JP2006507359A - 心循環器疾患の治療のためのグリコーゲンホスホリラーゼ阻害剤の使用 - Google Patents
心循環器疾患の治療のためのグリコーゲンホスホリラーゼ阻害剤の使用 Download PDFInfo
- Publication number
- JP2006507359A JP2006507359A JP2005501508A JP2005501508A JP2006507359A JP 2006507359 A JP2006507359 A JP 2006507359A JP 2005501508 A JP2005501508 A JP 2005501508A JP 2005501508 A JP2005501508 A JP 2005501508A JP 2006507359 A JP2006507359 A JP 2006507359A
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- phthalic acid
- phenoxy
- hydroxy
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000011282 treatment Methods 0.000 title claims abstract description 38
- 208000024172 Cardiovascular disease Diseases 0.000 title claims abstract description 26
- 239000003112 inhibitor Substances 0.000 title claims description 18
- 102000007390 Glycogen Phosphorylase Human genes 0.000 title description 10
- 108010046163 Glycogen Phosphorylase Proteins 0.000 title description 10
- 238000000034 method Methods 0.000 claims abstract description 156
- -1 hydroxy, mercapto Chemical group 0.000 claims description 137
- 150000001875 compounds Chemical class 0.000 claims description 114
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 97
- 229910052736 halogen Inorganic materials 0.000 claims description 93
- 150000002367 halogens Chemical class 0.000 claims description 92
- 239000001257 hydrogen Substances 0.000 claims description 88
- 229910052739 hydrogen Inorganic materials 0.000 claims description 88
- 150000002431 hydrogen Chemical class 0.000 claims description 58
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 47
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 44
- 125000000217 alkyl group Chemical group 0.000 claims description 43
- 125000001424 substituent group Chemical group 0.000 claims description 43
- 229910052757 nitrogen Inorganic materials 0.000 claims description 36
- 125000003118 aryl group Chemical group 0.000 claims description 35
- 150000003839 salts Chemical class 0.000 claims description 33
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 32
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 29
- 206010003119 arrhythmia Diseases 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 25
- 230000006793 arrhythmia Effects 0.000 claims description 24
- 208000019622 heart disease Diseases 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 21
- 125000001072 heteroaryl group Chemical group 0.000 claims description 21
- 239000002220 antihypertensive agent Substances 0.000 claims description 20
- 229940030600 antihypertensive agent Drugs 0.000 claims description 19
- 150000003536 tetrazoles Chemical class 0.000 claims description 19
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 19
- 206010007558 Cardiac failure chronic Diseases 0.000 claims description 18
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 17
- 239000008194 pharmaceutical composition Substances 0.000 claims description 17
- 229940002612 prodrug Drugs 0.000 claims description 17
- 239000000651 prodrug Substances 0.000 claims description 17
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 16
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 16
- 206010003210 Arteriosclerosis Diseases 0.000 claims description 15
- 208000011775 arteriosclerosis disease Diseases 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000003282 alkyl amino group Chemical group 0.000 claims description 14
- 239000003416 antiarrhythmic agent Substances 0.000 claims description 14
- OQEBIHBLFRADNM-UHFFFAOYSA-N 1,4-dideoxy-1,4-imino-d-ribitol Chemical compound OCC1NCC(O)C1O OQEBIHBLFRADNM-UHFFFAOYSA-N 0.000 claims description 13
- 230000003287 optical effect Effects 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 230000000747 cardiac effect Effects 0.000 claims description 12
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 11
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 11
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 11
- 230000002107 myocardial effect Effects 0.000 claims description 11
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 claims description 11
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 10
- 239000005541 ACE inhibitor Substances 0.000 claims description 10
- 101710129690 Angiotensin-converting enzyme inhibitor Proteins 0.000 claims description 10
- 101710086378 Bradykinin-potentiating and C-type natriuretic peptides Proteins 0.000 claims description 10
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 10
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 claims description 10
- 239000003472 antidiabetic agent Substances 0.000 claims description 10
- 239000002876 beta blocker Substances 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 238000012360 testing method Methods 0.000 claims description 10
- OQEBIHBLFRADNM-UOWFLXDJSA-N (2r,3r,4r)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OC[C@H]1NC[C@@H](O)[C@@H]1O OQEBIHBLFRADNM-UOWFLXDJSA-N 0.000 claims description 9
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 9
- 206010002383 Angina Pectoris Diseases 0.000 claims description 9
- 206010052337 Diastolic dysfunction Diseases 0.000 claims description 9
- 208000007530 Essential hypertension Diseases 0.000 claims description 9
- 206010019280 Heart failures Diseases 0.000 claims description 9
- 206010058179 Hypertensive emergency Diseases 0.000 claims description 9
- 206010022562 Intermittent claudication Diseases 0.000 claims description 9
- 208000007177 Left Ventricular Hypertrophy Diseases 0.000 claims description 9
- 208000021642 Muscular disease Diseases 0.000 claims description 9
- 201000009623 Myopathy Diseases 0.000 claims description 9
- 230000005856 abnormality Effects 0.000 claims description 9
- 230000001154 acute effect Effects 0.000 claims description 9
- 239000000332 adrenergic beta-1 receptor antagonist Substances 0.000 claims description 9
- 229940125708 antidiabetic agent Drugs 0.000 claims description 9
- 208000029078 coronary artery disease Diseases 0.000 claims description 9
- 208000021156 intermittent vascular claudication Diseases 0.000 claims description 9
- 201000005857 malignant hypertension Diseases 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 230000033764 rhythmic process Effects 0.000 claims description 9
- 206010042772 syncope Diseases 0.000 claims description 9
- 206010071436 Systolic dysfunction Diseases 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 150000003949 imides Chemical class 0.000 claims description 7
- 230000000414 obstructive effect Effects 0.000 claims description 7
- 150000003053 piperidines Chemical class 0.000 claims description 7
- METKIMKYRPQLGS-GFCCVEGCSA-N (R)-atenolol Chemical compound CC(C)NC[C@@H](O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-GFCCVEGCSA-N 0.000 claims description 6
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 claims description 6
- 239000002083 C09CA01 - Losartan Substances 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 229960002274 atenolol Drugs 0.000 claims description 6
- 206010012601 diabetes mellitus Diseases 0.000 claims description 6
- 150000002632 lipids Chemical class 0.000 claims description 6
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical group CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 claims description 6
- 229960003105 metformin Drugs 0.000 claims description 6
- 229960002237 metoprolol Drugs 0.000 claims description 6
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 claims description 6
- 229960002508 pindolol Drugs 0.000 claims description 6
- PHUTUTUABXHXLW-UHFFFAOYSA-N pindolol Chemical compound CC(C)NCC(O)COC1=CC=CC2=NC=C[C]12 PHUTUTUABXHXLW-UHFFFAOYSA-N 0.000 claims description 6
- 229960004605 timolol Drugs 0.000 claims description 6
- LTMHDMANZUZIPE-AMTYYWEZSA-N Digoxin Natural products O([C@H]1[C@H](C)O[C@H](O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4[C@H]([C@]5(O)[C@](C)([C@H](O)C4)[C@H](C4=CC(=O)OC4)CC5)CC3)CC2)C[C@@H]1O)[C@H]1O[C@H](C)[C@@H](O[C@H]2O[C@@H](C)[C@H](O)[C@@H](O)C2)[C@@H](O)C1 LTMHDMANZUZIPE-AMTYYWEZSA-N 0.000 claims description 5
- 108010061435 Enalapril Proteins 0.000 claims description 5
- 208000008589 Obesity Diseases 0.000 claims description 5
- 208000001132 Osteoporosis Diseases 0.000 claims description 5
- GOEMGAFJFRBGGG-UHFFFAOYSA-N acebutolol Chemical compound CCCC(=O)NC1=CC=C(OCC(O)CNC(C)C)C(C(C)=O)=C1 GOEMGAFJFRBGGG-UHFFFAOYSA-N 0.000 claims description 5
- 229960002122 acebutolol Drugs 0.000 claims description 5
- 239000002333 angiotensin II receptor antagonist Substances 0.000 claims description 5
- 229940126317 angiotensin II receptor antagonist Drugs 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 230000036772 blood pressure Effects 0.000 claims description 5
- 229960000830 captopril Drugs 0.000 claims description 5
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical group SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- LTMHDMANZUZIPE-PUGKRICDSA-N digoxin Chemical compound C1[C@H](O)[C@H](O)[C@@H](C)O[C@H]1O[C@@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@@H]3C[C@@H]4[C@]([C@@H]5[C@H]([C@]6(CC[C@@H]([C@@]6(C)[C@H](O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)C[C@@H]2O)C)C[C@@H]1O LTMHDMANZUZIPE-PUGKRICDSA-N 0.000 claims description 5
