA-N astacin Chemical compound CC=1C(=O)C(=O)CC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(=O)CC1(C)C RASZIXQTZOARSV-BDPUVYQTSA-N 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 230000036952 cancer formation Effects 0.000 description 2
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000006355 carbonyl methylene group Chemical group [H]C([H])([*:2])C([*:1])=O 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 231100000504 carcinogenesis Toxicity 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000032823 cell division Effects 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000004769 chrono-potentiometry Methods 0.000 description 2
- 229960002376 chymotrypsin Drugs 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000003869 coulometry Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 239000001177 diphosphate Substances 0.000 description 2
- 235000011180 diphosphates Nutrition 0.000 description 2
- QPJFIVIVOOQUKD-UHFFFAOYSA-N dipyrazino[2,3-f:2,3-h]quinoxaline Chemical group C1=CN=C2C3=NC=CN=C3C3=NC=CN=C3C2=N1 QPJFIVIVOOQUKD-UHFFFAOYSA-N 0.000 description 2
- BVQAWSJMUYMNQN-UHFFFAOYSA-N dipyridophenazine Chemical compound C1=CC=C2C3=NC4=CC=CC=C4N=C3C3=CC=CN=C3C2=N1 BVQAWSJMUYMNQN-UHFFFAOYSA-N 0.000 description 2
- 239000012990 dithiocarbamate Substances 0.000 description 2
- 238000002848 electrochemical method Methods 0.000 description 2
- 238000009713 electroplating Methods 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000011152 fibreglass Substances 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- 229910021397 glassy carbon Inorganic materials 0.000 description 2
- 125000004404 heteroalkyl group Chemical group 0.000 description 2
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 230000002779 inactivation Effects 0.000 description 2
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 2
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 2
- 150000002527 isonitriles Chemical class 0.000 description 2
- 229940043355 kinase inhibitor Drugs 0.000 description 2
- 235000019421 lipase Nutrition 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 230000002132 lysosomal effect Effects 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 238000003032 molecular docking Methods 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 2
- 210000002161 motor neuron Anatomy 0.000 description 2
- 230000004118 muscle contraction Effects 0.000 description 2
- 230000001537 neural effect Effects 0.000 description 2
- 230000003957 neurotransmitter release Effects 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 239000002777 nucleoside Substances 0.000 description 2
- 239000002773 nucleotide Substances 0.000 description 2
- 125000003729 nucleotide group Chemical group 0.000 description 2
- 238000005457 optimization Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- ASBFNPBREVZDOE-UHFFFAOYSA-N phenanthrene-9,10-diimine Chemical class C1=CC=C2C(=N)C(=N)C3=CC=CC=C3C2=C1 ASBFNPBREVZDOE-UHFFFAOYSA-N 0.000 description 2
- PHEDXBVPIONUQT-RGYGYFBISA-N phorbol 13-acetate 12-myristate Chemical compound C([C@]1(O)C(=O)C(C)=C[C@H]1[C@@]1(O)[C@H](C)[C@H]2OC(=O)CCCCCCCCCCCCC)C(CO)=C[C@H]1[C@H]1[C@]2(OC(C)=O)C1(C)C PHEDXBVPIONUQT-RGYGYFBISA-N 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 150000004032 porphyrins Chemical class 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000004983 proton decoupled 13C NMR spectroscopy Methods 0.000 description 2
- CVSGFMWKZVZOJD-UHFFFAOYSA-N pyrazino[2,3-f]quinoxaline Chemical compound C1=CN=C2C3=NC=CN=C3C=CC2=N1 CVSGFMWKZVZOJD-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000000682 scanning probe acoustic microscopy Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 230000019491 signal transduction Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052814 silicon oxide Inorganic materials 0.000 description 2
- 238000007614 solvation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 210000003568 synaptosome Anatomy 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 239000001226 triphosphate Substances 0.000 description 2
- 235000011178 triphosphate Nutrition 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000000304 virulence factor Substances 0.000 description 2
- 230000007923 virulence factor Effects 0.000 description 2
- 230000004572 zinc-binding Effects 0.000 description 2
- OGNSCSPNOLGXSM-UHFFFAOYSA-N (+/-)-DABA Natural products NCCC(N)C(O)=O OGNSCSPNOLGXSM-UHFFFAOYSA-N 0.000 description 1
- BQPPJGMMIYJVBR-UHFFFAOYSA-N (10S)-3c-Acetoxy-4.4.10r.13c.14t-pentamethyl-17c-((R)-1.5-dimethyl-hexen-(4)-yl)-(5tH)-Delta8-tetradecahydro-1H-cyclopenta[a]phenanthren Natural products CC12CCC(OC(C)=O)C(C)(C)C1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21C BQPPJGMMIYJVBR-UHFFFAOYSA-N 0.000 description 1
- SAAQPSNNIOGFSQ-LURJTMIESA-N (2s)-2-(pyridin-4-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC=NC=C1 SAAQPSNNIOGFSQ-LURJTMIESA-N 0.000 description 1
- CHGIKSSZNBCNDW-UHFFFAOYSA-N (3beta,5alpha)-4,4-Dimethylcholesta-8,24-dien-3-ol Natural products CC12CCC(O)C(C)(C)C1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21 CHGIKSSZNBCNDW-UHFFFAOYSA-N 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- JRNVQLOKVMWBFR-UHFFFAOYSA-N 1,2-benzenedithiol Chemical compound SC1=CC=CC=C1S JRNVQLOKVMWBFR-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- XYTLYKGXLMKYMV-UHFFFAOYSA-N 14alpha-methylzymosterol Natural products CC12CCC(O)CC1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21C XYTLYKGXLMKYMV-UHFFFAOYSA-N 0.000 description 1
