JP2002530389A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2002530389A5 JP2002530389A5 JP2000583879A JP2000583879A JP2002530389A5 JP 2002530389 A5 JP2002530389 A5 JP 2002530389A5 JP 2000583879 A JP2000583879 A JP 2000583879A JP 2000583879 A JP2000583879 A JP 2000583879A JP 2002530389 A5 JP2002530389 A5 JP 2002530389A5
- Authority
- JP
- Japan
- Prior art keywords
- stent device
- poly
- amine
- dimethoxy
- bicyclo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 heteroaryloxySi Chemical group 0.000 description 23
- 238000000576 coating method Methods 0.000 description 14
- 239000011248 coating agent Substances 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000002861 polymer material Substances 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229920000052 poly(p-xylylene) Polymers 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000000975 bioactive effect Effects 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229920001451 polypropylene glycol Polymers 0.000 description 4
- 229920001296 polysiloxane Polymers 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000005844 heterocyclyloxy group Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical group CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical group C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- VLGMELKIRGCWAA-XYPYZODXSA-N COc1cc2ncc(O[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC Chemical compound COc1cc2ncc(O[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC VLGMELKIRGCWAA-XYPYZODXSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- FTXKUBNATJTYSH-UHFFFAOYSA-N methyl 4-[(6,7-dimethoxyquinoxalin-2-yl)amino]cyclohexane-1-carboxylate Chemical compound C1CC(C(=O)OC)CCC1NC1=CN=C(C=C(OC)C(OC)=C2)C2=N1 FTXKUBNATJTYSH-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 229920001432 poly(L-lactide) Polymers 0.000 description 2
- 229920002627 poly(phosphazenes) Polymers 0.000 description 2
- 229920001610 polycaprolactone Polymers 0.000 description 2
- 239000004632 polycaprolactone Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 208000037803 restenosis Diseases 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 description 1
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- ICGQLNMKJVHCIR-UHFFFAOYSA-N 1,3,2-dioxazetidin-4-one Chemical compound O=C1ONO1 ICGQLNMKJVHCIR-UHFFFAOYSA-N 0.000 description 1
- QYCGBAJADAGLLK-UHFFFAOYSA-N 1-(cyclohepten-1-yl)cycloheptene Chemical group C1CCCCC=C1C1=CCCCCC1 QYCGBAJADAGLLK-UHFFFAOYSA-N 0.000 description 1
- VJIOUBTXSNPMNO-UHFFFAOYSA-N 2,7-dicyclohexyloxy-6-methoxyquinoxaline Chemical compound N1=C2C=C(OC3CCCCC3)C(OC)=CC2=NC=C1OC1CCCCC1 VJIOUBTXSNPMNO-UHFFFAOYSA-N 0.000 description 1
- UBIZPJMDFPWKAR-UHFFFAOYSA-N 2-(5-bicyclo[2.2.1]hept-2-enyloxy)-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OC1C(C=C2)CC2C1 UBIZPJMDFPWKAR-UHFFFAOYSA-N 0.000 description 1
- GRBVFGKKVXWZII-UHFFFAOYSA-N 2-(cyclopentylmethoxy)-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OCC1CCCC1 GRBVFGKKVXWZII-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- BEFUAVPFBGOHKT-UHFFFAOYSA-N 2-cyclohexyloxy-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OC1CCCCC1 BEFUAVPFBGOHKT-UHFFFAOYSA-N 0.000 description 1
- CSLYLUOENYVUID-UHFFFAOYSA-N 2-cyclopentyloxy-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OC1CCCC1 CSLYLUOENYVUID-UHFFFAOYSA-N 0.000 description 1
- ZHAMQTUXCPUZFN-UHFFFAOYSA-N 2-cyclopentylsulfanyl-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1SC1CCCC1 ZHAMQTUXCPUZFN-UHFFFAOYSA-N 0.000 description 1
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- OMHPHFWGEQHURJ-UHFFFAOYSA-N 6,7-dimethoxy-2-(4-methoxycyclohexyl)oxyquinoxaline Chemical compound C1CC(OC)CCC1OC1=CN=C(C=C(OC)C(OC)=C2)C2=N1 OMHPHFWGEQHURJ-UHFFFAOYSA-N 0.000 description 1
- YEAUGSGQDBWJFI-UHFFFAOYSA-N 6,7-dimethoxy-n-(4-methoxycyclohexyl)quinoxalin-2-amine Chemical compound C1CC(OC)CCC1NC1=CN=C(C=C(OC)C(OC)=C2)C2=N1 YEAUGSGQDBWJFI-UHFFFAOYSA-N 0.000 description 1
- SAPGBCWOQLHKKZ-UHFFFAOYSA-N 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C SAPGBCWOQLHKKZ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- JNMIZMOJWOWVMI-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)Br.Cl Chemical compound COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)Br.Cl JNMIZMOJWOWVMI-UHFFFAOYSA-N 0.000 description 1
- BSNPPAQPTUSCIM-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)OC Chemical compound COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)OC BSNPPAQPTUSCIM-UHFFFAOYSA-N 0.000 description 1
- RGDIEMDLYDBGAY-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C=CC(=N2)OC3CC4CCC3CC4)OC Chemical compound COC1=C(C=C2C(=C1)C=CC(=N2)OC3CC4CCC3CC4)OC RGDIEMDLYDBGAY-UHFFFAOYSA-N 0.000 description 1
- JDHYKJFPZBYRDS-XYPYZODXSA-N COc1cc2ncc(N[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC Chemical compound COc1cc2ncc(N[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC JDHYKJFPZBYRDS-XYPYZODXSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 229920001651 Cyanoacrylate Polymers 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 102000009123 Fibrin Human genes 0.000 description 1
- 108010073385 Fibrin Proteins 0.000 description 1
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- MWCLLHOVUTZFKS-UHFFFAOYSA-N Methyl cyanoacrylate Chemical compound COC(=O)C(=C)C#N MWCLLHOVUTZFKS-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229920001244 Poly(D,L-lactide) Polymers 0.000 description 1
- 229920001054 Poly(ethylene‐co‐vinyl acetate) Polymers 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920000954 Polyglycolide Polymers 0.000 description 1
- 229920000331 Polyhydroxybutyrate Polymers 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 230000003143 atherosclerotic effect Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical group CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000005026 carboxyaryl group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 229920006213 ethylene-alphaolefin copolymer Polymers 0.000 description 1