- 229960005156 digoxin Drugs 0.000 claims description 5
- LTMHDMANZUZIPE-UHFFFAOYSA-N digoxine Natural products C1C(O)C(O)C(C)OC1OC1C(C)OC(OC2C(OC(OC3CC4C(C5C(C6(CCC(C6(C)C(O)C5)C=5COC(=O)C=5)O)CC4)(C)CC3)CC2O)C)CC1O LTMHDMANZUZIPE-UHFFFAOYSA-N 0.000 claims description 5
- 229960000873 enalapril Drugs 0.000 claims description 5
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 claims description 5
- AQNDDEOPVVGCPG-UHFFFAOYSA-N esmolol Chemical compound COC(=O)CCC1=CC=C(OCC(O)CNC(C)C)C=C1 AQNDDEOPVVGCPG-UHFFFAOYSA-N 0.000 claims description 5
- 229960003745 esmolol Drugs 0.000 claims description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 5
- 150000002500 ions Chemical group 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- KJJZZJSZUJXYEA-UHFFFAOYSA-N losartan Chemical compound CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C=2[N]N=NN=2)C=C1 KJJZZJSZUJXYEA-UHFFFAOYSA-N 0.000 claims description 5
- 229960004773 losartan Drugs 0.000 claims description 5
- 229960004255 nadolol Drugs 0.000 claims description 5
- VWPOSFSPZNDTMJ-UCWKZMIHSA-N nadolol Chemical compound C1[C@@H](O)[C@@H](O)CC2=C1C=CC=C2OCC(O)CNC(C)(C)C VWPOSFSPZNDTMJ-UCWKZMIHSA-N 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 235000020824 obesity Nutrition 0.000 claims description 5
- 229960003712 propranolol Drugs 0.000 claims description 5
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 5
- 229960001455 quinapril Drugs 0.000 claims description 5
- JSDRRTOADPPCHY-HSQYWUDLSA-N quinapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)CC1=CC=CC=C1 JSDRRTOADPPCHY-HSQYWUDLSA-N 0.000 claims description 5
- 229960003401 ramipril Drugs 0.000 claims description 5
- HDACQVRGBOVJII-JBDAPHQKSA-N ramipril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](C[C@@H]2CCC[C@@H]21)C(O)=O)CC1=CC=CC=C1 HDACQVRGBOVJII-JBDAPHQKSA-N 0.000 claims description 5
- 229960002909 spirapril Drugs 0.000 claims description 5
- 108700035424 spirapril Proteins 0.000 claims description 5
- HRWCVUIFMSZDJS-SZMVWBNQSA-N spirapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2(C1)SCCS2)C(O)=O)CC1=CC=CC=C1 HRWCVUIFMSZDJS-SZMVWBNQSA-N 0.000 claims description 5
- SPYQWYTVWZBEHS-UHFFFAOYSA-N 1-(2-hydroxyethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCCN1CC(O)C(O)C1CO SPYQWYTVWZBEHS-UHFFFAOYSA-N 0.000 claims description 4
- VRYOSYRKUMQQTL-UHFFFAOYSA-N 3-(hydroxymethyl)-5-phenylmethoxypiperidin-4-ol Chemical compound OC1C(CO)CNCC1OCC1=CC=CC=C1 VRYOSYRKUMQQTL-UHFFFAOYSA-N 0.000 claims description 4
- QPYJXFZUIJOGNX-UHFFFAOYSA-N 5-(hydroxymethyl)piperidine-3,4-diol Chemical compound OCC1CNCC(O)C1O QPYJXFZUIJOGNX-UHFFFAOYSA-N 0.000 claims description 4
- WPRCMXASRHJGNG-UHFFFAOYSA-N 5-methylpiperidine-3,4-diol Chemical compound CC1CNCC(O)C1O WPRCMXASRHJGNG-UHFFFAOYSA-N 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 4
- 208000034486 Multi-organ failure Diseases 0.000 claims description 4
- 208000010718 Multiple Organ Failure Diseases 0.000 claims description 4
- QPYJXFZUIJOGNX-HSUXUTPPSA-N afegostat Chemical compound OC[C@H]1CNC[C@@H](O)[C@@H]1O QPYJXFZUIJOGNX-HSUXUTPPSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 208000029744 multiple organ dysfunction syndrome Diseases 0.000 claims description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims description 4
- OPFNZHIUHJBGEW-UHFFFAOYSA-N 1-hydroxyimidazole Chemical compound ON1C=CN=C1 OPFNZHIUHJBGEW-UHFFFAOYSA-N 0.000 claims description 3
- BSNCOPOPGMQUNL-UHFFFAOYSA-N 1-hydroxytetrazole Chemical compound ON1C=NN=N1 BSNCOPOPGMQUNL-UHFFFAOYSA-N 0.000 claims description 3
- GUYVHXUTASLLDR-UHFFFAOYSA-N 2-hydroxytriazole Chemical compound ON1N=CC=N1 GUYVHXUTASLLDR-UHFFFAOYSA-N 0.000 claims description 3
- NAQUAVBNIYTIIS-UHFFFAOYSA-N 4-{2-[(3-nitrobenzoyl)amino]phenoxy}phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 NAQUAVBNIYTIIS-UHFFFAOYSA-N 0.000 claims description 3
- 101100240526 Caenorhabditis elegans nhr-20 gene Proteins 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 230000035899 viability Effects 0.000 claims description 3
- RNSKZOAZKGPNNU-BWZBUEFSSA-N (2r,3r,4r)-1-(1,3-dihydroxypropan-2-yl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC(CO)N1C[C@@H](O)[C@H](O)[C@H]1CO RNSKZOAZKGPNNU-BWZBUEFSSA-N 0.000 claims description 2
- FAACDRZBXLTQDQ-UIYHXYAWSA-N (2r,3r,4r)-1-(2,3-dihydroxypropyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC(O)CN1C[C@@H](O)[C@H](O)[C@H]1CO FAACDRZBXLTQDQ-UIYHXYAWSA-N 0.000 claims description 2
- UHFWEDDFLFAJHG-FSDSQADBSA-N (2r,3r,4r)-1-(2-aminoethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound NCCN1C[C@@H](O)[C@H](O)[C@H]1CO UHFWEDDFLFAJHG-FSDSQADBSA-N 0.000 claims description 2
- SPYQWYTVWZBEHS-FSDSQADBSA-N (2r,3r,4r)-1-(2-hydroxyethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCCN1C[C@@H](O)[C@H](O)[C@H]1CO SPYQWYTVWZBEHS-FSDSQADBSA-N 0.000 claims description 2
- SPPKZKQXTFBLLK-IWSPIJDZSA-N (2r,3r,4r)-1-(cyclopropylmethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OC[C@@H]1[C@@H](O)[C@H](O)CN1CC1CC1 SPPKZKQXTFBLLK-IWSPIJDZSA-N 0.000 claims description 2
- SBDAWMSBMQBJRA-IJLUTSLNSA-N (2r,3r,4r)-1-benzyl-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OC[C@@H]1[C@@H](O)[C@H](O)CN1CC1=CC=CC=C1 SBDAWMSBMQBJRA-IJLUTSLNSA-N 0.000 claims description 2
- AORXTDSJOOFVRB-IWSPIJDZSA-N (2r,3r,4r)-1-butyl-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound CCCCN1C[C@@H](O)[C@H](O)[C@H]1CO AORXTDSJOOFVRB-IWSPIJDZSA-N 0.000 claims description 2
- ITBZTMURQMEUAL-HSUXUTPPSA-N (2r,3r,4r)-2-(hydroxymethyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3,4-diol Chemical compound OC[C@@H]1[C@@H](O)[C@H](O)CN1CC(F)(F)F ITBZTMURQMEUAL-HSUXUTPPSA-N 0.000 claims description 2
- UBVOJPDDTVFNFJ-HSUXUTPPSA-N (2r,3r,4r)-2-(hydroxymethyl)-1-methylpyrrolidine-3,4-diol Chemical compound CN1C[C@@H](O)[C@H](O)[C@H]1CO UBVOJPDDTVFNFJ-HSUXUTPPSA-N 0.000 claims description 2
- PXKLZLSYHLZPMK-BWZBUEFSSA-N (2r,3r,4r)-2-(hydroxymethyl)-1-propylpyrrolidine-3,4-diol Chemical compound CCCN1C[C@@H](O)[C@H](O)[C@H]1CO PXKLZLSYHLZPMK-BWZBUEFSSA-N 0.000 claims description 2
- RNSKZOAZKGPNNU-FXQIFTODSA-N (2s,3s,4s)-1-(1,3-dihydroxypropan-2-yl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC(CO)N1C[C@H](O)[C@@H](O)[C@@H]1CO RNSKZOAZKGPNNU-FXQIFTODSA-N 0.000 claims description 2
- FAACDRZBXLTQDQ-DWQAGKKUSA-N (2s,3s,4s)-1-(2,3-dihydroxypropyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC(O)CN1C[C@H](O)[C@@H](O)[C@@H]1CO FAACDRZBXLTQDQ-DWQAGKKUSA-N 0.000 claims description 2
- UHFWEDDFLFAJHG-ACZMJKKPSA-N (2s,3s,4s)-1-(2-aminoethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound NCCN1C[C@H](O)[C@@H](O)[C@@H]1CO UHFWEDDFLFAJHG-ACZMJKKPSA-N 0.000 claims description 2
- SPYQWYTVWZBEHS-ACZMJKKPSA-N (2s,3s,4s)-1-(2-hydroxyethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCCN1C[C@H](O)[C@@H](O)[C@@H]1CO SPYQWYTVWZBEHS-ACZMJKKPSA-N 0.000 claims description 2
- SPPKZKQXTFBLLK-CIUDSAMLSA-N (2s,3s,4s)-1-(cyclopropylmethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OC[C@H]1[C@H](O)[C@@H](O)CN1CC1CC1 SPPKZKQXTFBLLK-CIUDSAMLSA-N 0.000 claims description 2
- SBDAWMSBMQBJRA-SRVKXCTJSA-N (2s,3s,4s)-1-benzyl-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OC[C@H]1[C@H](O)[C@@H](O)CN1CC1=CC=CC=C1 SBDAWMSBMQBJRA-SRVKXCTJSA-N 0.000 claims description 2
- AORXTDSJOOFVRB-CIUDSAMLSA-N (2s,3s,4s)-1-butyl-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound CCCCN1C[C@H](O)[C@@H](O)[C@@H]1CO AORXTDSJOOFVRB-CIUDSAMLSA-N 0.000 claims description 2
- ITBZTMURQMEUAL-ZLUOBGJFSA-N (2s,3s,4s)-2-(hydroxymethyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3,4-diol Chemical compound OC[C@H]1[C@H](O)[C@@H](O)CN1CC(F)(F)F ITBZTMURQMEUAL-ZLUOBGJFSA-N 0.000 claims description 2
- UBVOJPDDTVFNFJ-ZLUOBGJFSA-N (2s,3s,4s)-2-(hydroxymethyl)-1-methylpyrrolidine-3,4-diol Chemical compound CN1C[C@H](O)[C@@H](O)[C@@H]1CO UBVOJPDDTVFNFJ-ZLUOBGJFSA-N 0.000 claims description 2
- PXKLZLSYHLZPMK-FXQIFTODSA-N (2s,3s,4s)-2-(hydroxymethyl)-1-propylpyrrolidine-3,4-diol Chemical compound CCCN1C[C@H](O)[C@@H](O)[C@@H]1CO PXKLZLSYHLZPMK-FXQIFTODSA-N 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- RNSKZOAZKGPNNU-UHFFFAOYSA-N 1-(1,3-dihydroxypropan-2-yl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC(CO)N1CC(O)C(O)C1CO RNSKZOAZKGPNNU-UHFFFAOYSA-N 0.000 claims description 2
- FAACDRZBXLTQDQ-UHFFFAOYSA-N 1-(2,3-dihydroxypropyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC(O)CN1CC(O)C(O)C1CO FAACDRZBXLTQDQ-UHFFFAOYSA-N 0.000 claims description 2
- UHFWEDDFLFAJHG-UHFFFAOYSA-N 1-(2-aminoethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound NCCN1CC(O)C(O)C1CO UHFWEDDFLFAJHG-UHFFFAOYSA-N 0.000 claims description 2
- SPPKZKQXTFBLLK-UHFFFAOYSA-N 1-(cyclopropylmethyl)-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC1C(O)C(O)CN1CC1CC1 SPPKZKQXTFBLLK-UHFFFAOYSA-N 0.000 claims description 2
- SBDAWMSBMQBJRA-UHFFFAOYSA-N 1-benzyl-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound OCC1C(O)C(O)CN1CC1=CC=CC=C1 SBDAWMSBMQBJRA-UHFFFAOYSA-N 0.000 claims description 2
