IT1076328B - Lama o paletta per un motore a turbina a gas - Google Patents
Lama o paletta per un motore a turbina a gasInfo
- Publication number
- IT1076328B IT1076328B IT19761/77A IT1976177A IT1076328B IT 1076328 B IT1076328 B IT 1076328B IT 19761/77 A IT19761/77 A IT 19761/77A IT 1976177 A IT1976177 A IT 1976177A IT 1076328 B IT1076328 B IT 1076328B
- Authority
- IT
- Italy
- Prior art keywords
- shovel
- blade
- gas turbine
- turbine engine
- engine
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F01—MACHINES OR ENGINES IN GENERAL; ENGINE PLANTS IN GENERAL; STEAM ENGINES
- F01D—NON-POSITIVE DISPLACEMENT MACHINES OR ENGINES, e.g. STEAM TURBINES
- F01D5/00—Blades; Blade-carrying members; Heating, heat-insulating, cooling or antivibration means on the blades or the members
- F01D5/12—Blades
- F01D5/14—Form or construction
- F01D5/18—Hollow blades, i.e. blades with cooling or heating channels or cavities; Heating, heat-insulating or cooling means on blades
- F01D5/187—Convection cooling
- F01D5/188—Convection cooling with an insert in the blade cavity to guide the cooling fluid, e.g. forming a separation wall
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Turbine Rotor Nozzle Sealing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3464/76A GB1565361A (en) | 1976-01-29 | 1976-01-29 | Blade or vane for a gas turbine engien |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT1076328B true IT1076328B (it) | 1985-04-27 |
Family
ID=9758824
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT19761/77A IT1076328B (it) | 1976-01-29 | 1977-01-28 | Lama o paletta per un motore a turbina a gas |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4168938A (enExample) |
| DE (1) | DE2703815C3 (enExample) |
| FR (1) | FR2381178A1 (enExample) |
| GB (1) | GB1565361A (enExample) |
| IT (1) | IT1076328B (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4303374A (en) * | 1978-12-15 | 1981-12-01 | General Electric Company | Film cooled airfoil body |
| FR2473621A1 (fr) * | 1980-01-10 | 1981-07-17 | Snecma | Aube de distributeur de turbine |
| US4676719A (en) * | 1985-12-23 | 1987-06-30 | United Technologies Corporation | Film coolant passages for cast hollow airfoils |
| US4726735A (en) * | 1985-12-23 | 1988-02-23 | United Technologies Corporation | Film cooling slot with metered flow |
| US4664597A (en) * | 1985-12-23 | 1987-05-12 | United Technologies Corporation | Coolant passages with full coverage film cooling slot |
| US4669957A (en) * | 1985-12-23 | 1987-06-02 | United Technologies Corporation | Film coolant passage with swirl diffuser |
| US4770608A (en) * | 1985-12-23 | 1988-09-13 | United Technologies Corporation | Film cooled vanes and turbines |
| US4653983A (en) * | 1985-12-23 | 1987-03-31 | United Technologies Corporation | Cross-flow film cooling passages |
| US4684323A (en) * | 1985-12-23 | 1987-08-04 | United Technologies Corporation | Film cooling passages with curved corners |
| US4738588A (en) * | 1985-12-23 | 1988-04-19 | Field Robert E | Film cooling passages with step diffuser |
| US4705455A (en) * | 1985-12-23 | 1987-11-10 | United Technologies Corporation | Convergent-divergent film coolant passage |
| GB2202907A (en) * | 1987-03-26 | 1988-10-05 | Secr Defence | Cooled aerofoil components |
| US4859147A (en) * | 1988-01-25 | 1989-08-22 | United Technologies Corporation | Cooled gas turbine blade |
