JP2008505920A - 抗菌剤 - Google Patents
抗菌剤 Download PDFInfo
- Publication number
- JP2008505920A JP2008505920A JP2007520525A JP2007520525A JP2008505920A JP 2008505920 A JP2008505920 A JP 2008505920A JP 2007520525 A JP2007520525 A JP 2007520525A JP 2007520525 A JP2007520525 A JP 2007520525A JP 2008505920 A JP2008505920 A JP 2008505920A
- Authority
- JP
- Japan
- Prior art keywords
- methyl
- pyrido
- oxo
- methyloxy
- dihydro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003242 anti bacterial agent Substances 0.000 title description 5
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 8
- 241000124008 Mammalia Species 0.000 claims abstract description 8
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims description 267
- -1 hydroxy, amino, piperidyl Chemical group 0.000 claims description 211
- 239000001257 hydrogen Substances 0.000 claims description 117
- 229910052739 hydrogen Inorganic materials 0.000 claims description 117
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 80
- 125000000217 alkyl group Chemical group 0.000 claims description 76
- 238000002360 preparation method Methods 0.000 claims description 53
- 150000003839 salts Chemical class 0.000 claims description 49
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 47
- 150000001412 amines Chemical class 0.000 claims description 36
- 125000003118 aryl group Chemical group 0.000 claims description 35
- 150000002431 hydrogen Chemical class 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 31
- 150000002367 halogens Chemical class 0.000 claims description 31
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 28
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 27
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 21
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 20
- 229910052731 fluorine Inorganic materials 0.000 claims description 20
- 239000011737 fluorine Substances 0.000 claims description 20
- 125000000623 heterocyclic group Chemical group 0.000 claims description 18
- 239000012453 solvate Substances 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 13
- 125000004429 atom Chemical group 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 7
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 6
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 5
- WCOPEZIWYVDOGJ-NNJIEVJOSA-N 6-[[[(2r)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-2-hydroxyethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@H]3OCCN(C3)CC(O)C3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 WCOPEZIWYVDOGJ-NNJIEVJOSA-N 0.000 claims description 5
- WCOPEZIWYVDOGJ-BUSXIPJBSA-N 6-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-2-hydroxyethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CC(O)C3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 WCOPEZIWYVDOGJ-BUSXIPJBSA-N 0.000 claims description 5
- 125000005035 acylthio group Chemical group 0.000 claims description 5
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 4
- 125000006242 amine protecting group Chemical group 0.000 claims description 4
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000005647 linker group Chemical group 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- 229910052721 tungsten Inorganic materials 0.000 claims description 4
- BEJKRDDWNPMACI-UHFFFAOYSA-N 4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-n-methyl-n-[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methyl]morpholine-2-carboxamide Chemical compound S1CC(=O)NC2=NC(CN(C)C(=O)C3OCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 BEJKRDDWNPMACI-UHFFFAOYSA-N 0.000 claims description 3
- XRAJCWSBLKBNDM-UHFFFAOYSA-N 6-[[8-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3-oxo-1,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CN3C(=O)CN4CCN(CC4C3)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 XRAJCWSBLKBNDM-UHFFFAOYSA-N 0.000 claims description 3
- HPYOIEYJFIOJFT-UHFFFAOYSA-N 6-[[8-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-oxo-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CN3CC4N(C(C3)=O)CCN(C4)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 HPYOIEYJFIOJFT-UHFFFAOYSA-N 0.000 claims description 3
- DNJYXXMLVYYZID-APWZRJJASA-N 6-[[[(2r)-4-[(2r)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@H]3OCCN(C3)C[C@H](O)C3=CC=NC4=CC=C(N=C43)OC)=CC=C21 DNJYXXMLVYYZID-APWZRJJASA-N 0.000 claims description 3
- DNJYXXMLVYYZID-LPHOPBHVSA-N 6-[[[(2s)-4-[(2r)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)C[C@H](O)C3=CC=NC4=CC=C(N=C43)OC)=CC=C21 DNJYXXMLVYYZID-LPHOPBHVSA-N 0.000 claims description 3
- QGYGRBYHGOAPRP-SFHVURJKSA-N 6-[[[(2s)-4-[2-(3-fluoro-6-methoxyquinolin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=C(F)C=NC4=CC=C(C=C43)OC)=CC=C21 QGYGRBYHGOAPRP-SFHVURJKSA-N 0.000 claims description 3
- DJIJBENPXOOCBF-UHFFFAOYSA-N 6-[[[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-3-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNCC3CCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 DJIJBENPXOOCBF-UHFFFAOYSA-N 0.000 claims description 3
- UGOBYQRYYQCZRB-UHFFFAOYSA-N 6-[[[4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperazin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNCC3NCCN(C3)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 UGOBYQRYYQCZRB-UHFFFAOYSA-N 0.000 claims description 3
- OAJYFQBGENGKHJ-UHFFFAOYSA-N 6-[[[4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNCC3OCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 OAJYFQBGENGKHJ-UHFFFAOYSA-N 0.000 claims description 3
- CTRVZTOAQIFNGS-SFHVURJKSA-N 6-methoxy-4-[2-[(2s)-2-[[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]methyl]morpholin-4-yl]ethyl]-1,5-naphthyridine-3-carbonitrile Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=C(C#N)C=NC4=CC=C(N=C43)OC)=CC=C21 CTRVZTOAQIFNGS-SFHVURJKSA-N 0.000 claims description 3
- INCQTOLYCXVNOH-AWEZNQCLSA-N 7-chloro-6-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound N1C(=O)COC(C=C2Cl)=C1N=C2CNC[C@@H](C1)OCCN1CCC1=C(F)C=NC2=CC=C(OC)N=C21 INCQTOLYCXVNOH-AWEZNQCLSA-N 0.000 claims description 3
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 3
- 125000005361 aryl sulfoxide group Chemical group 0.000 claims description 3
- 125000005110 aryl thio group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 3
- 125000004468 heterocyclylthio group Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 3
- MDPIIKLBVPRYLK-HNNXBMFYSA-N (2s)-n-(6-methoxy-1,5-naphthyridin-4-yl)-2-[[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]methyl]morpholine-4-carboxamide Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)C(=O)NC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 MDPIIKLBVPRYLK-HNNXBMFYSA-N 0.000 claims description 2
