JP2009288792A - ホスホネート正孔阻止層光導電体 - Google Patents
ホスホネート正孔阻止層光導電体 Download PDFInfo
- Publication number
- JP2009288792A JP2009288792A JP2009130197A JP2009130197A JP2009288792A JP 2009288792 A JP2009288792 A JP 2009288792A JP 2009130197 A JP2009130197 A JP 2009130197A JP 2009130197 A JP2009130197 A JP 2009130197A JP 2009288792 A JP2009288792 A JP 2009288792A
- Authority
- JP
- Japan
- Prior art keywords
- layer
- phosphonate
- diethyl
- charge
- charge transport
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 title claims abstract description 23
- 230000000903 blocking effect Effects 0.000 title description 41
- 239000000758 substrate Substances 0.000 claims abstract description 42
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical compound [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 claims abstract description 26
- 229920005989 resin Polymers 0.000 claims description 48
- 239000011347 resin Substances 0.000 claims description 48
- 239000000203 mixture Substances 0.000 claims description 31
- 229910052757 nitrogen Inorganic materials 0.000 claims description 24
- 239000011230 binding agent Substances 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 239000000049 pigment Substances 0.000 claims description 13
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 9
- 239000007787 solid Substances 0.000 claims description 9
- IUZMHUAHKBHJFY-UHFFFAOYSA-N 2-(diethoxyphosphorylmethyl)isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(CP(=O)(OCC)OCC)C(=O)C2=C1 IUZMHUAHKBHJFY-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- DOMZGECNJWVKAM-UHFFFAOYSA-N 1-(diethoxyphosphorylmethyl)pyrrolidine Chemical compound CCOP(=O)(OCC)CN1CCCC1 DOMZGECNJWVKAM-UHFFFAOYSA-N 0.000 claims description 5
- RAABCCZMKIIGJW-UHFFFAOYSA-N 1-[ethoxy(methylsulfanylmethyl)phosphoryl]oxyethane Chemical compound CCOP(=O)(CSC)OCC RAABCCZMKIIGJW-UHFFFAOYSA-N 0.000 claims description 5
- XJVQZLBCYMWOSM-UHFFFAOYSA-N 1-chloro-3-(diethoxyphosphorylmethyl)benzene Chemical compound CCOP(=O)(OCC)CC1=CC=CC(Cl)=C1 XJVQZLBCYMWOSM-UHFFFAOYSA-N 0.000 claims description 5
- VIZPJAFCJKGFQB-UHFFFAOYSA-N 1-dibutoxyphosphoryl-n,n-diethylformamide Chemical compound CCCCOP(=O)(C(=O)N(CC)CC)OCCCC VIZPJAFCJKGFQB-UHFFFAOYSA-N 0.000 claims description 5
- OTUVLLBGFFIEJO-UHFFFAOYSA-N 1-diethoxyphosphoryl-4-methoxybenzene Chemical compound CCOP(=O)(OCC)C1=CC=C(OC)C=C1 OTUVLLBGFFIEJO-UHFFFAOYSA-N 0.000 claims description 5
- GJDRKHHGPHLVNI-UHFFFAOYSA-N 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol Chemical compound CCOP(=O)(OCC)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 GJDRKHHGPHLVNI-UHFFFAOYSA-N 0.000 claims description 5
- SGGUHCSKZHSULP-UHFFFAOYSA-N 2-dibutoxyphosphoryl-n,n-diethylacetamide Chemical compound CCCCOP(=O)(CC(=O)N(CC)CC)OCCCC SGGUHCSKZHSULP-UHFFFAOYSA-N 0.000 claims description 5
- HPEVTTNSIPGLEL-UHFFFAOYSA-N 2-diethoxyphosphoryl-1-phenylethanone Chemical compound CCOP(=O)(OCC)CC(=O)C1=CC=CC=C1 HPEVTTNSIPGLEL-UHFFFAOYSA-N 0.000 claims description 5
- KWMBADTWRIGGGG-UHFFFAOYSA-N 2-diethoxyphosphorylacetonitrile Chemical compound CCOP(=O)(CC#N)OCC KWMBADTWRIGGGG-UHFFFAOYSA-N 0.000 claims description 5
- TZPPDWDHNIMTDQ-UHFFFAOYSA-N 2-dimethoxyphosphorylethanol Chemical compound COP(=O)(OC)CCO TZPPDWDHNIMTDQ-UHFFFAOYSA-N 0.000 claims description 5
- POSVXIWJQXSIIP-UHFFFAOYSA-N 3-diphenoxyphosphoryl-1,3-benzoxazole-2-thione Chemical compound C=1C=CC=CC=1OP(N1C(OC2=CC=CC=C21)=S)(=O)OC1=CC=CC=C1 POSVXIWJQXSIIP-UHFFFAOYSA-N 0.000 claims description 5
- PKLFGXZSNISEOV-UHFFFAOYSA-N 9,10-bis(diethoxyphosphorylmethyl)anthracene Chemical compound C1=CC=C2C(CP(=O)(OCC)OCC)=C(C=CC=C3)C3=C(CP(=O)(OCC)OCC)C2=C1 PKLFGXZSNISEOV-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- VZEGPPPCKHRYGO-UHFFFAOYSA-N diethoxyphosphorylbenzene Chemical compound CCOP(=O)(OCC)C1=CC=CC=C1 VZEGPPPCKHRYGO-UHFFFAOYSA-N 0.000 claims description 5
- ZWWWLCMDTZFSOO-UHFFFAOYSA-N diethoxyphosphorylformonitrile Chemical compound CCOP(=O)(C#N)OCC ZWWWLCMDTZFSOO-UHFFFAOYSA-N 0.000 claims description 5