- CWGFSQJQIHRAAE-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.OCC(N)(CO)CO CWGFSQJQIHRAAE-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- HKOAFLAGUQUJQG-UHFFFAOYSA-N 2-pyrimidin-2-ylpyrimidine Chemical group N1=CC=CN=C1C1=NC=CC=N1 HKOAFLAGUQUJQG-UHFFFAOYSA-N 0.000 description 1
- RREAVEQOCKXSHQ-UHFFFAOYSA-N 2h-inden-2-ide Chemical compound C1=CC=C2[CH-]C=CC2=C1 RREAVEQOCKXSHQ-UHFFFAOYSA-N 0.000 description 1
- ZOOGRGPOEVQQDX-UUOKFMHZSA-N 3',5'-cyclic GMP Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=C(NC2=O)N)=C2N=C1 ZOOGRGPOEVQQDX-UUOKFMHZSA-N 0.000 description 1
- FPTJELQXIUUCEY-UHFFFAOYSA-N 3beta-Hydroxy-lanostan Natural products C1CC2C(C)(C)C(O)CCC2(C)C2C1C1(C)CCC(C(C)CCCC(C)C)C1(C)CC2 FPTJELQXIUUCEY-UHFFFAOYSA-N 0.000 description 1
- BWGRDBSNKQABCB-UHFFFAOYSA-N 4,4-difluoro-N-[3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-thiophen-2-ylpropyl]cyclohexane-1-carboxamide Chemical compound CC(C)C1=NN=C(C)N1C1CC2CCC(C1)N2CCC(NC(=O)C1CCC(F)(F)CC1)C1=CC=CS1 BWGRDBSNKQABCB-UHFFFAOYSA-N 0.000 description 1
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 108010068327 4-hydroxyphenylpyruvate dioxygenase Proteins 0.000 description 1
- 102100028626 4-hydroxyphenylpyruvate dioxygenase Human genes 0.000 description 1
- 101710169336 5'-deoxyadenosine deaminase Proteins 0.000 description 1
- 102100026802 72 kDa type IV collagenase Human genes 0.000 description 1
- 101710151806 72 kDa type IV collagenase Proteins 0.000 description 1
- 108091005508 Acid proteases Proteins 0.000 description 1
- ZHQQRIUYLMXDPP-SSDOTTSWSA-N Actinidine Natural products C1=NC=C(C)C2=C1[C@H](C)CC2 ZHQQRIUYLMXDPP-SSDOTTSWSA-N 0.000 description 1
- 102000057234 Acyl transferases Human genes 0.000 description 1
- 108700016155 Acyl transferases Proteins 0.000 description 1
- 102100036664 Adenosine deaminase Human genes 0.000 description 1
- SMPNJFHAPJOHPP-JOILOJCLSA-N Adenosine, cyclic 3',5'-[hydrogen [p(s)]-phosphorothioate] Chemical compound C([C@H]1O2)OP(O)(=S)O[C@H]1[C@@H](O)[C@@H]2N1C(N=CN=C2N)=C2N=C1 SMPNJFHAPJOHPP-JOILOJCLSA-N 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 102000007698 Alcohol dehydrogenase Human genes 0.000 description 1
- 108010021809 Alcohol dehydrogenase Proteins 0.000 description 1
- 102000005369 Aldehyde Dehydrogenase Human genes 0.000 description 1
- 108020002663 Aldehyde Dehydrogenase Proteins 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- 102100022749 Aminopeptidase N Human genes 0.000 description 1
- 102000001381 Arachidonate 5-Lipoxygenase Human genes 0.000 description 1
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 description 1
- 241001120493 Arene Species 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 102000014654 Aromatase Human genes 0.000 description 1
- 108010078554 Aromatase Proteins 0.000 description 1
- 108091005502 Aspartic proteases Proteins 0.000 description 1
- 102000035101 Aspartic proteases Human genes 0.000 description 1
- 108090000658 Astacin Proteins 0.000 description 1
- 102000034498 Astacin Human genes 0.000 description 1
- 231100000699 Bacterial toxin Toxicity 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 108010004032 Bromelains Proteins 0.000 description 1
- 108010049990 CD13 Antigens Proteins 0.000 description 1
- 102000004631 Calcineurin Human genes 0.000 description 1
- 108010042955 Calcineurin Proteins 0.000 description 1
- 108010026870 Calcium-Calmodulin-Dependent Protein Kinases Proteins 0.000 description 1
- 102000019025 Calcium-Calmodulin-Dependent Protein Kinases Human genes 0.000 description 1
- 108010032088 Calpain Proteins 0.000 description 1
- 102000007590 Calpain Human genes 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 108010031425 Casein Kinases Proteins 0.000 description 1
- 102000005403 Casein Kinases Human genes 0.000 description 1
- 108010076667 Caspases Proteins 0.000 description 1
- 102000011727 Caspases Human genes 0.000 description 1
- 102000003908 Cathepsin D Human genes 0.000 description 1
- 108090000258 Cathepsin D Proteins 0.000 description 1
- 108010031896 Cell Cycle Proteins Proteins 0.000 description 1
- 102000005483 Cell Cycle Proteins Human genes 0.000 description 1
- 108010059892 Cellulase Proteins 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 108090000746 Chymosin Proteins 0.000 description 1
- 108090000175 Cis-trans-isomerases Proteins 0.000 description 1
- 102000003813 Cis-trans-isomerases Human genes 0.000 description 1
- 108091035707 Consensus sequence Proteins 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 206010011703 Cyanosis Diseases 0.000 description 1
- 102000008130 Cyclic AMP-Dependent Protein Kinases Human genes 0.000 description 1
- 108010049894 Cyclic AMP-Dependent Protein Kinases Proteins 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- 102000003849 Cytochrome P450 Human genes 0.000 description 1
- 108020001738 DNA Glycosylase Proteins 0.000 description 1
- 102000028381 DNA glycosylase Human genes 0.000 description 1
- 206010012335 Dependence Diseases 0.000 description 1
- 101100296720 Dictyostelium discoideum Pde4 gene Proteins 0.000 description 1
- 101100135868 Dictyostelium discoideum pde3 gene Proteins 0.000 description 1