- NZJRODSXVMZZDT-UHFFFAOYSA-N 6-[[7-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3-oxo-5,6,8,8a-tetrahydro-1h-imidazo[1,5-a]pyrazin-2-yl]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CN3CC4N(C3=O)CCN(C4)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 NZJRODSXVMZZDT-UHFFFAOYSA-N 0.000 claims description 2
- OLLLXPOAZSYQDY-INIZCTEOSA-N 6-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 OLLLXPOAZSYQDY-INIZCTEOSA-N 0.000 claims description 2
- NXBSBBMUDZDBMP-SFHVURJKSA-N 6-[[[(2s)-4-[2-(3-fluoro-6-methoxyquinolin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=C(F)C=NC4=CC=C(C=C43)OC)=CC=C21 NXBSBBMUDZDBMP-SFHVURJKSA-N 0.000 claims description 2
- OXEITQIJQHGVNK-SFHVURJKSA-N 6-methoxy-4-[2-[(2s)-2-[[(3-oxo-4h-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]methyl]morpholin-4-yl]ethyl]-1,5-naphthyridine-3-carbonitrile Chemical compound O1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=C(C#N)C=NC4=CC=C(N=C43)OC)=CC=C21 OXEITQIJQHGVNK-SFHVURJKSA-N 0.000 claims description 2
- NITQQTGQNJQKIJ-INIZCTEOSA-N 8-fluoro-6-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(CNC[C@@H]3OCCN(C3)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC(F)=C21 NITQQTGQNJQKIJ-INIZCTEOSA-N 0.000 claims description 2
- 241000790917 Dioxys <bee> Species 0.000 claims description 2
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 2
- 125000005360 alkyl sulfoxide group Chemical group 0.000 claims description 2
- 150000001540 azides Chemical class 0.000 claims description 2
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 2
- QVXLXJYKKAKILO-UHFFFAOYSA-N n-[[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-3-yl]methyl]-3-oxo-4h-1,4-benzothiazine-6-sulfonamide Chemical compound S1CC(=O)NC2=CC(S(=O)(=O)NCC3CCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 QVXLXJYKKAKILO-UHFFFAOYSA-N 0.000 claims description 2
- RIVPPGHNETZFKI-UHFFFAOYSA-N n-[[4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methyl]-3-oxo-4h-1,4-benzothiazine-6-sulfonamide Chemical compound S1CC(=O)NC2=CC(S(=O)(=O)NCC3OCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 RIVPPGHNETZFKI-UHFFFAOYSA-N 0.000 claims description 2
- JBYPDPRGTXGQGZ-UHFFFAOYSA-N n-[[4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methyl]-3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxamide Chemical compound S1CC(=O)NC2=NC(C(=O)NCC3OCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 JBYPDPRGTXGQGZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 12
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims 2
- OAJYFQBGENGKHJ-GOSISDBHSA-N 6-[[[(2r)-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@H]3OCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 OAJYFQBGENGKHJ-GOSISDBHSA-N 0.000 claims 1
- NWWLLPDMCNFPOA-UHFFFAOYSA-N 6-[[[4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperazin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNCC3NCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 NWWLLPDMCNFPOA-UHFFFAOYSA-N 0.000 claims 1
- PSDYQSWHANEKRV-UHFFFAOYSA-N [S]N Chemical group [S]N PSDYQSWHANEKRV-UHFFFAOYSA-N 0.000 claims 1
- LMJJOAJSFFEASA-UHFFFAOYSA-N n-[[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-3-yl]methyl]-3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxamide Chemical compound S1CC(=O)NC2=NC(C(=O)NCC3CCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 LMJJOAJSFFEASA-UHFFFAOYSA-N 0.000 claims 1
- 238000011282 treatment Methods 0.000 abstract description 11
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 abstract 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 abstract 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 abstract 2
- 150000005054 naphthyridines Chemical class 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 297
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 197
- 239000000243 solution Substances 0.000 description 188
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 106
- 239000007787 solid Substances 0.000 description 101
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 89
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 74
- 239000000203 mixture Substances 0.000 description 73
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 66
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 64
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 59
- 238000006243 chemical reaction Methods 0.000 description 52
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 51
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 39
- 238000005481 NMR spectroscopy Methods 0.000 description 39
- 239000000377 silicon dioxide Substances 0.000 description 39
- 230000002829 reductive effect Effects 0.000 description 36
- 239000000463 material Substances 0.000 description 35
- 235000019439 ethyl acetate Nutrition 0.000 description 34
- 150000002500 ions Chemical class 0.000 description 34
- 239000011734 sodium Substances 0.000 description 33
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 26
- 238000004440 column chromatography Methods 0.000 description 26
- 239000000047 product Substances 0.000 description 26
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 25
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 25
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 24
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- VEPGNAIYGRUSIA-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carbaldehyde Chemical compound S1CC(=O)NC2=NC(C=O)=CC=C21 VEPGNAIYGRUSIA-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 239000000741 silica gel Substances 0.000 description 21
- 229910002027 silica gel Inorganic materials 0.000 description 21
- 239000002904 solvent Substances 0.000 description 20
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 17
- 238000000746 purification Methods 0.000 description 17
- 239000000725 suspension Substances 0.000 description 17
- 239000006260 foam Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- 235000019198 oils Nutrition 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 13
- 229910052786 argon Inorganic materials 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- DACDXLNXHJKSJG-UHFFFAOYSA-N 8-ethenyl-2-methoxy-1,5-naphthyridine Chemical compound N1=CC=C(C=C)C2=NC(OC)=CC=C21 DACDXLNXHJKSJG-UHFFFAOYSA-N 0.000 description 11
- 239000008346 aqueous phase Substances 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- 239000000706 filtrate Substances 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- 235000011181 potassium carbonates Nutrition 0.000 description 11
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 11
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- 238000000967 suction filtration Methods 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- 239000012458 free base Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 7