- 229950003499 fibrin Drugs 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 229920002674 hyaluronan Polymers 0.000 description 1
- 229960003160 hyaluronic acid Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 description 1
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FVMOLSMWWNSWLX-UHFFFAOYSA-N n-(3-bicyclo[2.2.1]heptanyl)-6,7-dimethylquinoxalin-2-amine Chemical compound N1=C2C=C(C)C(C)=CC2=NC=C1NC1C(C2)CCC2C1 FVMOLSMWWNSWLX-UHFFFAOYSA-N 0.000 description 1
- WDTKJTQWHUMMDU-WOPDTQHZSA-N n-[(1r,3s,4s)-3-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine Chemical compound C1=C(OC)C(OC)=CC2=NC(N[C@@H]3[C@@]4([H])CC[C@](C4)(C3)[H])=CN=C21 WDTKJTQWHUMMDU-WOPDTQHZSA-N 0.000 description 1
- WDTKJTQWHUMMDU-QJPTWQEYSA-N n-[(1s,3r,4r)-3-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine Chemical compound C1=C(OC)C(OC)=CC2=NC(N[C@H]3[C@]4([H])CC[C@@](C4)(C3)[H])=CN=C21 WDTKJTQWHUMMDU-QJPTWQEYSA-N 0.000 description 1
- NXGYOWSWPPHJLL-UHFFFAOYSA-N n-[(6,7-dimethoxyquinoxalin-2-yl)methyl]cyclohexanamine Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1CNC1CCCCC1 NXGYOWSWPPHJLL-UHFFFAOYSA-N 0.000 description 1
- YFZQPHGDRHSTGB-UHFFFAOYSA-N n-cycloheptyl-6,7-dimethoxyquinoxalin-2-amine Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1NC1CCCCCC1 YFZQPHGDRHSTGB-UHFFFAOYSA-N 0.000 description 1
- HFYHDNNINOTPHW-UHFFFAOYSA-N n-cyclohexyl-6,8-dimethylquinoxalin-2-amine Chemical compound C1=NC2=CC(C)=CC(C)=C2N=C1NC1CCCCC1 HFYHDNNINOTPHW-UHFFFAOYSA-N 0.000 description 1
- RHZYQTPCJHEBKB-UHFFFAOYSA-N n-cyclohexyl-6-methoxy-7-morpholin-4-ylquinoxalin-2-amine Chemical compound N1=C2C=C(N3CCOCC3)C(OC)=CC2=NC=C1NC1CCCCC1 RHZYQTPCJHEBKB-UHFFFAOYSA-N 0.000 description 1
- CFAAOOAZIREBHB-UHFFFAOYSA-N n-cyclohexyl-6-methoxyquinoxalin-2-amine Chemical compound C1=NC2=CC(OC)=CC=C2N=C1NC1CCCCC1 CFAAOOAZIREBHB-UHFFFAOYSA-N 0.000 description 1
- FBCVQPSZSMHQGK-UHFFFAOYSA-N n-cyclopentyl-6,7-dimethoxyquinoxalin-2-amine Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1NC1CCCC1 FBCVQPSZSMHQGK-UHFFFAOYSA-N 0.000 description 1
- VBXDPTHXXPWTNC-UHFFFAOYSA-N n-heptan-2-yl-6,7-dimethoxyquinoxalin-2-amine Chemical compound C1=C(OC)C(OC)=CC2=NC(NC(C)CCCCC)=CN=C21 VBXDPTHXXPWTNC-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- NRNFFDZCBYOZJY-UHFFFAOYSA-N p-quinodimethane Chemical group C=C1C=CC(=C)C=C1 NRNFFDZCBYOZJY-UHFFFAOYSA-N 0.000 description 1
- 229920001308 poly(aminoacid) Polymers 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 239000005015 poly(hydroxybutyrate) Substances 0.000 description 1
- 229920001606 poly(lactic acid-co-glycolic acid) Polymers 0.000 description 1
- 239000002745 poly(ortho ester) Substances 0.000 description 1
- 229920002463 poly(p-dioxanone) polymer Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000000622 polydioxanone Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920006216 polyvinyl aromatic Polymers 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- 229920006214 polyvinylidene halide Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005338 substituted cycloalkoxy group Chemical group 0.000 description 1
- YFHICDDUDORKJB-UHFFFAOYSA-N trimethylene carbonate Chemical compound O=C1OCCCO1 YFHICDDUDORKJB-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/198,718 | 1998-11-24 | ||
| US09/198,718 US6180632B1 (en) | 1997-05-28 | 1998-11-24 | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| PCT/US1999/027825 WO2000031051A1 (en) | 1998-11-24 | 1999-11-23 | Quinoline and quinoxaline compounds as pdgf-receptor and/or lck tyrosine kinase inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2002530389A JP2002530389A (ja) | 2002-09-17 |
| JP2002530389A5 true JP2002530389A5 (cg-RX-API-DMAC7.html) | 2007-01-18 |
Family
ID=22734514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000583879A Pending JP2002530389A (ja) | 1998-11-24 | 1999-11-23 | キノリン又はキノキサリン化合物 |
Country Status (22)
| Country | Link |
|---|---|
| US (5) | US6180632B1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1133480A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2002530389A (cg-RX-API-DMAC7.html) |
| KR (1) | KR100784291B1 (cg-RX-API-DMAC7.html) |
| CN (1) | CN100390154C (cg-RX-API-DMAC7.html) |
| AU (1) | AU777256B2 (cg-RX-API-DMAC7.html) |
| BG (1) | BG65497B1 (cg-RX-API-DMAC7.html) |
| BR (1) | BR9915653A (cg-RX-API-DMAC7.html) |
| CA (1) | CA2352261A1 (cg-RX-API-DMAC7.html) |
| CZ (1) | CZ20012276A3 (cg-RX-API-DMAC7.html) |
| EA (1) | EA007534B1 (cg-RX-API-DMAC7.html) |
| EE (1) | EE200100280A (cg-RX-API-DMAC7.html) |
| HU (1) | HUP0104605A3 (cg-RX-API-DMAC7.html) |
| ID (1) | ID29611A (cg-RX-API-DMAC7.html) |
| IL (1) | IL143406A0 (cg-RX-API-DMAC7.html) |
| MX (1) | MXPA01005317A (cg-RX-API-DMAC7.html) |
| NO (1) | NO319801B1 (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ512096A (cg-RX-API-DMAC7.html) |
| PL (1) | PL348979A1 (cg-RX-API-DMAC7.html) |
| SK (1) | SK9062001A3 (cg-RX-API-DMAC7.html) |
| UA (1) | UA76935C2 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2000031051A1 (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8778375B2 (en) | 2005-04-29 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Amorphous poly(D,L-lactide) coating |
Families Citing this family (185)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6776792B1 (en) * | 1997-04-24 | 2004-08-17 | Advanced Cardiovascular Systems Inc. | Coated endovascular stent |
| US6180632B1 (en) | 1997-05-28 | 2001-01-30 | Aventis Pharmaceuticals Products Inc. | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| DK1087934T3 (da) * | 1998-04-01 | 2004-06-28 | Cardiome Pharma Corp | Aminocyclohexyletherforbindelser og anvendelser deraf |
| US6455734B1 (en) * | 2000-08-09 | 2002-09-24 | Magnesium Diagnostics, Inc. | Antagonists of the magnesium binding defect as therapeutic agents and methods for treatment of abnormal physiological states |