- 101100189582 Dictyostelium discoideum pdeD gene Proteins 0.000 description 1
- FMKGDHLSXFDSOU-BDPUVYQTSA-N Dienon-Astacin Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(=CC1(C)C)O)C=CC=C(/C)C=CC2=C(C)C(=O)C(=CC2(C)C)O FMKGDHLSXFDSOU-BDPUVYQTSA-N 0.000 description 1
- 102000003850 Dipeptidase 1 Human genes 0.000 description 1
- 108090000204 Dipeptidase 1 Proteins 0.000 description 1
- 108700034637 EC 3.2.-.- Proteins 0.000 description 1
- 108700033921 EC 3.4.23.20 Proteins 0.000 description 1
- 108700034062 EC 5.99.-.- Proteins 0.000 description 1
- 102000001301 EGF receptor Human genes 0.000 description 1
- 108060006698 EGF receptor Proteins 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 108010091443 Exopeptidases Proteins 0.000 description 1
- 102000018389 Exopeptidases Human genes 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 102000013446 GTP Phosphohydrolases Human genes 0.000 description 1
- 108091006109 GTPases Proteins 0.000 description 1
- BKLIAINBCQPSOV-UHFFFAOYSA-N Gluanol Natural products CC(C)CC=CC(C)C1CCC2(C)C3=C(CCC12C)C4(C)CCC(O)C(C)(C)C4CC3 BKLIAINBCQPSOV-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 108010031186 Glycoside Hydrolases Proteins 0.000 description 1
- 102000005744 Glycoside Hydrolases Human genes 0.000 description 1
- 102000051366 Glycosyltransferases Human genes 0.000 description 1
- 108700023372 Glycosyltransferases Proteins 0.000 description 1
- 108010078321 Guanylate Cyclase Proteins 0.000 description 1
- 102000014469 Guanylate cyclase Human genes 0.000 description 1
- 102000016761 Haem oxygenases Human genes 0.000 description 1
- 108050006318 Haem oxygenases Proteins 0.000 description 1
- 108010025076 Holoenzymes Proteins 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 1
- 101000605534 Homo sapiens Prostate-specific antigen Proteins 0.000 description 1
- 101000639136 Homo sapiens Vesicle-associated membrane protein 2 Proteins 0.000 description 1
- 102000004867 Hydro-Lyases Human genes 0.000 description 1
- 108090001042 Hydro-Lyases Proteins 0.000 description 1
- 102000003746 Insulin Receptor Human genes 0.000 description 1
- 108010001127 Insulin Receptor Proteins 0.000 description 1
- 108010036012 Iodide peroxidase Proteins 0.000 description 1
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- LOPKHWOTGJIQLC-UHFFFAOYSA-N Lanosterol Natural products CC(CCC=C(C)C)C1CCC2(C)C3=C(CCC12C)C4(C)CCC(C)(O)C(C)(C)C4CC3 LOPKHWOTGJIQLC-UHFFFAOYSA-N 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical group O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 102100030417 Matrilysin Human genes 0.000 description 1
- 108090000855 Matrilysin Proteins 0.000 description 1
- 108010000684 Matrix Metalloproteinases Proteins 0.000 description 1
- 102000002274 Matrix Metalloproteinases Human genes 0.000 description 1
- 108010015302 Matrix metalloproteinase-9 Proteins 0.000 description 1
- 102100030412 Matrix metalloproteinase-9 Human genes 0.000 description 1
- 102000005741 Metalloproteases Human genes 0.000 description 1
- 108010006035 Metalloproteases Proteins 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 1
- 102000016397 Methyltransferase Human genes 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 108090000028 Neprilysin Proteins 0.000 description 1
- 102000003729 Neprilysin Human genes 0.000 description 1
- CAHGCLMLTWQZNJ-UHFFFAOYSA-N Nerifoliol Natural products CC12CCC(O)C(C)(C)C1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21C CAHGCLMLTWQZNJ-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 108020004711 Nucleic Acid Probes Proteins 0.000 description 1
- 108091028043 Nucleic acid sequence Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- MTJGIYKWSXKZNV-UHFFFAOYSA-N OC(=O)CCCCCCCCCCSSC1=CC=CC=N1 Chemical compound OC(=O)CCCCCCCCCCSSC1=CC=CC=N1 MTJGIYKWSXKZNV-UHFFFAOYSA-N 0.000 description 1
- RWUGVMAIHSIACN-UHFFFAOYSA-N OS(N[S])(=O)=O Chemical compound OS(N[S])(=O)=O RWUGVMAIHSIACN-UHFFFAOYSA-N 0.000 description 1
- 102000043276 Oncogene Human genes 0.000 description 1
- 108700020796 Oncogene Proteins 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 238000005052 Osteryoung square wave voltammetry Methods 0.000 description 1
- 101150098694 PDE5A gene Proteins 0.000 description 1
- 108010067372 Pancreatic elastase Proteins 0.000 description 1
- 102000016387 Pancreatic elastase Human genes 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 108010067902 Peptide Library Proteins 0.000 description 1
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 1
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 1
- 108010001441 Phosphopeptides Proteins 0.000 description 1
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 1
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 101100082610 Plasmodium falciparum (isolate 3D7) PDEdelta gene Proteins 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 101800001357 Potential peptide Proteins 0.000 description 1
- 102400000745 Potential peptide Human genes 0.000 description 1
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 1
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 1
- 101800001753 Protease Proteins 0.000 description 1
- 101710118538 Protease Proteins 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 101710182361 Pyruvate:ferredoxin oxidoreductase Proteins 0.000 description 1
- 108090001087 RNA ligase (ATP) Proteins 0.000 description 1