- AORXTDSJOOFVRB-UHFFFAOYSA-N 1-butyl-2-(hydroxymethyl)pyrrolidine-3,4-diol Chemical compound CCCCN1CC(O)C(O)C1CO AORXTDSJOOFVRB-UHFFFAOYSA-N 0.000 claims description 2
- ITBZTMURQMEUAL-UHFFFAOYSA-N 2-(hydroxymethyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3,4-diol Chemical compound OCC1C(O)C(O)CN1CC(F)(F)F ITBZTMURQMEUAL-UHFFFAOYSA-N 0.000 claims description 2
- PXKLZLSYHLZPMK-UHFFFAOYSA-N 2-(hydroxymethyl)-1-propylpyrrolidine-3,4-diol Chemical compound CCCN1CC(O)C(O)C1CO PXKLZLSYHLZPMK-UHFFFAOYSA-N 0.000 claims description 2
- OQEBIHBLFRADNM-YUPRTTJUSA-N 2-hydroxymethyl-pyrrolidine-3,4-diol Chemical compound OC[C@@H]1NC[C@H](O)[C@H]1O OQEBIHBLFRADNM-YUPRTTJUSA-N 0.000 claims description 2
- FQOGWNRPPJMSEC-UHFFFAOYSA-N 3-(hydroxymethyl)piperidin-4-ol Chemical compound OCC1CNCCC1O FQOGWNRPPJMSEC-UHFFFAOYSA-N 0.000 claims description 2
- ITQKQYKCQXTDMI-UHFFFAOYSA-N 3-chloro-5-(hydroxymethyl)piperidin-4-ol Chemical compound OCC1CNCC(Cl)C1O ITQKQYKCQXTDMI-UHFFFAOYSA-N 0.000 claims description 2
- DQKZUKLPJVJMSG-UHFFFAOYSA-N 3-fluoro-5-(hydroxymethyl)piperidin-4-ol Chemical compound OCC1CNCC(F)C1O DQKZUKLPJVJMSG-UHFFFAOYSA-N 0.000 claims description 2
- DGBUIVDAWBSYNN-UHFFFAOYSA-N 4-(2-benzamidophenoxy)phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC=C1 DGBUIVDAWBSYNN-UHFFFAOYSA-N 0.000 claims description 2
- VVKGQPDUARVBOZ-UHFFFAOYSA-N 4-[2-[(2,3-difluorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(F)=C1F VVKGQPDUARVBOZ-UHFFFAOYSA-N 0.000 claims description 2
- APZUXEBITGMEIB-UHFFFAOYSA-N 4-[2-[(2,4-difluorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=C(F)C=C1F APZUXEBITGMEIB-UHFFFAOYSA-N 0.000 claims description 2
- VQCMQIGHKZWSLI-UHFFFAOYSA-N 4-[2-[(2,5-difluorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC(F)=CC=C1F VQCMQIGHKZWSLI-UHFFFAOYSA-N 0.000 claims description 2
- SFCOKTHIBWHMTI-UHFFFAOYSA-N 4-[2-[(2-fluorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC=C1F SFCOKTHIBWHMTI-UHFFFAOYSA-N 0.000 claims description 2
- FLLFGDHYICFTTN-UHFFFAOYSA-N 4-[2-[(3-acetylbenzoyl)amino]phenoxy]phthalic acid Chemical compound CC(=O)C1=CC=CC(C(=O)NC=2C(=CC=CC=2)OC=2C=C(C(C(O)=O)=CC=2)C(O)=O)=C1 FLLFGDHYICFTTN-UHFFFAOYSA-N 0.000 claims description 2
- ALCRXWIBODOCNW-UHFFFAOYSA-N 4-[2-[(3-aminobenzoyl)amino]phenoxy]phthalic acid Chemical compound NC1=CC=CC(C(=O)NC=2C(=CC=CC=2)OC=2C=C(C(C(O)=O)=CC=2)C(O)=O)=C1 ALCRXWIBODOCNW-UHFFFAOYSA-N 0.000 claims description 2
- AFPDZCFEHVEMNS-UHFFFAOYSA-N 4-[2-[(3-bromobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(Br)=C1 AFPDZCFEHVEMNS-UHFFFAOYSA-N 0.000 claims description 2
- VCBSWJNDIGSNCL-UHFFFAOYSA-N 4-[2-[(3-chlorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(Cl)=C1 VCBSWJNDIGSNCL-UHFFFAOYSA-N 0.000 claims description 2
- QNTGQOUVJGQXDE-UHFFFAOYSA-N 4-[2-[(3-cyanobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(C#N)=C1 QNTGQOUVJGQXDE-UHFFFAOYSA-N 0.000 claims description 2
- VVYJNJOVJLDUQN-UHFFFAOYSA-N 4-[2-[(3-fluorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(F)=C1 VVYJNJOVJLDUQN-UHFFFAOYSA-N 0.000 claims description 2
- ZKMKGWKWZJBKKI-UHFFFAOYSA-N 4-[2-[(3-iodobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(I)=C1 ZKMKGWKWZJBKKI-UHFFFAOYSA-N 0.000 claims description 2
- VNUIPDGLBJFCJN-UHFFFAOYSA-N 4-[2-[(3-methoxybenzoyl)amino]phenoxy]phthalic acid Chemical compound COC1=CC=CC(C(=O)NC=2C(=CC=CC=2)OC=2C=C(C(C(O)=O)=CC=2)C(O)=O)=C1 VNUIPDGLBJFCJN-UHFFFAOYSA-N 0.000 claims description 2
- JVOSSUPMKPAEMQ-UHFFFAOYSA-N 4-[2-[(3-methylbenzoyl)amino]phenoxy]phthalic acid Chemical compound CC1=CC=CC(C(=O)NC=2C(=CC=CC=2)OC=2C=C(C(C(O)=O)=CC=2)C(O)=O)=C1 JVOSSUPMKPAEMQ-UHFFFAOYSA-N 0.000 claims description 2
- QTYNBBFOPMKRDO-UHFFFAOYSA-N 4-[2-[(3-nitrobenzoyl)amino]-4-(trifluoromethyl)phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 QTYNBBFOPMKRDO-UHFFFAOYSA-N 0.000 claims description 2
- XLLFYCMEMKJYQC-UHFFFAOYSA-N 4-[2-[(3-nitrobenzoyl)amino]phenyl]sulfanylphthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1SC1=CC=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 XLLFYCMEMKJYQC-UHFFFAOYSA-N 0.000 claims description 2
- MUKOHJFPFAAHLV-UHFFFAOYSA-N 4-[2-[(3-nitrophenyl)methylamino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NCC1=CC=CC([N+]([O-])=O)=C1 MUKOHJFPFAAHLV-UHFFFAOYSA-N 0.000 claims description 2
- HRNDZVZGISDBSH-UHFFFAOYSA-N 4-[2-[(4-fluorobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=C(F)C=C1 HRNDZVZGISDBSH-UHFFFAOYSA-N 0.000 claims description 2
- KNIRYHSJMHOIJZ-UHFFFAOYSA-N 4-[2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC(C(F)(F)F)=CC=C1F KNIRYHSJMHOIJZ-UHFFFAOYSA-N 0.000 claims description 2
- PVEZUVRSEDFBED-UHFFFAOYSA-N 4-[2-[[3-(dimethylamino)benzoyl]amino]phenoxy]phthalic acid Chemical compound CN(C)C1=CC=CC(C(=O)NC=2C(=CC=CC=2)OC=2C=C(C(C(O)=O)=CC=2)C(O)=O)=C1 PVEZUVRSEDFBED-UHFFFAOYSA-N 0.000 claims description 2
- BLFABBPOEGGGBW-UHFFFAOYSA-N 4-[2-[[3-(trifluoromethoxy)benzoyl]amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(OC(F)(F)F)=C1 BLFABBPOEGGGBW-UHFFFAOYSA-N 0.000 claims description 2
- AFJVJGBEGXWQNS-UHFFFAOYSA-N 4-[2-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(C(F)(F)F)=C1 AFJVJGBEGXWQNS-UHFFFAOYSA-N 0.000 claims description 2
- MKQSGNJOMQDZCH-UHFFFAOYSA-N 4-[4-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 MKQSGNJOMQDZCH-UHFFFAOYSA-N 0.000 claims description 2
- BWWJUWJMTJBQPN-UHFFFAOYSA-N 4-[4-[(4-iodobenzoyl)amino]-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC(C(=C1)NC(=O)C=2C=C(C=CC=2)[N+]([O-])=O)=CC=C1NC(=O)C1=CC=C(I)C=C1 BWWJUWJMTJBQPN-UHFFFAOYSA-N 0.000 claims description 2
- UREVCBHMCDVYLI-UHFFFAOYSA-N 4-[4-acetamido-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C=1C=CC([N+]([O-])=O)=CC=1C(=O)NC1=CC(NC(=O)C)=CC=C1OC1=CC=C(C(O)=O)C(C(O)=O)=C1 UREVCBHMCDVYLI-UHFFFAOYSA-N 0.000 claims description 2
- GJXZFZQTSAOZSF-UHFFFAOYSA-N 4-[4-amino-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C=1C=CC([N+]([O-])=O)=CC=1C(=O)NC1=CC(N)=CC=C1OC1=CC=C(C(O)=O)C(C(O)=O)=C1 GJXZFZQTSAOZSF-UHFFFAOYSA-N 0.000 claims description 2
- UITDURQSKACGOI-UHFFFAOYSA-N 4-[4-benzamido-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC(C(=C1)NC(=O)C=2C=C(C=CC=2)[N+]([O-])=O)=CC=C1NC(=O)C1=CC=CC=C1 UITDURQSKACGOI-UHFFFAOYSA-N 0.000 claims description 2
- OAZBMVAPRVXFSM-UHFFFAOYSA-N 4-[4-bromo-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=C(Br)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 OAZBMVAPRVXFSM-UHFFFAOYSA-N 0.000 claims description 2
- JNEHUYVPZOKWNK-UHFFFAOYSA-N 4-[4-cyano-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=C(C#N)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 JNEHUYVPZOKWNK-UHFFFAOYSA-N 0.000 claims description 2
- SXQSXGKQUDBDKG-UHFFFAOYSA-N 4-[4-fluoro-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC=C(F)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 SXQSXGKQUDBDKG-UHFFFAOYSA-N 0.000 claims description 2
- VIXZBRNAXCGCCC-UHFFFAOYSA-N 4-[4-methoxycarbonyl-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C=1C=CC([N+]([O-])=O)=CC=1C(=O)NC1=CC(C(=O)OC)=CC=C1OC1=CC=C(C(O)=O)C(C(O)=O)=C1 VIXZBRNAXCGCCC-UHFFFAOYSA-N 0.000 claims description 2
- JSWGGLZASDOWGM-UHFFFAOYSA-N 4-[4-methyl-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C=1C=CC([N+]([O-])=O)=CC=1C(=O)NC1=CC(C)=CC=C1OC1=CC=C(C(O)=O)C(C(O)=O)=C1 JSWGGLZASDOWGM-UHFFFAOYSA-N 0.000 claims description 2
- IVZCUPXQGWYXRH-UHFFFAOYSA-N 4-[5-fluoro-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC1=CC(F)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 IVZCUPXQGWYXRH-UHFFFAOYSA-N 0.000 claims description 2
- AJYMAGBHSPVRBG-UHFFFAOYSA-N 4-[5-methyl-2-[(3-nitrobenzoyl)amino]phenoxy]phthalic acid Chemical compound C=1C=C(C(O)=O)C(C(O)=O)=CC=1OC1=CC(C)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 AJYMAGBHSPVRBG-UHFFFAOYSA-N 0.000 claims description 2
- MCMVVHHPHOTFDO-UHFFFAOYSA-N 4-chloro-5-(hydroxymethyl)piperidin-3-ol Chemical compound OCC1CNCC(O)C1Cl MCMVVHHPHOTFDO-UHFFFAOYSA-N 0.000 claims description 2
- AMRGLJFRLTZTMG-UHFFFAOYSA-N 4-fluoro-5-(hydroxymethyl)piperidin-3-ol Chemical compound OCC1CNCC(O)C1F AMRGLJFRLTZTMG-UHFFFAOYSA-N 0.000 claims description 2
- VFYAZSTYKPFSFL-UHFFFAOYSA-N 4-{2,4-bis[(3-nitrobenzoyl)amino]phenoxy}phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1OC(C(=C1)NC(=O)C=2C=C(C=CC=2)[N+]([O-])=O)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 VFYAZSTYKPFSFL-UHFFFAOYSA-N 0.000 claims description 2
- MMWSFXGSQAOMQI-UHFFFAOYSA-N 5-(2-hydroxyethyl)piperidine-3,4-diol Chemical compound OCCC1CNCC(O)C1O MMWSFXGSQAOMQI-UHFFFAOYSA-N 0.000 claims description 2
- KTXBXDGOZMHNIC-UHFFFAOYSA-N 5-(chloromethyl)piperidine-3,4-diol Chemical compound OC1CNCC(CCl)C1O KTXBXDGOZMHNIC-UHFFFAOYSA-N 0.000 claims description 2
- BEQPGACEJJJLEA-UHFFFAOYSA-N 5-(fluoromethyl)piperidine-3,4-diol Chemical compound OC1CNCC(CF)C1O BEQPGACEJJJLEA-UHFFFAOYSA-N 0.000 claims description 2
- WIWXVOPKTGFUMA-UHFFFAOYSA-M 5-(hydroxymethyl)-1,1-dimethylpiperidin-1-ium-3,4-diol;chloride Chemical compound [Cl-].C[N+]1(C)CC(O)C(O)C(CO)C1 WIWXVOPKTGFUMA-UHFFFAOYSA-M 0.000 claims description 2