- SZHYPQDQYNLZJP-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound S1CC(=O)NC2=NC(C(=O)O)=CC=C21 SZHYPQDQYNLZJP-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 208000015181 infectious disease Diseases 0.000 description 7
- 239000000546 pharmaceutical excipient Substances 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- UIRSLBDCOYTZPH-UHFFFAOYSA-N 4h-1,4-thiazin-3-one Chemical compound O=C1CSC=CN1 UIRSLBDCOYTZPH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 6
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 6
- FHHZOYXKOICLGH-UHFFFAOYSA-N dichloromethane;ethanol Chemical compound CCO.ClCCl FHHZOYXKOICLGH-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 150000003840 hydrochlorides Chemical class 0.000 description 6
- 238000001727 in vivo Methods 0.000 description 6
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 238000006268 reductive amination reaction Methods 0.000 description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 6
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 5
- XOXXGNIBXYQQNS-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde Chemical compound O1CC(=O)NC2=NC(C=O)=CC=C21 XOXXGNIBXYQQNS-UHFFFAOYSA-N 0.000 description 5
- NJYPMXVETRNGGM-UHFFFAOYSA-N 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-sulfonyl chloride Chemical compound S1CC(=O)NC2=NC(S(=O)(=O)Cl)=CC=C21 NJYPMXVETRNGGM-UHFFFAOYSA-N 0.000 description 5
- KWYSRDPJHYGSBD-UHFFFAOYSA-N 8-ethenyl-7-fluoro-2-methoxy-1,5-naphthyridine Chemical compound N1=CC(F)=C(C=C)C2=NC(OC)=CC=C21 KWYSRDPJHYGSBD-UHFFFAOYSA-N 0.000 description 5
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 5
- XWHZMFVWPUWQLK-UHFFFAOYSA-N [1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-3-yl]methanamine Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCN1CCCC(CN)C1 XWHZMFVWPUWQLK-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 238000003818 flash chromatography Methods 0.000 description 5
- 230000000670 limiting effect Effects 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- IYHJNCQAADULQE-MRVPVSSYSA-N tert-butyl n-[[(2r)-morpholin-2-yl]methyl]carbamate Chemical compound CC(C)(C)OC(=O)NC[C@H]1CNCCO1 IYHJNCQAADULQE-MRVPVSSYSA-N 0.000 description 5
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 5
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 241000606768 Haemophilus influenzae Species 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- 238000006845 Michael addition reaction Methods 0.000 description 4
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- AJIRBVJBVZBXQI-UHFFFAOYSA-N [4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methanamine Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCN1CCOC(CN)C1 AJIRBVJBVZBXQI-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- FJDMNLFVZHBIHR-UHFFFAOYSA-N diethyl 2-[[(6-methoxypyridin-3-yl)amino]methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CNC1=CC=C(OC)N=C1 FJDMNLFVZHBIHR-UHFFFAOYSA-N 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 210000004072 lung Anatomy 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 3
- MCGUOACWOAWGGX-NKUHCKNESA-N 2-[(2s)-2-(aminomethyl)morpholin-4-yl]-1-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethanol Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1C(O)CN1CCO[C@@H](CN)C1 MCGUOACWOAWGGX-NKUHCKNESA-N 0.000 description 3
- OWSZRSPMHIRUNG-ZDUSSCGKSA-N 4-[2-[(2s)-2-(aminomethyl)morpholin-4-yl]ethyl]-6-methoxy-1,5-naphthyridine-3-carbonitrile Chemical compound C12=NC(OC)=CC=C2N=CC(C#N)=C1CCN1CCO[C@@H](CN)C1 OWSZRSPMHIRUNG-ZDUSSCGKSA-N 0.000 description 3
- UUVDJIWRSIJEBS-UHFFFAOYSA-N 6-methoxypyridin-3-amine Chemical compound COC1=CC=C(N)C=N1 UUVDJIWRSIJEBS-UHFFFAOYSA-N 0.000 description 3
- IKQSVZSSJQHCDT-UHFFFAOYSA-N 7-formyl-2,3-dihydro-1,4-benzodioxine-5-carbonitrile Chemical compound O1CCOC2=C1C=C(C=O)C=C2C#N IKQSVZSSJQHCDT-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- VKIJXFIYBAYHOE-VOTSOKGWSA-N [(e)-2-phenylethenyl]boronic acid Chemical compound OB(O)\C=C\C1=CC=CC=C1 VKIJXFIYBAYHOE-VOTSOKGWSA-N 0.000 description 3
- VTWJKEZCXALLKM-UHFFFAOYSA-N [1,3]oxathiolo[5,4-c]pyridine-6-carbaldehyde Chemical compound C1=NC(C=O)=CC2=C1OCS2 VTWJKEZCXALLKM-UHFFFAOYSA-N 0.000 description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 3
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000005587 bubbling Effects 0.000 description 3
- 238000004296 chiral HPLC Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- MQYQOVYIJOLTNX-UHFFFAOYSA-N dichloromethane;n,n-dimethylformamide Chemical compound ClCCl.CN(C)C=O MQYQOVYIJOLTNX-UHFFFAOYSA-N 0.000 description 3
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 3
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- HZONUGDFRUXYSA-UHFFFAOYSA-N ethyl 2-(6-bromo-2-nitropyridin-3-yl)oxyacetate Chemical compound CCOC(=O)COC1=CC=C(Br)N=C1[N+]([O-])=O HZONUGDFRUXYSA-UHFFFAOYSA-N 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229940047650 haemophilus influenzae Drugs 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 3
- 230000010412 perfusion Effects 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- APUWIVSROIMCRW-UHFFFAOYSA-N (2-methylpropan-2-yl)oxycarbonyl piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)OC(=O)N1CCCCC1 APUWIVSROIMCRW-UHFFFAOYSA-N 0.000 description 2
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 description 2
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 2
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 2
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- IXPFZGASIYQZGR-UHFFFAOYSA-N 2,2,2-trifluoro-n-(piperidin-3-ylmethyl)acetamide Chemical compound FC(F)(F)C(=O)NCC1CCCNC1 IXPFZGASIYQZGR-UHFFFAOYSA-N 0.000 description 2
- UQFACPPCTSSQPZ-UHFFFAOYSA-N 2,2,2-trifluoro-n-[[1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-3-yl]methyl]acetamide Chemical compound C12=NC(OC)=CC=C2N=CC=C1CCN1CCCC(CNC(=O)C(F)(F)F)C1 UQFACPPCTSSQPZ-UHFFFAOYSA-N 0.000 description 2
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 2
- MCGUOACWOAWGGX-VUUHIHSGSA-N 2-[(2r)-2-(aminomethyl)morpholin-4-yl]-1-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethanol Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1C(O)CN1CCO[C@H](CN)C1 MCGUOACWOAWGGX-VUUHIHSGSA-N 0.000 description 2
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 2
- XYBYNVQWRLVUCY-UHFFFAOYSA-N 2-methoxy-1,5-naphthyridine Chemical compound N1=CC=CC2=NC(OC)=CC=C21 XYBYNVQWRLVUCY-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- ADVQGQHVRIFSQQ-UHFFFAOYSA-N 2h-1,4-oxazine-6-carbaldehyde Chemical compound O=CC1=CN=CCO1 ADVQGQHVRIFSQQ-UHFFFAOYSA-N 0.000 description 2
- ILLRLIDVEQSPFR-UHFFFAOYSA-N 2h-1,4-thiazine-6-carbaldehyde Chemical compound O=CC1=CN=CCS1 ILLRLIDVEQSPFR-UHFFFAOYSA-N 0.000 description 2
- GASZFYGRWPWZHP-UHFFFAOYSA-N 2h-1,4-thiazine-6-carboxamide Chemical compound NC(=O)C1=CN=CCS1 GASZFYGRWPWZHP-UHFFFAOYSA-N 0.000 description 2