- 108090000783 Renin Proteins 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 102000028649 Ribonucleoside-diphosphate reductase Human genes 0.000 description 1
- 108010038105 Ribonucleoside-diphosphate reductase Proteins 0.000 description 1
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000242678 Schistosoma Species 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical group [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical class [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- 102100028848 Stromelysin-2 Human genes 0.000 description 1
- 101710108792 Stromelysin-2 Proteins 0.000 description 1
- 101710172711 Structural protein Proteins 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- 102000019259 Succinate Dehydrogenase Human genes 0.000 description 1
- 108010012901 Succinate Dehydrogenase Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 102000004385 Sulfurtransferases Human genes 0.000 description 1
- 108090000984 Sulfurtransferases Proteins 0.000 description 1
- 206010043376 Tetanus Diseases 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical group OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 1
- 102000035100 Threonine proteases Human genes 0.000 description 1
- 108091005501 Threonine proteases Proteins 0.000 description 1
- 102000014267 Thyroid peroxidases Human genes 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 101710183280 Topoisomerase Proteins 0.000 description 1
- 102000003929 Transaminases Human genes 0.000 description 1
- 108090000340 Transaminases Proteins 0.000 description 1
- 108020004566 Transfer RNA Proteins 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108010046334 Urease Proteins 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 102100033220 Xanthine oxidase Human genes 0.000 description 1
- 108010093894 Xanthine oxidase Proteins 0.000 description 1
- 241000607734 Yersinia <bacteria> Species 0.000 description 1
- 102000036859 Zinc-dependent proteases Human genes 0.000 description 1
- 108091006973 Zinc-dependent proteases Proteins 0.000 description 1
- XLVKXZZJSTWDJY-UHFFFAOYSA-N [SiH4].[Si] Chemical group [SiH4].[Si] XLVKXZZJSTWDJY-UHFFFAOYSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- ZHQQRIUYLMXDPP-ZETCQYMHSA-N actinidine Chemical compound C1=NC=C(C)C2=C1[C@@H](C)CC2 ZHQQRIUYLMXDPP-ZETCQYMHSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 230000004103 aerobic respiration Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001356 alkyl thiols Chemical class 0.000 description 1
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 238000000029 amperostatic coulometry Methods 0.000 description 1
- 108010038083 amyloid fibril protein AS-SAM Proteins 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000000637 arginyl group Chemical group N[C@@H](CCCNC(N)=N)C(=O)* 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 239000012237 artificial material Substances 0.000 description 1
- 235000003676 astacin Nutrition 0.000 description 1
- 239000000688 bacterial toxin Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- SNDWLALPDYYGKQ-UHFFFAOYSA-N benzene;3h-dithiole-3-carboxylic acid Chemical compound C1=CC=CC=C1.OC(=O)C1SSC=C1 SNDWLALPDYYGKQ-UHFFFAOYSA-N 0.000 description 1
- IWCQVOVBDXJJDF-UHFFFAOYSA-N benzene;chromium;cyclohexane Chemical compound [Cr].[CH-]1[CH-][CH-][CH-][CH-][CH-]1.C1=CC=CC=C1 IWCQVOVBDXJJDF-UHFFFAOYSA-N 0.000 description 1
- 239000013060 biological fluid Substances 0.000 description 1
- 239000012620 biological material Substances 0.000 description 1
- 238000007413 biotinylation Methods 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000009534 blood test Methods 0.000 description 1
- 238000010504 bond cleavage reaction Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 235000019835 bromelain Nutrition 0.000 description 1
- 102100029175 cGMP-specific 3',5'-cyclic phosphodiesterase Human genes 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 108010025267 calcium-dependent protein kinase Proteins 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 238000001460 carbon-13 nuclear magnetic resonance spectrum Methods 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000009087 cell motility Effects 0.000 description 1
- 230000010307 cell transformation Effects 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 238000000970 chrono-amperometry Methods 0.000 description 1
- 229940080701 chymosin Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003759 clinical diagnosis Methods 0.000 description 1
- 150000004700 cobalt complex Chemical class 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000003271 compound fluorescence assay Methods 0.000 description 1
- 229920001940 conductive polymer Polymers 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 230000002920 convulsive effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000011889 copper foil Substances 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- ZOOGRGPOEVQQDX-UHFFFAOYSA-N cyclic GMP Natural products O1C2COP(O)(=O)OC2C(O)C1N1C=NC2=C1NC(N)=NC2=O ZOOGRGPOEVQQDX-UHFFFAOYSA-N 0.000 description 1