- AIPRAPZUGUTQKX-UHFFFAOYSA-N diethoxyphosphorylmethylbenzene Chemical compound CCOP(=O)(OCC)CC1=CC=CC=C1 AIPRAPZUGUTQKX-UHFFFAOYSA-N 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- PHQOGHDTIVQXHL-UHFFFAOYSA-N n'-(3-trimethoxysilylpropyl)ethane-1,2-diamine Chemical compound CO[Si](OC)(OC)CCCNCCN PHQOGHDTIVQXHL-UHFFFAOYSA-N 0.000 claims description 5
- WBSRIXCTCFFHEF-UHFFFAOYSA-N (3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinic acid Chemical compound CCOP(O)(=O)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 WBSRIXCTCFFHEF-UHFFFAOYSA-N 0.000 claims description 4
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical group CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- NHBRUUFBSBSTHM-UHFFFAOYSA-N n'-[2-(3-trimethoxysilylpropylamino)ethyl]ethane-1,2-diamine Chemical compound CO[Si](OC)(OC)CCCNCCNCCN NHBRUUFBSBSTHM-UHFFFAOYSA-N 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- CCJKFLLIJCGHMO-UHFFFAOYSA-N 2-[diethoxyphosphorylmethyl(2-hydroxyethyl)amino]ethanol Chemical group CCOP(=O)(OCC)CN(CCO)CCO CCJKFLLIJCGHMO-UHFFFAOYSA-N 0.000 claims description 3
- SJHHDDDGXWOYOE-UHFFFAOYSA-N oxytitamium phthalocyanine Chemical group [Ti+2]=O.C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 SJHHDDDGXWOYOE-UHFFFAOYSA-N 0.000 claims description 3
- TXZUUQRMOIEKKQ-UHFFFAOYSA-N 2-[diethoxy(phenyl)silyl]oxy-n,n-dimethylethanamine Chemical compound CN(C)CCO[Si](OCC)(OCC)C1=CC=CC=C1 TXZUUQRMOIEKKQ-UHFFFAOYSA-N 0.000 claims description 2
- HXLAEGYMDGUSBD-UHFFFAOYSA-N 3-[diethoxy(methyl)silyl]propan-1-amine Chemical compound CCO[Si](C)(OCC)CCCN HXLAEGYMDGUSBD-UHFFFAOYSA-N 0.000 claims description 2
- CNODSORTHKVDEM-UHFFFAOYSA-N 4-trimethoxysilylaniline Chemical compound CO[Si](OC)(OC)C1=CC=C(N)C=C1 CNODSORTHKVDEM-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000005237 alkyleneamino group Chemical group 0.000 claims description 2
- IKUCSZCOPRPNOY-UHFFFAOYSA-N methyl 3-[2-(3-trimethoxysilylpropylamino)ethylamino]propanoate Chemical class COC(=O)CCNCCNCCC[Si](OC)(OC)OC IKUCSZCOPRPNOY-UHFFFAOYSA-N 0.000 claims description 2
- INJVFBCDVXYHGQ-UHFFFAOYSA-N n'-(3-triethoxysilylpropyl)ethane-1,2-diamine Chemical compound CCO[Si](OCC)(OCC)CCCNCCN INJVFBCDVXYHGQ-UHFFFAOYSA-N 0.000 claims description 2
- IZIQYHDAXYDQHR-UHFFFAOYSA-N n'-propyl-n'-trimethoxysilylethane-1,2-diamine Chemical compound CCCN(CCN)[Si](OC)(OC)OC IZIQYHDAXYDQHR-UHFFFAOYSA-N 0.000 claims description 2
- AQIQPUUNTCVHBS-UHFFFAOYSA-N n,n-dimethyl-3-triethoxysilylpropan-1-amine Chemical compound CCO[Si](OCC)(OCC)CCCN(C)C AQIQPUUNTCVHBS-UHFFFAOYSA-N 0.000 claims description 2
- KBJFYLLAMSZSOG-UHFFFAOYSA-N n-(3-trimethoxysilylpropyl)aniline Chemical compound CO[Si](OC)(OC)CCCNC1=CC=CC=C1 KBJFYLLAMSZSOG-UHFFFAOYSA-N 0.000 claims description 2
- DTPZJXALAREFEY-UHFFFAOYSA-N n-methyl-3-triethoxysilylpropan-1-amine Chemical compound CCO[Si](OCC)(OCC)CCCNC DTPZJXALAREFEY-UHFFFAOYSA-N 0.000 claims description 2
- 229940122361 Bisphosphonate Drugs 0.000 claims 2
- KFXQQTZBLCSGES-UHFFFAOYSA-N P(OCC(F)(F)F)(OCC(=O)OC)=O Chemical compound P(OCC(F)(F)F)(OCC(=O)OC)=O KFXQQTZBLCSGES-UHFFFAOYSA-N 0.000 claims 2
- 150000004663 bisphosphonates Chemical class 0.000 claims 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 2
- SJECZPVISLOESU-UHFFFAOYSA-N 3-trimethoxysilylpropan-1-amine Chemical compound CO[Si](OC)(OC)CCCN SJECZPVISLOESU-UHFFFAOYSA-N 0.000 claims 1
- IJLQBKZGZJEDJT-UHFFFAOYSA-N 5-tri(butan-2-yloxy)silylpentane-1,3-diamine Chemical compound CCC(C)O[Si](OC(C)CC)(OC(C)CC)CCC(N)CCN IJLQBKZGZJEDJT-UHFFFAOYSA-N 0.000 claims 1
- QQQSFSZALRVCSZ-UHFFFAOYSA-N triethoxysilane Chemical compound CCO[SiH](OCC)OCC QQQSFSZALRVCSZ-UHFFFAOYSA-N 0.000 claims 1
- 238000012546 transfer Methods 0.000 abstract description 4
- 239000010410 layer Substances 0.000 description 204
- 230000032258 transport Effects 0.000 description 55
- 229920000877 Melamine resin Polymers 0.000 description 27
- 238000000576 coating method Methods 0.000 description 26
- -1 cyanomethyl Chemical group 0.000 description 24
- 239000011248 coating agent Substances 0.000 description 21
- 229920003270 Cymel® Polymers 0.000 description 20
- 239000000463 material Substances 0.000 description 19
- 239000000243 solution Substances 0.000 description 18