- CYCTZRRPYHKVQQ-UHFFFAOYSA-N 5-(hydroxymethyl)-1-methylpiperidine-3,4-diol Chemical compound CN1CC(O)C(O)C(CO)C1 CYCTZRRPYHKVQQ-UHFFFAOYSA-N 0.000 claims description 2
- XCPUOKRBVCHXNS-UHFFFAOYSA-N 5-(hydroxymethyl)piperidin-3-ol Chemical compound OCC1CNCC(O)C1 XCPUOKRBVCHXNS-UHFFFAOYSA-N 0.000 claims description 2
- UIALTIIMHGHQRO-UHFFFAOYSA-N 5-ethylpiperidine-3,4-diol Chemical compound CCC1CNCC(O)C1O UIALTIIMHGHQRO-UHFFFAOYSA-N 0.000 claims description 2
- SOWLFRYBIBVUNW-UHFFFAOYSA-N 5-phenylpiperidine-3,4-diol Chemical compound OC1C(O)CNCC1C1=CC=CC=C1 SOWLFRYBIBVUNW-UHFFFAOYSA-N 0.000 claims description 2
- XVRLSSYAFOIBQU-UHFFFAOYSA-N 5-propan-2-ylpiperidine-3,4-diol Chemical compound CC(C)C1CNCC(O)C1O XVRLSSYAFOIBQU-UHFFFAOYSA-N 0.000 claims description 2
- KDHNIDSJJULIGE-UHFFFAOYSA-N 5-propylpiperidine-3,4-diol Chemical compound CCCC1CNCC(O)C1O KDHNIDSJJULIGE-UHFFFAOYSA-N 0.000 claims description 2
- ICJDWETZEPFXIX-KEWYIRBNSA-N CC[C@H]1OC(OC)[C@H](O)[C@@H](O)[C@@H]1O Chemical compound CC[C@H]1OC(OC)[C@H](O)[C@@H](O)[C@@H]1O ICJDWETZEPFXIX-KEWYIRBNSA-N 0.000 claims description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 2
- FCXGEEJWNLHSQW-UHFFFAOYSA-N dimethyl 4-(2-benzamidophenoxy)benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC=C1 FCXGEEJWNLHSQW-UHFFFAOYSA-N 0.000 claims description 2
- FZDIOJAQYNNMDD-UHFFFAOYSA-N dimethyl 4-[2,4-bis[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC(C(=C1)NC(=O)C=2C=C(C=CC=2)[N+]([O-])=O)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 FZDIOJAQYNNMDD-UHFFFAOYSA-N 0.000 claims description 2
- MUAOHNWPBPJTCX-UHFFFAOYSA-N dimethyl 4-[2-[(2,3-difluorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(F)=C1F MUAOHNWPBPJTCX-UHFFFAOYSA-N 0.000 claims description 2
- ZFDCKWGKMGHAHU-UHFFFAOYSA-N dimethyl 4-[2-[(2,4-difluorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=C(F)C=C1F ZFDCKWGKMGHAHU-UHFFFAOYSA-N 0.000 claims description 2
- OVOVTEJWEVOJQA-UHFFFAOYSA-N dimethyl 4-[2-[(2,5-difluorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC(F)=CC=C1F OVOVTEJWEVOJQA-UHFFFAOYSA-N 0.000 claims description 2
- FOEMSVVLOJVPQA-UHFFFAOYSA-N dimethyl 4-[2-[(2-fluorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC=C1F FOEMSVVLOJVPQA-UHFFFAOYSA-N 0.000 claims description 2
- OVDUANNCKBGWQN-UHFFFAOYSA-N dimethyl 4-[2-[(3-acetylbenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(C(C)=O)=C1 OVDUANNCKBGWQN-UHFFFAOYSA-N 0.000 claims description 2
- OTGHWRBMKUJNAF-UHFFFAOYSA-N dimethyl 4-[2-[(3-aminobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(N)=C1 OTGHWRBMKUJNAF-UHFFFAOYSA-N 0.000 claims description 2
- NFPQLJCRDAFOPP-UHFFFAOYSA-N dimethyl 4-[2-[(3-bromobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(Br)=C1 NFPQLJCRDAFOPP-UHFFFAOYSA-N 0.000 claims description 2
- XHUSLRFPEVSIEL-UHFFFAOYSA-N dimethyl 4-[2-[(3-chlorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(Cl)=C1 XHUSLRFPEVSIEL-UHFFFAOYSA-N 0.000 claims description 2
- LUTZRRDKNFEVNC-UHFFFAOYSA-N dimethyl 4-[2-[(3-cyanobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(C#N)=C1 LUTZRRDKNFEVNC-UHFFFAOYSA-N 0.000 claims description 2
- OAGAGQMSBFGEFP-UHFFFAOYSA-N dimethyl 4-[2-[(3-fluorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(F)=C1 OAGAGQMSBFGEFP-UHFFFAOYSA-N 0.000 claims description 2
- HGPRLIXTWNNYIJ-UHFFFAOYSA-N dimethyl 4-[2-[(3-iodobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(I)=C1 HGPRLIXTWNNYIJ-UHFFFAOYSA-N 0.000 claims description 2
- VDJVSUZCSFQEGQ-UHFFFAOYSA-N dimethyl 4-[2-[(3-methoxybenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(OC)=C1 VDJVSUZCSFQEGQ-UHFFFAOYSA-N 0.000 claims description 2
- FAAVFFSKXPNVLV-UHFFFAOYSA-N dimethyl 4-[2-[(3-methylbenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(C)=C1 FAAVFFSKXPNVLV-UHFFFAOYSA-N 0.000 claims description 2
- LAHFMWBSDGASDT-UHFFFAOYSA-N dimethyl 4-[2-[(3-nitrobenzoyl)amino]-4-(trifluoromethyl)phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(C(F)(F)F)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 LAHFMWBSDGASDT-UHFFFAOYSA-N 0.000 claims description 2
- DLQVQMNIWMDHGG-UHFFFAOYSA-N dimethyl 4-[2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 DLQVQMNIWMDHGG-UHFFFAOYSA-N 0.000 claims description 2
- HREOUTRZTDTJJP-UHFFFAOYSA-N dimethyl 4-[2-[(3-nitrobenzoyl)amino]phenyl]sulfanylbenzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1SC1=CC=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 HREOUTRZTDTJJP-UHFFFAOYSA-N 0.000 claims description 2
- KEFVWPZJUVQJGV-UHFFFAOYSA-N dimethyl 4-[2-[(3-nitrophenyl)methylamino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NCC1=CC=CC([N+]([O-])=O)=C1 KEFVWPZJUVQJGV-UHFFFAOYSA-N 0.000 claims description 2
- HECYLQJHWLPCDV-UHFFFAOYSA-N dimethyl 4-[2-[(4-fluorobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=C(F)C=C1 HECYLQJHWLPCDV-UHFFFAOYSA-N 0.000 claims description 2
- VZGXLJPNZBFBHI-UHFFFAOYSA-N dimethyl 4-[2-[[2-fluoro-5-(trifluoromethyl)benzoyl]amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC(C(F)(F)F)=CC=C1F VZGXLJPNZBFBHI-UHFFFAOYSA-N 0.000 claims description 2
- VGYNLWKLCXBTRB-UHFFFAOYSA-N dimethyl 4-[2-[[3-(dimethylamino)benzoyl]amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(N(C)C)=C1 VGYNLWKLCXBTRB-UHFFFAOYSA-N 0.000 claims description 2
- QXNJPFNSYHOOAG-UHFFFAOYSA-N dimethyl 4-[2-[[3-(trifluoromethoxy)benzoyl]amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(OC(F)(F)F)=C1 QXNJPFNSYHOOAG-UHFFFAOYSA-N 0.000 claims description 2
- MKADAAWCNLMZLG-UHFFFAOYSA-N dimethyl 4-[2-[[3-(trifluoromethyl)benzoyl]amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=CC=C1NC(=O)C1=CC=CC(C(F)(F)F)=C1 MKADAAWCNLMZLG-UHFFFAOYSA-N 0.000 claims description 2
- IAKJTGDECMFKEH-UHFFFAOYSA-N dimethyl 4-[4-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC(C=C1)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 IAKJTGDECMFKEH-UHFFFAOYSA-N 0.000 claims description 2
- CZSORXIJJWKPQI-UHFFFAOYSA-N dimethyl 4-[4-[(4-iodobenzoyl)amino]-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC(C(=C1)NC(=O)C=2C=C(C=CC=2)[N+]([O-])=O)=CC=C1NC(=O)C1=CC=C(I)C=C1 CZSORXIJJWKPQI-UHFFFAOYSA-N 0.000 claims description 2
- OIJGUEADSJUHBK-UHFFFAOYSA-N dimethyl 4-[4-acetamido-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(NC(C)=O)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 OIJGUEADSJUHBK-UHFFFAOYSA-N 0.000 claims description 2
- GGUCVQBQCNBCRS-UHFFFAOYSA-N dimethyl 4-[4-amino-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(N)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 GGUCVQBQCNBCRS-UHFFFAOYSA-N 0.000 claims description 2
- AVVMNJOGOKZHEH-UHFFFAOYSA-N dimethyl 4-[4-bromo-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(Br)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 AVVMNJOGOKZHEH-UHFFFAOYSA-N 0.000 claims description 2
- OHLYWEPWAJOTLG-UHFFFAOYSA-N dimethyl 4-[4-cyano-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(C#N)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 OHLYWEPWAJOTLG-UHFFFAOYSA-N 0.000 claims description 2
- DVJNBBPZGGEJSL-UHFFFAOYSA-N dimethyl 4-[4-fluoro-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(F)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 DVJNBBPZGGEJSL-UHFFFAOYSA-N 0.000 claims description 2
- FQZNZYWDGGARJQ-UHFFFAOYSA-N dimethyl 4-[4-methoxycarbonyl-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C=1C=CC([N+]([O-])=O)=CC=1C(=O)NC1=CC(C(=O)OC)=CC=C1OC1=CC=C(C(=O)OC)C(C(=O)OC)=C1 FQZNZYWDGGARJQ-UHFFFAOYSA-N 0.000 claims description 2
- SAEILBIRVJGPMV-UHFFFAOYSA-N dimethyl 4-[4-methyl-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC=C(C)C=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 SAEILBIRVJGPMV-UHFFFAOYSA-N 0.000 claims description 2
- SRSWXBBLIUZNMY-UHFFFAOYSA-N dimethyl 4-[5-fluoro-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC(F)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 SRSWXBBLIUZNMY-UHFFFAOYSA-N 0.000 claims description 2
- XOTWJIRZYGLPLG-UHFFFAOYSA-N dimethyl 4-[5-methyl-2-[(3-nitrobenzoyl)amino]phenoxy]benzene-1,2-dicarboxylate Chemical compound C1=C(C(=O)OC)C(C(=O)OC)=CC=C1OC1=CC(C)=CC=C1NC(=O)C1=CC=CC([N+]([O-])=O)=C1 XOTWJIRZYGLPLG-UHFFFAOYSA-N 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- IVHLSEUCKYUWLB-UHFFFAOYSA-N n-[2-(1,3-dioxoisoindol-5-yl)oxyphenyl]-3-nitrobenzamide Chemical compound [O-][N+](=O)C1=CC=CC(C(=O)NC=2C(=CC=CC=2)OC=2C=C3C(=O)NC(=O)C3=CC=2)=C1 IVHLSEUCKYUWLB-UHFFFAOYSA-N 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004950 trifluoroalkyl group Chemical group 0.000 claims description 2
- 125000001483 monosaccharide substituent group Chemical group 0.000 claims 6
- 208000020446 Cardiac disease Diseases 0.000 claims 3
- 208000034189 Sclerosis Diseases 0.000 claims 3
- 210000001367 artery Anatomy 0.000 claims 3
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 claims 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 2
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 claims 1
- 239000000674 adrenergic antagonist Substances 0.000 claims 1
- 229940127088 antihypertensive drug Drugs 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- 230000004083 survival effect Effects 0.000 claims 1