- 125000006841 cyclic skeleton Chemical group 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 210000000805 cytoplasm Anatomy 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000002242 deionisation method Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000001903 differential pulse voltammetry Methods 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- QBSJHOGDIUQWTH-UHFFFAOYSA-N dihydrolanosterol Natural products CC(C)CCCC(C)C1CCC2(C)C3=C(CCC12C)C4(C)CCC(C)(O)C(C)(C)C4CC3 QBSJHOGDIUQWTH-UHFFFAOYSA-N 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 238000002651 drug therapy Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 229920001746 electroactive polymer Polymers 0.000 description 1
- 238000007812 electrochemical assay Methods 0.000 description 1
- 230000005518 electrochemistry Effects 0.000 description 1
- 238000003934 electrogravimetry Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000001077 electron transfer detection Methods 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- DEFVIWRASFVYLL-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl)tetraacetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCOCCN(CC(O)=O)CC(O)=O DEFVIWRASFVYLL-UHFFFAOYSA-N 0.000 description 1
- 230000028023 exocytosis Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 238000001917 fluorescence detection Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 201000011424 foodborne botulism Diseases 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 229920001002 functional polymer Polymers 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-L glutamate group Chemical group N[C@@H](CCC(=O)[O-])C(=O)[O-] WHUUTDBJXJRKMK-VKHMYHEASA-L 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 229910001922 gold oxide Inorganic materials 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 239000000122 growth hormone Substances 0.000 description 1
- 150000002374 hemiaminals Chemical class 0.000 description 1
- 238000013537 high throughput screening Methods 0.000 description 1
- 150000002411 histidines Chemical class 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000000852 hydrogen donor Substances 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 238000002847 impedance measurement Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 201000011422 infant botulism Diseases 0.000 description 1
- 210000001926 inhibitory interneuron Anatomy 0.000 description 1
- 229940030980 inova Drugs 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000003674 kinase activity assay Methods 0.000 description 1
- 229940058690 lanosterol Drugs 0.000 description 1
- CAHGCLMLTWQZNJ-RGEKOYMOSA-N lanosterol Chemical compound C([C@]12C)C[C@@H](O)C(C)(C)[C@H]1CCC1=C2CC[C@]2(C)[C@H]([C@H](CCC=C(C)C)C)CC[C@@]21C CAHGCLMLTWQZNJ-RGEKOYMOSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000001459 lithography Methods 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001840 matrix-assisted laser desorption--ionisation time-of-flight mass spectrometry Methods 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 108020004084 membrane receptors Proteins 0.000 description 1
- 102000020235 metallo-beta-lactamase Human genes 0.000 description 1
- 108060004734 metallo-beta-lactamase Proteins 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- GNOLWGAJQVLBSM-UHFFFAOYSA-N n,n,5,7-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-amine Chemical compound C1=C(C)C=C2C(N(C)C)CCCC2=C1C GNOLWGAJQVLBSM-UHFFFAOYSA-N 0.000 description 1
- RKISUIUJZGSLEV-UHFFFAOYSA-N n-[2-(octadecanoylamino)ethyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCCNC(=O)CCCCCCCCCCCCCCCCC RKISUIUJZGSLEV-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- 238000001807 normal pulse voltammetry Methods 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000002853 nucleic acid probe Substances 0.000 description 1
- 238000001668 nucleic acid synthesis Methods 0.000 description 1
- 238000005935 nucleophilic addition reaction Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 1
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical compound [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229940055729 papain Drugs 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000002161 passivation Methods 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 125000002097 pentamethylcyclopentadienyl group Chemical group 0.000 description 1
- 229960003330 pentetic acid Drugs 0.000 description 1
- 239000000816 peptidomimetic Substances 0.000 description 1
- 150000005041 phenanthrolines Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 125000002743 phosphorus functional group Chemical group 0.000 description 1
- 108091005981 phosphorylated proteins Proteins 0.000 description 1
- 238000000206 photolithography Methods 0.000 description 1
- 230000029553 photosynthesis Effects 0.000 description 1
- 238000010672 photosynthesis Methods 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 239000013612 plasmid Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- QVLTXCYWHPZMCA-UHFFFAOYSA-N po4-po4 Chemical group OP(O)(O)=O.OP(O)(O)=O QVLTXCYWHPZMCA-UHFFFAOYSA-N 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 208000017497 prostate disease Diseases 0.000 description 1
- 235000004252 protein component Nutrition 0.000 description 1
- 230000009822 protein phosphorylation Effects 0.000 description 1
- 230000006337 proteolytic cleavage Effects 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000000083 pulse voltammetry Methods 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 239000002901 radioactive waste Substances 0.000 description 1