- 229920000515 polycarbonate Polymers 0.000 description 17
- 239000000523 sample Substances 0.000 description 17
- 238000003384 imaging method Methods 0.000 description 16
- 238000000034 method Methods 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 13
- 229910052737 gold Inorganic materials 0.000 description 13
- 239000010931 gold Substances 0.000 description 13
- 150000007974 melamines Chemical class 0.000 description 13
- 239000004417 polycarbonate Substances 0.000 description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 239000012790 adhesive layer Substances 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 229920001807 Urea-formaldehyde Polymers 0.000 description 11
- GZVHEAJQGPRDLQ-UHFFFAOYSA-N 6-phenyl-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(C=2C=CC=CC=2)=N1 GZVHEAJQGPRDLQ-UHFFFAOYSA-N 0.000 description 10
- 229920003180 amino resin Polymers 0.000 description 10
- 230000000052 comparative effect Effects 0.000 description 10
- 239000010936 titanium Substances 0.000 description 10
- 229920002554 vinyl polymer Polymers 0.000 description 10
- VPVSTMAPERLKKM-UHFFFAOYSA-N glycoluril Chemical compound N1C(=O)NC2NC(=O)NC21 VPVSTMAPERLKKM-UHFFFAOYSA-N 0.000 description 9
- 238000007639 printing Methods 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 8
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 8
- 229910052719 titanium Inorganic materials 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 7
- 229920002451 polyvinyl alcohol Polymers 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 6
- 229920002635 polyurethane Polymers 0.000 description 6
- 239000004814 polyurethane Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 5
- 239000004372 Polyvinyl alcohol Substances 0.000 description 5
- 206010047571 Visual impairment Diseases 0.000 description 5
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 5
- 239000003963 antioxidant agent Substances 0.000 description 5
- 239000004020 conductor Substances 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 239000011118 polyvinyl acetate Substances 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 229910052711 selenium Inorganic materials 0.000 description 5
- 239000011669 selenium Substances 0.000 description 5
- 150000003384 small molecules Chemical class 0.000 description 5
- 229910052726 zirconium Inorganic materials 0.000 description 5
- 239000004425 Makrolon Substances 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 4
- 150000001241 acetals Chemical class 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 229920005596 polymer binder Polymers 0.000 description 4
- 239000002491 polymer binding agent Substances 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 229920002689 polyvinyl acetate Polymers 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- DRCOGQJUVZRNSQ-UHFFFAOYSA-N 1-(diethoxyphosphorylmethyl)-4-[4-(diethoxyphosphorylmethyl)phenyl]benzene Chemical compound C1=CC(CP(=O)(OCC)OCC)=CC=C1C1=CC=C(CP(=O)(OCC)OCC)C=C1 DRCOGQJUVZRNSQ-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 241000254173 Coleoptera Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000004640 Melamine resin Substances 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000009825 accumulation Methods 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 238000007605 air drying Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000003618 dip coating Methods 0.000 description 3
- 238000007667 floating Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000000643 oven drying Methods 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 239000002861 polymer material Substances 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 239000004800 polyvinyl chloride Substances 0.000 description 3
- 229910000077 silane Inorganic materials 0.000 description 3
- 150000003672 ureas Chemical class 0.000 description 3
- NAJNIFLHKZVKRU-UHFFFAOYSA-N 2-methyl-n-[4-[4-(2-methylanilino)phenyl]phenyl]aniline Chemical compound CC1=CC=CC=C1NC1=CC=C(C=2C=CC(NC=3C(=CC=CC=3)C)=CC=2)C=C1 NAJNIFLHKZVKRU-UHFFFAOYSA-N 0.000 description 2