| US7507545B2 (en) | 1999-03-31 | 2009-03-24 | Cardiome Pharma Corp. | Ion channel modulating activity method |
| US7807211B2 (en) * | 1999-09-03 | 2010-10-05 | Advanced Cardiovascular Systems, Inc. | Thermal treatment of an implantable medical device |
| US20070032853A1 (en) * | 2002-03-27 | 2007-02-08 | Hossainy Syed F | 40-O-(2-hydroxy)ethyl-rapamycin coated stent |
| US6790228B2 (en) * | 1999-12-23 | 2004-09-14 | Advanced Cardiovascular Systems, Inc. | Coating for implantable devices and a method of forming the same |
| US20050238686A1 (en) * | 1999-12-23 | 2005-10-27 | Advanced Cardiovascular Systems, Inc. | Coating for implantable devices and a method of forming the same |
| US20160287708A9 (en) * | 2000-03-15 | 2016-10-06 | Orbusneich Medical, Inc. | Progenitor Endothelial Cell Capturing with a Drug Eluting Implantable Medical Device |
| US20050271701A1 (en) * | 2000-03-15 | 2005-12-08 | Orbus Medical Technologies, Inc. | Progenitor endothelial cell capturing with a drug eluting implantable medical device |
| US9522217B2 (en) | 2000-03-15 | 2016-12-20 | Orbusneich Medical, Inc. | Medical device with coating for capturing genetically-altered cells and methods for using same |
| US8088060B2 (en) * | 2000-03-15 | 2012-01-03 | Orbusneich Medical, Inc. | Progenitor endothelial cell capturing with a drug eluting implantable medical device |
| US6953560B1 (en) | 2000-09-28 | 2005-10-11 | Advanced Cardiovascular Systems, Inc. | Barriers for polymer-coated implantable medical devices and methods for making the same |
| US7057053B2 (en) * | 2000-10-06 | 2006-06-06 | Cardiome Pharma Corp. | Ion channel modulating compounds and uses thereof |
| US7524879B2 (en) * | 2000-10-06 | 2009-04-28 | Cardiome Pharma Corp. | Ion channel modulating compounds and uses thereof |
| US6783793B1 (en) * | 2000-10-26 | 2004-08-31 | Advanced Cardiovascular Systems, Inc. | Selective coating of medical devices |
| US7807210B1 (en) * | 2000-10-31 | 2010-10-05 | Advanced Cardiovascular Systems, Inc. | Hemocompatible polymers on hydrophobic porous polymers |
| GB0100761D0 (en) | 2001-01-11 | 2001-02-21 | Biocompatibles Ltd | Drug delivery from stents |
| US6780424B2 (en) | 2001-03-30 | 2004-08-24 | Charles David Claude | Controlled morphologies in polymer drug for release of drugs from polymer films |
| SK287686B6 (sk) * | 2001-04-10 | 2011-06-06 | Ciba Specialty Chemicals Holding Inc. | Izolačná kompozícia na strednonapäťové a vysokonapäťové káble a spôsob jej výroby |
| US6743462B1 (en) * | 2001-05-31 | 2004-06-01 | Advanced Cardiovascular Systems, Inc. | Apparatus and method for coating implantable devices |
| US6695920B1 (en) * | 2001-06-27 | 2004-02-24 | Advanced Cardiovascular Systems, Inc. | Mandrel for supporting a stent and a method of using the mandrel to coat a stent |
| US8741378B1 (en) | 2001-06-27 | 2014-06-03 | Advanced Cardiovascular Systems, Inc. | Methods of coating an implantable device |
| US6565659B1 (en) * | 2001-06-28 | 2003-05-20 | Advanced Cardiovascular Systems, Inc. | Stent mounting assembly and a method of using the same to coat a stent |
| US7682669B1 (en) | 2001-07-30 | 2010-03-23 | Advanced Cardiovascular Systems, Inc. | Methods for covalently immobilizing anti-thrombogenic material into a coating on a medical device |
| US8303651B1 (en) | 2001-09-07 | 2012-11-06 | Advanced Cardiovascular Systems, Inc. | Polymeric coating for reducing the rate of release of a therapeutic substance from a stent |
| US6753071B1 (en) * | 2001-09-27 | 2004-06-22 | Advanced Cardiovascular Systems, Inc. | Rate-reducing membrane for release of an agent |
| KR101173497B1 (ko) * | 2002-03-11 | 2012-08-14 | 알콘, 인코퍼레이티드 | 이식 가능한 약물 전달 시스템 |
| AUPS275302A0 (en) * | 2002-05-31 | 2002-06-27 | Khouri, Anthony | Vehicle mounted concrete mixing drum and method of manufacture thereof |
| US7011842B1 (en) | 2002-06-21 | 2006-03-14 | Advanced Cardiovascular Systems, Inc. | Polycationic peptide coatings and methods of making the same |
| US7794743B2 (en) * | 2002-06-21 | 2010-09-14 | Advanced Cardiovascular Systems, Inc. | Polycationic peptide coatings and methods of making the same |
| US7217426B1 (en) | 2002-06-21 | 2007-05-15 | Advanced Cardiovascular Systems, Inc. | Coatings containing polycationic peptides for cardiovascular therapy |
| US6994867B1 (en) | 2002-06-21 | 2006-02-07 | Advanced Cardiovascular Systems, Inc. | Biocompatible carrier containing L-arginine |
| US7056523B1 (en) | 2002-06-21 | 2006-06-06 | Advanced Cardiovascular Systems, Inc. | Implantable medical devices incorporating chemically conjugated polymers and oligomers of L-arginine |
| US7070798B1 (en) | 2002-06-21 | 2006-07-04 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable medical devices incorporating chemically-bound polymers and oligomers of L-arginine |
| US8506617B1 (en) | 2002-06-21 | 2013-08-13 | Advanced Cardiovascular Systems, Inc. | Micronized peptide coated stent |
| US7033602B1 (en) | 2002-06-21 | 2006-04-25 | Advanced Cardiovascular Systems, Inc. | Polycationic peptide coatings and methods of coating implantable medical devices |
| US6896965B1 (en) * | 2002-11-12 | 2005-05-24 | Advanced Cardiovascular Systems, Inc. | Rate limiting barriers for implantable devices |
| US7776926B1 (en) * | 2002-12-11 | 2010-08-17 | Advanced Cardiovascular Systems, Inc. | Biocompatible coating for implantable medical devices |
| US7758880B2 (en) | 2002-12-11 | 2010-07-20 | Advanced Cardiovascular Systems, Inc. | Biocompatible polyacrylate compositions for medical applications |
| US7074276B1 (en) * | 2002-12-12 | 2006-07-11 | Advanced Cardiovascular Systems, Inc. | Clamp mandrel fixture and a method of using the same to minimize coating defects |
| US20060002968A1 (en) * | 2004-06-30 | 2006-01-05 | Gordon Stewart | Anti-proliferative and anti-inflammatory agent combination for treatment of vascular disorders |
