JP2009532058A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2009532058A5 JP2009532058A5 JP2009503696A JP2009503696A JP2009532058A5 JP 2009532058 A5 JP2009532058 A5 JP 2009532058A5 JP 2009503696 A JP2009503696 A JP 2009503696A JP 2009503696 A JP2009503696 A JP 2009503696A JP 2009532058 A5 JP2009532058 A5 JP 2009532058A5
- Authority
- JP
- Japan
- Prior art keywords
- enzyme
- substrate
- conjugate
- detection zone
- test kit
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000001514 detection method Methods 0.000 claims description 159
- 239000000758 substrate Substances 0.000 claims description 132
- 102000004190 Enzymes Human genes 0.000 claims description 122
- 108090000790 Enzymes Proteins 0.000 claims description 122
- 239000000523 sample Substances 0.000 claims description 100
- 230000027455 binding Effects 0.000 claims description 62
- 239000000463 material Substances 0.000 claims description 56
- 239000000126 substance Substances 0.000 claims description 34
- 239000012501 chromatography media Substances 0.000 claims description 27
- 239000002532 enzyme inhibitor Substances 0.000 claims description 26
- 238000006555 catalytic reaction Methods 0.000 claims description 24
- 230000001809 detectable Effects 0.000 claims description 24
- -1 peptide Proteins 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 18
- 235000018102 proteins Nutrition 0.000 claims description 18
- 102000004169 proteins and genes Human genes 0.000 claims description 18
- 108090000623 proteins and genes Proteins 0.000 claims description 18
- 108090001123 antibodies Proteins 0.000 claims description 15
- 102000004965 antibodies Human genes 0.000 claims description 15
- 102000004357 Transferases Human genes 0.000 claims description 10
- 108090000992 Transferases Proteins 0.000 claims description 10
- 238000009007 Diagnostic Kit Methods 0.000 claims description 9
- 239000000427 antigen Substances 0.000 claims description 7
- 102000038129 antigens Human genes 0.000 claims description 7
- 108091007172 antigens Proteins 0.000 claims description 7
- 108010045030 monoclonal antibodies Proteins 0.000 claims description 7
- 108090000288 Glycoproteins Proteins 0.000 claims description 6
- 102000003886 Glycoproteins Human genes 0.000 claims description 6
- 108091000081 Phosphotransferases Proteins 0.000 claims description 6
- 102000005614 monoclonal antibodies Human genes 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 4
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 4
- 108010010803 Gelatin Proteins 0.000 claims description 3
- 102000003960 Ligases Human genes 0.000 claims description 3
- 108090000364 Ligases Proteins 0.000 claims description 3
- 150000001720 carbohydrates Chemical class 0.000 claims description 3
- 229920000159 gelatin Polymers 0.000 claims description 3
- 239000008273 gelatin Substances 0.000 claims description 3
- 235000019322 gelatine Nutrition 0.000 claims description 3
- 235000011852 gelatine desserts Nutrition 0.000 claims description 3
- 150000002632 lipids Chemical class 0.000 claims description 3
- 150000007523 nucleic acids Chemical class 0.000 claims description 3
- 102100001249 ALB Human genes 0.000 claims description 2
- 101710027066 ALB Proteins 0.000 claims description 2
- 108010076119 Caseins Proteins 0.000 claims description 2
- 102000008186 Collagen Human genes 0.000 claims description 2
- 108010035532 Collagen Proteins 0.000 claims description 2
- 102000016942 Elastin Human genes 0.000 claims description 2
- 108010014258 Elastin Proteins 0.000 claims description 2
- 102000016359 Fibronectins Human genes 0.000 claims description 2
- 108010067306 Fibronectins Proteins 0.000 claims description 2
- 108010054147 Hemoglobins Proteins 0.000 claims description 2
- 102000001554 Hemoglobins Human genes 0.000 claims description 2
- 102000004157 Hydrolases Human genes 0.000 claims description 2
- 108090000604 Hydrolases Proteins 0.000 claims description 2
- 102000004877 Insulin Human genes 0.000 claims description 2
- 108090001061 Insulin Proteins 0.000 claims description 2
- 102000011782 Keratins Human genes 0.000 claims description 2
- 108010076876 Keratins Proteins 0.000 claims description 2
- 102000007547 Laminin Human genes 0.000 claims description 2
- 108010085895 Laminin Proteins 0.000 claims description 2
- 108010062374 Myoglobin Proteins 0.000 claims description 2
- 102000036913 Myoglobin Human genes 0.000 claims description 2
- 102000016611 Proteoglycans Human genes 0.000 claims description 2
- 108010067787 Proteoglycans Proteins 0.000 claims description 2
- 229940050528 albumin Drugs 0.000 claims description 2
- 239000005018 casein Substances 0.000 claims description 2
- 235000021240 caseins Nutrition 0.000 claims description 2
- 229920001436 collagen Polymers 0.000 claims description 2
- 229960005188 collagen Drugs 0.000 claims description 2
- 229920002549 elastin Polymers 0.000 claims description 2
- 230000037320 fibronectin Effects 0.000 claims description 2
- 108020004707 nucleic acids Proteins 0.000 claims description 2
- 102000011632 Caseins Human genes 0.000 claims 1
- 102000030951 Phosphotransferases Human genes 0.000 claims 1
- 230000000452 restraining Effects 0.000 claims 1
- 229940088598 Enzyme Drugs 0.000 description 98
- 239000000047 product Substances 0.000 description 80
- 239000012528 membrane Substances 0.000 description 33
- 229920000867 polyelectrolyte Polymers 0.000 description 32
- 238000000034 method Methods 0.000 description 26
- 102000035443 Peptidases Human genes 0.000 description 23
- 108091005771 Peptidases Proteins 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 22
- 239000002245 particle Substances 0.000 description 21
- 239000004365 Protease Substances 0.000 description 18
- 229940110715 ENZYMES FOR TREATMENT OF WOUNDS AND ULCERS Drugs 0.000 description 17
- 229940114721 Enzymes FOR DISORDERS OF THE MUSCULO-SKELETAL SYSTEM Drugs 0.000 description 17
- 229940093738 Enzymes for ALIMENTARY TRACT AND METABOLISM Drugs 0.000 description 17
- 229940019336 antithrombotic Enzymes Drugs 0.000 description 17
- 229940020899 hematological Enzymes Drugs 0.000 description 17
- 229940083249 peripheral vasodilators Enzymes Drugs 0.000 description 17
- 235000019833 protease Nutrition 0.000 description 16
- 239000000370 acceptor Substances 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 12
- 230000005284 excitation Effects 0.000 description 12