- KBUKVNCANNQFCI-UHFFFAOYSA-N 2h-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde Chemical compound O1CC=NC2=NC(C=O)=CC=C21 KBUKVNCANNQFCI-UHFFFAOYSA-N 0.000 description 2
- CSUZMBGLKCRFKF-UHFFFAOYSA-N 2h-thiazine-6-carbaldehyde Chemical compound O=CC1=CC=CNS1 CSUZMBGLKCRFKF-UHFFFAOYSA-N 0.000 description 2
- KLSHZDPXXKAHIJ-UHFFFAOYSA-N 3-bromo-4-hydroxy-5-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(Br)=C1O KLSHZDPXXKAHIJ-UHFFFAOYSA-N 0.000 description 2
- FEXJVEZCIWUQMB-UHFFFAOYSA-N 3-oxo-4h-1,4-benzothiazine-6-sulfonyl chloride Chemical compound S1CC(=O)NC2=CC(S(=O)(=O)Cl)=CC=C21 FEXJVEZCIWUQMB-UHFFFAOYSA-N 0.000 description 2
- LGWMTRPJZFEWCX-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCOC(C(O)=O)C1 LGWMTRPJZFEWCX-UHFFFAOYSA-N 0.000 description 2
- UXVVWOFTXSGSQU-UHFFFAOYSA-N 4-bromo-6-methoxy-1,5-naphthyridine-3-carboxylic acid Chemical compound N1=CC(C(O)=O)=C(Br)C2=NC(OC)=CC=C21 UXVVWOFTXSGSQU-UHFFFAOYSA-N 0.000 description 2
- PDLFBBIUMUHLAY-UHFFFAOYSA-N 4-chloro-6-methoxy-1,5-naphthyridine-3-carbonitrile Chemical compound N1=CC(C#N)=C(Cl)C2=NC(OC)=CC=C21 PDLFBBIUMUHLAY-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- BHYAVPITKGMHFV-UHFFFAOYSA-N 4-ethenyl-3-fluoro-6-methoxyquinoline Chemical compound N1=CC(F)=C(C=C)C2=CC(OC)=CC=C21 BHYAVPITKGMHFV-UHFFFAOYSA-N 0.000 description 2
- NGELQKRIKYROIV-UHFFFAOYSA-N 4-ethenyl-6-methoxy-1,5-naphthyridine-3-carbonitrile Chemical compound N1=CC(C#N)=C(C=C)C2=NC(OC)=CC=C21 NGELQKRIKYROIV-UHFFFAOYSA-N 0.000 description 2
- FFNCEXOZZTUYQX-UHFFFAOYSA-N 4-methylmorpholin-3-amine Chemical compound CN1CCOCC1N FFNCEXOZZTUYQX-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- XISPDFMAOWZEQG-UHFFFAOYSA-N 4h-1,4-oxazin-3-one Chemical compound O=C1COC=CN1 XISPDFMAOWZEQG-UHFFFAOYSA-N 0.000 description 2
- FBXGQDUVJBKEAJ-UHFFFAOYSA-N 4h-oxazin-3-one Chemical compound O=C1CC=CON1 FBXGQDUVJBKEAJ-UHFFFAOYSA-N 0.000 description 2
- HSPFQVCYAGBAAM-FQEVSTJZSA-N 5-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-2,3-dihydro-1-benzofuran-7-carbonitrile Chemical compound C([C@@H]1OCCN(C1)CCC1=C(F)C=NC2=CC=C(N=C21)OC)NCC(C=C1C#N)=CC2=C1OCC2 HSPFQVCYAGBAAM-FQEVSTJZSA-N 0.000 description 2
- POVCOBXPOKOJRY-UHFFFAOYSA-N 5-formyl-2,3-dihydro-1-benzofuran-7-carbonitrile Chemical compound N#CC1=CC(C=O)=CC2=C1OCC2 POVCOBXPOKOJRY-UHFFFAOYSA-N 0.000 description 2
- DVOSSCDEZOATHG-UHFFFAOYSA-N 6-bromo-2-nitropyridin-3-ol;2-nitropyridin-3-ol Chemical compound OC1=CC=CN=C1[N+]([O-])=O.OC1=CC=C(Br)N=C1[N+]([O-])=O DVOSSCDEZOATHG-UHFFFAOYSA-N 0.000 description 2
- KVRFERBTBNDKCP-IBGZPJMESA-N 7-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-2,3-dihydro-1,4-benzodioxine-5-carbonitrile Chemical compound O1CCOC(C(=C2)C#N)=C1C=C2CNC[C@@H](C1)OCCN1CCC1=C(F)C=NC2=CC=C(OC)N=C21 KVRFERBTBNDKCP-IBGZPJMESA-N 0.000 description 2
- YHPUYZUWGDSMNO-UHFFFAOYSA-N 8-fluoro-3-oxo-4h-1,4-benzoxazine-6-carbaldehyde Chemical compound N1C(=O)COC2=C1C=C(C=O)C=C2F YHPUYZUWGDSMNO-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- MEECGNNGVVALQT-UHDJGPCESA-N BrC1=NC=CC=C1.C(=C\C1=CC=CC=C1)/C=1C=CC=2OCC(NC2N1)=O Chemical compound BrC1=NC=CC=C1.C(=C\C1=CC=CC=C1)/C=1C=CC=2OCC(NC2N1)=O MEECGNNGVVALQT-UHDJGPCESA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- 241000194031 Enterococcus faecium Species 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- ICEBCMIPDKRROM-UHFFFAOYSA-N N1=CC=CC=C1.O=C1NC2=C(OC1)C=CC(=N2)C=O Chemical compound N1=CC=CC=C1.O=C1NC2=C(OC1)C=CC(=N2)C=O ICEBCMIPDKRROM-UHFFFAOYSA-N 0.000 description 2
- 241000277275 Oncorhynchus mykiss Species 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- QJTBGQTVACLGDB-UHFFFAOYSA-N [1,3]oxathiolo[5,4-c]pyridin-6-ylmethanol Chemical compound C1=NC(CO)=CC2=C1OCS2 QJTBGQTVACLGDB-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 230000000845 anti-microbial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000007806 chemical reaction intermediate Substances 0.000 description 2
- PSEHHVRCDVOTID-YYNWCRCSSA-N chloro-bis[(1r,3s,4r,5r)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane Chemical compound C([C@@H]([C@H]1C)B(Cl)[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@@H]2C)[C@H]2C(C)(C)[C@@H]1C2 PSEHHVRCDVOTID-YYNWCRCSSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- KXIRJHCVVKYTLS-UHFFFAOYSA-N ethyl 4-bromo-6-methoxy-1,5-naphthyridine-3-carboxylate Chemical compound C1=CC(OC)=NC2=C(Br)C(C(=O)OCC)=CN=C21 KXIRJHCVVKYTLS-UHFFFAOYSA-N 0.000 description 2
- UQVDJAIJPVHGER-UHFFFAOYSA-N ethyl 6-methoxy-4-oxo-1h-1,5-naphthyridine-3-carboxylate Chemical compound C1=C(OC)N=C2C(=O)C(C(=O)OCC)=CNC2=C1 UQVDJAIJPVHGER-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- CZFNISFYDPIDNM-UHFFFAOYSA-N n,n-dimethylformamide;oxolane Chemical compound CN(C)C=O.C1CCOC1 CZFNISFYDPIDNM-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 2
- UIYOVVYZPVVUMJ-UHFFFAOYSA-N tert-butyl carbamoyl carbonate Chemical compound CC(C)(C)OC(=O)OC(N)=O UIYOVVYZPVVUMJ-UHFFFAOYSA-N 0.000 description 2
- WLXNXPNLGQJYHI-UHFFFAOYSA-N tert-butyl n-[(4-benzylmorpholin-2-yl)methyl]carbamate Chemical compound C1COC(CNC(=O)OC(C)(C)C)CN1CC1=CC=CC=C1 WLXNXPNLGQJYHI-UHFFFAOYSA-N 0.000 description 2
- WLXNXPNLGQJYHI-HNNXBMFYSA-N tert-butyl n-[[(2s)-4-benzylmorpholin-2-yl]methyl]carbamate Chemical compound C1CO[C@@H](CNC(=O)OC(C)(C)C)CN1CC1=CC=CC=C1 WLXNXPNLGQJYHI-HNNXBMFYSA-N 0.000 description 2
- IYHJNCQAADULQE-QMMMGPOBSA-N tert-butyl n-[[(2s)-morpholin-2-yl]methyl]carbamate Chemical compound CC(C)(C)OC(=O)NC[C@@H]1CNCCO1 IYHJNCQAADULQE-QMMMGPOBSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- VSTXZNYDCUXXFN-FZMZJTMJSA-N (1r)-2-[(2s)-2-(aminomethyl)morpholin-4-yl]-1-(6-methoxy-1,5-naphthyridin-4-yl)ethanol Chemical compound C([C@H](O)C1=CC=NC2=CC=C(N=C21)OC)N1CCO[C@@H](CN)C1 VSTXZNYDCUXXFN-FZMZJTMJSA-N 0.000 description 1
- CADQEVJCGCIBDZ-VIFPVBQESA-N (1r)-2-bromo-1-(6-methoxy-1,5-naphthyridin-4-yl)ethanol Chemical compound N1=CC=C([C@@H](O)CBr)C2=NC(OC)=CC=C21 CADQEVJCGCIBDZ-VIFPVBQESA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- CKZVBXBEDDAEFE-UHFFFAOYSA-N (4-benzylmorpholin-2-yl)methanamine Chemical compound C1COC(CN)CN1CC1=CC=CC=C1 CKZVBXBEDDAEFE-UHFFFAOYSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- CHRJZRDFSQHIFI-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;styrene Chemical compound C=CC1=CC=CC=C1.C=CC1=CC=CC=C1C=C CHRJZRDFSQHIFI-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- UICMCANVSAQMRW-UHFFFAOYSA-N 1,4-dibenzylpiperazine-2-carbonitrile Chemical compound C1CN(CC=2C=CC=CC=2)C(C#N)CN1CC1=CC=CC=C1 UICMCANVSAQMRW-UHFFFAOYSA-N 0.000 description 1
- PLWDTZKINXQMKP-UHFFFAOYSA-N 1-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethane-1,2-diol Chemical compound N1=CC(F)=C(C(O)CO)C2=NC(OC)=CC=C21 PLWDTZKINXQMKP-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- WEBVDBDZSOJGPB-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-5-carbaldehyde Chemical compound O=CC1=CC=C2OCCC2=C1 WEBVDBDZSOJGPB-UHFFFAOYSA-N 0.000 description 1