| GB2242941B (en) * | 1990-04-11 | 1994-05-04 | Rolls Royce Plc | A cooled gas turbine engine aerofoil |
| US5405242A (en) * | 1990-07-09 | 1995-04-11 | United Technologies Corporation | Cooled vane |
| GB2262314A (en) * | 1991-12-10 | 1993-06-16 | Rolls Royce Plc | Air cooled gas turbine engine aerofoil. |
| FR2689176B1 (fr) * | 1992-03-25 | 1995-07-13 | Snecma | Aube refrigeree de turbo-machine. |
| US5439354A (en) * | 1993-06-15 | 1995-08-08 | General Electric Company | Hollow airfoil impact resistance improvement |
| DE4447515C2 (de) * | 1993-11-22 | 1999-02-25 | Toshiba Kawasaki Kk | Gekühlte Turbinenschaufel |
| DE4445632C2 (de) * | 1994-12-21 | 1999-09-30 | Hermann Schwelling | Abfallpresse |
| EP0892151A1 (de) | 1997-07-15 | 1999-01-20 | Asea Brown Boveri AG | Kühlsystem für den Vorderkantenbereich einer hohlen Gasturbinenschaufel |
| US6283708B1 (en) * | 1999-12-03 | 2001-09-04 | United Technologies Corporation | Coolable vane or blade for a turbomachine |
| JP3782637B2 (ja) * | 2000-03-08 | 2006-06-07 | 三菱重工業株式会社 | ガスタービン冷却静翼 |
| US6468031B1 (en) * | 2000-05-16 | 2002-10-22 | General Electric Company | Nozzle cavity impingement/area reduction insert |
| US20090293495A1 (en) * | 2008-05-29 | 2009-12-03 | General Electric Company | Turbine airfoil with metered cooling cavity |
| CH699998A1 (de) * | 2008-11-26 | 2010-05-31 | Alstom Technology Ltd | Leitschaufel für eine Gasturbine. |
| US9011077B2 (en) * | 2011-04-20 | 2015-04-21 | Siemens Energy, Inc. | Cooled airfoil in a turbine engine |
| US9151173B2 (en) | 2011-12-15 | 2015-10-06 | General Electric Company | Use of multi-faceted impingement openings for increasing heat transfer characteristics on gas turbine components |
| CN102588000B (zh) * | 2012-03-12 | 2014-11-05 | 南京航空航天大学 | 涡轮叶片前缘沉槽肋内冷结构及其方法 |
| US9963982B2 (en) * | 2014-09-08 | 2018-05-08 | United Technologies Corporation | Casting optimized to improve suction side cooling shaped hole performance |
| US10053996B2 (en) * | 2014-12-12 | 2018-08-21 | United Technologies Corporation | Sliding baffle inserts |
| US10641113B2 (en) * | 2015-04-08 | 2020-05-05 | United Technologies Corporation | Airfoils |
| US10138735B2 (en) * | 2015-11-04 | 2018-11-27 | General Electric Company | Turbine airfoil internal core profile |
| US10364685B2 (en) * | 2016-08-12 | 2019-07-30 | Gneral Electric Company | Impingement system for an airfoil |
| US10436048B2 (en) * | 2016-08-12 | 2019-10-08 | General Electric Comapny | Systems for removing heat from turbine components |
| US10443397B2 (en) * | 2016-08-12 | 2019-10-15 | General Electric Company | Impingement system for an airfoil |
| US10408062B2 (en) * | 2016-08-12 | 2019-09-10 | General Electric Company | Impingement system for an airfoil |
| GB2555632A (en) * | 2016-11-07 | 2018-05-09 | Rolls Royce Plc | Self-sealing impingement cooling tube for a turbine vane |
| US10260363B2 (en) * | 2016-12-08 | 2019-04-16 | General Electric Company | Additive manufactured seal for insert compartmentalization |
| KR102048863B1 (ko) * | 2018-04-17 | 2019-11-26 | 두산중공업 주식회사 | 인서트 지지부를 구비한 터빈 베인 |
| DE102018209610A1 (de) | 2018-06-14 | 2019-12-19 | MTU Aero Engines AG | Schaufelblatt für eine Strömungsmaschine |
| US11203981B1 (en) | 2020-08-06 | 2021-12-21 | Raytheon Technologies Corporation | Baffle systems for airfoils |