- 239000012530 fluid Substances 0.000 description 11
- 229920000126 Latex Polymers 0.000 description 9
- 239000000020 Nitrocellulose Substances 0.000 description 9
- 102000001253 Protein Kinases Human genes 0.000 description 9
- 239000004816 latex Substances 0.000 description 9
- 229920001220 nitrocellulos Polymers 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- 108010090804 Streptavidin Proteins 0.000 description 8
- 229920002678 cellulose Polymers 0.000 description 8
- 239000001913 cellulose Substances 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- RKCAIXNGYQCCAL-UHFFFAOYSA-N Porphin Chemical compound N1C(C=C2N=C(C=C3NC(=C4)C=C3)C=C2)=CC=C1C=C1C=CC4=N1 RKCAIXNGYQCCAL-UHFFFAOYSA-N 0.000 description 7
- ROFVEXUMMXZLPA-UHFFFAOYSA-N 2,2'-bipyridyl Chemical compound N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 6
- 102000005862 Angiotensin II Human genes 0.000 description 6
- 229950006323 Angiotensin ii Drugs 0.000 description 6
- 101800000733 Angiotensin-2 Proteins 0.000 description 6
- 229910052693 Europium Inorganic materials 0.000 description 6
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II dizwitterion Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 6
- 239000005092 Ruthenium Substances 0.000 description 6
- 125000000524 functional group Chemical group 0.000 description 6
- 229910052747 lanthanoid Inorganic materials 0.000 description 6
- 150000002602 lanthanoids Chemical class 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000004417 polycarbonate Substances 0.000 description 6
- 102000004196 processed proteins & peptides Human genes 0.000 description 6
- 108090000765 processed proteins & peptides Proteins 0.000 description 6
- KJTLSVCANCCWHF-UHFFFAOYSA-N ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 6
- 229910052707 ruthenium Inorganic materials 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 5
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 5
- 201000011510 cancer Diseases 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 5
- 239000005518 polymer electrolyte Substances 0.000 description 5
- 229920001184 polypeptide Polymers 0.000 description 5
- ORWYRWWVDCYOMK-HBZPZAIKSA-N Angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 4
- 102400000344 Angiotensin-1 Human genes 0.000 description 4
- 101800000734 Angiotensin-1 Proteins 0.000 description 4
- 108090001008 Avidin Proteins 0.000 description 4
- 108060001965 CSN2 Proteins 0.000 description 4
- 102100014432 CSN2 Human genes 0.000 description 4
- 102000018898 GTPase-Activating Proteins Human genes 0.000 description 4
- 108091006078 GTPase-accelerating proteins Proteins 0.000 description 4
- 102000038027 MAP kinase family Human genes 0.000 description 4
- 108091007472 MAP kinase family Proteins 0.000 description 4
- 108060006633 Protein Kinases Proteins 0.000 description 4
- 239000011324 bead Substances 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 150000004676 glycans Polymers 0.000 description 4
- 230000003301 hydrolyzing Effects 0.000 description 4
- 239000002609 media Substances 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000006011 modification reaction Methods 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229920001282 polysaccharide Polymers 0.000 description 4
- 239000005017 polysaccharide Substances 0.000 description 4
- 150000004804 polysaccharides Polymers 0.000 description 4
- 108010014186 ras Proteins Proteins 0.000 description 4
- 102000016914 ras Proteins Human genes 0.000 description 4
- 230000035945 sensitivity Effects 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 235000021247 β-casein Nutrition 0.000 description 4
- ZKHQWZAMYRWXGA-KQYNXXCUSA-N Adenosine triphosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-N 0.000 description 3
- 210000004369 Blood Anatomy 0.000 description 3
- 229920002799 BoPET Polymers 0.000 description 3
- 102100011339 KLK3 Human genes 0.000 description 3
- 239000004677 Nylon Substances 0.000 description 3
- 108010072866 Prostate-Specific Antigen Proteins 0.000 description 3
- 239000002250 absorbent Substances 0.000 description 3
- 230000002745 absorbent Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M buffer Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 125000002843 carboxylic acid group Chemical group 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 230000002860 competitive Effects 0.000 description 3
- 230000000875 corresponding Effects 0.000 description 3
- 229940042399 direct acting antivirals Protease inhibitors Drugs 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 230000003100 immobilizing Effects 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 108091005584 methylated proteins Proteins 0.000 description 3
- 239000003068 molecular probe Substances 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 108010087904 neutravidin Proteins 0.000 description 3
- 229920001778 nylon Polymers 0.000 description 3
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 229920000962 poly(amidoamine) Polymers 0.000 description 3
- 229920000768 polyamine Polymers 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 230000002829 reduced Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000010409 thin film Substances 0.000 description 3
- 238000011144 upstream manufacturing Methods 0.000 description 3
- SXGZJKUKBWWHRA-UHFFFAOYSA-N 2-(N-morpholino)ethanesulfonic acid Chemical compound [O-]S(=O)(=O)CC[NH+]1CCOCC1 SXGZJKUKBWWHRA-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 108091005545 Acid proteases Proteins 0.000 description 2
- 206010059512 Apoptosis Diseases 0.000 description 2
- 108091005540 Aspartic proteases Proteins 0.000 description 2
- 102000035336 Aspartic proteases Human genes 0.000 description 2
- 108091005650 Basic proteases Proteins 0.000 description 2
- 229940098773 Bovine Serum Albumin Drugs 0.000 description 2
- 108091003117 Bovine Serum Albumin Proteins 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 239000004367 Lipase Substances 0.000 description 2
- 102000005741 Metalloproteases Human genes 0.000 description 2
- 108010006035 Metalloproteases Proteins 0.000 description 2
- BXGTVNLGPMZLAZ-UHFFFAOYSA-N N'-ethylmethanediimine;hydrochloride Chemical compound Cl.CCN=C=N BXGTVNLGPMZLAZ-UHFFFAOYSA-N 0.000 description 2
- 101700080605 NUC1 Proteins 0.000 description 2
- 108010006232 Neuraminidase Proteins 0.000 description 2
