JP2005523934A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2005523934A5 JP2005523934A5 JP2004501363A JP2004501363A JP2005523934A5 JP 2005523934 A5 JP2005523934 A5 JP 2005523934A5 JP 2004501363 A JP2004501363 A JP 2004501363A JP 2004501363 A JP2004501363 A JP 2004501363A JP 2005523934 A5 JP2005523934 A5 JP 2005523934A5
- Authority
- JP
- Japan
- Prior art keywords
- appropriate
- formula
- diluent
- catalyst
- specified above
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002253 acid Substances 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- WGLLSSPDPJPLOR-UHFFFAOYSA-N 2,3-dimethylbut-2-ene Chemical group CC(C)=C(C)C WGLLSSPDPJPLOR-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229940053202 antiepileptics carboxamide derivative Drugs 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 description 1
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 1
- GTKIGDZXPDCIKR-UHFFFAOYSA-N 2-phenylbenzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=CC=C1 GTKIGDZXPDCIKR-UHFFFAOYSA-N 0.000 description 1
- 0 Cc1c(*)c(S)c(*)[s]1 Chemical compound Cc1c(*)c(S)c(*)[s]1 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10219035A DE10219035A1 (de) | 2002-04-29 | 2002-04-29 | Biphenylcarboxamide |
| PCT/EP2003/003964 WO2003093223A1 (de) | 2002-04-29 | 2003-04-16 | Biphenylcarboxamide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2005523934A JP2005523934A (ja) | 2005-08-11 |
| JP2005523934A5 true JP2005523934A5 (enExample) | 2010-04-02 |
Family
ID=29224851
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2004501363A Pending JP2005523934A (ja) | 2002-04-29 | 2003-04-16 | ビオフェニルカルボキサミド |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US7208169B2 (enExample) |
| EP (1) | EP1501786A1 (enExample) |
| JP (1) | JP2005523934A (enExample) |
| AU (1) | AU2003227635A1 (enExample) |
| BR (1) | BRPI0309830B1 (enExample) |
| DE (1) | DE10219035A1 (enExample) |
| PL (1) | PL372935A1 (enExample) |
| WO (1) | WO2003093223A1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10325438A1 (de) * | 2003-05-21 | 2004-12-09 | Bayer Cropscience Ag | Difluormethylbenzanilide |
| AU2004240720A1 (en) | 2003-05-21 | 2004-12-02 | Bayer Cropscience Aktiengesellschaft | Iodopyrazolyl carboxanilides |
| DE10354607A1 (de) * | 2003-11-21 | 2005-06-16 | Bayer Cropscience Ag | Siylierte Carboxamide |
| DE102004005786A1 (de) * | 2004-02-06 | 2005-08-25 | Bayer Cropscience Ag | Haloalkylcarboxamide |
| DE102004005785A1 (de) * | 2004-02-06 | 2005-08-25 | Bayer Cropscience Ag | 2-Halogenfuryl/thienyl-3-carboxamide |
| CA2797533A1 (en) * | 2010-04-27 | 2011-11-10 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
| JP2013023476A (ja) * | 2011-07-22 | 2013-02-04 | Sagami Chemical Research Institute | ５−フルオロ−１ｈ−ピラゾール−４−カルボン酸類の製造方法 |
| US11039617B2 (en) | 2013-01-30 | 2021-06-22 | Agrofresh Inc. | Large scale methods of uniformly coating packaging surfaces with a volatile antimicrobial to preserve food freshness |
| US10070649B2 (en) | 2013-01-30 | 2018-09-11 | Agrofresh Inc. | Volatile applications against pathogens |
| WO2017155879A1 (en) | 2016-03-07 | 2017-09-14 | Agrofresh Inc. | Synergistic methods of using benzoxaborole compounds and preservative gases as an antimicrobial for crops |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5045554A (en) | 1988-11-29 | 1991-09-03 | Monsanto Company | Substituted thiazoles and their use as fungicides |
| AU6049590A (en) | 1989-07-25 | 1991-02-22 | Monsanto Company | Substituted carboxanilidothiazoles and their use as fungicides |
| CA2081935C (en) | 1991-11-22 | 2004-05-25 | Karl Eicken | Anilide derivatives and their use for combating botrytis |
| US5223526A (en) | 1991-12-06 | 1993-06-29 | Monsanto Company | Pyrazole carboxanilide fungicides and use |
| DE4231519A1 (de) | 1992-09-21 | 1994-03-24 | Basf Ag | Cyclohex(en)ylcarbonsäureamide, Verfahren zu ihrer Herstellung und sie enthaltende Mittel zur Bekämpfung von Schadpilzen |
| DE4231517A1 (de) | 1992-09-21 | 1994-03-24 | Basf Ag | Carbonsäureanilide, Verfahren zu ihrer Herstellung und sie enthaltende Mittel zur Bekämpfung von Schadpilzen |
| US5633218A (en) * | 1995-05-24 | 1997-05-27 | E. I. Du Pont De Nemours And Company | Herbicidal benzodioxoles and benzodioxanes |
| GB9510459D0 (en) | 1995-05-24 | 1995-07-19 | Zeneca Ltd | Bicyclic amines |
| GB9624611D0 (en) * | 1996-11-26 | 1997-01-15 | Zeneca Ltd | Bicyclic amine compounds |
| IL130058A0 (en) * | 1996-11-26 | 2000-02-29 | Zeneca Ltd | 8-Azabicyclo(3.2.1)octane-8-azabicyclo(3.2.1)oct-6-ene-9-azabicyclo(3.3.1)nonane-9-aza-3-oxabicyclo (3.3.1)nonane- and 9-aza-3-thiabicyclo(3.3.1)nonane derivatives their preparation and their use as insecticides |
| DE19735224A1 (de) * | 1997-08-15 | 1999-02-18 | Basf Ag | Biphenylamide |
| EA004248B1 (ru) * | 1998-06-19 | 2004-02-26 | Х.Лундбекк А/С | Производные 4-, 5-, 6- и 7-замещенного индола и индолина, их получение и применение |
| GB9817548D0 (en) * | 1998-08-12 | 1998-10-07 | Novartis Ag | Organic compounds |
| DE19840322A1 (de) * | 1998-09-04 | 2000-03-09 | Bayer Ag | Pyrazol-carboxanilide |
| GB0012671D0 (en) * | 2000-05-24 | 2000-07-19 | Merck Sharp & Dohme | Therapeutic agents |
| WO2002008197A1 (de) * | 2000-07-24 | 2002-01-31 | Bayer Cropscience Ag | Biphenylcarboxamide |
-
2002
- 2002-04-29 DE DE10219035A patent/DE10219035A1/de not_active Withdrawn
-
2003
- 2003-04-16 JP JP2004501363A patent/JP2005523934A/ja active Pending
- 2003-04-16 BR BRPI0309830-3A patent/BRPI0309830B1/pt not_active IP Right Cessation
- 2003-04-16 EP EP03725044A patent/EP1501786A1/de not_active Withdrawn
- 2003-04-16 AU AU2003227635A patent/AU2003227635A1/en not_active Abandoned
- 2003-04-16 WO PCT/EP2003/003964 patent/WO2003093223A1/de not_active Ceased
- 2003-04-16 US US10/512,706 patent/US7208169B2/en not_active Expired - Lifetime
- 2003-04-16 PL PL03372935A patent/PL372935A1/xx unknown