| US11905842B2 (en) * | 2021-12-16 | 2024-02-20 | General Electric Company | Partition damper seal configurations for segmented internal cooling hardware |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3533711A (en) * | 1966-02-26 | 1970-10-13 | Gen Electric | Cooled vane structure for high temperature turbines |
| US3540811A (en) * | 1967-06-26 | 1970-11-17 | Gen Electric | Fluid-cooled turbine blade |
| US3635586A (en) * | 1970-04-06 | 1972-01-18 | Rolls Royce | Method and apparatus for turbine blade cooling |
| GB1355558A (en) * | 1971-07-02 | 1974-06-05 | Rolls Royce | Cooled vane or blade for a gas turbine engine |
| US3891348A (en) * | 1972-04-24 | 1975-06-24 | Gen Electric | Turbine blade with increased film cooling |
| GB1400285A (en) * | 1972-08-02 | 1975-07-16 | Rolls Royce | Hollow cooled vane or blade for a gas turbine engine |
| CH584347A5 (enExample) * | 1974-11-08 | 1977-01-31 | Bbc Sulzer Turbomaschinen | |
| US4025226A (en) * | 1975-10-03 | 1977-05-24 | United Technologies Corporation | Air cooled turbine vane |
-
1976
- 1976-01-29 GB GB3464/76A patent/GB1565361A/en not_active Expired
-
1977
- 1977-01-28 IT IT19761/77A patent/IT1076328B/it active
- 1977-01-28 FR FR7702473A patent/FR2381178A1/fr active Granted
- 1977-01-28 US US05/763,707 patent/US4168938A/en not_active Expired - Lifetime
- 1977-01-31 DE DE2703815A patent/DE2703815C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4168938A (en) | 1979-09-25 |
| DE2703815A1 (de) | 1979-02-08 |
| FR2381178B1 (enExample) | 1982-09-17 |
| DE2703815B2 (de) | 1979-11-29 |
| FR2381178A1 (fr) | 1978-09-15 |
| DE2703815C3 (de) | 1980-08-07 |
| GB1565361A (en) | 1980-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT1076328B (it) | Lama o paletta per un motore a turbina a gas | |
| IT7821288A0 (it) | Motore per turbina a gas. | |
| IT8020445A0 (it) | Motore a turbina a gas. | |
| IT7921628A0 (it) | Motore a turbina a gas. | |
| IT8020482A0 (it) | Rotore palettato per motore a turbina a gas. | |
| SE433519B (sv) | Rotor for en gasturbin | |
| AR211811A1 (es) | Paleta de rotor de turbina de gas | |
| IT8019702A0 (it) | Cappottatura di motore a turbina agas. | |
| IT8124388A0 (it) | Struttura di carcassa per motore di turbina a gas. | |
| IT7821869A0 (it) | Paletta di rotore raffreddata per motore a turbina a gas. | |
| IT1048186B (it) | Lama per un motore a turbina a gas | |
| IT7924987A0 (it) | Pala composta in ceramica per turbina a gas. | |
| IT1099249B (it) | Paletta di rotore raffreddata per un turbomotore a gas | |
| IT1084998B (it) | Motore a turbina a gas munito di dispositivo antighiaccio | |
| IT8025620A0 (it) | Motore a turbina a gas modulare. | |
| NO772442L (no) | Skovlkonstruksjon for gassturbin. | |
| IT1085791B (it) | Paletta di rotore per motore a turbina a gas | |
| IT1092252B (it) | Paletta di guida ad ugello per un motore a turbina a gas | |
| IT7822908A0 (it) | Paletta di rotore per motore a turbina a gas. | |
| IT7919648A0 (it) | Motori a turbina a gas. | |
| IT7822485A0 (it) | Disco palettato per motore a turbina a gas. | |
| IT1077139B (it) | Impianto di accensione per motore a turbina a gas | |
| IT1068291B (it) | Lama o pala per un motore a turbina a gas | |
| IT1089618B (it) | Attrezzo di taglio azionato con motore a gas | |
| IT1092591B (it) | Paletta raffreddata di turbina a gas |