| US7094256B1 (en) | 2002-12-16 | 2006-08-22 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable medical device containing polycationic peptides |
| US7758881B2 (en) * | 2004-06-30 | 2010-07-20 | Advanced Cardiovascular Systems, Inc. | Anti-proliferative and anti-inflammatory agent combination for treatment of vascular disorders with an implantable medical device |
| US8435550B2 (en) * | 2002-12-16 | 2013-05-07 | Abbot Cardiovascular Systems Inc. | Anti-proliferative and anti-inflammatory agent combination for treatment of vascular disorders with an implantable medical device |
| US7144419B2 (en) * | 2003-01-24 | 2006-12-05 | Medtronic Vascular, Inc. | Drug-polymer coated stent with blended phenoxy and styrenic block copolymers |
| US7063884B2 (en) * | 2003-02-26 | 2006-06-20 | Advanced Cardiovascular Systems, Inc. | Stent coating |
| US20080215137A1 (en) * | 2003-04-30 | 2008-09-04 | Boston Scientific Scimed, Inc. | Therapeutic driving layer for a medical device |
| US20040220656A1 (en) * | 2003-04-30 | 2004-11-04 | Epstein Samuel J. | Coated medical devices and methods of making the same |
| CA2524323C (en) * | 2003-05-02 | 2012-05-15 | Cardiome Pharma Corp. | Aminocyclohexyl ether compounds and uses thereof |
| US20090041841A1 (en) * | 2003-05-02 | 2009-02-12 | Cardiome Pharma Corp. | Controlled release tablet formulations for the prevention of arrhythmias |
| US7345086B2 (en) * | 2003-05-02 | 2008-03-18 | Cardiome Pharma Corp. | Uses of ion channel modulating compounds |
| US7279174B2 (en) * | 2003-05-08 | 2007-10-09 | Advanced Cardiovascular Systems, Inc. | Stent coatings comprising hydrophilic additives |
| US20050118344A1 (en) | 2003-12-01 | 2005-06-02 | Pacetti Stephen D. | Temperature controlled crimping |
| US20050021127A1 (en) * | 2003-07-21 | 2005-01-27 | Kawula Paul John | Porous glass fused onto stent for drug retention |
| CA2445420A1 (en) * | 2003-07-29 | 2005-01-29 | Invitrogen Corporation | Kinase and phosphatase assays |
| US7727752B2 (en) | 2003-07-29 | 2010-06-01 | Life Technologies Corporation | Kinase and phosphatase assays |
| US7619059B2 (en) * | 2003-07-29 | 2009-11-17 | Life Technologies Corporation | Bimolecular optical probes |
| US7785512B1 (en) | 2003-07-31 | 2010-08-31 | Advanced Cardiovascular Systems, Inc. | Method and system of controlled temperature mixing and molding of polymers with active agents for implantable medical devices |
| WO2005018635A2 (en) * | 2003-08-07 | 2005-03-03 | Cardiome Pharma Corp. | Ion channel modulating activity i |
| NZ592039A (en) | 2003-08-27 | 2013-03-28 | Ophthotech Corp | Combination therapy for the treatment of ocular neovascular disorders |
| US20050064485A1 (en) * | 2003-09-12 | 2005-03-24 | Kurt Vogel | Multiplex binding and activity assays |
| US7198675B2 (en) * | 2003-09-30 | 2007-04-03 | Advanced Cardiovascular Systems | Stent mandrel fixture and method for selectively coating surfaces of a stent |
| CA2549579A1 (en) * | 2003-10-07 | 2005-04-28 | Centelion | Anti-vascular and anti-proliferation methods, therapies, and combinations employing specific tyrosine kinase inhibitors |
| US7345087B2 (en) * | 2003-10-31 | 2008-03-18 | Cardiome Pharma Corp. | Aminocyclohexyl ether compounds and uses thereof |
| US7261946B2 (en) * | 2003-11-14 | 2007-08-28 | Advanced Cardiovascular Systems, Inc. | Block copolymers of acrylates and methacrylates with fluoroalkenes |
| US9114198B2 (en) * | 2003-11-19 | 2015-08-25 | Advanced Cardiovascular Systems, Inc. | Biologically beneficial coatings for implantable devices containing fluorinated polymers and methods for fabricating the same |
| US8192752B2 (en) * | 2003-11-21 | 2012-06-05 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable devices including biologically erodable polyesters and methods for fabricating the same |
| US7220816B2 (en) * | 2003-12-16 | 2007-05-22 | Advanced Cardiovascular Systems, Inc. | Biologically absorbable coatings for implantable devices based on poly(ester amides) and methods for fabricating the same |
| US7435788B2 (en) * | 2003-12-19 | 2008-10-14 | Advanced Cardiovascular Systems, Inc. | Biobeneficial polyamide/polyethylene glycol polymers for use with drug eluting stents |
| US7563324B1 (en) | 2003-12-29 | 2009-07-21 | Advanced Cardiovascular Systems Inc. | System and method for coating an implantable medical device |
| TWI332003B (en) * | 2004-01-30 | 2010-10-21 | Lilly Co Eli | Kinase inhibitors |
| US8685431B2 (en) * | 2004-03-16 | 2014-04-01 | Advanced Cardiovascular Systems, Inc. | Biologically absorbable coatings for implantable devices based on copolymers having ester bonds and methods for fabricating the same |
| US8778014B1 (en) | 2004-03-31 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Coatings for preventing balloon damage to polymer coated stents |
| CA2561819A1 (en) | 2004-04-01 | 2005-12-01 | Cardiome Pharma Corp. | Prodrugs of ion channel modulating compounds and uses thereof |
| WO2005097087A2 (en) * | 2004-04-01 | 2005-10-20 | Cardiome Pharma Corp. | Merged ion channel modulating compounds and uses thereof |
| US7553377B1 (en) | 2004-04-27 | 2009-06-30 | Advanced Cardiovascular Systems, Inc. | Apparatus and method for electrostatic coating of an abluminal stent surface |
| US20050265960A1 (en) * | 2004-05-26 | 2005-12-01 | Pacetti Stephen D | Polymers containing poly(ester amides) and agents for use with medical articles and methods of fabricating the same |
| US8293890B2 (en) * | 2004-04-30 | 2012-10-23 | Advanced Cardiovascular Systems, Inc. | Hyaluronic acid based copolymers |
| US7820732B2 (en) * | 2004-04-30 | 2010-10-26 | Advanced Cardiovascular Systems, Inc. | Methods for modulating thermal and mechanical properties of coatings on implantable devices |
| US20050288481A1 (en) * | 2004-04-30 | 2005-12-29 | Desnoyer Jessica R | Design of poly(ester amides) for the control of agent-release from polymeric compositions |
| US9561309B2 (en) * | 2004-05-27 | 2017-02-07 | Advanced Cardiovascular Systems, Inc. | Antifouling heparin coatings |