- ROJNYKZWTOHRNU-UHFFFAOYSA-N 2-chloro-4,5-difluoro-n-[[2-methoxy-5-(methylcarbamoylamino)phenyl]carbamoyl]benzamide Chemical compound CNC(=O)NC1=CC=C(OC)C(NC(=O)NC(=O)C=2C(=CC(F)=C(F)C=2)Cl)=C1 ROJNYKZWTOHRNU-UHFFFAOYSA-N 0.000 abstract description 9
- 230000002526 effect on cardiovascular system Effects 0.000 abstract description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 17
- 239000000556 agonist Substances 0.000 description 14
- 201000010099 disease Diseases 0.000 description 12
- 239000003814 drug Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 208000028867 ischemia Diseases 0.000 description 10
- 239000000546 pharmaceutical excipient Substances 0.000 description 10
- 239000002253 acid Substances 0.000 description 9
- 239000007788 liquid Substances 0.000 description 8
- 229920002527 Glycogen Polymers 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 239000003085 diluting agent Substances 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 229940096919 glycogen Drugs 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- 241000283973 Oryctolagus cuniculus Species 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 239000005557 antagonist Substances 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 208000024891 symptom Diseases 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 239000003937 drug carrier Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 239000000796 flavoring agent Substances 0.000 description 5
- 239000008103 glucose Substances 0.000 description 5
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000003765 sweetening agent Substances 0.000 description 5
- 230000000699 topical effect Effects 0.000 description 5
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 4
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 4
- 244000215068 Acacia senegal Species 0.000 description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- 229920000084 Gum arabic Polymers 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 206010061216 Infarction Diseases 0.000 description 4
- 102000007399 Nuclear hormone receptor Human genes 0.000 description 4
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 4
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 description 4
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 description 4
- 102000034527 Retinoid X Receptors Human genes 0.000 description 4
- 108010038912 Retinoid X Receptors Proteins 0.000 description 4
- 235000010489 acacia gum Nutrition 0.000 description 4
- 239000000205 acacia gum Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 235000003599 food sweetener Nutrition 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 230000007574 infarction Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 4
- 210000000663 muscle cell Anatomy 0.000 description 4
- 208000010125 myocardial infarction Diseases 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000004006 olive oil Substances 0.000 description 4
- 235000008390 olive oil Nutrition 0.000 description 4
- 230000036961 partial effect Effects 0.000 description 4
- 150000003904 phospholipids Chemical class 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- 238000002054 transplantation Methods 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 102100021752 Corticoliberin Human genes 0.000 description 3
- 108010022152 Corticotropin-Releasing Hormone Proteins 0.000 description 3
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 101000976075 Homo sapiens Insulin Proteins 0.000 description 3
- 102000004310 Ion Channels Human genes 0.000 description 3
- 108090000862 Ion Channels Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 235000019483 Peanut oil Nutrition 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 206010038563 Reocclusion Diseases 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 230000003293 cardioprotective effect Effects 0.000 description 3
- 230000001684 chronic effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 210000005003 heart tissue Anatomy 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 3
- PBGKTOXHQIOBKM-FHFVDXKLSA-N insulin (human) Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3NC=NC=3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1=CN=CN1 PBGKTOXHQIOBKM-FHFVDXKLSA-N 0.000 description 3
- 238000007918 intramuscular administration Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000004060 metabolic process Effects 0.000 description 3
- 150000002772 monosaccharides Chemical group 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 239000000312 peanut oil Substances 0.000 description 3
- 239000008177 pharmaceutical agent Substances 0.000 description 3
- 230000002028 premature Effects 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 230000010410 reperfusion Effects 0.000 description 3
- 229940076279 serotonin Drugs 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- 102000054930 Agouti-Related Human genes 0.000 description 2
- 101710127426 Agouti-related protein Proteins 0.000 description 2
- 235000003911 Arachis Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 108090000312 Calcium Channels Proteins 0.000 description 2
- 102000003922 Calcium Channels Human genes 0.000 description 2
- 101800001982 Cholecystokinin Proteins 0.000 description 2
- 102100025841 Cholecystokinin Human genes 0.000 description 2
- 208000001778 Coronary Occlusion Diseases 0.000 description 2
- 206010011086 Coronary artery occlusion Diseases 0.000 description 2
- 102100032165 Corticotropin-releasing factor-binding protein Human genes 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- 208000032781 Diabetic cardiomyopathy Diseases 0.000 description 2
- 102000016622 Dipeptidyl Peptidase 4 Human genes 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 102000001267 GSK3 Human genes 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 101000930822 Giardia intestinalis Dipeptidyl-peptidase 4 Proteins 0.000 description 2
- 108010014905 Glycogen Synthase Kinase 3 Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 108010008364 Melanocortins Proteins 0.000 description 2
- 239000000637 Melanocyte-Stimulating Hormone Substances 0.000 description 2
- 108010007013 Melanocyte-Stimulating Hormones Proteins 0.000 description 2
- 101710151321 Melanostatin Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 102400000064 Neuropeptide Y Human genes 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000002727 Protein Tyrosine Phosphatase Human genes 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 2
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 229940107137 cholecystokinin Drugs 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 2
- 238000013270 controlled release Methods 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- 108010083720 corticotropin releasing factor-binding protein Proteins 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 229940074045 glyceryl distearate Drugs 0.000 description 2
- 229940075507 glyceryl monostearate Drugs 0.000 description 2
- 230000004116 glycogenolysis Effects 0.000 description 2
- 125000003147 glycosyl group Chemical group 0.000 description 2
- 239000000122 growth hormone Substances 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 239000007972 injectable composition Substances 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 230000000302 ischemic effect Effects 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- 229940057995 liquid paraffin Drugs 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 239000002865 melanocortin Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 231100000344 non-irritating Toxicity 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- URPYMXQQVHTUDU-OFGSCBOVSA-N nucleopeptide y Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 URPYMXQQVHTUDU-OFGSCBOVSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Chemical group 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 108020000494 protein-tyrosine phosphatase Proteins 0.000 description 2
- 230000002685 pulmonary effect Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000003772 serotonin uptake inhibitor Substances 0.000 description 2
- IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 235000011069 sorbitan monooleate Nutrition 0.000 description 2
- 239000001593 sorbitan monooleate Substances 0.000 description 2
- 229940035049 sorbitan monooleate Drugs 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 230000002459 sustained effect Effects 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 231100000563 toxic property Toxicity 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 102000003390 tumor necrosis factor Human genes 0.000 description 2
- 208000001072 type 2 diabetes mellitus Diseases 0.000 description 2
- 239000002691 unilamellar liposome Substances 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- CEMAWMOMDPGJMB-CYBMUJFWSA-N (2r)-1-(propan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)propan-2-ol Chemical compound CC(C)NC[C@@H](O)COC1=CC=CC=C1OCC=C CEMAWMOMDPGJMB-CYBMUJFWSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- WSEQXVZVJXJVFP-HXUWFJFHSA-N (R)-citalopram Chemical compound C1([C@@]2(C3=CC=C(C=C3CO2)C#N)CCCN(C)C)=CC=C(F)C=C1 WSEQXVZVJXJVFP-HXUWFJFHSA-N 0.000 description 1