- 238000009790 rate-determining step (RDS) Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920013730 reactive polymer Polymers 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000001223 reverse osmosis Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 125000000548 ribosyl group Chemical group C1([C@H](O)[C@H](O)[C@H](O1)CO)* 0.000 description 1
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 1
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 238000005317 semiclassical theory Methods 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Substances [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000004365 square wave voltammetry Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003950 stripping voltammetry Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 125000004354 sulfur functional group Chemical group 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 210000002182 synaptic membrane Anatomy 0.000 description 1
- JBQYATWDVHIOAR-UHFFFAOYSA-N tellanylidenegermanium Chemical compound [Te]=[Ge] JBQYATWDVHIOAR-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 238000006863 thiophosphorylation reaction Methods 0.000 description 1
- 230000036962 time dependent Effects 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 102000035160 transmembrane proteins Human genes 0.000 description 1
- 108091005703 transmembrane proteins Proteins 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
- 230000005641 tunneling Effects 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 241001515965 unidentified phage Species 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- ATCJTYORYKLVIA-SRXJVYAUSA-N vamp regimen Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1.C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1.C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C(C45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 ATCJTYORYKLVIA-SRXJVYAUSA-N 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 230000028973 vesicle-mediated transport Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 210000001835 viscera Anatomy 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US98073307P | 2007-10-17 | 2007-10-17 | |
| US8710208P | 2008-08-07 | 2008-08-07 | |
| US8709408P | 2008-08-07 | 2008-08-07 | |
| PCT/US2008/080363 WO2009052422A1 (en) | 2007-10-17 | 2008-10-17 | Electrochemical assay for the detection of enzymes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2011502245A JP2011502245A (ja) | 2011-01-20 |
| JP2011502245A5 true JP2011502245A5 (enExample) | 2011-12-15 |
Family
ID=40567805
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2010530160A Pending JP2011501161A (ja) | 2007-10-17 | 2008-10-17 | バイオセンサーに用いる新しい化学 |
| JP2010530156A Pending JP2011502245A (ja) | 2007-10-17 | 2008-10-17 | 酵素検出のための電気化学的検定方法 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2010530160A Pending JP2011501161A (ja) | 2007-10-17 | 2008-10-17 | バイオセンサーに用いる新しい化学 |
Country Status (6)
| Country | Link |
|---|---|
| US (5) | US20100003710A1 (enExample) |
| EP (2) | EP2210268A4 (enExample) |
| JP (2) | JP2011501161A (enExample) |
| AU (2) | AU2008311820A1 (enExample) |
| CA (2) | CA2702969A1 (enExample) |
| WO (2) | WO2009052436A1 (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8951400B2 (en) | 2007-10-17 | 2015-02-10 | Ohmx Corporation | Chemistry used in biosensors |
| EP2278636A1 (en) * | 2009-07-21 | 2011-01-26 | Sony Corporation | Uses of dithiocarbamate compounds |
| US9250234B2 (en) | 2011-01-19 | 2016-02-02 | Ohmx Corporation | Enzyme triggered redox altering chemical elimination (E-TRACE) immunoassay |
| EP2462238B1 (en) | 2009-08-07 | 2013-07-17 | Ohmx Corporation | Enzyme triggered redox altering chemical elimination (e-trace) immunoassay |
| US9000769B2 (en) | 2009-11-23 | 2015-04-07 | Proxim Diagnostics | Controlled electrochemical activation of carbon-based electrodes |
| CN102834512A (zh) | 2010-04-06 | 2012-12-19 | 株式会社Ihi | 金属salen配合物衍生物及其制造方法 |
| US20120034638A1 (en) | 2010-05-21 | 2012-02-09 | Michael Ahrens | Electrochemical assay for the detection of enzymatically active PSA |
| EP2737315B1 (en) | 2011-07-25 | 2022-03-16 | Proxim Diagnostics Corporation | Cartridge for diagnostic testing |
| US10248293B2 (en) * | 2011-09-30 | 2019-04-02 | Nokia Technologies Oy | Method, apparatus, computer program and user interface |
| FR2980989A1 (fr) * | 2011-10-06 | 2013-04-12 | Commissariat Energie Atomique | Procede de fonctionnalisation d'un substrat solide autre qu'un substrat en or par des composes chimiques specifiques |
| EP2768967B1 (en) | 2011-10-17 | 2017-12-06 | Ohmx Corporation | Single, direct detection of hemoglobin a1c percentage using enzyme triggered redox altering chemical elimination (e-trace) immunoassay |
| JP2014532720A (ja) * | 2011-11-04 | 2014-12-08 | オームクス コーポレイション | バイオセンサーにおいて使用される新規化学 |
| BR112014012928A2 (pt) * | 2011-12-02 | 2017-06-13 | Koninklijke Philips Nv | dispositivo de detecção de valor de ph para detectar o valor de ph de uma solução; e método para detecção de valor de ph de uma solução |
| US9250203B2 (en) | 2012-01-09 | 2016-02-02 | Ohmx Corporation | Enzyme cascade methods for E-TRACE assay signal amplification |
| DE102012201843A1 (de) * | 2012-02-08 | 2013-08-08 | Siemens Aktiengesellschaft | Anordnung und Verfahren zur elektrischen Detektion von flüssigen Proben mit Lateral Flow Assays |