| US20050271700A1 (en) * | 2004-06-03 | 2005-12-08 | Desnoyer Jessica R | Poly(ester amide) coating composition for implantable devices |
| US7563780B1 (en) | 2004-06-18 | 2009-07-21 | Advanced Cardiovascular Systems, Inc. | Heparin prodrugs and drug delivery stents formed therefrom |
| US20050287184A1 (en) | 2004-06-29 | 2005-12-29 | Hossainy Syed F A | Drug-delivery stent formulations for restenosis and vulnerable plaque |
| US7494665B1 (en) * | 2004-07-30 | 2009-02-24 | Advanced Cardiovascular Systems, Inc. | Polymers containing siloxane monomers |
| US8357391B2 (en) | 2004-07-30 | 2013-01-22 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable devices comprising poly (hydroxy-alkanoates) and diacid linkages |
| US7311980B1 (en) | 2004-08-02 | 2007-12-25 | Advanced Cardiovascular Systems, Inc. | Polyactive/polylactic acid coatings for an implantable device |
| US7648727B2 (en) * | 2004-08-26 | 2010-01-19 | Advanced Cardiovascular Systems, Inc. | Methods for manufacturing a coated stent-balloon assembly |
| US7244443B2 (en) * | 2004-08-31 | 2007-07-17 | Advanced Cardiovascular Systems, Inc. | Polymers of fluorinated monomers and hydrophilic monomers |
| US8110211B2 (en) * | 2004-09-22 | 2012-02-07 | Advanced Cardiovascular Systems, Inc. | Medicated coatings for implantable medical devices including polyacrylates |
| US9011831B2 (en) * | 2004-09-30 | 2015-04-21 | Advanced Cardiovascular Systems, Inc. | Methacrylate copolymers for medical devices |
| US7166680B2 (en) * | 2004-10-06 | 2007-01-23 | Advanced Cardiovascular Systems, Inc. | Blends of poly(ester amide) polymers |
| US20060083770A1 (en) * | 2004-10-15 | 2006-04-20 | Specialty Coating Systems, Inc. | Medical devices and methods of preparation and use |
| US7862835B2 (en) * | 2004-10-27 | 2011-01-04 | Boston Scientific Scimed, Inc. | Method of manufacturing a medical device having a porous coating thereon |
| US20060089485A1 (en) * | 2004-10-27 | 2006-04-27 | Desnoyer Jessica R | End-capped poly(ester amide) copolymers |
| US8603634B2 (en) | 2004-10-27 | 2013-12-10 | Abbott Cardiovascular Systems Inc. | End-capped poly(ester amide) copolymers |
| US7481835B1 (en) | 2004-10-29 | 2009-01-27 | Advanced Cardiovascular Systems, Inc. | Encapsulated covered stent |
| US7390497B2 (en) * | 2004-10-29 | 2008-06-24 | Advanced Cardiovascular Systems, Inc. | Poly(ester amide) filler blends for modulation of coating properties |
| US20060095122A1 (en) * | 2004-10-29 | 2006-05-04 | Advanced Cardiovascular Systems, Inc. | Implantable devices comprising biologically absorbable star polymers and methods for fabricating the same |
| US8263638B2 (en) * | 2004-11-08 | 2012-09-11 | Cardiome Pharma Corp. | Dosing regimens for ion channel modulating compounds |
| US7214759B2 (en) * | 2004-11-24 | 2007-05-08 | Advanced Cardiovascular Systems, Inc. | Biologically absorbable coatings for implantable devices based on polyesters and methods for fabricating the same |
| US8609123B2 (en) * | 2004-11-29 | 2013-12-17 | Advanced Cardiovascular Systems, Inc. | Derivatized poly(ester amide) as a biobeneficial coating |
| US20060115449A1 (en) * | 2004-11-30 | 2006-06-01 | Advanced Cardiovascular Systems, Inc. | Bioabsorbable, biobeneficial, tyrosine-based polymers for use in drug eluting stent coatings |
| US7892592B1 (en) | 2004-11-30 | 2011-02-22 | Advanced Cardiovascular Systems, Inc. | Coating abluminal surfaces of stents and other implantable medical devices |
| US7632307B2 (en) | 2004-12-16 | 2009-12-15 | Advanced Cardiovascular Systems, Inc. | Abluminal, multilayer coating constructs for drug-delivery stents |
| US7604818B2 (en) | 2004-12-22 | 2009-10-20 | Advanced Cardiovascular Systems, Inc. | Polymers of fluorinated monomers and hydrocarbon monomers |
| US7419504B2 (en) * | 2004-12-27 | 2008-09-02 | Advanced Cardiovascular Systems, Inc. | Poly(ester amide) block copolymers |
| US8007775B2 (en) * | 2004-12-30 | 2011-08-30 | Advanced Cardiovascular Systems, Inc. | Polymers containing poly(hydroxyalkanoates) and agents for use with medical articles and methods of fabricating the same |
| US7202325B2 (en) | 2005-01-14 | 2007-04-10 | Advanced Cardiovascular Systems, Inc. | Poly(hydroxyalkanoate-co-ester amides) and agents for use with medical articles |
| US9381279B2 (en) | 2005-03-24 | 2016-07-05 | Abbott Cardiovascular Systems Inc. | Implantable devices formed on non-fouling methacrylate or acrylate polymers |
| US7700659B2 (en) * | 2005-03-24 | 2010-04-20 | Advanced Cardiovascular Systems, Inc. | Implantable devices formed of non-fouling methacrylate or acrylate polymers |
| US20060216431A1 (en) * | 2005-03-28 | 2006-09-28 | Kerrigan Cameron K | Electrostatic abluminal coating of a stent crimped on a balloon catheter |
| US7795467B1 (en) | 2005-04-26 | 2010-09-14 | Advanced Cardiovascular Systems, Inc. | Bioabsorbable, biobeneficial polyurethanes for use in medical devices |
| US7637941B1 (en) | 2005-05-11 | 2009-12-29 | Advanced Cardiovascular Systems, Inc. | Endothelial cell binding coatings for rapid encapsulation of bioerodable stents |
| US7622070B2 (en) * | 2005-06-20 | 2009-11-24 | Advanced Cardiovascular Systems, Inc. | Method of manufacturing an implantable polymeric medical device |
| US7823533B2 (en) * | 2005-06-30 | 2010-11-02 | Advanced Cardiovascular Systems, Inc. | Stent fixture and method for reducing coating defects |
| US8021676B2 (en) | 2005-07-08 | 2011-09-20 | Advanced Cardiovascular Systems, Inc. | Functionalized chemically inert polymers for coatings |
| US7785647B2 (en) * | 2005-07-25 | 2010-08-31 | Advanced Cardiovascular Systems, Inc. | Methods of providing antioxidants to a drug containing product |
| US7735449B1 (en) | 2005-07-28 | 2010-06-15 | Advanced Cardiovascular Systems, Inc. | Stent fixture having rounded support structures and method for use thereof |
| US20070128246A1 (en) * | 2005-12-06 | 2007-06-07 | Hossainy Syed F A | Solventless method for forming a coating |