- XXWVEJFXXLLAIB-UHFFFAOYSA-N 4-[[4-(diethylamino)-2-methylphenyl]-phenylmethyl]-n,n-diethyl-3-methylaniline Chemical compound CC1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)N(CC)CC)C)C1=CC=CC=C1 XXWVEJFXXLLAIB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004322 Butylated hydroxytoluene Substances 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229920001634 Copolyester Polymers 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 229930182556 Polyacetal Natural products 0.000 description 2
- 239000004642 Polyimide Substances 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 229920000180 alkyd Polymers 0.000 description 2
- 229920005603 alternating copolymer Polymers 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- XITRBUPOXXBIJN-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 XITRBUPOXXBIJN-UHFFFAOYSA-N 0.000 description 2
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 2
- 229940095259 butylated hydroxytoluene Drugs 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 229910052732 germanium Inorganic materials 0.000 description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 2
- 150000002373 hemiacetals Chemical class 0.000 description 2
- 230000005525 hole transport Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- PVSJXEDBEXYLML-UHFFFAOYSA-N methyl 2-[bis(2,2,2-trifluoroethoxy)phosphoryl]acetate Chemical compound COC(=O)CP(=O)(OCC(F)(F)F)OCC(F)(F)F PVSJXEDBEXYLML-UHFFFAOYSA-N 0.000 description 2
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- PRMHOXAMWFXGCO-UHFFFAOYSA-M molport-000-691-708 Chemical compound N1=C(C2=CC=CC=C2C2=NC=3C4=CC=CC=C4C(=N4)N=3)N2[Ga](Cl)N2C4=C(C=CC=C3)C3=C2N=C2C3=CC=CC=C3C1=N2 PRMHOXAMWFXGCO-UHFFFAOYSA-M 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000012860 organic pigment Substances 0.000 description 2
- 229920000620 organic polymer Polymers 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 2
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 2
- 229920003207 poly(ethylene-2,6-naphthalate) Polymers 0.000 description 2
- 229920002239 polyacrylonitrile Polymers 0.000 description 2
- 239000011112 polyethylene naphthalate Substances 0.000 description 2
- 229920001721 polyimide Polymers 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 229920005604 random copolymer Polymers 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000004544 sputter deposition Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229920005992 thermoplastic resin Polymers 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000001771 vacuum deposition Methods 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XJKSTNDFUHDPQJ-UHFFFAOYSA-N 1,4-diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=C(C=2C=CC=CC=2)C=C1 XJKSTNDFUHDPQJ-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 1
- CBECDWUDYQOTSW-UHFFFAOYSA-N 2-ethylbut-3-enal Chemical compound CCC(C=C)C=O CBECDWUDYQOTSW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 1
- SSADPHQCUURWSW-UHFFFAOYSA-N 3,9-bis(2,6-ditert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound CC(C)(C)C1=CC(C)=CC(C(C)(C)C)=C1OP1OCC2(COP(OC=3C(=CC(C)=CC=3C(C)(C)C)C(C)(C)C)OC2)CO1 SSADPHQCUURWSW-UHFFFAOYSA-N 0.000 description 1
- BYMLDFIJRMZVOC-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;methane Chemical compound C.CC(C)(C)C1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O BYMLDFIJRMZVOC-UHFFFAOYSA-N 0.000 description 1
- PDGBJJIOGJPBLC-UHFFFAOYSA-N 3-chloro-n-[4-[4-[4-(n-(3-chlorophenyl)anilino)phenyl]phenyl]phenyl]-n-phenylaniline Chemical compound ClC1=CC=CC(N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=C(Cl)C=CC=2)=C1 PDGBJJIOGJPBLC-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- OGGKVJMNFFSDEV-UHFFFAOYSA-N 3-methyl-n-[4-[4-(n-(3-methylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound CC1=CC=CC(N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=C(C)C=CC=2)=C1 OGGKVJMNFFSDEV-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QVINBVLRRUFUKK-UHFFFAOYSA-N 4-butyl-n-[4-[4-[4-(4-butyl-n-(4-propan-2-ylphenyl)anilino)phenyl]phenyl]phenyl]-n-(4-propan-2-ylphenyl)aniline Chemical compound C1=CC(CCCC)=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC(CCCC)=CC=1)C=1C=CC(=CC=1)C(C)C)C1=CC=C(C(C)C)C=C1 QVINBVLRRUFUKK-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- JHRDMNILWGIFBI-UHFFFAOYSA-N 6-diazenyl-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(N=N)=N1 JHRDMNILWGIFBI-UHFFFAOYSA-N 0.000 description 1