- 102000005348 Neuraminidase Human genes 0.000 description 2
- 229920001850 Nucleic acid sequence Polymers 0.000 description 2
- 108010058846 Ovalbumin Proteins 0.000 description 2
- 229940092253 Ovalbumin Drugs 0.000 description 2
- 239000004695 Polyether sulfone Substances 0.000 description 2
- 239000004698 Polyethylene (PE) Substances 0.000 description 2
- 229920002873 Polyethylenimine Polymers 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- WUAPFZMCVAUBPE-UHFFFAOYSA-N Rhenium Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 230000006907 apoptotic process Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 238000003149 assay kit Methods 0.000 description 2
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- 229960002685 biotin Drugs 0.000 description 2
- 235000020958 biotin Nutrition 0.000 description 2
- 239000011616 biotin Substances 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000004891 communication Methods 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 229920003013 deoxyribonucleic acid Polymers 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 150000001991 dicarboxylic acids Chemical group 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- 102000004882 lipase Human genes 0.000 description 2
- 108090001060 lipase Proteins 0.000 description 2
- 235000019421 lipase Nutrition 0.000 description 2
- 239000003550 marker Substances 0.000 description 2
- 108060004795 methyltransferase family Proteins 0.000 description 2
- 102000016397 methyltransferase family Human genes 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L mgso4 Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 239000002159 nanocrystal Substances 0.000 description 2
- 101700006494 nucA Proteins 0.000 description 2
- 239000002773 nucleotide Substances 0.000 description 2
- 125000003729 nucleotide group Chemical group 0.000 description 2
- 229920001542 oligosaccharide Polymers 0.000 description 2
- 150000002482 oligosaccharides Polymers 0.000 description 2
- 230000003287 optical Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052762 osmium Inorganic materials 0.000 description 2
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 239000002953 phosphate buffered saline Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- HRGDZIGMBDGFTC-UHFFFAOYSA-N platinum(2+) Chemical compound [Pt+2] HRGDZIGMBDGFTC-UHFFFAOYSA-N 0.000 description 2
- 229920002496 poly(ether sulfone) Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 150000004032 porphyrins Chemical class 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000002203 pretreatment Methods 0.000 description 2
- 150000003141 primary amines Chemical group 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000003528 protein farnesyltransferase inhibitor Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910052702 rhenium Inorganic materials 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 239000004054 semiconductor nanocrystal Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 241000894007 species Species 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- 230000017613 viral reproduction Effects 0.000 description 2
- 230000000007 visual effect Effects 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Chemical group 0.000 description 2
- 239000011701 zinc Chemical group 0.000 description 2
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 1-butanal Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- CPYVWMZEWABQJJ-UHFFFAOYSA-N 2-(2,5-dioxopyrrol-1-yl)hexanoic acid;2-pyridin-2-ylpyridine Chemical compound N1=CC=CC=C1C1=CC=CC=N1.N1=CC=CC=C1C1=CC=CC=N1.CCCCC(C(O)=O)N1C(=O)C=CC1=O CPYVWMZEWABQJJ-UHFFFAOYSA-N 0.000 description 1
- SLEWGAUJQCRZIF-UHFFFAOYSA-N 2-[[6-[[bis(carboxymethyl)amino]methyl]-4-[2-(4-isothiocyanatophenyl)ethynyl]pyridin-2-yl]methyl-(carboxymethyl)amino]acetic acid Chemical group OC(=O)CN(CC(O)=O)CC1=NC(CN(CC(O)=O)CC(=O)O)=CC(C#CC=2C=CC(=CC=2)N=C=S)=C1 SLEWGAUJQCRZIF-UHFFFAOYSA-N 0.000 description 1
- HPBPNWPROCLLAA-UHFFFAOYSA-N 2-bromoethanone Chemical group BrC[C]=O HPBPNWPROCLLAA-UHFFFAOYSA-N 0.000 description 1
- FYHPYXWTVHOLPH-UHFFFAOYSA-N 2-ethenylpyridin-1-ium;iodide Chemical compound [I-].C=CC1=CC=CC=[NH+]1 FYHPYXWTVHOLPH-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- COCMHKNAGZHBDZ-UHFFFAOYSA-N 4-carboxy-3-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate Chemical compound C=12C=CC(=[N+](C)C)C=C2OC2=CC(N(C)C)=CC=C2C=1C1=CC(C([O-])=O)=CC=C1C(O)=O COCMHKNAGZHBDZ-UHFFFAOYSA-N 0.000 description 1
- OHSRAWAUPZWNKY-UHFFFAOYSA-N 4-methyl-2-pyridin-2-ylpyridine Chemical compound CC1=CC=NC(C=2N=CC=CC=2)=C1 OHSRAWAUPZWNKY-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 1
- YMZMTOFQCVHHFB-UHFFFAOYSA-N 5-carboxytetramethylrhodamine Chemical compound C=12C=CC(N(C)C)=CC2=[O+]C2=CC(N(C)C)=CC=C2C=1C1=CC=C(C(O)=O)C=C1C([O-])=O YMZMTOFQCVHHFB-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N AI2O3 Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- 210000004381 Amniotic Fluid Anatomy 0.000 description 1
- 206010003445 Ascites Diseases 0.000 description 1
- 210000003567 Ascitic Fluid Anatomy 0.000 description 1
- 101710010421 BN863_22020 Proteins 0.000 description 1
- 101710010411 BN863_22030 Proteins 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 206010060945 Bacterial infection Diseases 0.000 description 1
- 210000001124 Body Fluids Anatomy 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N Butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 101700083324 CDC25 Proteins 0.000 description 1
- 101710012460 CDC25C Proteins 0.000 description 1
- 101710012391 CIPK24 Proteins 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 229940095731 Candida albicans Drugs 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 210000001736 Capillaries Anatomy 0.000 description 1
- 108090000712 Cathepsin B Proteins 0.000 description 1
- 102000004225 Cathepsin B Human genes 0.000 description 1
- 102000003902 Cathepsin C Human genes 0.000 description 1
- 108090000267 Cathepsin C Proteins 0.000 description 1
- 108090000617 Cathepsin G Proteins 0.000 description 1
- 102000004173 Cathepsin G Human genes 0.000 description 1
- 229920002301 Cellulose acetate Polymers 0.000 description 1
- 210000001175 Cerebrospinal Fluid Anatomy 0.000 description 1
- 108090000317 Chymotrypsin Proteins 0.000 description 1
- 229920002676 Complementary DNA Chemical group 0.000 description 1