- APIKZMSFECOLHI-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-7-carbonitrile Chemical compound N#CC1=CC=CC2=C1OCC2 APIKZMSFECOLHI-UHFFFAOYSA-N 0.000 description 1
- QNLSLYKWBHYEHK-UHFFFAOYSA-N 2-(2-formylphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1C=O QNLSLYKWBHYEHK-UHFFFAOYSA-N 0.000 description 1
- GMSCKKIRAYIIAL-UHFFFAOYSA-N 2-(hydroxymethyl)-5-[(4-methoxyphenyl)methoxy]-1h-pyridin-4-one Chemical compound C1=CC(OC)=CC=C1COC1=CNC(CO)=CC1=O GMSCKKIRAYIIAL-UHFFFAOYSA-N 0.000 description 1
- SHHBEUOYUVPTCG-UHFFFAOYSA-N 2-(hydroxymethyl)-5-[(4-methoxyphenyl)methoxy]pyran-4-one Chemical compound C1=CC(OC)=CC=C1COC1=COC(CO)=CC1=O SHHBEUOYUVPTCG-UHFFFAOYSA-N 0.000 description 1
- PCUKRXLKASGFHS-UHFFFAOYSA-N 2-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-3,4,7,8,9,9a-hexahydro-1h-pyrazino[1,2-a]pyrazin-6-one Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1CCN(C1)CCN2C1CNCC2=O PCUKRXLKASGFHS-UHFFFAOYSA-N 0.000 description 1
- BXNQDUMAPNIZAG-UHFFFAOYSA-N 2-amino-4-bromo-6-fluorophenol Chemical compound NC1=CC(Br)=CC(F)=C1O BXNQDUMAPNIZAG-UHFFFAOYSA-N 0.000 description 1
- WSUNSFXIUBQFSW-UHFFFAOYSA-N 2-ethenyloxaborinane Chemical compound C=CB1CCCCO1 WSUNSFXIUBQFSW-UHFFFAOYSA-N 0.000 description 1
- XRRUOZBSPBSFFM-UHFFFAOYSA-N 2-fluoro-6-methoxyquinoline Chemical compound N1=C(F)C=CC2=CC(OC)=CC=C21 XRRUOZBSPBSFFM-UHFFFAOYSA-N 0.000 description 1
- VFUFXHFSNCESKR-VIFPVBQESA-N 2-methoxy-8-[(2r)-oxiran-2-yl]-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC=C1[C@@H]1CO1 VFUFXHFSNCESKR-VIFPVBQESA-N 0.000 description 1
- VFUFXHFSNCESKR-SECBINFHSA-N 2-methoxy-8-[(2s)-oxiran-2-yl]-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC=C1[C@H]1CO1 VFUFXHFSNCESKR-SECBINFHSA-N 0.000 description 1
- JDNQOMCAIVSZRC-UHFFFAOYSA-N 2-oxo-3,4-dihydropyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound C1C(=O)SC2=C(N1)N=C(C=C2)C(=O)O JDNQOMCAIVSZRC-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 1
- IGDLCKRTTABTCE-UHFFFAOYSA-N 2h-oxazine-6-carbaldehyde Chemical compound O=CC1=CC=CNO1 IGDLCKRTTABTCE-UHFFFAOYSA-N 0.000 description 1
- NEJGGKXNNGPDAP-UHFFFAOYSA-N 3,4-dihydro-2h-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid Chemical compound S1CCNC2=NC(C(=O)O)=CC=C21 NEJGGKXNNGPDAP-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- FXAHCXPEXLCFFY-UHFFFAOYSA-N 4-(chloromethyl)morpholine Chemical compound ClCN1CCOCC1 FXAHCXPEXLCFFY-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- RHXOSWPXKBXUAG-UHFFFAOYSA-N 4-bromo-3-fluoro-6-methoxyquinoline Chemical compound N1=CC(F)=C(Br)C2=CC(OC)=CC=C21 RHXOSWPXKBXUAG-UHFFFAOYSA-N 0.000 description 1
- BAFTWOGEBKTZKK-UHFFFAOYSA-N 4-bromo-4h-1,2-benzoxazin-3-one Chemical compound C1=CC=C2C(Br)C(=O)NOC2=C1 BAFTWOGEBKTZKK-UHFFFAOYSA-N 0.000 description 1
- ZKAIYCQLABGZDR-UHFFFAOYSA-N 4-bromo-6-methoxy-1,5-naphthyridin-3-amine Chemical compound N1=CC(N)=C(Br)C2=NC(OC)=CC=C21 ZKAIYCQLABGZDR-UHFFFAOYSA-N 0.000 description 1
- GXLKMKBWTSNOHZ-UHFFFAOYSA-N 4-bromo-6-methoxyquinolin-3-amine Chemical compound N1=CC(N)=C(Br)C2=CC(OC)=CC=C21 GXLKMKBWTSNOHZ-UHFFFAOYSA-N 0.000 description 1
- KQYURGVTWROAAG-UHFFFAOYSA-N 4-bromo-6-methoxyquinolin-3-amine tert-butyl N-(4-bromo-6-methoxyquinolin-3-yl)carbamate Chemical compound COc1ccc2ncc(N)c(Br)c2c1.COc1ccc2ncc(NC(=O)OC(C)(C)C)c(Br)c2c1 KQYURGVTWROAAG-UHFFFAOYSA-N 0.000 description 1
- OLFLIHLXAHHBAF-UHFFFAOYSA-N 4-bromo-6-methoxyquinoline-3-carboxylic acid;ethyl 4-bromo-6-methoxyquinoline-3-carboxylate Chemical compound N1=CC(C(O)=O)=C(Br)C2=CC(OC)=CC=C21.C1=CC(OC)=CC2=C(Br)C(C(=O)OCC)=CN=C21 OLFLIHLXAHHBAF-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- QRAOZQGIUIDZQZ-UHFFFAOYSA-N 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine Chemical compound C=1C=C2N(C)CCOC2=CC=1B1OC(C)(C)C(C)(C)O1 QRAOZQGIUIDZQZ-UHFFFAOYSA-N 0.000 description 1
- ANHQLUBMNSSPBV-UHFFFAOYSA-N 4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound C1=CN=C2NC(=O)COC2=C1 ANHQLUBMNSSPBV-UHFFFAOYSA-N 0.000 description 1
- GVUSWMIMPJDWNW-UHFFFAOYSA-N 4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound C1=CN=C2NC(=O)CSC2=C1 GVUSWMIMPJDWNW-UHFFFAOYSA-N 0.000 description 1
- UEEKAQZCMVXISZ-UHFFFAOYSA-N 5-hydroxy-2-(hydroxymethyl)-1h-pyridine-4-thione Chemical compound OCC1=CC(S)=C(O)C=N1 UEEKAQZCMVXISZ-UHFFFAOYSA-N 0.000 description 1
- QKCZJBYIJRYYFB-UHFFFAOYSA-N 6-(hydroxymethyl)-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CO)=CC=C21 QKCZJBYIJRYYFB-UHFFFAOYSA-N 0.000 description 1
- RXYLWTCGXMDZTF-UHFFFAOYSA-N 6-(methylaminomethyl)-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC)=CC=C21 RXYLWTCGXMDZTF-UHFFFAOYSA-N 0.000 description 1
- VPOGMOJKALOBMB-VOTSOKGWSA-N 6-[(e)-2-phenylethenyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound N1=C2NC(=O)COC2=CC=C1\C=C\C1=CC=CC=C1 VPOGMOJKALOBMB-VOTSOKGWSA-N 0.000 description 1
- WTGWHRCIRZONKT-INIZCTEOSA-N 6-[[[(2s)-4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=C(F)C=NC4=CC=C(N=C43)OC)=CC=C21 WTGWHRCIRZONKT-INIZCTEOSA-N 0.000 description 1
- OAJYFQBGENGKHJ-SFHVURJKSA-N 6-[[[(2s)-4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]morpholin-2-yl]methylamino]methyl]-4h-pyrido[3,2-b][1,4]thiazin-3-one Chemical compound S1CC(=O)NC2=NC(CNC[C@@H]3OCCN(C3)CCC3=CC=NC4=CC=C(N=C43)OC)=CC=C21 OAJYFQBGENGKHJ-SFHVURJKSA-N 0.000 description 1
- GDVHYNCHZKTTSQ-UHFFFAOYSA-N 6-bromo-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(Br)=CC=C21 GDVHYNCHZKTTSQ-UHFFFAOYSA-N 0.000 description 1
- XSWFSNTZVXBPOA-UHFFFAOYSA-N 6-bromo-7-chloro-4h-pyrido[3,2-b][1,4]oxazin-3-one;6-bromo-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=NC(Br)=CC=C21.O1CC(=O)NC2=C1C=C(Cl)C(Br)=N2 XSWFSNTZVXBPOA-UHFFFAOYSA-N 0.000 description 1
- LMBVTDHVXJAUKM-UHFFFAOYSA-N 6-bromo-8-fluoro-4h-1,4-benzoxazin-3-one Chemical compound N1C(=O)COC2=C1C=C(Br)C=C2F LMBVTDHVXJAUKM-UHFFFAOYSA-N 0.000 description 1
- USGHUYLOTYBQGN-UHFFFAOYSA-N 6-ethenyl-8-fluoro-4h-1,4-benzoxazin-3-one Chemical compound N1C(=O)COC2=C1C=C(C=C)C=C2F USGHUYLOTYBQGN-UHFFFAOYSA-N 0.000 description 1
- VUHCPMIDSUGHNO-UHFFFAOYSA-N 6-methoxy-1,5-naphthyridin-4-amine Chemical compound N1=CC=C(N)C2=NC(OC)=CC=C21 VUHCPMIDSUGHNO-UHFFFAOYSA-N 0.000 description 1
- SSMACLPPRSQXHH-UHFFFAOYSA-N 6-methoxy-1h-1,5-naphthyridin-4-one Chemical compound N1C=CC(=O)C2=NC(OC)=CC=C21 SSMACLPPRSQXHH-UHFFFAOYSA-N 0.000 description 1
- HJMQBGKEMMQBSW-UHFFFAOYSA-N 7-bromo-2,3-dihydro-1-benzofuran-5-carbaldehyde Chemical compound BrC1=CC(C=O)=CC2=C1OCC2 HJMQBGKEMMQBSW-UHFFFAOYSA-N 0.000 description 1
- LNPCPKDZGSQOBD-UHFFFAOYSA-N 7-chloro-3-oxo-4h-1,4-benzoxazine-6-carbaldehyde Chemical compound O1CC(=O)NC2=C1C=C(Cl)C(C=O)=C2 LNPCPKDZGSQOBD-UHFFFAOYSA-N 0.000 description 1