- HCTHYIRJERPQJA-UHFFFAOYSA-N 7,14,25,32-tetrazaundecacyclo[21.13.2.22,5.03,19.04,16.06,14.08,13.020,37.025,33.026,31.034,38]tetraconta-1(37),2,4,6,8,10,12,16,18,20,22,26,28,30,32,34(38),35,39-octadecaene-15,24-dione Chemical group C1=CC=C2N(C(C3=CC=C4C5=CC=C6C(N7C8=CC=CC=C8N=C7C7=CC=C(C5=C67)C=5C=CC6=C3C4=5)=O)=O)C6=NC2=C1 HCTHYIRJERPQJA-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229910000967 As alloy Inorganic materials 0.000 description 1
- 229920001342 Bakelite® Polymers 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 239000004420 Iupilon Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- GHTKPGGSAYMCMW-UHFFFAOYSA-N P(O)(OCC(=O)OC)=O Chemical compound P(O)(OCC(=O)OC)=O GHTKPGGSAYMCMW-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004695 Polyether sulfone Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 1
- 229910001370 Se alloy Inorganic materials 0.000 description 1
- 229910052581 Si3N4 Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 229920001986 Vinylidene chloride-vinyl chloride copolymer Polymers 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- YGCOKJWKWLYHTG-UHFFFAOYSA-N [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol Chemical compound OCN(CO)C1=NC(N(CO)CO)=NC(N(CO)CO)=N1 YGCOKJWKWLYHTG-UHFFFAOYSA-N 0.000 description 1
- SUYARWBGPSQLRC-UHFFFAOYSA-N [bis(2-hydroxyethyl)amino]methylphosphonic acid Chemical compound OCCN(CCO)CP(O)(O)=O SUYARWBGPSQLRC-UHFFFAOYSA-N 0.000 description 1
- 125000004036 acetal group Chemical group 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021417 amorphous silicon Inorganic materials 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000004637 bakelite Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 230000005516 deep trap Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000011928 denatured alcohol Substances 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- MJUJXFBTEFXVKU-UHFFFAOYSA-N diethyl phosphonate Chemical compound CCOP(=O)OCC MJUJXFBTEFXVKU-UHFFFAOYSA-N 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 239000012799 electrically-conductive coating Substances 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical class O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000007756 gravure coating Methods 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 229920000592 inorganic polymer Polymers 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- XYRLXKVOGUCZAX-UHFFFAOYSA-N n'-[3-tri(butan-2-yloxy)silylpropyl]ethane-1,2-diamine Chemical compound CCC(C)O[Si](OC(C)CC)(OC(C)CC)CCCNCCN XYRLXKVOGUCZAX-UHFFFAOYSA-N 0.000 description 1
- QOKHTAQKELTIPD-UHFFFAOYSA-N n-(4-butylphenyl)-n-[4-[4-[4-(n-(4-butylphenyl)-4-methylanilino)phenyl]phenyl]phenyl]-4-methylaniline Chemical compound C1=CC(CCCC)=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC(C)=CC=1)C=1C=CC(CCCC)=CC=1)C1=CC=C(C)C=C1 QOKHTAQKELTIPD-UHFFFAOYSA-N 0.000 description 1
- GJXJFORUMJEJPV-UHFFFAOYSA-N n-[4-[4-(4-butyl-n-(2,5-dimethylphenyl)anilino)-4-phenylcyclohexa-1,5-dien-1-yl]phenyl]-n-(4-butylphenyl)-2,5-dimethylaniline Chemical compound C1=CC(CCCC)=CC=C1N(C=1C(=CC=C(C)C=1)C)C1=CC=C(C=2C=CC(CC=2)(N(C=2C=CC(CCCC)=CC=2)C=2C(=CC=C(C)C=2)C)C=2C=CC=CC=2)C=C1 GJXJFORUMJEJPV-UHFFFAOYSA-N 0.000 description 1
- AFSGGEJIUYIWLV-UHFFFAOYSA-N n-[4-[4-[4-(4-butyl-n-(2-ethyl-6-methylphenyl)anilino)phenyl]phenyl]phenyl]-n-(4-butylphenyl)-2-ethyl-6-methylaniline Chemical compound C1=CC(CCCC)=CC=C1N(C=1C(=CC=CC=1C)CC)C1=CC=C(C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC(CCCC)=CC=2)C=2C(=CC=CC=2C)CC)C=C1 AFSGGEJIUYIWLV-UHFFFAOYSA-N 0.000 description 1
- GVFRJEQSPPYVMT-UHFFFAOYSA-N n-[4-[4-[4-(4-butyl-n-(3-methylphenyl)anilino)phenyl]phenyl]phenyl]-n-(4-butylphenyl)-3-methylaniline Chemical compound C1=CC(CCCC)=CC=C1N(C=1C=C(C)C=CC=1)C1=CC=C(C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC(CCCC)=CC=2)C=2C=C(C)C=CC=2)C=C1 GVFRJEQSPPYVMT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JTHNLKXLWOXOQK-UHFFFAOYSA-N n-propyl vinyl ketone Natural products CCCC(=O)C=C JTHNLKXLWOXOQK-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229930184652 p-Terphenyl Natural products 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000013034 phenoxy resin Substances 0.000 description 1