- ZFGXBCDXTQOQTR-UHFFFAOYSA-N Coproporphyrin Iii Chemical compound C1C([C](C=2C)CCC(O)=O)=NC=2CC([C](C=2C)CCC(O)=O)=NC=2CC(=N2)=C(CCC(O)=O)C(C)=C2CC2=NC1=C(CCC(O)=O)[C]2C ZFGXBCDXTQOQTR-UHFFFAOYSA-N 0.000 description 1
- GMCUFXQQBLXXDC-UHFFFAOYSA-N Coproporphyrinogen I Chemical compound C1C([C](C=2C)CCC(O)=O)=NC=2CC([C](C=2C)CCC(O)=O)=NC=2CC(=N2)=C(CCC(O)=O)C(C)=C2CC2=NC1=C(C)[C]2CCC(O)=O GMCUFXQQBLXXDC-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 229960003624 Creatine Drugs 0.000 description 1
- 101700062901 DPP Proteins 0.000 description 1
- 102100014977 DPP7 Human genes 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 208000007342 Diabetic Nephropathy Diseases 0.000 description 1
- 206010061835 Diabetic nephropathy Diseases 0.000 description 1
- 102000016622 Dipeptidyl Peptidase 4 Human genes 0.000 description 1
- 108090000212 Dipeptidyl-peptidase II Proteins 0.000 description 1
- 229910052692 Dysprosium Inorganic materials 0.000 description 1
- 102000020165 EC 2.1.1.71 Human genes 0.000 description 1
- 108010074253 EC 2.1.1.71 Proteins 0.000 description 1
- 102000004420 EC 2.7.3.2 Human genes 0.000 description 1
- 108010042126 EC 2.7.3.2 Proteins 0.000 description 1
- 206010014561 Emphysema Diseases 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 210000003617 Erythrocyte Membrane Anatomy 0.000 description 1
- AVOLMBLBETYQHX-UHFFFAOYSA-N Etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 description 1
- 229960002541 Ethacrynic Acid Drugs 0.000 description 1
- QPADNTZLUBYNEN-UHFFFAOYSA-N Ethallobarbital Chemical compound C=CCC1(CC)C(=O)NC(=O)NC1=O QPADNTZLUBYNEN-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 102000018389 Exopeptidases Human genes 0.000 description 1
- 108010091443 Exopeptidases Proteins 0.000 description 1
- 210000003722 Extracellular Fluid Anatomy 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 102000005720 Glutathione Transferase family Human genes 0.000 description 1
- 108010070675 Glutathione Transferase family Proteins 0.000 description 1
- XKMLYUALXHKNFT-UUOKFMHZSA-N Guanosine-5'-triphosphate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XKMLYUALXHKNFT-UUOKFMHZSA-N 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N Haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 102000005548 Hexokinases Human genes 0.000 description 1
- 108020002022 Hexokinases Proteins 0.000 description 1
- 229940088597 Hormone Drugs 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N Isoniazid Chemical class NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-N Isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 108090001090 Lectins Chemical group 0.000 description 1
- 102000004856 Lectins Human genes 0.000 description 1
- 102000004317 Lyases Human genes 0.000 description 1
- 108090000856 Lyases Proteins 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 206010027476 Metastasis Diseases 0.000 description 1
- 210000004080 Milk Anatomy 0.000 description 1
- 241001430197 Mollicutes Species 0.000 description 1
- GHGSXSFHVYYNAP-UHFFFAOYSA-N N(C(=O)N)[S] Chemical compound N(C(=O)N)[S] GHGSXSFHVYYNAP-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-hydroxy-Succinimide Chemical class ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 210000004940 Nucleus Anatomy 0.000 description 1
- 108010067372 Pancreatic Elastase Proteins 0.000 description 1
- 102000016387 Pancreatic Elastase Human genes 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- FAXGPCHRFPCXOO-LXTPJMTPSA-N Pepstatin Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 1
- 229950000964 Pepstatin Drugs 0.000 description 1
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- 210000002381 Plasma Anatomy 0.000 description 1
- 108010001014 Plasminogen Activators Proteins 0.000 description 1
- 102000001938 Plasminogen Activators Human genes 0.000 description 1
- 210000002706 Plastids Anatomy 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 108010039918 Polylysine Proteins 0.000 description 1
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 102100008178 RASGRF1 Human genes 0.000 description 1
- 101710037103 RPL35A Proteins 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 102000007312 Recombinant Proteins Human genes 0.000 description 1
- 108010033725 Recombinant Proteins Proteins 0.000 description 1
- 206010039073 Rheumatoid arthritis Diseases 0.000 description 1
- 102100019538 SOS1 Human genes 0.000 description 1
- 108010025180 SOS1 Protein Proteins 0.000 description 1
- 102100019537 SOS2 Human genes 0.000 description 1
- 101700074040 SOS2 Proteins 0.000 description 1
- 210000003296 Saliva Anatomy 0.000 description 1
- 229910052772 Samarium Inorganic materials 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- 210000004243 Sweat Anatomy 0.000 description 1
- 210000001179 Synovial Fluid Anatomy 0.000 description 1
- 108060008444 TPR Proteins 0.000 description 1
- 229910052771 Terbium Inorganic materials 0.000 description 1
- DRGAZIDRYFYHIJ-UHFFFAOYSA-N Terpyridine Chemical compound N1=CC=CC=C1C1=CC=CC(C=2N=CC=CC=2)=N1 DRGAZIDRYFYHIJ-UHFFFAOYSA-N 0.000 description 1
- MPLHNVLQVRSVEE-UHFFFAOYSA-N Texas Red Chemical compound [O-]S(=O)(=O)C1=CC(S(Cl)(=O)=O)=CC=C1C(C1=CC=2CCCN3CCCC(C=23)=C1O1)=C2C1=C(CCC1)C3=[N+]1CCCC3=C2 MPLHNVLQVRSVEE-UHFFFAOYSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 210000002700 Urine Anatomy 0.000 description 1
- 206010046914 Vaginal infection Diseases 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- 206010047461 Viral infection Diseases 0.000 description 1
- 208000001756 Virus Disease Diseases 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- RFSCAHMUZAIKDV-UHFFFAOYSA-N [Ru].BrCCCCC1(CC(=NC=C1)C1=NC=CC=C1)C.N1=C(C=CC=C1)C1=NC=CC=C1.N1=C(C=CC=C1)C1=NC=CC=C1 Chemical compound [Ru].BrCCCCC1(CC(=NC=C1)C1=NC=CC=C1)C.N1=C(C=CC=C1)C1=NC=CC=C1.N1=C(C=CC=C1)C1=NC=CC=C1 RFSCAHMUZAIKDV-UHFFFAOYSA-N 0.000 description 1
- NBXPGTKIFRPXNI-UHFFFAOYSA-N [Ru].CC1(CC(=NC=C1)C1=NC=CC=C1)CCCC(=O)O.N1=C(C=CC=C1)C1=NC=CC=C1.N1=C(C=CC=C1)C1=NC=CC=C1 Chemical compound [Ru].CC1(CC(=NC=C1)C1=NC=CC=C1)CCCC(=O)O.N1=C(C=CC=C1)C1=NC=CC=C1.N1=C(C=CC=C1)C1=NC=CC=C1 NBXPGTKIFRPXNI-UHFFFAOYSA-N 0.000 description 1
- ZXLYKNKUQNVBPB-UHFFFAOYSA-N [Ru].CC1(CC(=NC=C1)C1=NC=CC=C1)CCCC1OCCO1 Chemical compound [Ru].CC1(CC(=NC=C1)C1=NC=CC=C1)CCCC1OCCO1 ZXLYKNKUQNVBPB-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000011358 absorbing material Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000012491 analyte Substances 0.000 description 1