- RTHCYVBBDHJXIQ-MRXNPFEDSA-N (R)-fluoxetine Chemical compound O([C@H](CCNC)C=1C=CC=CC=1)C1=CC=C(C(F)(F)F)C=C1 RTHCYVBBDHJXIQ-MRXNPFEDSA-N 0.000 description 1
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WLRMANUAADYWEA-NWASOUNVSA-N (S)-timolol maleate Chemical compound OC(=O)\C=C/C(O)=O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 WLRMANUAADYWEA-NWASOUNVSA-N 0.000 description 1
- FFEKJBVVAJTQST-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,1-dimethyl-2-(2-morpholin-4-ylphenyl)guanidine Chemical compound OC(=O)\C=C\C(O)=O.CN(C)C(N)=NC1=CC=CC=C1N1CCOCC1 FFEKJBVVAJTQST-WLHGVMLRSA-N 0.000 description 1
- BRIPGNJWPCKDQZ-WXXKFALUSA-N (e)-but-2-enedioic acid;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol Chemical compound OC(=O)\C=C\C(O)=O.COCCC1=CC=C(OCC(O)CNC(C)C)C=C1.COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 BRIPGNJWPCKDQZ-WXXKFALUSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical class OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- PKDBCJSWQUOKDO-UHFFFAOYSA-M 2,3,5-triphenyltetrazolium chloride Chemical compound [Cl-].C1=CC=CC=C1C(N=[N+]1C=2C=CC=CC=2)=NN1C1=CC=CC=C1 PKDBCJSWQUOKDO-UHFFFAOYSA-M 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- NJXWZWXCHBNOOG-UHFFFAOYSA-N 3,3-diphenylpropyl(1-phenylethyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C(C)[NH2+]CCC(C=1C=CC=CC=1)C1=CC=CC=C1 NJXWZWXCHBNOOG-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- MEAPRSDUXBHXGD-UHFFFAOYSA-N 3-chloro-n-(4-propan-2-ylphenyl)propanamide Chemical compound CC(C)C1=CC=C(NC(=O)CCCl)C=C1 MEAPRSDUXBHXGD-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- SWLAMJPTOQZTAE-UHFFFAOYSA-N 4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]benzoic acid Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(C(O)=O)C=C1 SWLAMJPTOQZTAE-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- RZTAMFZIAATZDJ-HNNXBMFYSA-N 5-o-ethyl 3-o-methyl (4s)-4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)[C@@H]1C1=CC=CC(Cl)=C1Cl RZTAMFZIAATZDJ-HNNXBMFYSA-N 0.000 description 1
- SLXTWXQUEZSSTJ-UHFFFAOYSA-N 6-[1-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopropyl]pyridine-3-carboxylic acid Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C1(C=2N=CC(=CC=2)C(O)=O)CC1 SLXTWXQUEZSSTJ-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 208000004476 Acute Coronary Syndrome Diseases 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241001514645 Agonis Species 0.000 description 1
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- ITPDYQOUSLNIHG-UHFFFAOYSA-N Amiodarone hydrochloride Chemical compound [Cl-].CCCCC=1OC2=CC=CC=C2C=1C(=O)C1=CC(I)=C(OCC[NH+](CC)CC)C(I)=C1 ITPDYQOUSLNIHG-UHFFFAOYSA-N 0.000 description 1
- 206010002388 Angina unstable Diseases 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229940123208 Biguanide Drugs 0.000 description 1
- 108010051479 Bombesin Proteins 0.000 description 1
- 102000013585 Bombesin Human genes 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 1
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 description 1
- ORJBVYALWPYXDI-UHFFFAOYSA-N CC(Nc(cccc1)c1Oc1ccc(C(O)=O)c(C(O)=O)c1)=O Chemical compound CC(Nc(cccc1)c1Oc1ccc(C(O)=O)c(C(O)=O)c1)=O ORJBVYALWPYXDI-UHFFFAOYSA-N 0.000 description 1
- 0 CC1C(*)N(*)C(*)C1* Chemical compound CC1C(*)N(*)C(*)C1* 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- 102100021809 Chorionic somatomammotropin hormone 1 Human genes 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 229920002911 Colestipol Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 101710198884 GATA-type zinc finger protein 1 Proteins 0.000 description 1
- 101800002068 Galanin Proteins 0.000 description 1
- 102000019432 Galanin Human genes 0.000 description 1
- HEMJJKBWTPKOJG-UHFFFAOYSA-N Gemfibrozil Chemical compound CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 HEMJJKBWTPKOJG-UHFFFAOYSA-N 0.000 description 1
- 102400000321 Glucagon Human genes 0.000 description 1
- 108060003199 Glucagon Proteins 0.000 description 1
- DTHNMHAUYICORS-KTKZVXAJSA-N Glucagon-like peptide 1 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 108010051696 Growth Hormone Proteins 0.000 description 1
- 208000035150 Hypercholesterolemia Diseases 0.000 description 1
- 206010060378 Hyperinsulinaemia Diseases 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108010057186 Insulin Glargine Proteins 0.000 description 1
- COCFEDIXXNGUNL-RFKWWTKHSA-N Insulin glargine Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3NC=NC=3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(=O)NCC(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1=CN=CN1 COCFEDIXXNGUNL-RFKWWTKHSA-N 0.000 description 1
- 229940122355 Insulin sensitizer Drugs 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 102000016267 Leptin Human genes 0.000 description 1
- 108010092277 Leptin Proteins 0.000 description 1
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 206010028851 Necrosis Diseases 0.000 description 1
- 108010025020 Nerve Growth Factor Proteins 0.000 description 1
- 102000007072 Nerve Growth Factors Human genes 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 102000002512 Orexin Human genes 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- CXOFVDLJLONNDW-UHFFFAOYSA-N Phenytoin Chemical compound N1C(=O)NC(=O)C1(C=1C=CC=CC=1)C1=CC=CC=C1 CXOFVDLJLONNDW-UHFFFAOYSA-N 0.000 description 1
- 108010003044 Placental Lactogen Proteins 0.000 description 1
- 239000000381 Placental Lactogen Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 102000004257 Potassium Channel Human genes 0.000 description 1
- TUZYXOIXSAXUGO-UHFFFAOYSA-N Pravastatin Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(O)C=C21 TUZYXOIXSAXUGO-UHFFFAOYSA-N 0.000 description 1
- 102100040918 Pro-glucagon Human genes 0.000 description 1
- 102100024819 Prolactin Human genes 0.000 description 1
- 108010057464 Prolactin Proteins 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- LOUPRKONTZGTKE-LHHVKLHASA-N Quinidine Natural products C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- RYMZZMVNJRMUDD-UHFFFAOYSA-N SJ000286063 Natural products C12C(OC(=O)C(C)(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 RYMZZMVNJRMUDD-UHFFFAOYSA-N 0.000 description 1
- 108010052164 Sodium Channels Proteins 0.000 description 1
- 102000018674 Sodium Channels Human genes 0.000 description 1
- 102100038803 Somatotropin Human genes 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940123464 Thiazolidinedione Drugs 0.000 description 1
- 102000011923 Thyrotropin Human genes 0.000 description 1
- 108010061174 Thyrotropin Proteins 0.000 description 1
- 102000008219 Uncoupling Protein 2 Human genes 0.000 description 1
- 108010021111 Uncoupling Protein 2 Proteins 0.000 description 1
- 208000007814 Unstable Angina Diseases 0.000 description 1
- 108010059705 Urocortins Proteins 0.000 description 1
- 102000005630 Urocortins Human genes 0.000 description 1
- HOBWAPHTEJGALG-JKCMADFCSA-N [(1r,5s)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfate Chemical compound [O-]S([O-])(=O)=O.C([C@H]1CC[C@@H](C2)[NH+]1C)C2OC(=O)C(CO)C1=CC=CC=C1.C([C@H]1CC[C@@H](C2)[NH+]1C)C2OC(=O)C(CO)C1=CC=CC=C1 HOBWAPHTEJGALG-JKCMADFCSA-N 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- DOQPXTMNIUCOSY-UHFFFAOYSA-N [4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium;chloride Chemical compound [H+].[Cl-].C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 DOQPXTMNIUCOSY-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000036982 action potential Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 239000000048 adrenergic agonist Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 239000003888 alpha glucosidase inhibitor Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229960005260 amiodarone Drugs 0.000 description 1
- 229940025084 amphetamine Drugs 0.000 description 1
- 239000003392 amylase inhibitor Substances 0.000 description 1
- 230000006538 anaerobic glycolysis Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000003178 anti-diabetic effect Effects 0.000 description 1
- 230000001315 anti-hyperlipaemic effect Effects 0.000 description 1
- 239000000883 anti-obesity agent Substances 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125710 antiobesity agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- NZLBHDRPUJLHCE-UHFFFAOYSA-N aprindine Chemical compound C1C2=CC=CC=C2CC1N(CCCN(CC)CC)C1=CC=CC=C1 NZLBHDRPUJLHCE-UHFFFAOYSA-N 0.000 description 1
- 229960004957 aprindine Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229960002028 atropine sulfate Drugs 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 150000004283 biguanides Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- DNDCVAGJPBKION-DOPDSADYSA-N bombesin Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC=1NC2=CC=CC=C2C=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1NC(=O)CC1)C(C)C)C1=CN=CN1 DNDCVAGJPBKION-DOPDSADYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- OZVBMTJYIDMWIL-AYFBDAFISA-N bromocriptine Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@]2(C(=O)N3[C@H](C(N4CCC[C@H]4[C@]3(O)O2)=O)CC(C)C)C(C)C)C2)=C3C2=C(Br)NC3=C1 OZVBMTJYIDMWIL-AYFBDAFISA-N 0.000 description 1