- 229920006287 phenoxy resin Polymers 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- 108091008695 photoreceptors Proteins 0.000 description 1
- 229920000090 poly(aryl ether) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920003050 poly-cycloolefin Polymers 0.000 description 1
- 229920001230 polyarylate Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920006393 polyether sulfone Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920000306 polymethylpentene Polymers 0.000 description 1
- 239000011116 polymethylpentene Substances 0.000 description 1
- 229920000069 polyphenylene sulfide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 1
- 238000004088 simulation Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- NBXZNTLFQLUFES-UHFFFAOYSA-N triethoxy(propyl)silane Chemical compound CCC[Si](OCC)(OCC)OCC NBXZNTLFQLUFES-UHFFFAOYSA-N 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
- 238000002061 vacuum sublimation Methods 0.000 description 1
- 125000005287 vanadyl group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/10—Bases for charge-receiving or other layers
- G03G5/102—Bases for charge-receiving or other layers consisting of or comprising metals
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0612—Acyclic or carbocyclic compounds containing nitrogen
- G03G5/0614—Amines
- G03G5/06142—Amines arylamine
- G03G5/06144—Amines arylamine diamine
- G03G5/061443—Amines arylamine diamine benzidine
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0612—Acyclic or carbocyclic compounds containing nitrogen
- G03G5/0614—Amines
- G03G5/06142—Amines arylamine
- G03G5/06144—Amines arylamine diamine
- G03G5/061446—Amines arylamine diamine terphenyl-diamine
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/14—Inert intermediate or cover layers for charge-receiving layers
- G03G5/142—Inert intermediate layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/14—Inert intermediate or cover layers for charge-receiving layers
- G03G5/142—Inert intermediate layers
- G03G5/144—Inert intermediate layers comprising inorganic material
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12/129,977 US8062816B2 (en) | 2008-05-30 | 2008-05-30 | Phosphonate hole blocking layer photoconductors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2009288792A true JP2009288792A (ja) | 2009-12-10 |
| JP2009288792A5 JP2009288792A5 (enExample) | 2012-07-12 |
Family
ID=40983404
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2009130197A Withdrawn JP2009288792A (ja) | 2008-05-30 | 2009-05-29 | ホスホネート正孔阻止層光導電体 |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US8062816B2 (enExample) |
| EP (1) | EP2128709A1 (enExample) |
| JP (1) | JP2009288792A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7968261B2 (en) * | 2008-05-30 | 2011-06-28 | Xerox Corporation | Zirconocene containing photoconductors |
| US8048601B2 (en) * | 2008-05-30 | 2011-11-01 | Xerox Corporation | Aminosilane and self crosslinking acrylic resin hole blocking layer photoconductors |
| US7951514B2 (en) * | 2008-05-30 | 2011-05-31 | Xerox Corporation | Polymer anticurl backside coating (ACBC) photoconductors |
| US7985521B2 (en) * | 2008-05-30 | 2011-07-26 | Xerox Corporation | Anthracene containing photoconductors |
| US8012656B2 (en) * | 2008-05-30 | 2011-09-06 | Xerox Corporation | Backing layer containing photoconductor |
| US7968263B2 (en) * | 2008-05-30 | 2011-06-28 | Xerox Corporation | Amine phosphate containing photogenerating layer photoconductors |
| US8003289B2 (en) * | 2008-05-30 | 2011-08-23 | Xerox Corporation | Ferrocene containing photoconductors |
| US20150346616A1 (en) | 2014-06-03 | 2015-12-03 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, manufacturing method of electrophotographic photosensitive member, process cartridge and electrophotographic apparatus, and phthalocyanine crystal and manufacturing method of phthalocyanine crystal |