| US20070135909A1 (en) * | 2005-12-08 | 2007-06-14 | Desnoyer Jessica R | Adhesion polymers to improve stent retention |
| US7976891B1 (en) | 2005-12-16 | 2011-07-12 | Advanced Cardiovascular Systems, Inc. | Abluminal stent coating apparatus and method of using focused acoustic energy |
| US7591841B2 (en) | 2005-12-16 | 2009-09-22 | Advanced Cardiovascular Systems, Inc. | Implantable devices for accelerated healing |
| US7867547B2 (en) | 2005-12-19 | 2011-01-11 | Advanced Cardiovascular Systems, Inc. | Selectively coating luminal surfaces of stents |
| US7638156B1 (en) | 2005-12-19 | 2009-12-29 | Advanced Cardiovascular Systems, Inc. | Apparatus and method for selectively coating a medical article |
| US20070148390A1 (en) * | 2005-12-27 | 2007-06-28 | Specialty Coating Systems, Inc. | Fluorinated coatings |
| US20070196428A1 (en) * | 2006-02-17 | 2007-08-23 | Thierry Glauser | Nitric oxide generating medical devices |
| US7601383B2 (en) * | 2006-02-28 | 2009-10-13 | Advanced Cardiovascular Systems, Inc. | Coating construct containing poly (vinyl alcohol) |
| US7713637B2 (en) * | 2006-03-03 | 2010-05-11 | Advanced Cardiovascular Systems, Inc. | Coating containing PEGylated hyaluronic acid and a PEGylated non-hyaluronic acid polymer |
| US20070231363A1 (en) * | 2006-03-29 | 2007-10-04 | Yung-Ming Chen | Coatings formed from stimulus-sensitive material |
| US20070259101A1 (en) * | 2006-05-02 | 2007-11-08 | Kleiner Lothar W | Microporous coating on medical devices |
| US8304012B2 (en) * | 2006-05-04 | 2012-11-06 | Advanced Cardiovascular Systems, Inc. | Method for drying a stent |
| US8003156B2 (en) | 2006-05-04 | 2011-08-23 | Advanced Cardiovascular Systems, Inc. | Rotatable support elements for stents |
| US7985441B1 (en) | 2006-05-04 | 2011-07-26 | Yiwen Tang | Purification of polymers for coating applications |
| US7775178B2 (en) * | 2006-05-26 | 2010-08-17 | Advanced Cardiovascular Systems, Inc. | Stent coating apparatus and method |
| US8568764B2 (en) * | 2006-05-31 | 2013-10-29 | Advanced Cardiovascular Systems, Inc. | Methods of forming coating layers for medical devices utilizing flash vaporization |
| US9561351B2 (en) * | 2006-05-31 | 2017-02-07 | Advanced Cardiovascular Systems, Inc. | Drug delivery spiral coil construct |
| US8703167B2 (en) | 2006-06-05 | 2014-04-22 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable medical devices for controlled release of a hydrophilic drug and a hydrophobic drug |
| US20080124372A1 (en) * | 2006-06-06 | 2008-05-29 | Hossainy Syed F A | Morphology profiles for control of agent release rates from polymer matrices |
| US8778376B2 (en) | 2006-06-09 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Copolymer comprising elastin pentapeptide block and hydrophilic block, and medical device and method of treating |
| US20070286882A1 (en) * | 2006-06-09 | 2007-12-13 | Yiwen Tang | Solvent systems for coating medical devices |
| US8114150B2 (en) | 2006-06-14 | 2012-02-14 | Advanced Cardiovascular Systems, Inc. | RGD peptide attached to bioabsorbable stents |
| US20080095918A1 (en) * | 2006-06-14 | 2008-04-24 | Kleiner Lothar W | Coating construct with enhanced interfacial compatibility |
| US8603530B2 (en) | 2006-06-14 | 2013-12-10 | Abbott Cardiovascular Systems Inc. | Nanoshell therapy |
| US8048448B2 (en) * | 2006-06-15 | 2011-11-01 | Abbott Cardiovascular Systems Inc. | Nanoshells for drug delivery |
| US8017237B2 (en) | 2006-06-23 | 2011-09-13 | Abbott Cardiovascular Systems, Inc. | Nanoshells on polymers |
| US8956640B2 (en) * | 2006-06-29 | 2015-02-17 | Advanced Cardiovascular Systems, Inc. | Block copolymers including a methoxyethyl methacrylate midblock |
| US20080008736A1 (en) * | 2006-07-06 | 2008-01-10 | Thierry Glauser | Random copolymers of methacrylates and acrylates |
| US9028859B2 (en) * | 2006-07-07 | 2015-05-12 | Advanced Cardiovascular Systems, Inc. | Phase-separated block copolymer coatings for implantable medical devices |
| US8703169B1 (en) | 2006-08-15 | 2014-04-22 | Abbott Cardiovascular Systems Inc. | Implantable device having a coating comprising carrageenan and a biostable polymer |
| US20080085293A1 (en) * | 2006-08-22 | 2008-04-10 | Jenchen Yang | Drug eluting stent and therapeutic methods using c-Jun N-terminal kinase inhibitor |
| JP5557373B2 (ja) * | 2006-11-21 | 2014-07-23 | アボット ラボラトリーズ | 薬剤溶出性コーティングにおけるテトラフルオロエチレン、ヘキサフルオロプロピレン、及びフッ化ビニリデンのターポリマーの使用 |
| US7713541B1 (en) * | 2006-11-21 | 2010-05-11 | Abbott Cardiovascular Systems Inc. | Zwitterionic terpolymers, method of making and use on medical devices |
| US20080118541A1 (en) * | 2006-11-21 | 2008-05-22 | Abbott Laboratories | Use of a terpolymer of tetrafluoroethylene, hexafluoropropylene, and vinylidene fluoride in drug eluting coatings on medical devices |
| US8597673B2 (en) * | 2006-12-13 | 2013-12-03 | Advanced Cardiovascular Systems, Inc. | Coating of fast absorption or dissolution |
| US8017141B2 (en) | 2006-12-15 | 2011-09-13 | Advanced Cardiovascular Systems, Inc. | Coatings of acrylamide-based copolymers |
| PE20090288A1 (es) * | 2007-05-10 | 2009-04-03 | Smithkline Beecham Corp | Derivados de quinoxalina como inhibidores de la pi3 quinasa |
| US20080286332A1 (en) | 2007-05-14 | 2008-11-20 | Pacetti Stephen D | Implantable medical devices with a topcoat layer of phosphoryl choline acrylate polymer for reduced thrombosis, and improved mechanical properties |
| US8147769B1 (en) | 2007-05-16 | 2012-04-03 | Abbott Cardiovascular Systems Inc. | Stent and delivery system with reduced chemical degradation |
| US9056155B1 (en) | 2007-05-29 | 2015-06-16 | Abbott Cardiovascular Systems Inc. | Coatings having an elastic primer layer |
| US8048441B2 (en) | 2007-06-25 | 2011-11-01 | Abbott Cardiovascular Systems, Inc. | Nanobead releasing medical devices |
| US8109904B1 (en) | 2007-06-25 | 2012-02-07 | Abbott Cardiovascular Systems Inc. | Drug delivery medical devices |