- 229960002802 bromocriptine Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-O butylazanium Chemical compound CCCC[NH3+] HQABUPZFAYXKJW-UHFFFAOYSA-O 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- FYBXRCFPOTXTJF-UHFFFAOYSA-N carteolol hydrochloride Chemical compound [Cl-].N1C(=O)CCC2=C1C=CC=C2OCC(O)C[NH2+]C(C)(C)C FYBXRCFPOTXTJF-UHFFFAOYSA-N 0.000 description 1
- 229960002165 carteolol hydrochloride Drugs 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 230000001886 ciliary effect Effects 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 229960001653 citalopram Drugs 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000011281 clinical therapy Methods 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 229960001214 clofibrate Drugs 0.000 description 1
- 229960003920 cocaine Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 229960002604 colestipol Drugs 0.000 description 1
- GMRWGQCZJGVHKL-UHFFFAOYSA-N colestipol Chemical compound ClCC1CO1.NCCNCCNCCNCCN GMRWGQCZJGVHKL-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000007933 dermal patch Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229960001767 dextrothyroxine Drugs 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- 229960001066 disopyramide Drugs 0.000 description 1
- UVTNFZQICZKOEM-UHFFFAOYSA-N disopyramide Chemical compound C=1C=CC=NC=1C(C(N)=O)(CCN(C(C)C)C(C)C)C1=CC=CC=C1 UVTNFZQICZKOEM-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- BXKDSDJJOVIHMX-UHFFFAOYSA-N edrophonium chloride Chemical compound [Cl-].CC[N+](C)(C)C1=CC=CC(O)=C1 BXKDSDJJOVIHMX-UHFFFAOYSA-N 0.000 description 1
- 229960002406 edrophonium chloride Drugs 0.000 description 1
- 230000000042 effect on ischemia Effects 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical compound CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 229960003580 felodipine Drugs 0.000 description 1
- 229960004638 fendiline hcl Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229960002464 fluoxetine Drugs 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229960003627 gemfibrozil Drugs 0.000 description 1
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 1
- 229960004666 glucagon Drugs 0.000 description 1
- 230000004110 gluconeogenesis Effects 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 230000004190 glucose uptake Effects 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 229960002989 glutamic acid Drugs 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FBPFZTCFMRRESA-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexol Chemical compound OCC(O)C(O)C(O)C(O)CO FBPFZTCFMRRESA-UHFFFAOYSA-N 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 201000001421 hyperglycemia Diseases 0.000 description 1
- 230000003451 hyperinsulinaemic effect Effects 0.000 description 1
- 201000008980 hyperinsulinism Diseases 0.000 description 1
- 229940126904 hypoglycaemic agent Drugs 0.000 description 1
- 230000007954 hypoxia Effects 0.000 description 1
- 150000002462 imidazolines Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 201000004332 intermediate coronary syndrome Diseases 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 208000037906 ischaemic injury Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940060975 lantus Drugs 0.000 description 1
- 229940039781 leptin Drugs 0.000 description 1
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 description 1
- 229960004194 lidocaine Drugs 0.000 description 1
- 229960004393 lidocaine hydrochloride Drugs 0.000 description 1
- YECIFGHRMFEPJK-UHFFFAOYSA-N lidocaine hydrochloride monohydrate Chemical compound O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C YECIFGHRMFEPJK-UHFFFAOYSA-N 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 230000037356 lipid metabolism Effects 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 238000011866 long-term treatment Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229960000519 losartan potassium Drugs 0.000 description 1
- 229960004844 lovastatin Drugs 0.000 description 1
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 description 1
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000007726 management method Methods 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 229950004994 meglitinide Drugs 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229960002704 metipranolol Drugs 0.000 description 1
- BLWNYSZZZWQCKO-UHFFFAOYSA-N metipranolol hydrochloride Chemical compound [Cl-].CC(C)[NH2+]CC(O)COC1=CC(C)=C(OC(C)=O)C(C)=C1C BLWNYSZZZWQCKO-UHFFFAOYSA-N 0.000 description 1
- 229960002005 metoprolol fumarate Drugs 0.000 description 1
- 229960001300 metoprolol tartrate Drugs 0.000 description 1
- VLPIATFUUWWMKC-UHFFFAOYSA-N mexiletine Chemical compound CC(N)COC1=C(C)C=CC=C1C VLPIATFUUWWMKC-UHFFFAOYSA-N 0.000 description 1
- 229960001070 mexiletine hydrochloride Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229960003365 mitiglinide Drugs 0.000 description 1
- WPGGHFDDFPHPOB-BBWFWOEESA-N mitiglinide Chemical compound C([C@@H](CC(=O)N1C[C@@H]2CCCC[C@@H]2C1)C(=O)O)C1=CC=CC=C1 WPGGHFDDFPHPOB-BBWFWOEESA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SLZIZIJTGAYEKK-CIJSCKBQSA-N molport-023-220-247 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)CN)[C@@H](C)O)C1=CNC=N1 SLZIZIJTGAYEKK-CIJSCKBQSA-N 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 210000000107 myocyte Anatomy 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DQCKKXVULJGBQN-XFWGSAIBSA-N naltrexone Chemical compound N1([C@@H]2CC3=CC=C(C=4O[C@@H]5[C@](C3=4)([C@]2(CCC5=O)O)CC1)O)CC1CC1 DQCKKXVULJGBQN-XFWGSAIBSA-N 0.000 description 1
- 229960003086 naltrexone Drugs 0.000 description 1
- 125000004626 naphthothienyl group Chemical group C1(=CSC2=C1C1=CC=CC=C1C=C2)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000003887 narcotic antagonist Substances 0.000 description 1
- 229960000698 nateglinide Drugs 0.000 description 1
- OELFLUMRDSZNSF-BRWVUGGUSA-N nateglinide Chemical compound C1C[C@@H](C(C)C)CC[C@@H]1C(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 OELFLUMRDSZNSF-BRWVUGGUSA-N 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 239000003900 neurotrophic factor Substances 0.000 description 1
- LBHIOVVIQHSOQN-UHFFFAOYSA-N nicorandil Chemical compound [O-][N+](=O)OCCNC(=O)C1=CC=CN=C1 LBHIOVVIQHSOQN-UHFFFAOYSA-N 0.000 description 1
- 229960002497 nicorandil Drugs 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000002767 noradrenalin uptake inhibitor Substances 0.000 description 1
- 230000002474 noradrenergic effect Effects 0.000 description 1
- 230000007959 normoxia Effects 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 108060005714 orexin Proteins 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- YDCVQGAUCOROHB-UHFFFAOYSA-N oxadiazolidine-4,5-dione Chemical compound O=C1NNOC1=O YDCVQGAUCOROHB-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000011458 pharmacological treatment Methods 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- 229960002036 phenytoin Drugs 0.000 description 1
- 150000008105 phosphatidylcholines Chemical class 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 108020001213 potassium channel Proteins 0.000 description 1
- 239000003450 potassium channel blocker Substances 0.000 description 1
- OXCMYAYHXIHQOA-UHFFFAOYSA-N potassium;[2-butyl-5-chloro-3-[[4-[2-(1,2,4-triaza-3-azanidacyclopenta-1,4-dien-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol Chemical compound [K+].CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C2=N[N-]N=N2)C=C1 OXCMYAYHXIHQOA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229960002965 pravastatin Drugs 0.000 description 1
- TUZYXOIXSAXUGO-PZAWKZKUSA-N pravastatin Chemical compound C1=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(O)=O)[C@H]2[C@@H](OC(=O)[C@@H](C)CC)C[C@H](O)C=C21 TUZYXOIXSAXUGO-PZAWKZKUSA-N 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FYPMFJGVHOHGLL-UHFFFAOYSA-N probucol Chemical compound C=1C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=1SC(C)(C)SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FYPMFJGVHOHGLL-UHFFFAOYSA-N 0.000 description 1
- 229960003912 probucol Drugs 0.000 description 1
- ABTXGJFUQRCPNH-UHFFFAOYSA-N procainamide hydrochloride Chemical compound [H+].[Cl-].CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 ABTXGJFUQRCPNH-UHFFFAOYSA-N 0.000 description 1
- 229960003253 procainamide hydrochloride Drugs 0.000 description 1
- 229940097325 prolactin Drugs 0.000 description 1
- XWIHRGFIPXWGEF-UHFFFAOYSA-N propafenone hydrochloride Chemical compound Cl.CCCNCC(O)COC1=CC=CC=C1C(=O)CCC1=CC=CC=C1 XWIHRGFIPXWGEF-UHFFFAOYSA-N 0.000 description 1
- 229960002443 propafenone hydrochloride Drugs 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 229960004604 propranolol hydrochloride Drugs 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229960001404 quinidine Drugs 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000011555 rabbit model Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000003488 releasing hormone Substances 0.000 description 1