- AXSGPMJQROKJEE-UHFFFAOYSA-N 7-chloro-3-oxo-4h-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde Chemical compound O1CC(=O)NC2=C1C=C(Cl)C(C=O)=N2 AXSGPMJQROKJEE-UHFFFAOYSA-N 0.000 description 1
- JYLCKRIWKFFNRF-UHDJGPCESA-N 7-chloro-3-oxo-4h-pyrido[3,2-b][1,4]oxazine-6-carbaldehyde;7-chloro-6-[(e)-2-phenylethenyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound O1CC(=O)NC2=C1C=C(Cl)C(C=O)=N2.ClC1=CC=2OCC(=O)NC=2N=C1\C=C\C1=CC=CC=C1 JYLCKRIWKFFNRF-UHDJGPCESA-N 0.000 description 1
- KCUQAQAXSNZKKN-VOTSOKGWSA-N 7-chloro-6-[(e)-2-phenylethenyl]-4h-pyrido[3,2-b][1,4]oxazin-3-one Chemical compound ClC1=CC=2OCC(=O)NC=2N=C1\C=C\C1=CC=CC=C1 KCUQAQAXSNZKKN-VOTSOKGWSA-N 0.000 description 1
- QMJFZPVEZZYXHU-UHFFFAOYSA-N 7-fluoro-2-methoxy-8-(oxiran-2-yl)-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1C1CO1 QMJFZPVEZZYXHU-UHFFFAOYSA-N 0.000 description 1
- QMJFZPVEZZYXHU-MRVPVSSYSA-N 7-fluoro-2-methoxy-8-[(2s)-oxiran-2-yl]-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1[C@H]1CO1 QMJFZPVEZZYXHU-MRVPVSSYSA-N 0.000 description 1
- HPQMRRPAOIGXFW-UHFFFAOYSA-N 8-bromo-2-methoxy-1,5-naphthyridine Chemical compound N1=CC=C(Br)C2=NC(OC)=CC=C21 HPQMRRPAOIGXFW-UHFFFAOYSA-N 0.000 description 1
- KBDDFKYRMCBPOT-UHFFFAOYSA-N 8-bromo-7-fluoro-2-methoxy-1,5-naphthyridine Chemical compound N1=CC(F)=C(Br)C2=NC(OC)=CC=C21 KBDDFKYRMCBPOT-UHFFFAOYSA-N 0.000 description 1
- YZSRAQQJZKNORR-UHFFFAOYSA-N 9h-fluoren-9-ylmethyl 4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-[[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]methyl]piperazine-1-carboxylate Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1COC(=O)N(C(CNCC=1N=C2NC(=O)CSC2=CC=1)C1)CCN1CCC1=C(F)C=NC2=CC=C(OC)N=C21 YZSRAQQJZKNORR-UHFFFAOYSA-N 0.000 description 1
- ZZOKVYOCRSMTSS-UHFFFAOYSA-N 9h-fluoren-9-ylmethyl carbamate Chemical compound C1=CC=C2C(COC(=O)N)C3=CC=CC=C3C2=C1 ZZOKVYOCRSMTSS-UHFFFAOYSA-N 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 101001053395 Arabidopsis thaliana Acid beta-fructofuranosidase 4, vacuolar Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ICGOPPLWSORKBJ-UHFFFAOYSA-N BrC1=C(C=NC2=CC=C(C=C12)OC)C(=O)O.C(C)(C)(C)OC(NC=1C=NC2=CC=C(C=C2C1Br)OC)=O Chemical compound BrC1=C(C=NC2=CC=C(C=C12)OC)C(=O)O.C(C)(C)(C)OC(NC=1C=NC2=CC=C(C=C2C1Br)OC)=O ICGOPPLWSORKBJ-UHFFFAOYSA-N 0.000 description 1
- UPNQXOMBNKAIFH-UHFFFAOYSA-N BrC1=C(C=NC2=CC=C(N=C12)OC)C(=O)O.BrC1=C(C=NC2=CC=C(N=C12)OC)N Chemical compound BrC1=C(C=NC2=CC=C(N=C12)OC)C(=O)O.BrC1=C(C=NC2=CC=C(N=C12)OC)N UPNQXOMBNKAIFH-UHFFFAOYSA-N 0.000 description 1
- MSSZCHOMQVAJBS-UHFFFAOYSA-N BrC=1C=C(C=O)C=C(C1O)O.BrC1=CC(=CC2=C1OCCO2)C=O Chemical compound BrC=1C=C(C=O)C=C(C1O)O.BrC1=CC(=CC2=C1OCCO2)C=O MSSZCHOMQVAJBS-UHFFFAOYSA-N 0.000 description 1
- WLQUOUCBFFUWIF-UHFFFAOYSA-N COC1=CC=C(N)C=C1.OC1=C(C=NC2=CC=C(C=C12)OC)C(=O)OCC Chemical compound COC1=CC=C(N)C=C1.OC1=C(C=NC2=CC=C(C=C12)OC)C(=O)OCC WLQUOUCBFFUWIF-UHFFFAOYSA-N 0.000 description 1
- 0 COc1nc2c(CCN3CC(CN(Cc(nc4N5)ccc4SCC5=O)C(CCl)=C)*CC3)c(F)cnc2cc1 Chemical compound COc1nc2c(CCN3CC(CN(Cc(nc4N5)ccc4SCC5=O)C(CCl)=C)*CC3)c(F)cnc2cc1 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 108090000204 Dipeptidase 1 Proteins 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- XNRVGTHNYCNCFF-UHFFFAOYSA-N Lapatinib ditosylate monohydrate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1.CC1=CC=C(S(O)(=O)=O)C=C1.O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 XNRVGTHNYCNCFF-UHFFFAOYSA-N 0.000 description 1
- 241000589248 Legionella Species 0.000 description 1
- 241000589242 Legionella pneumophila Species 0.000 description 1
- 208000007764 Legionnaires' Disease Diseases 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 241000588655 Moraxella catarrhalis Species 0.000 description 1
- GYSZKHFKOIWBPI-UHFFFAOYSA-N N1=C(C=CC=C1C)C.BrCC(=O)C1=CC=NC2=CC=C(N=C12)OC Chemical compound N1=C(C=CC=C1C)C.BrCC(=O)C1=CC=NC2=CC=C(N=C12)OC GYSZKHFKOIWBPI-UHFFFAOYSA-N 0.000 description 1
- 101001068640 Nicotiana tabacum Basic form of pathogenesis-related protein 1 Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- PWIFVORWEZFTBW-UHFFFAOYSA-N S1CC=NC=C1S(=O)(=O)N Chemical compound S1CC=NC=C1S(=O)(=O)N PWIFVORWEZFTBW-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000122971 Stenotrophomonas Species 0.000 description 1
- 241000122973 Stenotrophomonas maltophilia Species 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- IIGVVCYDNIPRLU-UHFFFAOYSA-N [2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-2-hydroxyethyl] 4-methylbenzenesulfonate Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1C(O)COS(=O)(=O)C1=CC=C(C)C=C1 IIGVVCYDNIPRLU-UHFFFAOYSA-N 0.000 description 1
- HFULIAGIYKACCH-UHFFFAOYSA-N [4-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperazin-2-yl]methanamine Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1CCN1CCNC(CN)C1 HFULIAGIYKACCH-UHFFFAOYSA-N 0.000 description 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 1
- NBABWSIDMVKICO-UHFFFAOYSA-N [N+](=O)([O-])C1=NC=CC=C1.BrC=1C=CC=2OCC(NC2N1)=O Chemical compound [N+](=O)([O-])C1=NC=CC=C1.BrC=1C=CC=2OCC(NC2N1)=O NBABWSIDMVKICO-UHFFFAOYSA-N 0.000 description 1
- AYBYKIJEVNAGQH-UHFFFAOYSA-N [N+](=O)([O-])N(C(=N)S(=O)(=O)N(N)C(=O)O)C#N Chemical compound [N+](=O)([O-])N(C(=N)S(=O)(=O)N(N)C(=O)O)C#N AYBYKIJEVNAGQH-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 238000011482 antibacterial activity assay Methods 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000004540 benzothiazol-5-yl group Chemical group S1C=NC2=C1C=CC(=C2)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 102000006635 beta-lactamase Human genes 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000007819 coupling partner Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- SQKZZFWTOOPCDQ-UHFFFAOYSA-N dichloromethane;ethyl acetate;hexane Chemical compound ClCCl.CCCCCC.CCOC(C)=O SQKZZFWTOOPCDQ-UHFFFAOYSA-N 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 108010037444 diisopropylglutathione ester Proteins 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003221 ear drop Substances 0.000 description 1
- 229940047652 ear drops Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229940092559 enterobacter aerogenes Drugs 0.000 description 1
- 229940032049 enterococcus faecalis Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- RWMJRMPOKXSHHI-UHFFFAOYSA-N ethenylboron Chemical compound [B]C=C RWMJRMPOKXSHHI-UHFFFAOYSA-N 0.000 description 1
- ARMFCDDVBRLZCM-UHFFFAOYSA-N ethyl 1,5-naphthyridine-3-carboxylate Chemical compound C1=CC=NC2=CC(C(=O)OCC)=CN=C21 ARMFCDDVBRLZCM-UHFFFAOYSA-N 0.000 description 1
- PVBRSNZAOAJRKO-UHFFFAOYSA-N ethyl 2-sulfanylacetate Chemical compound CCOC(=O)CS PVBRSNZAOAJRKO-UHFFFAOYSA-N 0.000 description 1
