IT946871B - Turbina per filare - Google Patents
Turbina per filareInfo
- Publication number
- IT946871B IT946871B IT19746/72A IT1974672A IT946871B IT 946871 B IT946871 B IT 946871B IT 19746/72 A IT19746/72 A IT 19746/72A IT 1974672 A IT1974672 A IT 1974672A IT 946871 B IT946871 B IT 946871B
- Authority
- IT
- Italy
- Prior art keywords
- turbine
- wire
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H4/00—Open-end spinning machines or arrangements for imparting twist to independently moving fibres separated from slivers; Piecing arrangements therefor; Covering endless core threads with fibres by open-end spinning techniques
- D01H4/04—Open-end spinning machines or arrangements for imparting twist to independently moving fibres separated from slivers; Piecing arrangements therefor; Covering endless core threads with fibres by open-end spinning techniques imparting twist by contact of fibres with a running surface
- D01H4/08—Rotor spinning, i.e. the running surface being provided by a rotor
- D01H4/10—Rotors
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Spinning Or Twisting Of Yarns (AREA)
- Spinning Methods And Devices For Manufacturing Artificial Fibers (AREA)
- Processing And Handling Of Plastics And Other Materials For Molding In General (AREA)
- Lining Or Joining Of Plastics Or The Like (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2103718A DE2103718C2 (de) | 1971-01-27 | 1971-01-27 | Offenend-Spinnaggregat mit einem Spinnrotor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT946871B true IT946871B (it) | 1973-05-21 |
Family
ID=5797021
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT19746/72A IT946871B (it) | 1971-01-27 | 1972-01-24 | Turbina per filare |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3797962A (enExample) |
| DE (1) | DE2103718C2 (enExample) |
| FR (1) | FR2123468B1 (enExample) |
| GB (1) | GB1377853A (enExample) |
| IT (1) | IT946871B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3911659A (en) * | 1972-08-17 | 1975-10-14 | Rieter Ag Maschf | Bearing arrangement for a spinning rotor of an open end spinning device |
| JPS5024817U (enExample) * | 1973-06-29 | 1975-03-20 | ||
| CS169114B1 (enExample) * | 1973-10-24 | 1976-07-29 | ||
| DE2538261C3 (de) * | 1975-08-28 | 1981-08-06 | Skf Kugellagerfabriken Gmbh, 8720 Schweinfurt | Offenend-Spinneinrichtung |
| DE2721385A1 (de) * | 1977-05-12 | 1978-11-23 | Stahlecker Fritz | Vorrichtung zum abdichten einer oeffnung in der rueckwand eines rotorgehaeuses |
| NL7811164A (nl) * | 1978-11-10 | 1980-05-13 | Ihc Holland Nv | Afdichting van een as. |
| US4335886A (en) * | 1980-07-22 | 1982-06-22 | Cornell Pump Company | Labyrinth seal with current-forming sealing passages |
| US6830426B1 (en) * | 2002-07-11 | 2004-12-14 | David T. Stilcs | Gas injection seal system for a centrifugal pump |
| DE10237040B4 (de) * | 2002-08-07 | 2011-08-11 | Wilhelm Stahlecker GmbH, 73326 | Vorrichtung zum Abdichten einer Öffnung eines Rotorgehäuses |
| US20160326987A1 (en) * | 2014-02-19 | 2016-11-10 | Mitsubishi Heavy Industries, Ltd. | Thrust vectoring device |
| DE102016123698A1 (de) * | 2016-12-07 | 2018-06-07 | Saurer Germany Gmbh & Co. Kg | Spinnrotor für eine Offenend-Spinnvorrichtung und Offenend- Spinnvorrichtung |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2732232A (en) * | 1956-01-24 | whitfield | ||
| US835836A (en) * | 1906-02-27 | 1906-11-13 | Richard Schulz | Labyrinth packing for rotary machines. |