| EP3121288A1 (en) | 2012-07-27 | 2017-01-25 | Ohmx Corporation | Electronic measurements of monolayers following homogeneous reactions of their components |
| US9416390B2 (en) | 2012-07-27 | 2016-08-16 | Ohmx Corporation | Electric measurement of monolayers following pro-cleave detection of presence and activity of enzymes and other target analytes |
| GB2514825B (en) * | 2013-06-06 | 2017-11-08 | Bangor Univ | Sensors |
| WO2015042493A2 (en) | 2013-09-20 | 2015-03-26 | Ohmx Corporation | Psa enzymatic activity: a new biomarker for assessing prostate cancer aggressiveness |
| EP3137904A1 (en) | 2014-04-29 | 2017-03-08 | Ohmx Corporation | Bioelectronic binding assay using peak profiling |
| WO2016025539A1 (en) * | 2014-08-11 | 2016-02-18 | Ohmx Corporation | Enzyme triggered redox altering chemical elimination (-trace) assay with multiplexing capabilities |
| WO2016061590A1 (en) | 2014-10-17 | 2016-04-21 | Wardell Mark R | Method for detecting proteases and active infection in biological fluids and tissues |
| US9373561B1 (en) | 2014-12-18 | 2016-06-21 | International Business Machines Corporation | Integrated circuit barrierless microfluidic channel |
| WO2016100834A2 (en) * | 2014-12-19 | 2016-06-23 | Ohmx Corporation | Competitive enzymatic assays |
| AU2016215455A1 (en) * | 2015-02-02 | 2017-08-17 | Ontera Inc. | Labile linkers for biomarker detection |
| US20170030907A1 (en) * | 2015-06-26 | 2017-02-02 | Uti Limited Partnership | Tlr-4 based electrochemical biosensor |
| CN105259349B (zh) * | 2015-11-03 | 2017-11-14 | 青岛农业大学 | 一种免固定生物传感电极的制备及其在免标记均相光致电化学农残检测与癌症诊断中的应用 |
| US11793893B2 (en) | 2016-10-03 | 2023-10-24 | The Penn State Research Foundation | Compounds comprising conductive oligomers, materials formed therefrom, and methods of making and using same |
| CN108760845B (zh) * | 2018-05-21 | 2020-06-09 | 浙江工业大学 | 一种改性pb修饰电极及其制备方法 |
| US10908092B2 (en) | 2018-10-11 | 2021-02-02 | Baker Hughes, A Ge Company, Llc | Process for making cyano functionalized gold nanoparticles |
| CN111385495B (zh) * | 2018-12-29 | 2022-02-11 | 天津大学青岛海洋技术研究院 | 一种用于补偿tof传感器中电荷转移不完全的方法 |
| KR102750082B1 (ko) * | 2022-05-12 | 2025-01-03 | 서울대학교산학협력단 | 다중 복합 재료 및 상기 다중 복합 재료를 포함하는 금속 센서 및 상기 다중 복합 재료의 제조 방법 |
Family Cites Families (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0018002B1 (de) * | 1979-04-24 | 1983-02-09 | Marcel Jozefonvicz | Neues Bestimmungsverfahren für Proteasen und Antiproteasen |
| FR2673183B1 (fr) * | 1991-02-21 | 1996-09-27 | Asulab Sa | Complexes mono, bis ou tris (2,2'-bipyridine substituee) d'un metal choisi parmi le fer, le ruthenium, l'osmium ou le vanadium et leurs procedes de preparation . |
| DE4430023A1 (de) * | 1994-08-24 | 1996-02-29 | Boehringer Mannheim Gmbh | Elektrochemischer Sensor |
| JP2001503376A (ja) | 1995-12-12 | 2001-03-13 | カルフォルニア・インスティテュート・オブ・テクノロジー | コバルト・シッフ塩基化合物 |
| US5804400A (en) * | 1996-02-05 | 1998-09-08 | Igen International, Inc. | Electrochemiluminescent assay |
| EP0879412A4 (en) * | 1996-02-08 | 2004-08-11 | Ambri Ltd | BIOSENSOR TO DETECT ENZYMS |
| US6750016B2 (en) * | 1996-07-29 | 2004-06-15 | Nanosphere, Inc. | Nanoparticles having oligonucleotides attached thereto and uses therefor |
| US7045285B1 (en) * | 1996-11-05 | 2006-05-16 | Clinical Micro Sensors, Inc. | Electronic transfer moieties attached to peptide nucleic acids |
| AU744503B2 (en) * | 1997-06-12 | 2002-02-28 | Clinical Micro Sensors, Inc. | Electronic methods for the detection of analytes |
| US6013459A (en) * | 1997-06-12 | 2000-01-11 | Clinical Micro Sensors, Inc. | Detection of analytes using reorganization energy |
| US6134461A (en) * | 1998-03-04 | 2000-10-17 | E. Heller & Company | Electrochemical analyte |
| RU2161653C2 (ru) * | 1998-08-24 | 2001-01-10 | ФАРМАКОВСКИЙ Дмитрий Александрович | Способ количественного электрохимического анализа биомолекул |
| US6541617B1 (en) * | 1998-10-27 | 2003-04-01 | Clinical Micro Sensors, Inc. | Detection of target analytes using particles and electrodes |
| US6432723B1 (en) * | 1999-01-22 | 2002-08-13 | Clinical Micro Sensors, Inc. | Biosensors utilizing ligand induced conformation changes |
| US6495336B1 (en) * | 1999-02-23 | 2002-12-17 | Pentapharm Ag | Oligopeptide derivatives for the electrochemical measurement of protease activity |
| US7234414B2 (en) * | 1999-11-18 | 2007-06-26 | Sensortec Limited | Mastitis detection |
| GB0002201D0 (en) * | 2000-01-31 | 2000-03-22 | Imperial College | Process |
| US6753143B2 (en) * | 2000-05-01 | 2004-06-22 | Clinical Micro Sensors, Inc. | Target analyte detection using asymmetrical self-assembled monolayers |
| DE10024314A1 (de) * | 2000-05-17 | 2001-11-22 | Basf Ag | Verfahren, umfassend die indirekte elektrochemische Regeneration von NAD(P)H |
| US6676816B2 (en) * | 2001-05-11 | 2004-01-13 | Therasense, Inc. | Transition metal complexes with (pyridyl)imidazole ligands and sensors using said complexes |
| US6932894B2 (en) * | 2001-05-15 | 2005-08-23 | Therasense, Inc. | Biosensor membranes composed of polymers containing heterocyclic nitrogens |
| RU2301997C2 (ru) | 2001-08-24 | 2007-06-27 | Сенсор-Тек Лимитед | Способ получения высокочувствительных потенциометрических датчиков |
| JP2005535120A (ja) * | 2002-08-06 | 2005-11-17 | アベシア・リミテッド | 有機電子デバイス |
| US7214528B1 (en) * | 2002-12-31 | 2007-05-08 | Oregon Health & Sciences University | Device for direct electrical detection of molecules and molecule-molecule interactions |