- JQGFRMBBTLWQHW-UHFFFAOYSA-N ethyl 4-bromo-6-methoxyquinoline-3-carboxylate Chemical compound C1=CC(OC)=CC2=C(Br)C(C(=O)OCC)=CN=C21 JQGFRMBBTLWQHW-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- IRXSLJNXXZKURP-UHFFFAOYSA-N fluorenylmethyloxycarbonyl chloride Chemical compound C1=CC=C2C(COC(=O)Cl)C3=CC=CC=C3C2=C1 IRXSLJNXXZKURP-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000005182 global health Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- LFKYBJLFJOOKAE-UHFFFAOYSA-N imidazol-2-ylidenemethanone Chemical compound O=C=C1N=CC=N1 LFKYBJLFJOOKAE-UHFFFAOYSA-N 0.000 description 1
- 125000004130 indan-2-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])(*)C2([H])[H] 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- BEJNERDRQOWKJM-UHFFFAOYSA-N kojic acid Chemical compound OCC1=CC(=O)C(O)=CO1 BEJNERDRQOWKJM-UHFFFAOYSA-N 0.000 description 1
- 229960004705 kojic acid Drugs 0.000 description 1
- WZNJWVWKTVETCG-UHFFFAOYSA-N kojic acid Natural products OC(=O)C(N)CN1C=CC(=O)C(O)=C1 WZNJWVWKTVETCG-UHFFFAOYSA-N 0.000 description 1
- 125000000686 lactone group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000002611 lead compounds Chemical class 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 229940115932 legionella pneumophila Drugs 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000008176 lyophilized powder Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- VPKDCDLSJZCGKE-UHFFFAOYSA-N methanediimine Chemical compound N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UIAHQILQYROVCF-UHFFFAOYSA-N methyl 3-oxo-4h-pyrido[3,2-b][1,4]thiazine-6-carboxylate Chemical compound S1CC(=O)NC2=NC(C(=O)OC)=CC=C21 UIAHQILQYROVCF-UHFFFAOYSA-N 0.000 description 1
- OQUCMNQHZFOMPC-UHFFFAOYSA-N methyl 6-amino-5-bromopyridine-2-carboxylate Chemical compound COC(=O)C1=CC=C(Br)C(N)=N1 OQUCMNQHZFOMPC-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- ZKWFSTHEYLJLEL-UHFFFAOYSA-N morpholine-4-carboxamide Chemical compound NC(=O)N1CCOCC1 ZKWFSTHEYLJLEL-UHFFFAOYSA-N 0.000 description 1
- AXXFHQMEKPTDGB-UHFFFAOYSA-N n-methyl-n-[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methyl]morpholine-2-carboxamide Chemical compound C=1C=C2SCC(=O)NC2=NC=1CN(C)C(=O)C1CNCCO1 AXXFHQMEKPTDGB-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluenecarboxylic acid Natural products CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000003305 oral gavage Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- OKBMCNHOEMXPTM-UHFFFAOYSA-M potassium peroxymonosulfate Chemical compound [K+].OOS([O-])(=O)=O OKBMCNHOEMXPTM-UHFFFAOYSA-M 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 229940074439 potassium sodium tartrate Drugs 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000004526 pyridazin-2-yl group Chemical group N1N(C=CC=C1)* 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- ZSJVRUWXJDVHQI-UHFFFAOYSA-N quinoline-6-sulfonamide Chemical compound N1=CC=CC2=CC(S(=O)(=O)N)=CC=C21 ZSJVRUWXJDVHQI-UHFFFAOYSA-N 0.000 description 1
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- TUZFIWBNGKNFPW-UHFFFAOYSA-M sodium;2-methylpropane-2-thiolate Chemical compound [Na+].CC(C)(C)[S-] TUZFIWBNGKNFPW-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- REQQFSGHFORUFI-UHFFFAOYSA-N tert-butyl 2-[methyl-[(3-oxo-4h-pyrido[3,2-b][1,4]thiazin-6-yl)methyl]carbamoyl]morpholine-4-carboxylate Chemical compound C=1C=C2SCC(=O)NC2=NC=1CN(C)C(=O)C1CN(C(=O)OC(C)(C)C)CCO1 REQQFSGHFORUFI-UHFFFAOYSA-N 0.000 description 1
- WPWXYQIMXTUMJB-UHFFFAOYSA-N tert-butyl 3-(aminomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(CN)C1 WPWXYQIMXTUMJB-UHFFFAOYSA-N 0.000 description 1
- BKVPYQVNQYUOGG-UHFFFAOYSA-N tert-butyl 8-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-4-oxo-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate Chemical compound C1CN(C(CN(C2)C(=O)OC(C)(C)C)=O)C2CN1CCC1=C(F)C=NC2=CC=C(OC)N=C21 BKVPYQVNQYUOGG-UHFFFAOYSA-N 0.000 description 1
- XCAQIUOFDMREBA-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(=O)OC(C)(C)C XCAQIUOFDMREBA-UHFFFAOYSA-N 0.000 description 1
- WLXNXPNLGQJYHI-OAHLLOKOSA-N tert-butyl n-[[(2r)-4-benzylmorpholin-2-yl]methyl]carbamate Chemical compound C1CO[C@H](CNC(=O)OC(C)(C)C)CN1CC1=CC=CC=C1 WLXNXPNLGQJYHI-OAHLLOKOSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 238000002627 tracheal intubation Methods 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 150000003952 β-lactams Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US58644604P | 2004-07-08 | 2004-07-08 | |
| PCT/US2005/024221 WO2006014580A1 (en) | 2004-07-08 | 2005-07-08 | Antibacterial agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2008505920A true JP2008505920A (ja) | 2008-02-28 |
| JP2008505920A5 JP2008505920A5 (enExample) | 2008-09-04 |
Family
ID=35787423
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2007520525A Pending JP2008505920A (ja) | 2004-07-08 | 2005-07-08 | 抗菌剤 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US20070254872A1 (enExample) |
| EP (1) | EP1773831A1 (enExample) |
| JP (1) | JP2008505920A (enExample) |
| WO (1) | WO2006014580A1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2009532423A (ja) * | 2006-04-06 | 2009-09-10 | グラクソ グループ リミテッド | 抗菌剤としてのピロロ−キノキサリノン誘導体 |
| JP2013514331A (ja) * | 2009-12-18 | 2013-04-25 | バジリア ファルマスーチカ アーゲー | 三環式抗生物質 |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7691850B2 (en) * | 2004-06-15 | 2010-04-06 | Glaxo Group Limited | Antibacterial agents |
| EP1845995A4 (en) * | 2005-01-25 | 2010-03-03 | Glaxo Group Ltd | ANTIBACTERIAL AGENTS |
| MY150958A (en) | 2005-06-16 | 2014-03-31 | Astrazeneca Ab | Compounds for the treatment of multi-drug resistant bacterial infections |
| WO2007081597A2 (en) * | 2005-10-21 | 2007-07-19 | Glaxo Group Limited | Peri condensed tricyclic compounds useful as antibacterial agents |
| US8217042B2 (en) | 2005-11-11 | 2012-07-10 | Zentaris Gmbh | Pyridopyrazines and their use as modulators of kinases |
| EP1790342A1 (de) | 2005-11-11 | 2007-05-30 | Zentaris GmbH | Pyridopyrazin-Derivate und deren Verwendung als Modulatoren der Signaltransduktionswege |
| EP2007377A4 (en) | 2006-04-06 | 2011-08-17 | Glaxo Group Ltd | ANTIBACTERIAL ACTIVE SUBSTANCES |
| KR101409261B1 (ko) | 2006-05-26 | 2014-06-18 | 다이쇼 세이야꾸 가부시끼가이샤 | 신규의 복소환 화합물 또는 그 염 및 그 중간체 |
| EP1992628A1 (en) | 2007-05-18 | 2008-11-19 | Glaxo Group Limited | Derivatives and analogs of N-ethylquinolones and N-ethylazaquinolones |
| WO2008044767A1 (en) * | 2006-10-13 | 2008-04-17 | Takeda Pharmaceutical Company Limited | Aromatic amine derivative and use thereof |
| JP5389013B2 (ja) | 2007-04-20 | 2014-01-15 | グラクソ グループ リミテッド | 抗菌剤としての三環式含窒素化合物 |
| EP2080761A1 (en) | 2008-01-18 | 2009-07-22 | Glaxo Group Limited | Compounds |
| CA2720672A1 (en) | 2008-04-15 | 2009-10-22 | Actelion Pharmaceuticals Ltd | Tricyclic antibiotics |