| GB190613004A (en) * | 1906-06-05 | 1907-02-14 | Wilhelm Heinrich Eyermann | Improvements in Stuffing Box Substitutes. |
| US963593A (en) * | 1909-07-23 | 1910-07-05 | Henri Legros | Centrifugal pump. |
| GB191315487A (en) * | 1912-08-15 | 1913-12-11 | William Laighton Tobey | Improved Exhaust Silencer for Internal Combustion Engines. |
| US2005429A (en) * | 1932-03-21 | 1935-06-18 | Foster Wheeler Corp | Centrifugal pump and the like |
| GB527811A (en) * | 1939-04-21 | 1940-10-16 | Albert Frank Collins | Oil throwers for roller bearing axleboxes and the like |
| US2729106A (en) * | 1952-11-01 | 1956-01-03 | Norden Ketay Corp | Air-supported gyroscope |
| DE1093628B (de) * | 1957-09-19 | 1960-11-24 | Goerlitzer Maschb Veb | Labyrinthspaltdichtung, insbesondere fuer Dampf- oder Gasturbinen |
| US3273906A (en) * | 1963-08-15 | 1966-09-20 | James A Pennington | Rotating shaft seal |
| FR1490165A (fr) * | 1966-03-05 | 1967-07-28 | Vyzk Ustav Bavlnarsky | Chambre de filage pour le filage continu sans anneau de fibres textiles sous dépression et machine à filer pourvue d'une chambre conforme ou similaire |
| AT268106B (de) * | 1966-03-05 | 1969-01-27 | Vyzk Ustav Bavlnarsky | Spinnkammer-Spinnvorrichtung zum kontinuierlichen Spinnen von Textilfasern mit Unterdruck |
| CH485876A (de) * | 1968-01-22 | 1970-02-15 | Elitex Zavody Textilniho | Maschine zum ringlosen, kontinuierlichen Feinspinnen von Garn |
| GB1297308A (enExample) * | 1969-03-20 | 1972-11-22 | ||
| GB1286960A (en) * | 1969-04-09 | 1972-08-31 | Tmm Research Ltd | Improvements relating to open-end spinning devices |
-
1971
- 1971-01-27 DE DE2103718A patent/DE2103718C2/de not_active Expired
-
1972
- 1972-01-24 GB GB330572A patent/GB1377853A/en not_active Expired
- 1972-01-24 IT IT19746/72A patent/IT946871B/it active
- 1972-01-25 US US00220597A patent/US3797962A/en not_active Expired - Lifetime
- 1972-01-27 FR FR7202698A patent/FR2123468B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2103718A1 (de) | 1972-08-17 |
| GB1377853A (en) | 1974-12-18 |
| DE2103718C2 (de) | 1982-08-05 |
| US3797962A (en) | 1974-03-19 |
| FR2123468A1 (enExample) | 1972-09-08 |
| FR2123468B1 (enExample) | 1975-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH539197A (de) | Turbine | |
| RO67319A (ro) | Pasta de dinti | |
| AT332136B (de) | Kopfbedeckung | |
| BE837736Q (fr) | Moissonneuse | |
| BE791162A (fr) | Rotor de turbine | |
| IT973418B (it) | Composizione per indicare tempera ture | |
| BE788968A (fr) | Caillebotis | |
| IT969869B (it) | Perfezionamenti relativi a mieti trebbia | |
| CH529914A (de) | Turbinenstufe | |
| IT946856B (it) | Turbina per filare | |
| IT974757B (it) | Motore | |
| IT946871B (it) | Turbina per filare | |
| CH537520A (de) | Turbolader | |
| MX147027A (es) | Procedimiento para producir azaspiranos | |
| FI54714C (fi) | Faergloes faergbildare foer anvaendning i tryckkaensliga kopieringssystem | |
| IT960686B (it) | Perfezionamenti ai contatori | |
| BE789658A (fr) | Compositions polyurethanne-goudron | |
| BE791856R (fr) | Perfectionnements aux | |
| AT320158B (de) | Zahnreinigungsmittel | |
| BE775619A (fr) | Compositions anesthesiques | |
| IT958450B (it) | Procedimento per produrre n 2 4 dialogeno s triazin 6 il uree | |
| IT944270B (it) | Procedimento per ottenere idroge noclorosilani | |
| BE782129A (fr) | Compositions topiques ameliorees | |
| BE786929A (fr) | Compositions aromatisantes | |
| IT974122B (it) | Raccoglitrici di radici |