| US20060269826A1 (en) * | 2003-03-03 | 2006-11-30 | Eugenii Katz | Novel electrode with switchable and tunable power output and fuel cell using such electrode |
| JP4614630B2 (ja) * | 2003-03-31 | 2011-01-19 | 有限会社筑波物質情報研究所 | 機能性高分子化合物およびそれを用いたバイオセンサ |
| US20050136394A1 (en) * | 2003-06-23 | 2005-06-23 | Hong Fang | Cell-based assay for identifying peptidase inhibitors |
| AU2003903504A0 (en) * | 2003-07-08 | 2003-07-24 | Johnson, Daniel | Improvements in sensor chips |
| GB0316075D0 (en) * | 2003-07-09 | 2003-08-13 | Molecular Sensing Plc | Protease detection assay |
| US20060003382A1 (en) * | 2004-05-10 | 2006-01-05 | Amanda Eckermann | Compositions and methods for analyte detection |
| US7511142B2 (en) * | 2004-07-28 | 2009-03-31 | Agency For Science, Technology And Research | Mediator-modified redox biomolecules for use in electrochemical determination of analyte |
| ATE445020T1 (de) | 2004-08-13 | 2009-10-15 | Egomedical Technologies Ag | Analyttestsystem zur bestimmung der konzentration eines analyten in einer physiologischen oder wässrigen flüssigkeit |
| GB2420180A (en) * | 2004-11-11 | 2006-05-17 | Sensor Tech Ltd | Method of electrochemical analysis of an analyte |
| DE102005019302A1 (de) * | 2005-04-26 | 2006-11-16 | Toxogen Gmbh | Carrier zum Targeting von Nervenzellen |
| US7728094B2 (en) * | 2005-05-03 | 2010-06-01 | Imec | Selfassembled grafted polymeric layer for use in biosensor technology |
| JP2007000082A (ja) * | 2005-06-23 | 2007-01-11 | Sysmex Corp | キナーゼ活性測定方法及び試薬 |
| JP4858143B2 (ja) * | 2006-02-22 | 2012-01-18 | セイコーエプソン株式会社 | 膜形成方法、膜付基板、センサおよび液状組成物 |
| WO2008045799A2 (en) | 2006-10-06 | 2008-04-17 | Nanomix, Inc. | Electrochemical nanosensors for biomolecule detection |
| CN102460139B (zh) | 2009-06-08 | 2014-04-30 | 西安大略大学 | 鉴别靶存在情况的电化学方法和装置 |
| WO2011041586A1 (en) | 2009-09-30 | 2011-04-07 | Virogenomics, Inc. | Electromagnetic detection of analytes |
-
2008
- 2008-10-17 JP JP2010530160A patent/JP2011501161A/ja active Pending
- 2008-10-17 CA CA2702969A patent/CA2702969A1/en not_active Abandoned
- 2008-10-17 JP JP2010530156A patent/JP2011502245A/ja active Pending
- 2008-10-17 WO PCT/US2008/080379 patent/WO2009052436A1/en not_active Ceased
- 2008-10-17 US US12/253,828 patent/US20100003710A1/en not_active Abandoned
- 2008-10-17 US US12/253,875 patent/US8734631B2/en active Active
- 2008-10-17 AU AU2008311820A patent/AU2008311820A1/en not_active Abandoned
- 2008-10-17 EP EP08839088A patent/EP2210268A4/en not_active Withdrawn
- 2008-10-17 EP EP08839694A patent/EP2212342A4/en not_active Withdrawn
- 2008-10-17 CA CA2702977A patent/CA2702977A1/en not_active Abandoned
- 2008-10-17 WO PCT/US2008/080363 patent/WO2009052422A1/en not_active Ceased
- 2008-10-17 AU AU2008312352A patent/AU2008312352A1/en not_active Abandoned
-
2012
- 2012-01-18 US US13/353,001 patent/US8802390B2/en not_active Expired - Fee Related
-
2014
- 2014-04-16 US US14/254,817 patent/US20150198552A9/en not_active Abandoned
- 2014-05-19 US US14/281,865 patent/US20140342383A1/en not_active Abandoned
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2011502245A5 (enExample) | ||
| US8802390B2 (en) | Electrochemical assay for the detection of enzymes | |
| US9416390B2 (en) | Electric measurement of monolayers following pro-cleave detection of presence and activity of enzymes and other target analytes | |
| US9340567B2 (en) | Chemistry used in biosensors | |
| Songa et al. | Electrochemical detection of glyphosate herbicide using horseradish peroxidase immobilized on sulfonated polymer matrix | |
| Li et al. | Self-assembled integrated nanozyme cascade biosensor with dual catalytic activity for portable urease analysis | |
| JP2011501161A5 (enExample) | ||
| US8951400B2 (en) | Chemistry used in biosensors | |
| Cao et al. | A simple and general approach to assay protease activity with electrochemical technique | |
| Malecka et al. | Femtomolar detection of thrombin in serum and cerebrospinal fluid via direct electrocatalysis of oxygen reduction by the covalent G4-hemin-aptamer complex | |
| Kjaergaard et al. | Two-electron reduction versus one-electron oxidation of the type 3 pair in the multicopper oxidases | |
| CA2880101A1 (en) | Electronic measurements of monolayers following homogeneous reactions of their components | |
| Domínguez-Renedo et al. | Determination of metals based on electrochemical biosensors | |
| Chen et al. | Nanopore stochastic sensing based on non-covalent interactions | |
| CA2860739A1 (en) | Enzyme cascade methods for e-trace assay signal amplification | |
| Wu et al. | A Portable Electrochemical Biosensor Based on an Amino-Modified Ionic Metal–Organic Framework for the One-Site Detection of Multiple Organophosphorus Pesticides | |
| Lira et al. | Regulation of thrombin activity with ultrasmall nanoparticles: effects of surface chemistry | |
| Yang et al. | Conversion of inhibition biosensing to substrate-like biosensing for quinalphos selective detection | |
| He et al. | Hierarchically Macroporous Ce-MOF Nanozyme with Enhanced Phosphoester Hydrolase-and Oxidase-like Activities for Self-Cascade Colorimetric Detection of Profenofos On-Site | |
| Wu et al. | A novel electrochemical biosensor for highly selective detection of protease biomarker from Bacillus licheniformis with D-amino acid containing peptide | |
| BILITEWSKI | 3. BIOCHEMICAL PRINCIPLES |