IT946856B - Turbina per filare - Google Patents
Turbina per filareInfo
- Publication number
- IT946856B IT946856B IT19728/72A IT1972872A IT946856B IT 946856 B IT946856 B IT 946856B IT 19728/72 A IT19728/72 A IT 19728/72A IT 1972872 A IT1972872 A IT 1972872A IT 946856 B IT946856 B IT 946856B
- Authority
- IT
- Italy
- Prior art keywords
- turbine
- wire
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01H—SPINNING OR TWISTING
- D01H4/00—Open-end spinning machines or arrangements for imparting twist to independently moving fibres separated from slivers; Piecing arrangements therefor; Covering endless core threads with fibres by open-end spinning techniques
- D01H4/04—Open-end spinning machines or arrangements for imparting twist to independently moving fibres separated from slivers; Piecing arrangements therefor; Covering endless core threads with fibres by open-end spinning techniques imparting twist by contact of fibres with a running surface
- D01H4/08—Rotor spinning, i.e. the running surface being provided by a rotor
- D01H4/10—Rotors
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Textile Engineering (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Spinning Or Twisting Of Yarns (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712103717 DE2103717A1 (de) | 1971-01-27 | 1971-01-27 | Spinnturbine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT946856B true IT946856B (it) | 1973-05-21 |
Family
ID=5797020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT19728/72A IT946856B (it) | 1971-01-27 | 1972-01-22 | Turbina per filare |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3837154A (OSRAM) |
| DE (1) | DE2103717A1 (OSRAM) |
| FR (1) | FR2123467B1 (OSRAM) |
| GB (1) | GB1357695A (OSRAM) |
| IT (1) | IT946856B (OSRAM) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1383194A (en) * | 1970-10-08 | 1975-02-05 | Platt International Ltd | Open-end spinning apparatus |
| US3911659A (en) * | 1972-08-17 | 1975-10-14 | Rieter Ag Maschf | Bearing arrangement for a spinning rotor of an open end spinning device |
| DE2246791A1 (de) * | 1972-09-23 | 1974-03-28 | Fritz Stahlecker | Nach dem offen-end-verfahren arbeitende spinnmaschine |
| GB1434629A (en) * | 1973-09-21 | 1976-05-05 | Noguera J M | Yarn spinning apparatus |
| US4022007A (en) * | 1974-04-15 | 1977-05-10 | Kabushiki Kaisha Toyoda Jidoshokki Seisakusho | Cooling means for ringless spinning frame |
| DE2721385A1 (de) * | 1977-05-12 | 1978-11-23 | Stahlecker Fritz | Vorrichtung zum abdichten einer oeffnung in der rueckwand eines rotorgehaeuses |
| DE3020725C2 (de) * | 1980-05-31 | 1982-08-12 | Schubert & Salzer Maschinenfabrik Ag, 8070 Ingolstadt | Vorrichtung zum Abdichten einer Bohrung eines unter Unterdruck stehenden Rotorgehäuses |
| GB2129840A (en) * | 1982-11-12 | 1984-05-23 | John James Stamp | Open-end spinning rotors |
| DE3313926A1 (de) * | 1983-04-16 | 1984-10-18 | Stahlecker, Fritz, 7347 Bad Überkingen | Oe-rotorspinnmaschine mit einer in die offenen seiten der spinnrotoren einfuehrbaren reinigungseinrichtung |
| CA2161006A1 (en) * | 1993-05-04 | 1994-11-10 | Reinhard Konig | Centrifugal spinning process and device |
| DE102004052511A1 (de) * | 2004-10-21 | 2006-04-27 | Spindelfabrik Süssen Schurr Stahlecker & Grill GmbH | Lüfter für Spinnmaschinen |
| DE102014108526A1 (de) * | 2014-06-17 | 2015-12-17 | Maschinenfabrik Rieter Ag | Offenendspinnvorrichtung mit einer Zwischenkammer |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US27499A (en) * | 1860-03-13 | Improved feathering paddle-wheel | ||
| US3543500A (en) * | 1967-06-05 | 1970-12-01 | Tmm Research Ltd | Spinning of textile yarns |
| CH455597A (de) * | 1967-09-27 | 1968-07-15 | Rieter Ag Maschf | Spinnvorrichtung |
| CH457220A (de) * | 1967-09-27 | 1968-05-31 | Rieter Ag Maschf | Spinnvorrichtung |
| US3557542A (en) * | 1968-04-25 | 1971-01-26 | Lev Ivanovich Oskin | Twisting and forming device for pneumatic and mechanical spinning |
-
1971
- 1971-01-27 DE DE19712103717 patent/DE2103717A1/de active Pending
-
1972
- 1972-01-22 IT IT19728/72A patent/IT946856B/it active
- 1972-01-27 US US00221203A patent/US3837154A/en not_active Expired - Lifetime
- 1972-01-27 GB GB389672A patent/GB1357695A/en not_active Expired
- 1972-01-27 FR FR7202697A patent/FR2123467B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1357695A (en) | 1974-06-26 |
| FR2123467B1 (OSRAM) | 1975-10-24 |
| US3837154A (en) | 1974-09-24 |
| FR2123467A1 (OSRAM) | 1972-09-08 |
| DE2103717A1 (de) | 1972-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH539197A (de) | Turbine | |
| RO67319A (ro) | Pasta de dinti | |
| AT332136B (de) | Kopfbedeckung | |
| BE837736Q (fr) | Moissonneuse | |
| BE791162A (fr) | Rotor de turbine | |
| IT973418B (it) | Composizione per indicare tempera ture | |
| BE788968A (fr) | Caillebotis | |
| IT969869B (it) | Perfezionamenti relativi a mieti trebbia | |
| CH529914A (de) | Turbinenstufe | |
| IT946856B (it) | Turbina per filare | |
| IT974757B (it) | Motore | |
| IT946871B (it) | Turbina per filare | |
| CH537520A (de) | Turbolader | |
| MX147027A (es) | Procedimiento para producir azaspiranos | |
| FI54714B (fi) | Faergloes faergbildare foer anvaendning i tryckkaensliga kopieringssystem | |
| IT960686B (it) | Perfezionamenti ai contatori | |
| BE789658A (fr) | Compositions polyurethanne-goudron | |
| BE791856R (fr) | Perfectionnements aux | |
| AT320158B (de) | Zahnreinigungsmittel | |
| BE775619A (fr) | Compositions anesthesiques | |
| IT958450B (it) | Procedimento per produrre n 2 4 dialogeno s triazin 6 il uree | |
| IT944270B (it) | Procedimento per ottenere idroge noclorosilani | |
| BE782129A (fr) | Compositions topiques ameliorees | |
| BE786929A (fr) | Compositions aromatisantes | |
| IT974122B (it) | Raccoglitrici di radici |