| JP2012505866A (ja) | 2008-10-17 | 2012-03-08 | グラクソ グループ リミテッド | 抗菌剤として使用される三環式窒素化合物 |
| CN102232078B (zh) | 2008-12-12 | 2014-07-16 | 埃科特莱茵药品有限公司 | 5-氨基-2-(1-羟基-乙基)-四氢吡喃衍生物 |
| WO2010081874A1 (en) | 2009-01-15 | 2010-07-22 | Glaxo Group Limited | Naphthyridin-2 (1 h)-one compounds useful as antibacterials |
| WO2010084152A1 (en) | 2009-01-21 | 2010-07-29 | Basilea Pharmaceutica Ag | Novel bicyclic antibiotics |
| CN103635474B (zh) * | 2011-06-17 | 2016-04-27 | 巴斯利尔药物股份公司 | 三环抗生素 |
| AU2015304847B2 (en) | 2014-08-22 | 2018-10-25 | Glaxosmithkline Intellectual Property Development Limited | Tricyclic nitrogen containing compounds for treating Neisseria gonorrhoea infection |
| MA41169A (fr) | 2014-12-17 | 2017-10-24 | Acraf | Composés antibactériens à large spectre d'activité |
| TW201706258A (zh) | 2015-04-17 | 2017-02-16 | 艾伯維有限公司 | 作為tnf信號傳遞調節劑之吲唑酮 |
| UY36851A (es) | 2015-08-16 | 2017-03-31 | Glaxosmithkline Ip Dev Ltd | Compuestos para uso en aplicaciones antibacterianas |
| KR20220087497A (ko) | 2019-10-18 | 2022-06-24 | 더 리전츠 오브 더 유니버시티 오브 캘리포니아 | 병원성 혈관을 표적화하기 위한 화합물 및 방법 |
| JP2025510646A (ja) | 2022-03-14 | 2025-04-15 | スラップ ファーマシューティカルズ エルエルシー | 多環式化合物 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2004035569A2 (de) * | 2002-10-10 | 2004-04-29 | Morphochem Aktiengesellschaft für kombinatorische Chemie | Neue verbindungen mit antibakterieller aktivität |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997017973A1 (en) * | 1995-11-13 | 1997-05-22 | Smithkline Beecham Corporation | Hemoregulatory compounds |
| GB9822440D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| GB9914486D0 (en) * | 1999-06-21 | 1999-08-18 | Smithkline Beecham Plc | Medicaments |
| GB9917406D0 (en) * | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| GB9917408D0 (en) * | 1999-07-23 | 1999-09-22 | Smithkline Beecham Plc | Compounds |
| US6403610B1 (en) * | 1999-09-17 | 2002-06-11 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation and the compositions which comprise them |
| US6803369B1 (en) * | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| DE60125373T2 (de) * | 2000-07-26 | 2007-10-18 | Smithkline Beecham P.L.C., Brentford | Aminopiperidin chinoline und ihre azaisosteren analoga mit antibakterieller wirkung |
| EP1320529B1 (en) * | 2000-09-21 | 2006-05-24 | Smithkline Beecham Plc | Quinoline derivatives as antibacterials |
| US6603005B2 (en) * | 2000-11-15 | 2003-08-05 | Aventis Pharma S.A. | Heterocyclylalkylpiperidine derivatives, their preparation and compositions containing them |
| GB0101577D0 (en) * | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| US6602884B2 (en) * | 2001-03-13 | 2003-08-05 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation, and compositions containing them |
| US20030203917A1 (en) * | 2001-07-25 | 2003-10-30 | Smithkline Beecham Corporation And Smithkline Beecham P.L.C. | Compounds and methods for the treatment of neoplastic disease |
| AU2003239302A1 (en) * | 2002-01-29 | 2003-09-02 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| WO2003064421A1 (en) * | 2002-01-29 | 2003-08-07 | Glaxo Group Limited | Aminopiperidine derivatives |
| AR040336A1 (es) * | 2002-06-26 | 2005-03-30 | Glaxo Group Ltd | Compuesto de piperidina, uso del mismo para la fabricacion de un medicamento, composicion farmaceutica que lo comprende y procedimiento para preparar dicho compuesto |
| FR2844268B1 (fr) * | 2002-09-11 | 2004-10-22 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leurs procedes et intermediaires de preparation et les compositions qui les contiennent |
| FR2844270B1 (fr) * | 2002-09-11 | 2006-05-19 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leur procede et intermediaires de preparation et les compositions qui les contiennent |
| JP4704755B2 (ja) * | 2002-11-05 | 2011-06-22 | グラクソスミスクライン・リミテッド・ライアビリティ・カンパニー | 抗菌剤 |
| JP4654035B2 (ja) * | 2002-11-05 | 2011-03-16 | グラクソスミスクライン・リミテッド・ライアビリティ・カンパニー | 抗菌剤 |
| AU2003294565A1 (en) * | 2002-12-04 | 2004-06-23 | Glaxo Group Limited | Quinolines and nitrogenated derivatives thereof and their use as antibacterial agents |
| AR042486A1 (es) * | 2002-12-18 | 2005-06-22 | Glaxo Group Ltd | Compuesto de quinolina y naftiridina halosustituido en la posicion 3, procedimiento para preparar el compuesto, composicion farmaceutica que lo comprende y su uso para preparar dicha composicion . |
| TW200507841A (en) * | 2003-03-27 | 2005-03-01 | Glaxo Group Ltd | Antibacterial agents |
| US7232833B2 (en) * | 2003-03-28 | 2007-06-19 | Novexel | 4-substituted quinoline derivatives, method and intermediates for their preparation and pharmaceutical compositions containing them |
| DE10316081A1 (de) * | 2003-04-08 | 2004-10-21 | Morphochem AG Aktiengesellschaft für kombinatorische Chemie | Neue Verbindungen mit antibakterieller Aktivität |
| US7348434B2 (en) * | 2003-08-08 | 2008-03-25 | Antony Bigot | 4-substituted quinoline derivatives, method and intermediates for their preparation and pharmaceutical compositions containing them |
-
2005
- 2005-07-08 EP EP05771319A patent/EP1773831A1/en not_active Withdrawn
- 2005-07-08 JP JP2007520525A patent/JP2008505920A/ja active Pending
- 2005-07-08 US US11/570,441 patent/US20070254872A1/en not_active Abandoned
- 2005-07-08 WO PCT/US2005/024221 patent/WO2006014580A1/en not_active Ceased
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2004035569A2 (de) * | 2002-10-10 | 2004-04-29 | Morphochem Aktiengesellschaft für kombinatorische Chemie | Neue verbindungen mit antibakterieller aktivität |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2009532423A (ja) * | 2006-04-06 | 2009-09-10 | グラクソ グループ リミテッド | 抗菌剤としてのピロロ−キノキサリノン誘導体 |
| JP2013514331A (ja) * | 2009-12-18 | 2013-04-25 | バジリア ファルマスーチカ アーゲー | 三環式抗生物質 |
Also Published As
| Publication number | Publication date |
|---|---|
| US20070254872A1 (en) | 2007-11-01 |
| EP1773831A1 (en) | 2007-04-18 |
| WO2006014580A1 (en) | 2006-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2008505920A (ja) | 抗菌剤 | |
| US7618959B2 (en) | Antibacterial agents | |
| US7709496B2 (en) | Antibacterial agents | |
| US7691850B2 (en) | Antibacterial agents | |
| US7648984B2 (en) | Antibacterial agents | |
| JP2006521401A (ja) | 抗菌物質 | |
| JP2009532423A (ja) | 抗菌剤としてのピロロ−キノキサリノン誘導体 | |
| US7605169B2 (en) | Antibacterial agents | |
| US20070161627A1 (en) | Antibacterial agents | |
| US7592334B2 (en) | Antibacterial agents | |
| US7655648B2 (en) | Antibacterial agents | |
| US20080194547A1 (en) | Antibacterial Agents | |
| US7709472B2 (en) | Antibacterial agents | |
| US7648980B2 (en) | Antibacterial agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20080708 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20080708 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20110809 |
|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 20120124 |