- 230000001745 anti-biotin Effects 0.000 description 1
- 239000003696 aspartic proteinase inhibitor Substances 0.000 description 1
- 238000002820 assay format Methods 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 108010041102 azocasein Proteins 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 102000024070 binding proteins Human genes 0.000 description 1
- 108091007650 binding proteins Proteins 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium Chemical group [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000004432 carbon atoms Chemical group C* 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000024881 catalytic activity Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 101700018328 ccdB Proteins 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000012292 cell migration Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- SQNNHEYXAJPPKH-UHFFFAOYSA-N chloroethene;prop-2-enoic acid Chemical compound ClC=C.OC(=O)C=C SQNNHEYXAJPPKH-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000001684 chronic Effects 0.000 description 1
- 229960002376 chymotrypsin Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000295 complement Effects 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006046 creatine Substances 0.000 description 1
- CVSVTCORWBXHQV-UHFFFAOYSA-N creatine zwitterion Chemical compound NC(=[NH2+])N(C)CC([O-])=O CVSVTCORWBXHQV-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000002852 cysteine proteinase inhibitor Substances 0.000 description 1
- 230000003436 cytoskeletal Effects 0.000 description 1
- 239000000412 dendrimer Substances 0.000 description 1
- 229920000736 dendritic polymer Polymers 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- BVQAWSJMUYMNQN-UHFFFAOYSA-N dipyridophenazine Chemical compound C1=CC=C2C3=NC4=CC=CC=C4N=C3C3=CC=CN=C3C2=N1 BVQAWSJMUYMNQN-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 238000000295 emission spectrum Methods 0.000 description 1
- 230000002708 enhancing Effects 0.000 description 1
- 230000029578 entry into host Effects 0.000 description 1
- 238000003891 environmental analysis Methods 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N ethanolamine Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- 238000001917 fluorescence detection Methods 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000004186 food analysis Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 201000010238 heart disease Diseases 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002402 hexoses Chemical class 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 102000021129 hormone binding proteins Human genes 0.000 description 1
- 108091010194 hormone binding proteins Proteins 0.000 description 1
- 238000009396 hybridization Methods 0.000 description 1
- 230000028993 immune response Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000002523 lectin Chemical group 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 238000000504 luminescence detection Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 210000004962 mammalian cells Anatomy 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000037353 metabolic pathway Effects 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 239000003475 metalloproteinase inhibitor Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011325 microbead Substances 0.000 description 1
- 239000011859 microparticle Substances 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- 230000001264 neutralization Effects 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 230000036963 noncompetitive Effects 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- 210000000056 organs Anatomy 0.000 description 1
- 108010000416 ovomacroglobulin Proteins 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 108010091212 pepstatin Proteins 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000006366 phosphorylation reaction Methods 0.000 description 1
- 230000000865 phosphorylative Effects 0.000 description 1
- 108060006184 phycobiliprotein family Proteins 0.000 description 1
- 238000004375 physisorption Methods 0.000 description 1
- 229920000371 poly(diallyldimethylammonium chloride) polymer Polymers 0.000 description 1
- 229920000779 poly(divinylbenzene) Polymers 0.000 description 1
- 229920001483 poly(ethyl methacrylate) polymer Polymers 0.000 description 1
- 229920000580 poly(melamine) Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920005671 poly(vinyl chloride-propylene) Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920001888 polyacrylic acid Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000011528 polyamide (building material) Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 108091008117 polyclonal antibodies Proteins 0.000 description 1
- 229920000656 polylysine Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- 230000003389 potentiating Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N precursor Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- 230000000135 prohibitive Effects 0.000 description 1
- 108010090013 prohormone thiol protease Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000004853 protein function Effects 0.000 description 1
- KYQCOXFCLRTKLS-UHFFFAOYSA-N pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 239000002096 quantum dot Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000002285 radioactive Effects 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 238000010188 recombinant method Methods 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 125000003748 selenium group Chemical group *[Se]* 0.000 description 1
- 238000004092 self-diagnosis Methods 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 230000003595 spectral Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 108060007951 sulfatase family Proteins 0.000 description 1
- 102000005262 sulfatase family Human genes 0.000 description 1
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 1
- 229910052713 technetium Inorganic materials 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium Chemical group [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 210000001519 tissues Anatomy 0.000 description 1