| US10649353B2 (en) * | 2018-10-03 | 2020-05-12 | Xerox Corporation | Tethered metal dioxide for imaging members |
| US10527960B1 (en) * | 2018-10-23 | 2020-01-07 | Xerox Corporation | Tethered metal dioxide for imaging members |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4265990A (en) * | 1977-05-04 | 1981-05-05 | Xerox Corporation | Imaging system with a diamine charge transport material in a polycarbonate resin |
| US4298697A (en) | 1979-10-23 | 1981-11-03 | Diamond Shamrock Corporation | Method of making sheet or shaped cation exchange membrane |
| US4338390A (en) | 1980-12-04 | 1982-07-06 | Xerox Corporation | Quarternary ammonium sulfate or sulfonate charge control agents for electrophotographic developers compatible with viton fuser |
| US4464450A (en) * | 1982-09-21 | 1984-08-07 | Xerox Corporation | Multi-layer photoreceptor containing siloxane on a metal oxide layer |
| US4518669A (en) | 1982-11-06 | 1985-05-21 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| US4579801A (en) | 1983-08-02 | 1986-04-01 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member having phenolic subbing layer |
| US4560635A (en) | 1984-08-30 | 1985-12-24 | Xerox Corporation | Toner compositions with ammonium sulfate charge enhancing additives |
| US4775605A (en) | 1986-01-09 | 1988-10-04 | Ricoh Co., Ltd. | Layered photosensitive material for electrophotography |
| US4921769A (en) * | 1988-10-03 | 1990-05-01 | Xerox Corporation | Photoresponsive imaging members with polyurethane blocking layers |
| US4921773A (en) | 1988-12-30 | 1990-05-01 | Xerox Corporation | Process for preparing an electrophotographic imaging member |
| JPH0693129B2 (ja) | 1989-01-21 | 1994-11-16 | キヤノン株式会社 | 電子写真感光体 |
| US5385796A (en) * | 1989-12-29 | 1995-01-31 | Xerox Corporation | Electrophotographic imaging member having unmodified hydroxy methacrylate polymer charge blocking layer |
| US5114818A (en) * | 1990-06-27 | 1992-05-19 | Xerox Corporation | Heat shielded electrostatographic imaging members |
| DE69215315T2 (de) | 1991-09-24 | 1997-06-12 | Agfa Gevaert Nv | Elektrophotographisches Aufzeichnungsmaterial |
| US5721080A (en) | 1992-06-04 | 1998-02-24 | Agfa-Gevaert, N.V. | Electrophotographic material containing particular phthalocyanines |
| JP2765407B2 (ja) * | 1992-10-09 | 1998-06-18 | 富士ゼロックス株式会社 | 電子写真感光体の製造方法 |
| US5656407A (en) | 1993-06-29 | 1997-08-12 | Mita Industrial Co., Ltd. | Photosensitive material for electrophotography |
| JP3053734B2 (ja) | 1993-07-20 | 2000-06-19 | シャープ株式会社 | 電子写真感光体及びその製造方法 |
| US5473064A (en) | 1993-12-20 | 1995-12-05 | Xerox Corporation | Hydroxygallium phthalocyanine imaging members and processes |
| US5521306A (en) | 1994-04-26 | 1996-05-28 | Xerox Corporation | Processes for the preparation of hydroxygallium phthalocyanine |
| US5482811A (en) | 1994-10-31 | 1996-01-09 | Xerox Corporation | Method of making hydroxygallium phthalocyanine type V photoconductive imaging members |
| US5703487A (en) | 1996-01-11 | 1997-12-30 | Xerox Corporation | Detection of charge deficient spot susceptibility |
| US5641599A (en) | 1996-01-11 | 1997-06-24 | Xerox Corporation | Electrophotographic imaging member with improved charge blocking layer |
| JPH1055077A (ja) * | 1996-08-13 | 1998-02-24 | Fuji Electric Co Ltd | 電子写真用感光体 |
| US6150824A (en) | 1997-10-30 | 2000-11-21 | Xerox Corporation | Contactless system for detecting subtle surface potential charge patterns |
| US6008653A (en) | 1997-10-30 | 1999-12-28 | Xerox Corporation | Contactless system for detecting microdefects on electrostatographic members |
| US5906904A (en) * | 1998-03-27 | 1999-05-25 | Xerox Corporation | Electrophotographic imaging member with improved support layer |
| US6015645A (en) * | 1998-05-29 | 2000-01-18 | Xerox Corporation | Photoconductive imaging members |
| US6177219B1 (en) * | 1999-10-12 | 2001-01-23 | Xerox Corporation | Blocking layer with needle shaped particles |
| US6200716B1 (en) | 1999-11-15 | 2001-03-13 | Xerox Corporation | Photoreceptor with poly (vinylbenzyl alcohol) |