| US20090041845A1 (en) * | 2007-08-08 | 2009-02-12 | Lothar Walter Kleiner | Implantable medical devices having thin absorbable coatings |
| US10301265B2 (en) * | 2008-05-28 | 2019-05-28 | Virginia I. Roxas-Duncan | Small molecule inhibitors of botulinum neurotoxins |
| WO2010099139A2 (en) | 2009-02-25 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Combination anti-cancer therapy |
| WO2010099363A1 (en) | 2009-02-27 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| WO2010099138A2 (en) | 2009-02-27 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| WO2010099364A2 (en) | 2009-02-27 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| EP2241557A1 (de) | 2009-04-02 | 2010-10-20 | Æterna Zentaris GmbH | Chinoxalin-Derivate und deren Anwendung zur Behandlung gutartiger und bösartiger Tumorerkrankungen |
| GB0908905D0 (en) | 2009-05-26 | 2009-07-01 | Sentinel Oncology Ltd | Pharmaceutical compounds |
| US10253020B2 (en) | 2009-06-12 | 2019-04-09 | Abivax | Compounds for preventing, inhibiting, or treating cancer, AIDS and/or premature aging |
| US8685433B2 (en) | 2010-03-31 | 2014-04-01 | Abbott Cardiovascular Systems Inc. | Absorbable coating for implantable device |
| DK2624695T3 (en) | 2010-10-08 | 2016-01-04 | Nivalis Therapeutics Inc | NOVEL SUBSTITUTED quinoline-RELATIONS AS S-NITROSOGLUTATHIONREDUKTASEINHIBITORER |
| AU2011343518B2 (en) | 2010-12-16 | 2016-11-10 | Nivalis Therapeutics, Inc. | Novel substituted bicyclic aromatic compounds as S-nitrosoglutathione reductase inhibitors |
| WO2012149014A1 (en) | 2011-04-25 | 2012-11-01 | OSI Pharmaceuticals, LLC | Use of emt gene signatures in cancer drug discovery, diagnostics, and treatment |
| WO2013152252A1 (en) | 2012-04-06 | 2013-10-10 | OSI Pharmaceuticals, LLC | Combination anti-cancer therapy |
| EP2757161A1 (en) | 2013-01-17 | 2014-07-23 | Splicos | miRNA-124 as a biomarker of viral infection |
| ES2721441T3 (es) | 2013-10-25 | 2019-07-31 | Kuraray Co | Composición adhesiva termofusible |
| WO2015156674A2 (en) | 2014-04-10 | 2015-10-15 | Stichting Het Nederlands Kanker Instituut | Method for treating cancer |
| EP2974729A1 (en) | 2014-07-17 | 2016-01-20 | Abivax | Quinoline derivatives for use in the treatment of inflammatory diseases |
| WO2016121607A1 (ja) | 2015-01-27 | 2016-08-04 | 株式会社クラレ | アクリル系ブロック共重合体および粘接着剤組成物 |
| WO2017044766A1 (en) | 2015-09-10 | 2017-03-16 | Nivalis Therapeutics, Inc. | Solid forms of an s-nitrosoglutathione reductase inhibitor |
| EP3669873A1 (en) | 2018-12-20 | 2020-06-24 | Abivax | Quinoline derivatives for use ine the traeatment of inflammation diseases |
Family Cites Families (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272824A (en) | 1962-12-06 | 1966-09-13 | Norwich Pharma Co | 4-amino-6, 7-di(lower) alkoxyquinolines |
| DE2913728A1 (de) * | 1979-04-05 | 1980-10-16 | Bayer Ag | 2-sulfonyl-chinoxaline, verfahren zu ihrer herstellung sowie ihre verwendung als mikrobizide |
| NZ194196A (en) * | 1979-07-17 | 1983-07-15 | Ici Australia Ltd | -(quinoxalin-2-yl(oxy or thio) phen (oxy or ylthio)-alkanoic acid derivatives or precursors |
| US4358307A (en) | 1979-10-02 | 1982-11-09 | Ici Australia Limited | Herbicidal quinoxaline carboxylic acid derivatives |
| US4462994A (en) | 1981-05-19 | 1984-07-31 | Nissan Chemical Industries, Inc. | N-Containing heterocyclic ring-substituted O-arylphosphate derivatives, preparation thereof, and insecticides, acaricides and nematocides containing said derivatives |
| IT1226045B (it) * | 1981-07-29 | 1990-12-10 | Simes | Derivati tetraidrochinolici |
| US4661499A (en) | 1985-06-18 | 1987-04-28 | Merck Frosst Canada, Inc. | 2-[(substituted)-phenoxymethyl]quinolines |
| US4888427A (en) | 1987-04-07 | 1989-12-19 | University Of Florida | Amino acids containing dihydropyridine ring systems for site-specific delivery of peptides to the brain |
| US5120348A (en) | 1988-01-06 | 1992-06-09 | Uniroyal Chemical Company, Inc. | Heterocyclic-alkylene quinoxalinyloxyphenoxypropanoate herbicides |
| US5319102A (en) | 1988-01-06 | 1994-06-07 | Uniroyal Chemical Company, Inc. | Heterocyclic-alkylene quinoxalinyloxyphenoxypropanoate herbicides |
| GB8907865D0 (en) * | 1989-04-07 | 1989-05-24 | Wyeth John & Brother Ltd | Tetrahydroquinoline derivatives |
| DE69110787T2 (de) * | 1990-02-28 | 1996-04-04 | Medtronic, Inc., Minneapolis, Minn. | Intraluminale prothese mit wirkstoffeluierung. |
| GB9004483D0 (en) | 1990-02-28 | 1990-04-25 | Erba Carlo Spa | New aryl-and heteroarylethenylene derivatives and process for their preparation |
| US5710158A (en) | 1991-05-10 | 1998-01-20 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Aryl and heteroaryl quinazoline compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| SG64322A1 (en) | 1991-05-10 | 1999-04-27 | Rhone Poulenc Rorer Int | Bis mono and bicyclic aryl and heteroaryl compounds which inhibit egf and/or pdgf receptor tyrosine kinase |
| US5480883A (en) | 1991-05-10 | 1996-01-02 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Bis mono- and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| US5823853A (en) * | 1996-07-18 | 1998-10-20 | Speedfam Corporation | Apparatus for the in-process detection of workpieces with a monochromatic light source |
| US6177401B1 (en) | 1992-11-13 | 2001-01-23 | Max-Planck-Gesellschaft Zur Forderung Der Wissenschaften | Use of organic compounds for the inhibition of Flk-1 mediated vasculogenesis and angiogenesis |
| US5336518A (en) | 1992-12-11 | 1994-08-09 | Cordis Corporation | Treatment of metallic surfaces using radiofrequency plasma deposition and chemical attachment of bioactive agents |
| US5700823A (en) | 1994-01-07 | 1997-12-23 | Sugen, Inc. | Treatment of platelet derived growth factor related disorders such as cancers |
| WO1995024190A2 (en) | 1994-03-07 | 1995-09-14 | Sugen, Inc. | Receptor tyrosine kinase inhibitors for inhibiting cell proliferative disorders and compositions thereof |