- 239000003558 transferase inhibitor Substances 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- HNVRWFFXWFXICS-UHFFFAOYSA-N tris(2,2'-bipyridine)ruthenium(II) Chemical compound C=1C=CC=[N]2C=1C1=CC=CC=[N]1[Ru+2]132([N]2=CC=CC=C2C2=CC=CC=[N]23)[N]2=CC=CC=C2C2=CC=CC=[N]12 HNVRWFFXWFXICS-UHFFFAOYSA-N 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 230000036967 uncompetitive Effects 0.000 description 1
- 201000008100 vaginitis Diseases 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11/399,687 US8758989B2 (en) | 2006-04-06 | 2006-04-06 | Enzymatic detection techniques |
| US11/399,687 | 2006-04-06 | ||
| PCT/IB2007/050880 WO2007113702A2 (en) | 2006-04-06 | 2007-03-14 | Enzymatic detection techniques |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2009532058A JP2009532058A (ja) | 2009-09-10 |
| JP2009532058A5 true JP2009532058A5 (US20060003336A1-20060105-C00008.png) | 2012-10-04 |
| JP5420394B2 JP5420394B2 (ja) | 2014-02-19 |
Family
ID=38564045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2009503696A Active JP5420394B2 (ja) | 2006-04-06 | 2007-03-14 | 酵素検出技術 |
Country Status (7)
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7504235B2 (en) | 2005-08-31 | 2009-03-17 | Kimberly-Clark Worldwide, Inc. | Enzyme detection technique |
| US20130058923A1 (en) * | 2011-08-03 | 2013-03-07 | Qun Huo | Biomolecular interactions and interaction products as biomarkers for detection, diagnosis, prognosis and predicting therapeutic responses of human diseases |
| GB201206977D0 (en) * | 2012-04-20 | 2012-06-06 | Mologic Ltd | An enzyme detection device |
| US10254279B2 (en) * | 2013-03-29 | 2019-04-09 | Nima Labs, Inc. | System and method for detection of target substances |
| WO2015152287A1 (ja) * | 2014-03-31 | 2015-10-08 | 国立大学法人愛媛大学 | 機能性材料、機能性材料の製造方法および機能性液体 |
| CN106442969B (zh) * | 2016-08-23 | 2018-08-31 | 中国人民解放军军事医学科学院微生物流行病研究所 | 一种用于检测肉毒毒素的试剂盒 |
| KR200497491Y1 (ko) | 2021-03-29 | 2023-11-29 | 신정식 | 높이 조절이 가능한 낚시용 받침대 |
Family Cites Families (120)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3772076A (en) * | 1970-01-26 | 1973-11-13 | Hercules Inc | Reaction products of epihalohydrin and polymers of diallylamine and their use in paper |
| US3700623A (en) * | 1970-04-22 | 1972-10-24 | Hercules Inc | Reaction products of epihalohydrin and polymers of diallylamine and their use in paper |
| US4140580A (en) * | 1976-05-03 | 1979-02-20 | Mcdonnell Douglas Corporation | Broth for indicating presence of candida yeast and other yeasts and fungi |
| US4275149A (en) * | 1978-11-24 | 1981-06-23 | Syva Company | Macromolecular environment control in specific receptor assays |
| WO1982000641A1 (en) * | 1980-08-25 | 1982-03-04 | Ab Kabivitrum | Peptide substrates for determination of protease activity |
| US4874695A (en) * | 1983-03-08 | 1989-10-17 | American Home Products Corp. | Rapid indentification of yeast and other fungal microorganisms by enzyme detection |
| EP0127797B1 (de) * | 1983-06-03 | 1987-06-16 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Markermoleküle für Fluoreszenz-Immuno-Assays sowie Verfahren und Zwischenprodukte zu deren Herstellung |
| US4537657A (en) * | 1983-08-26 | 1985-08-27 | Hercules Incorporated | Wet strength resins |
| US4637979A (en) * | 1984-04-06 | 1987-01-20 | Miles Laboratories, Inc. | Composition and test device for determining the presence of leukocytes containing a zwitterion coupling agent |
| DE3413077A1 (de) * | 1984-04-06 | 1985-10-17 | Miles Laboratories, Inc., Elkhart, Ind. | Chromogene aminosaeure- und peptidester, verfahren zu deren herstellung, verwendung dieser verbindungen in analysenverfahren sowie mittel zum nachweis esterolytischer und/oder proteolytischer enzyme |
| DE3413078A1 (de) * | 1984-04-06 | 1985-10-24 | Miles Laboratories, Inc., Elkhart, Ind. | Chromogene aminosaeure- und peptidester, verfahren zu deren herstellung, verwendung dieser verbindungen in analysenverfahren sowie mittel zum nachweis esterolytischer und/oder proteolytischer enzyme |
| US5310687A (en) * | 1984-10-31 | 1994-05-10 | Igen, Inc. | Luminescent metal chelate labels and means for detection |
| GB8526741D0 (en) * | 1985-10-30 | 1985-12-04 | Boots Celltech Diagnostics | Binding assay device |
| US5585279A (en) * | 1986-01-23 | 1996-12-17 | Davidson; Robert S. | Time-resolved luminescence binding assays using a fluorescent transition metal label other than ruthenium |
| US4859581A (en) * | 1986-03-10 | 1989-08-22 | Board Of Regents, The University Of Texas System | Endoglycosidase assay |
| US5591581A (en) * | 1986-04-30 | 1997-01-07 | Igen, Inc. | Electrochemiluminescent rhenium moieties and methods for their use |
| EP0272320B1 (en) * | 1986-06-17 | 1994-03-23 | Baxter Diagnostics Inc. | Homogeneous fluoroassay methods employing fluorescent background rejection |
| SE8703682L (sv) * | 1987-09-24 | 1989-03-25 | Wallac Oy | Homogen bestaemningsmetod som utnyttjar affinitetsreaktioner |
| US5670381A (en) * | 1988-01-29 | 1997-09-23 | Abbott Laboratories | Devices for performing ion-capture binding assays |
| US5124254A (en) * | 1988-02-08 | 1992-06-23 | University College Cardiff Consultants Limited | Detection of diamines in biological fluids |
| KR920000868Y1 (ko) * | 1988-07-08 | 1992-01-31 | 지이제루 기기 가부시기가이샤 | 송풍기 제어용의 조절장치 |
| US5075077A (en) * | 1988-08-02 | 1991-12-24 | Abbott Laboratories | Test card for performing assays |
| US5252459A (en) * | 1988-09-23 | 1993-10-12 | Abbott Laboratories | Indicator reagents, diagnostic assays and test kits employing organic polymer latex particles |
| EP0363191B1 (en) * | 1988-10-07 | 1999-01-27 | Fujikura Ltd. | Flat resistance for blower control unit of automobile air conditioner and blower control unit using the same |
| US5192940A (en) * | 1988-10-07 | 1993-03-09 | Fujikura, Ltd. | Flat resistance for blower control unit for automobile air conditioner and blower control unit using the same |
| MY104234A (en) * | 1988-11-17 | 1994-02-28 | Becton Dickinson Co | Immunoassay on a preblocked solid surface |
| US5252484A (en) * | 1988-11-29 | 1993-10-12 | Minnesota Mining And Manufacturing Company | Rapid read-out biological indicator |
| EP0465577B1 (en) * | 1989-03-29 | 1994-03-16 | E.I. Du Pont De Nemours And Company | Catalyzed reporter deposition |
| FR2659982B1 (fr) * | 1990-03-23 | 1995-10-20 | Serbio | Utilisation de substrats chromogenes dans la determination de candida. |
| US5326692B1 (en) * | 1992-05-13 | 1996-04-30 | Molecular Probes Inc | Fluorescent microparticles with controllable enhanced stokes shift |