| US6180309B1 (en) | 1999-11-26 | 2001-01-30 | Xerox Corporation | Organic photoreceptor with improved adhesion between coated layers |
| US6207334B1 (en) | 2000-05-12 | 2001-03-27 | Xerox Corporation | Photoreceptor with improved combination of overcoat layer and charge transport layer |
| US6255027B1 (en) * | 2000-05-22 | 2001-07-03 | Xerox Corporation | Blocking layer with light scattering particles having coated core |
| US6156468A (en) * | 2000-05-22 | 2000-12-05 | Xerox Corporation | Blocking layer with light scattering particles having rough surface |
| US6780554B2 (en) * | 2002-12-16 | 2004-08-24 | Xerox Corporation | Imaging member |
| US6913863B2 (en) * | 2003-02-19 | 2005-07-05 | Xerox Corporation | Photoconductive imaging members |
| US7018758B2 (en) * | 2003-09-17 | 2006-03-28 | Xerox Corporation | Photoconductive imaging members |
| US7166397B2 (en) * | 2003-12-23 | 2007-01-23 | Xerox Corporation | Imaging members |
| US7312007B2 (en) * | 2004-09-16 | 2007-12-25 | Xerox Corporation | Photoconductive imaging members |
| US7651827B2 (en) * | 2005-07-28 | 2010-01-26 | Xerox Corporation | Photoreceptor layer having phosphorus-containing lubricant |
| US7527902B2 (en) * | 2005-07-28 | 2009-05-05 | Xerox Corporation | Photoreceptor layer having solid and liquid lubricants |
| US7544452B2 (en) * | 2005-08-26 | 2009-06-09 | Xerox Corporation | Thick undercoats |
| US7604914B2 (en) * | 2006-04-13 | 2009-10-20 | Xerox Corporation | Imaging member |
| US7732112B2 (en) * | 2006-07-06 | 2010-06-08 | Xerox Corporation | Electrophotographic imaging member undercoat layers |
| US7560208B2 (en) * | 2006-08-01 | 2009-07-14 | Xerox Corporation | Polyester containing member |
| US8053151B2 (en) * | 2008-06-30 | 2011-11-08 | Xerox Corporation | Phosphonate containing photoconductors |
-
2008
- 2008-05-30 US US12/129,977 patent/US8062816B2/en not_active Expired - Fee Related
-
2009
- 2009-03-18 EP EP09155429A patent/EP2128709A1/en not_active Withdrawn
- 2009-05-29 JP JP2009130197A patent/JP2009288792A/ja not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| EP2128709A1 (en) | 2009-12-02 |
| US20090297967A1 (en) | 2009-12-03 |
| US8062816B2 (en) | 2011-11-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2009288792A (ja) | ホスホネート正孔阻止層光導電体 | |
| JP2009288791A (ja) | アミノシランおよび自己架橋型アクリル樹脂正孔阻止層光導電体 | |
| US20090325090A1 (en) | Phenolic resin hole blocking layer photoconductors | |
| US20110269063A1 (en) | Phenolic glycoluril containing photoconductors | |
| US8158315B2 (en) | SN containing hole blocking layer photoconductor | |
| JP2009288786A (ja) | リン酸アミン含有電荷発生層光導電体 | |
| US8227154B2 (en) | Melamine polymer hole blocking layer photoconductors | |
| US8221946B2 (en) | Aminosilane urea containing hole blocking layer photoconductors | |
| US8227155B2 (en) | Epoxysilane hole blocking layer photoconductors | |
| US7732111B2 (en) | Photoconductors containing halogenated binders and aminosilanes in hole blocking layer | |
| JP5745833B2 (ja) | スルホンアミド含有光導電体 | |
| JP2010204658A (ja) | チオン亜鉛光導電体 | |
| US7618756B2 (en) | Photoconductors containing chelating components | |
| US20110151365A1 (en) | Polyalkylene glycol benzoate containing photoconductors | |
| US8071267B2 (en) | Phenol polysulfide hole blocking layer photoconductors | |
| US8053152B2 (en) | Boron containing hole blocking layer photoconductor | |
| US7718336B2 (en) | Photoconductors containing photogenerating chelating components | |
| US8399164B2 (en) | Dendritic polyester polyol photoconductors | |
| US7838186B2 (en) | Photoconductors containing charge transport chelating components | |
| US7776498B2 (en) | Photoconductors containing halogenated binders | |
| US8367286B2 (en) | Phenolic urea hole blocking layer photoconductors | |
| US7759031B2 (en) | Photoconductors containing fluorogallium phthalocyanines | |
| JP5432464B2 (ja) | フッ化成分を含有するオーバーコートされた光導電体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Written amendment |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20120528 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20120528 |
|
| A761 | Written withdrawal of application |
Free format text: JAPANESE INTERMEDIATE CODE: A761 Effective date: 20121129 |