| DE4426373A1 (de) | 1994-07-26 | 1996-02-01 | Bayer Ag | 3-Substituierte Chinolin-5-carbonsäurederivate und Verfahren zu ihrer Herstellung |
| US5637113A (en) | 1994-12-13 | 1997-06-10 | Advanced Cardiovascular Systems, Inc. | Polymer film for wrapping a stent structure |
| AU4355296A (en) | 1994-12-28 | 1996-07-19 | Sankyo Company Limited | Indole derivatives |
| US5605696A (en) | 1995-03-30 | 1997-02-25 | Advanced Cardiovascular Systems, Inc. | Drug loaded polymeric material and method of manufacture |
| US5721277A (en) | 1995-04-21 | 1998-02-24 | Sugen, Inc. | Compounds and methods for inhibiting hyper-proliferative cell growth |
| AU716005B2 (en) | 1995-06-07 | 2000-02-17 | Cook Medical Technologies Llc | Implantable medical device |
| JP3476604B2 (ja) * | 1995-08-22 | 2003-12-10 | 鐘淵化学工業株式会社 | 薬剤を付着・コーティングしたステントの製造方法 |
| US6211215B1 (en) | 1996-07-19 | 2001-04-03 | Takeda Chemical Industries, Ltd. | Heterocyclic compounds, their production and use |
| WO1998031228A1 (en) * | 1997-01-21 | 1998-07-23 | Nissan Chemical Industries, Ltd. | Industrial antimicrobial/mildew-proofing agents, algicides and antifouling agents containing n-quinoxalylanilines |
| AU737252B2 (en) * | 1997-02-20 | 2001-08-16 | Cook Medical Technologies Llc | Coated implantable medical device |
| US6180632B1 (en) * | 1997-05-28 | 2001-01-30 | Aventis Pharmaceuticals Products Inc. | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| SI0991628T1 (en) | 1997-05-28 | 2005-06-30 | Aventis Pharmaceuticals Inc | QUINOLINE AND QUINOXALINE COMPOUNDS WHICH INHIBIT PLATELET-DERIVED GROWTH FACTOR AND/OR P56lck TYROSINE KINASES |
| US6245760B1 (en) * | 1997-05-28 | 2001-06-12 | Aventis Pharmaceuticals Products, Inc | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
-
1998
- 1998-11-24 US US09/198,718 patent/US6180632B1/en not_active Expired - Fee Related
-
1999
- 1999-11-23 CA CA002352261A patent/CA2352261A1/en not_active Abandoned
- 1999-11-23 CZ CZ20012276A patent/CZ20012276A3/cs unknown
- 1999-11-23 SK SK906-2001A patent/SK9062001A3/sk unknown
- 1999-11-23 IL IL14340699A patent/IL143406A0/xx unknown
- 1999-11-23 AU AU18294/00A patent/AU777256B2/en not_active Ceased
- 1999-11-23 UA UA2001064347A patent/UA76935C2/uk unknown
- 1999-11-23 EP EP99961784A patent/EP1133480A1/en not_active Withdrawn
- 1999-11-23 BR BR9915653-9A patent/BR9915653A/pt not_active Application Discontinuation
- 1999-11-23 NZ NZ512096A patent/NZ512096A/xx unknown
- 1999-11-23 PL PL99348979A patent/PL348979A1/xx unknown
- 1999-11-23 KR KR1020017006536A patent/KR100784291B1/ko not_active Expired - Fee Related
- 1999-11-23 CN CNB998157880A patent/CN100390154C/zh not_active Expired - Fee Related
- 1999-11-23 MX MXPA01005317A patent/MXPA01005317A/es active IP Right Grant
- 1999-11-23 ID IDW00200101350A patent/ID29611A/id unknown
- 1999-11-23 HU HU0104605A patent/HUP0104605A3/hu unknown
- 1999-11-23 JP JP2000583879A patent/JP2002530389A/ja active Pending
- 1999-11-23 EE EEP200100280A patent/EE200100280A/xx unknown
- 1999-11-23 EA EA200100579A patent/EA007534B1/ru not_active IP Right Cessation
- 1999-11-23 WO PCT/US1999/027825 patent/WO2000031051A1/en not_active Ceased
-
2000
- 2000-09-29 US US09/675,746 patent/US6528526B1/en not_active Expired - Fee Related
-
2001
- 2001-05-25 NO NO20012582A patent/NO319801B1/no unknown
- 2001-06-20 BG BG105625A patent/BG65497B1/bg unknown
-
2002
- 2002-12-12 US US10/317,464 patent/US6696434B2/en not_active Expired - Fee Related
-
2003
- 2003-02-04 US US10/357,882 patent/US6852712B2/en not_active Expired - Fee Related
- 2003-02-06 US US10/359,983 patent/US6821962B2/en not_active Expired - Fee Related
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8778375B2 (en) | 2005-04-29 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Amorphous poly(D,L-lactide) coating |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2002530389A5 (cg-RX-API-DMAC7.html) | ||
| JP2002530387A5 (cg-RX-API-DMAC7.html) | ||
| JP2843774B2 (ja) | 過増殖性血管疾患の治療薬 | |
| KR100784291B1 (ko) | 퀴놀린 및 퀴녹살린 화합물이 혼입된 중합체성 피복물을 갖는 스텐트 장치 | |
| US6534610B1 (en) | Hydrolytically degradable olefin copolymers | |
| ES2374386T3 (es) | Polímeros de monómeros fluorados y monómeros de hidrocarburo. | |
| JP2001527135A (ja) | オレフィン重合用担持触媒系 | |
| Sipos et al. | Controlled delivery of paclitaxel from stent coatings using poly (hydroxystyrene-b-isobutylene-b-hydroxystyrene) and its acetylated derivative | |
| HU215458B (hu) | Katalizátorhordozó és eljárás előállítására, hordozós metallocén katalizátorok, valamint felhasználásuk poliolefinek előállítására | |
| US20030008984A1 (en) | Novel catalyst system and the use thereof | |
| JP2007514808A (ja) | アクリレート及びメタクリレートのフルオロアルケンとのブロックコポリマー | |
| CA2360685A1 (en) | Methods for restoring and/or enhancing accommodation in pseudo phakia | |
| CA2449244A1 (en) | Negatively charged amphiphilic block copolymer as drug carrier and complex thereof with positively charged drug | |
| JP2003511540A5 (cg-RX-API-DMAC7.html) | ||
| JP5016309B2 (ja) | 医療用テープ剤 | |
| TW200613312A (en) | Magnesium compound, catalyst for olefin polymerization and method for producing olefin polymer | |
| DE60326469D1 (de) | Sprühgetrockneter polymerisationskatalysator und polymerisationsverfahren unter seiner verwendung | |
| JP2007533824A5 (cg-RX-API-DMAC7.html) | ||
| SG158131A1 (en) | Solid catalyst component and catalyst for olefin polymerization, and process for producing olefin polymer or copolymer | |
| JPH1053605A (ja) | 反応遅延剤を添加するc2−c12アルケンポリマーの製造方法 | |
| CA2656079A1 (en) | Cyclic amine compound | |
| JP2001511450A5 (cg-RX-API-DMAC7.html) | ||
| Soga et al. | Polymerization of propene with the XTiCl3/MgCl2–Al (i‐Bu) 3 catalyst system (X= cyclopentadienyl, pentamethylcyclopentadienyl, indenyl, and heptamethylindenyl) in the absence and presence of a lewis base | |
| DE50009515D1 (de) | Verfahren zur herstellung eines katalysatorfeststoffs zur olefinpolymerisation | |
| JP2008540618A5 (cg-RX-API-DMAC7.html) |