| US5139934A (en) * | 1990-05-25 | 1992-08-18 | Becton, Dickinson And Company | Substrate composition and method for solid phase urease immunoassay |
| US5292652A (en) * | 1990-10-05 | 1994-03-08 | Athena Neurosciences, Inc. | Amyloidin protease and uses thereof |
| KR920007514Y1 (ko) * | 1990-12-24 | 1992-10-15 | 동아전기부품 주식회사 | 모우터의 회전속도 조정용 저항기 |
| DE4217474A1 (de) * | 1992-05-27 | 1993-12-02 | Boehringer Mannheim Gmbh | Verfahren und Mittel zur Bestimmung eines Analyts |
| US5408575A (en) * | 1992-06-01 | 1995-04-18 | International Resistive Company, Inc. | Automotive fan controller |
| US5229741A (en) * | 1992-06-09 | 1993-07-20 | Indak Manufacturing Corp. | Automotive resistor unit having mounting clip |
| EP0606422B1 (en) * | 1992-07-02 | 1997-09-03 | SOINI, Erkki | Biospecific multiparameter assay method |
| US5291174A (en) * | 1993-02-04 | 1994-03-01 | General Motors Corporation | Ceramic substrate blower motor resistor array |
| US5416003A (en) * | 1993-04-14 | 1995-05-16 | Litmus Concepts, Inc. | Reporter enzyme release technology: methods of assaying for the presence of aspartic proteases and other hydrolytic enzyme activities |
| US5464741A (en) * | 1993-10-08 | 1995-11-07 | Henwell, Inc. | Palladium (II) octaethylporphine alpha-isothiocyanate as a phosphorescent label for immunoassays |
| US6451619B1 (en) * | 1994-06-29 | 2002-09-17 | Inverness Medical Switzerland Gmbh | Monitoring methods and devices for use therein |
| US5550527A (en) * | 1994-07-01 | 1996-08-27 | Dong A Electric Parts Co., Ltd. | Resistor device for controlling a rotational speed of a motor |
| US5464739A (en) * | 1994-08-22 | 1995-11-07 | Bayer Corporation | Composition method for determining the presence of leukocyte cells, esterase or protease in a test sample |
| US20010046668A1 (en) * | 1994-10-21 | 2001-11-29 | G.D. Searle & Co. | Fluorescence polarization method for determining protease activity |
| US5571684A (en) * | 1994-11-07 | 1996-11-05 | Litmus Concepts, Inc. | Assay for proline iminopeptidase and other hydrolytic activities |
| US5866434A (en) * | 1994-12-08 | 1999-02-02 | Meso Scale Technology | Graphitic nanotubes in luminescence assays |
| US5567596A (en) * | 1994-12-29 | 1996-10-22 | Research Foundation Of State University Of New York | Rapid assay of activators and inhibitors of clotting |
| AU5729096A (en) * | 1995-05-12 | 1996-11-29 | Schering Corporation | Surface plasmon resonance based enzymatic assay |
| JPH0992110A (ja) * | 1995-09-26 | 1997-04-04 | Denso Corp | 温度ヒューズ付抵抗器 |
| EP0852004B1 (en) | 1995-10-11 | 2011-01-19 | Luminex Corporation | Multiplexed analysis of clinical specimens |
| JPH09240250A (ja) * | 1995-12-27 | 1997-09-16 | Karusonitsuku Prod Kk | 抵抗器 |
| CA2245664A1 (en) * | 1996-02-08 | 1997-08-14 | Australian Membrane And Biotechnology Research Institute | Enzyme detection biosensors |
| GB9609024D0 (en) * | 1996-05-01 | 1996-07-03 | Idg Uk Ltd | Compounds |
| US6004530A (en) * | 1996-06-04 | 1999-12-21 | Roche Diagnostics Gmbh | Use of metallo-porphyrin conjugates for the detection of biological substances |
| US6444423B1 (en) * | 1996-06-07 | 2002-09-03 | Molecular Dynamics, Inc. | Nucleosides comprising polydentate ligands |
| US5922537A (en) * | 1996-11-08 | 1999-07-13 | N.o slashed.AB Immunoassay, Inc. | Nanoparticles biosensor |
| US5854011A (en) * | 1996-12-19 | 1998-12-29 | Idexx Laboratories Incorporated | Method and components for the detection of yeasts and/or molds in a sample |
| EP0972071A4 (en) * | 1997-03-07 | 2004-04-21 | Tropix Inc | TEST ARRANGEMENT FOR PROTEAS INHIBITORS |
| GB2323166B (en) | 1997-03-12 | 2001-04-11 | Johnson & Johnson Medical | Method and apparatus for mapping the condition of a wound |
| US6018288A (en) * | 1997-05-09 | 2000-01-25 | Indak Manufacturing Corp. | Flat resistors for automotive blower motor speed control or other service |
| US6069553A (en) * | 1997-05-16 | 2000-05-30 | Indak Manufacturing Corp. | Blower speed control resistors for automotive or other service |
| US5859581A (en) * | 1997-06-20 | 1999-01-12 | International Resistive Company, Inc. | Thick film resistor assembly for fan controller |
| US6613583B1 (en) * | 1997-06-27 | 2003-09-02 | Igen International, Inc. | Electrochemiluminescent label based on multimetallic assemblies |
| JPH11113596A (ja) * | 1997-10-16 | 1999-04-27 | Asahi Chem Ind Co Ltd | 蛋白質分解酵素活性の検出方法 |
| US6306642B1 (en) * | 1997-11-24 | 2001-10-23 | Quidel Corporation | Enzyme substrate delivery and product registration in one step enzyme immunoassays |
| US6017723A (en) * | 1998-03-27 | 2000-01-25 | Long Island Jewish Medical Center | Method for isolating inhibitors of protease activity |
| US6030840A (en) * | 1998-06-15 | 2000-02-29 | Nen Life Sciences, Inc. | Neutral enhancement of lanthanides for time resolved fluorescence |
| FI982422A0 (fi) * | 1998-11-09 | 1998-11-09 | Arctic Diagnostics Oy | Porfyriiniyhdisteitä, niiden konjugaatit sekä määritysmenetelmiä pohjautuen näiden konjugaattien käyttöön |
| US6261779B1 (en) * | 1998-11-10 | 2001-07-17 | Bio-Pixels Ltd. | Nanocrystals having polynucleotide strands and their use to form dendrimers in a signal amplification system |
| US6402918B1 (en) * | 1998-11-16 | 2002-06-11 | Joseph B. Schlenoff | Apparatus for capillary electrophoresis and associated method |
| WO2000050871A1 (en) * | 1999-02-26 | 2000-08-31 | Orchid Biosciences, Inc. | Microstructures for use in biological assays and reactions |
| US6472141B2 (en) * | 1999-05-21 | 2002-10-29 | Caliper Technologies Corp. | Kinase assays using polycations |
| US6485926B2 (en) * | 1999-12-22 | 2002-11-26 | Fuji Photo Film Co., Ltd. | Method for measuring protease activity |
| US6528321B1 (en) * | 2000-06-26 | 2003-03-04 | Beckman Coulter, Inc. | Opposable-element chromatographic assay device for detection of analytes in whole blood samples |
| WO2002002603A2 (en) | 2000-06-30 | 2002-01-10 | Incyte Genomics, Inc. | Protein modification and maintenance molecules |
| WO2002010358A2 (en) * | 2000-07-31 | 2002-02-07 | Maxygen, Inc. | Nucleotide incorporating enzymes |
| JP2002243743A (ja) * | 2001-02-20 | 2002-08-28 | Nitto Denko Corp | 被検物質の検出方法 |
| US7291477B2 (en) * | 2001-07-03 | 2007-11-06 | Xenotope Diagnostics, Inc. | Method and device for trichomonas detection |
| EP1425585A2 (en) | 2001-09-11 | 2004-06-09 | MERCK PATENT GmbH | Lateral flow test format for enzyme assays |
| US7045311B2 (en) * | 2001-10-25 | 2006-05-16 | Monogram Biosciences, Inc. | Whole cell assay systems for cell surface proteases |