- 230000002336 repolarization Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 230000002295 serotoninergic effect Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 229960002855 simvastatin Drugs 0.000 description 1
- RYMZZMVNJRMUDD-HGQWONQESA-N simvastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 RYMZZMVNJRMUDD-HGQWONQESA-N 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- VIDRYROWYFWGSY-UHFFFAOYSA-N sotalol hydrochloride Chemical compound Cl.CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1 VIDRYROWYFWGSY-UHFFFAOYSA-N 0.000 description 1
- 229960003579 sotalol hydrochloride Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical compound [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical compound S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 239000007885 tablet disintegrant Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- WUBVEMGCQRSBBT-UHFFFAOYSA-N tert-butyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(OS(=O)(=O)C(F)(F)F)=CC1 WUBVEMGCQRSBBT-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical class C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000004525 thiadiazinyl group Chemical group S1NN=C(C=C1)* 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 229960005221 timolol maleate Drugs 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 229950002929 trinitrophenol Drugs 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 239000000777 urocortin Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 208000003663 ventricular fibrillation Diseases 0.000 description 1
- 229960000881 verapamil hydrochloride Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/40—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil
- A61K31/4015—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with one nitrogen as the only ring hetero atom, e.g. sulpiride, succinimide, tolmetin, buflomedil having oxo groups directly attached to the heterocyclic ring, e.g. piracetam, ethosuximide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Organic Chemistry (AREA)
- Heart & Thoracic Surgery (AREA)
- Hospice & Palliative Care (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DKPA200201630 | 2002-10-28 | ||
| US10/429,625 US20040082641A1 (en) | 2002-10-28 | 2003-05-05 | Use of glycogen phosphorylase inhibitors for treatment of cardiovascular diseases |
| US10/429,626 US6960610B2 (en) | 2002-10-28 | 2003-05-05 | Use of glycogen phosphorylase inhibitors for treatment of cardiovascular diseases |
| PCT/DK2003/000695 WO2004037233A2 (en) | 2002-10-28 | 2003-10-14 | Use of glycogen phosphorylase inhibitors for treatment of cardiovascular diseases |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2006507359A true JP2006507359A (ja) | 2006-03-02 |
| JP2006507359A5 JP2006507359A5 (enExample) | 2006-11-30 |
Family
ID=32180137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2005501508A Withdrawn JP2006507359A (ja) | 2002-10-28 | 2003-10-14 | 心循環器疾患の治療のためのグリコーゲンホスホリラーゼ阻害剤の使用 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US20050054618A1 (enExample) |
| EP (1) | EP1558245A2 (enExample) |
| JP (1) | JP2006507359A (enExample) |
| AU (1) | AU2003273762A1 (enExample) |
| WO (1) | WO2004037233A2 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2013508366A (ja) * | 2009-10-19 | 2013-03-07 | アミカス セラピューティックス インコーポレイテッド | 中枢神経系の変性障害を予防および/または治療するための新規の組成物 |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PE20110235A1 (es) | 2006-05-04 | 2011-04-14 | Boehringer Ingelheim Int | Combinaciones farmaceuticas que comprenden linagliptina y metmorfina |
| CA2758271C (en) * | 2009-04-09 | 2018-06-05 | Robert Boyd | Methods for preventing and/or treating lysosomal storage disorders |
| US8304429B2 (en) * | 2009-04-09 | 2012-11-06 | Amicus Therapeutics, Inc. | Methods for preventing and/or treating degenerative disorders of the central nervous system |
| EP2490533B1 (en) | 2009-10-19 | 2015-09-16 | Amicus Therapeutics, Inc. | Novel compositions for preventing and/or treating lysosomal storage disorders |
| CA2803118C (en) | 2010-07-09 | 2015-11-03 | Pfizer Limited | Sulfonamide derivatives as nav 1.7 inhibitors |
| EP2590951B1 (en) | 2010-07-09 | 2015-01-07 | Pfizer Limited | Benzenesulfonamides useful as sodium channel inhibitors |
| WO2020023390A1 (en) | 2018-07-25 | 2020-01-30 | Modernatx, Inc. | Mrna based enzyme replacement therapy combined with a pharmacological chaperone for the treatment of lysosomal storage disorders |
| MX2021014443A (es) | 2019-05-31 | 2022-01-06 | Ikena Oncology Inc | Inhibidores del dominio asociado mejorador de la transcripcion (tead) y usos de los mismos. |
| AU2020282759A1 (en) | 2019-05-31 | 2021-12-23 | Ikena Oncology, Inc. | TEAD inhibitors and uses thereof |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5338829A (en) * | 1988-04-20 | 1994-08-16 | Trustees Of The University Of Pennsylvania | Peptides derived from human immunodeficiency virus-1 GP160 |
| US5242687A (en) * | 1989-03-15 | 1993-09-07 | Tkb Associates Limited Partnership | Method of reducing cellular immune response involving T-cells using CD8-bearing antigen presenting cells |
| US5759551A (en) * | 1993-04-27 | 1998-06-02 | United Biomedical, Inc. | Immunogenic LHRH peptide constructs and synthetic universal immune stimulators for vaccines |
| US5705388A (en) * | 1994-12-23 | 1998-01-06 | Ribozyme Pharmaceuticals, Inc. | CETP Ribozymes |
| CN1202105A (zh) * | 1995-09-08 | 1998-12-16 | 诺沃挪第克公司 | 2-烷基吡咯烷化合物 |
| US5998463A (en) * | 1998-02-27 | 1999-12-07 | Pfizer Inc | Glycogen phosphorylase inhibitors |
| WO2000047206A1 (en) * | 1999-02-12 | 2000-08-17 | Novo Nordisk A/S | Use of pyrrolidine derivatives for the manufacture of a pharmaceutical composition for the treatment or prophylaxis of obesity or appetite regulation |
-
2003
- 2003-10-14 EP EP03757718A patent/EP1558245A2/en not_active Withdrawn
- 2003-10-14 WO PCT/DK2003/000695 patent/WO2004037233A2/en not_active Ceased
- 2003-10-14 JP JP2005501508A patent/JP2006507359A/ja not_active Withdrawn
- 2003-10-14 AU AU2003273762A patent/AU2003273762A1/en not_active Abandoned
-
2004
- 2004-09-17 US US10/943,548 patent/US20050054618A1/en not_active Abandoned
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2013508366A (ja) * | 2009-10-19 | 2013-03-07 | アミカス セラピューティックス インコーポレイテッド | 中枢神経系の変性障害を予防および/または治療するための新規の組成物 |
| JP2015157822A (ja) * | 2009-10-19 | 2015-09-03 | アミカス セラピューティックス インコーポレイテッド | 中枢神経系の変性障害を予防および/または治療するための新規の組成物 |
Also Published As
| Publication number | Publication date |
|---|---|
| US20050054618A1 (en) | 2005-03-10 |
| WO2004037233A3 (en) | 2004-07-29 |
| WO2004037233A2 (en) | 2004-05-06 |
| EP1558245A2 (en) | 2005-08-03 |
| AU2003273762A1 (en) | 2004-05-13 |
| AU2003273762A8 (en) | 2004-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69922688T2 (de) | Zusammensetzungen aus einem 5ht1b/1d agonisten und einem selektiven cox-2 hemmer zur behandlung von migräne | |
| US20040082641A1 (en) | Use of glycogen phosphorylase inhibitors for treatment of cardiovascular diseases | |
| US9468615B2 (en) | Use of malononitrilamides in neuropathic pain | |
| AU2016228230B2 (en) | Pro-drugs of NSAIAS with very high skin and membranes penetration rates and their new medicinal uses | |
| CN1501796A (zh) | 用二肽基肽酶iv抑制剂治疗2型糖尿病 | |
| CA2796268A1 (en) | Methods for treatment of sleep-related breathing disorders | |
| US8912185B2 (en) | Use of glutaric acid derivatives or the pharmaceutically acceptable salts thereof as anti-arrhythmic agents | |
| JP2006507359A (ja) | 心循環器疾患の治療のためのグリコーゲンホスホリラーゼ阻害剤の使用 | |
| BRPI0712938A2 (pt) | mÉtodo para modular excrescÊncia de neurito pelo uso de um antagonista de receptor de galanina-3 | |
| WO2013116713A1 (en) | Treating neuropathic pain with seh inhibitors | |
| JP2024096211A (ja) | 高透過性薬物を含む医薬組成物の安定性を改善する方法、及びそれにより得られる医薬組成物 | |
| WO1996031470A1 (en) | Novel heterocyclic compounds | |
| US20090286862A1 (en) | Therapeutic agent for psychoneurotic disease | |
| JP2001517703A (ja) | 組合せ製剤としてのエンドセリン拮抗剤およびβ−受容体ブロッカー | |
| US20240199551A1 (en) | D-amphetamine compounds, compositions, and processes for making and using the same | |
| CN110290788A (zh) | 氨基甲酸酯化合物用于预防、缓解或治疗双相障碍的用途 | |
| KR20040044946A (ko) | Pde 억제제와 류코트리엔 수용체 길항제의 병용 | |
| JPS60500288A (ja) | 3−(3−置換アミノ−2−ヒドロキシプロポキシ)−4−置換−1・2・5−チアゾ−ル誘導体のエステル | |
| JP2642198B2 (ja) | 胃粘膜障害治療剤 | |
| JP2013035873A (ja) | 神経障害の治療における選択的オピエート受容体調節物質の使用 | |
| JP2025504447A (ja) | アスピリン及びその他のnsaidの高透過プロドラッグによる心血管疾患の予防又は治療 | |
| US6960610B2 (en) | Use of glycogen phosphorylase inhibitors for treatment of cardiovascular diseases | |
| US20070167500A1 (en) | Remedy for urinary tract diseases | |
| CN1042795C (zh) | 抗氧剂羟基咔唑化合物保护神经的用途及用其治疗的方法 | |
| WO2006132196A1 (ja) | β3作動薬を含有する新規な医薬 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20061011 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20061011 |
|
| A761 | Written withdrawal of application |
Free format text: JAPANESE INTERMEDIATE CODE: A761 Effective date: 20070528 |