| US20030119073A1 (en) * | 2001-12-21 | 2003-06-26 | Stephen Quirk | Sensors and methods of detection for proteinase enzymes |
| US20030119203A1 (en) | 2001-12-24 | 2003-06-26 | Kimberly-Clark Worldwide, Inc. | Lateral flow assay devices and methods for conducting assays |
| US8367013B2 (en) | 2001-12-24 | 2013-02-05 | Kimberly-Clark Worldwide, Inc. | Reading device, method, and system for conducting lateral flow assays |
| CN100501406C (zh) * | 2001-12-24 | 2009-06-17 | 金伯利-克拉克环球有限公司 | 直通型检测装置的内部校准系统 |
| US6747543B2 (en) * | 2002-04-02 | 2004-06-08 | Dong Ah Electronics Components Co., LTD | Resistor for driving motor for air conditioner blower |
| US7091049B2 (en) | 2002-06-26 | 2006-08-15 | Kimberly-Clark Worldwide, Inc. | Enhanced diffraction-based biosensor devices |
| US20040029205A1 (en) * | 2002-07-30 | 2004-02-12 | Small Parker Adams | Diagnostic system for differentiating sputum from saliva |
| US7432105B2 (en) | 2002-08-27 | 2008-10-07 | Kimberly-Clark Worldwide, Inc. | Self-calibration system for a magnetic binding assay |
| US7314763B2 (en) | 2002-08-27 | 2008-01-01 | Kimberly-Clark Worldwide, Inc. | Fluidics-based assay devices |
| US7285424B2 (en) | 2002-08-27 | 2007-10-23 | Kimberly-Clark Worldwide, Inc. | Membrane-based assay devices |
| US7041469B2 (en) * | 2002-10-10 | 2006-05-09 | Quidel Corporation | Assays for trichomonal and other hydrolases |
| US7781172B2 (en) | 2003-11-21 | 2010-08-24 | Kimberly-Clark Worldwide, Inc. | Method for extending the dynamic detection range of assay devices |
| AU2003295863A1 (en) * | 2002-11-22 | 2004-06-18 | Marligen Biosciences, Inc. | Detection of protease enzymes |
| US20040106190A1 (en) | 2002-12-03 | 2004-06-03 | Kimberly-Clark Worldwide, Inc. | Flow-through assay devices |
| US20040121334A1 (en) | 2002-12-19 | 2004-06-24 | Kimberly-Clark Worldwide, Inc. | Self-calibrated flow-through assay devices |
| US7247500B2 (en) * | 2002-12-19 | 2007-07-24 | Kimberly-Clark Worldwide, Inc. | Reduction of the hook effect in membrane-based assay devices |
| US20050112703A1 (en) | 2003-11-21 | 2005-05-26 | Kimberly-Clark Worldwide, Inc. | Membrane-based lateral flow assay devices that utilize phosphorescent detection |
| US7592020B2 (en) * | 2003-12-05 | 2009-09-22 | Kimberly-Clark Worldwide, Inc. | Personal care products with visual indicator of vaginitis |
| US20050136550A1 (en) | 2003-12-19 | 2005-06-23 | Kimberly-Clark Worldwide, Inc. | Flow control of electrochemical-based assay devices |
| US7943089B2 (en) | 2003-12-19 | 2011-05-17 | Kimberly-Clark Worldwide, Inc. | Laminated assay devices |
| EP1704245A1 (en) | 2003-12-31 | 2006-09-27 | Applera Corporation | Multiplex protease profiling |
| EP1557474A1 (en) * | 2004-01-21 | 2005-07-27 | Nederlandse Organisatie voor toegepast-natuurwetenschappelijk Onderzoek TNO | Method for determination of protein modifying or demodifying activity and suitable materials therefor |
| GB2422664A (en) | 2005-01-28 | 2006-08-02 | Ethicon Inc | Device for detecting an enzyme in a sample |
| US20050191704A1 (en) * | 2004-03-01 | 2005-09-01 | Kimberly-Clark Worldwide, Inc. | Assay devices utilizing chemichromic dyes |
| US20050220712A1 (en) | 2004-04-01 | 2005-10-06 | Wright Daniel G | Method for determining mucosal neutrophil counts in neutropenia patents |
| AU2005278123B2 (en) | 2004-04-16 | 2008-04-24 | Idexx Laboratories, Inc. | Canine Pancreatic Lipase |
| US7796266B2 (en) | 2004-04-30 | 2010-09-14 | Kimberly-Clark Worldwide, Inc. | Optical detection system using electromagnetic radiation to detect presence or quantity of analyte |
| US20060019265A1 (en) | 2004-04-30 | 2006-01-26 | Kimberly-Clark Worldwide, Inc. | Transmission-based luminescent detection systems |
| US7247375B2 (en) | 2004-04-30 | 2007-07-24 | Kimberly-Clark Worldwide, Inc. | Polymeric matrices for the encapsulation of phosphorescent molecules for analytical applications |
| US7094528B2 (en) | 2004-06-30 | 2006-08-22 | Kimberly-Clark Worldwide, Inc. | Magnetic enzyme detection techniques |
| US7906276B2 (en) | 2004-06-30 | 2011-03-15 | Kimberly-Clark Worldwide, Inc. | Enzymatic detection techniques |
| US7521226B2 (en) | 2004-06-30 | 2009-04-21 | Kimberly-Clark Worldwide, Inc. | One-step enzymatic and amine detection technique |
| US20060127459A1 (en) | 2004-12-15 | 2006-06-15 | Lei Huang | Urogenital infection inhibition |
| US20070128589A1 (en) * | 2005-07-13 | 2007-06-07 | Sanders Mitchell C | Substrates, sensors, and methods for assessing conditions in females |
| US7504235B2 (en) | 2005-08-31 | 2009-03-17 | Kimberly-Clark Worldwide, Inc. | Enzyme detection technique |
| US8003399B2 (en) | 2005-08-31 | 2011-08-23 | Kimberly-Clark Worldwide, Inc. | Nitrite detection technique |
| US7829347B2 (en) | 2005-08-31 | 2010-11-09 | Kimberly-Clark Worldwide, Inc. | Diagnostic test kits with improved detection accuracy |
| US20070134747A1 (en) | 2005-12-14 | 2007-06-14 | Kimberly-Clark Worldwide, Inc. | Detection of secreted lipase proteins from Candida species |
| GB2435511A (en) | 2006-02-23 | 2007-08-29 | Mologic Ltd | Protease detection |
| GB2437311A (en) | 2006-04-07 | 2007-10-24 | Mologic Ltd | A protease detection product |
-
2006
- 2006-04-06 US US11/399,687 patent/US8758989B2/en active Active
-
2007
- 2007-03-14 KR KR1020087024205A patent/KR101376363B1/ko active IP Right Grant
- 2007-03-14 MX MX2008012849A patent/MX2008012849A/es active IP Right Grant
- 2007-03-14 JP JP2009503696A patent/JP5420394B2/ja active Active
- 2007-03-14 CN CN2007800123137A patent/CN101416057B/zh not_active Expired - Fee Related
- 2007-03-14 WO PCT/IB2007/050880 patent/WO2007113702A2/en active Application Filing
- 2007-03-14 EP EP07735119.5A patent/EP2005180B1/en not_active Expired - Fee Related
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7897360B2 (en) | Enzyme detection techniques | |
| KR101210215B1 (ko) | 효소 검출 기법 | |
| US7964340B2 (en) | One-step enzymatic and amine detection technique | |
| US8614101B2 (en) | In situ lysis of cells in lateral flow immunoassays | |
| JP5420394B2 (ja) | 酵素検出技術 | |
| KR100804202B1 (ko) | 크로마토그래피 측정 시스템 | |
| WO2006007009A1 (en) | Magnetic enzyme detection techniques | |
| JP2009532058A5 (US20060003336A1-20060105-C00008.png) | ||
| EP2839288B1 (en) | An enzyme detection device | |
| US20150160219A1 (en) | Enzyme detection device | |
| JP2009222562A (ja) | 測定チップとそれを用いた測定方法 |