IT1048186B - Lama per un motore a turbina a gas - Google Patents
Lama per un motore a turbina a gasInfo
- Publication number
- IT1048186B IT1048186B IT25590/74A IT2559074A IT1048186B IT 1048186 B IT1048186 B IT 1048186B IT 25590/74 A IT25590/74 A IT 25590/74A IT 2559074 A IT2559074 A IT 2559074A IT 1048186 B IT1048186 B IT 1048186B
- Authority
- IT
- Italy
- Prior art keywords
- blade
- gas turbine
- turbine engine
- engine
- gas
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F01—MACHINES OR ENGINES IN GENERAL; ENGINE PLANTS IN GENERAL; STEAM ENGINES
- F01D—NON-POSITIVE DISPLACEMENT MACHINES OR ENGINES, e.g. STEAM TURBINES
- F01D9/00—Stators
- F01D9/02—Nozzles; Nozzle boxes; Stator blades; Guide conduits, e.g. individual nozzles
- F01D9/023—Transition ducts between combustor cans and first stage of the turbine in gas-turbine engines; their cooling or sealings
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Turbine Rotor Nozzle Sealing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB35579/73A GB1596255A (en) | 1973-07-26 | 1973-07-26 | Stator blade for a gas turbine engine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT1048186B true IT1048186B (it) | 1980-11-20 |
Family
ID=10379305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT25590/74A IT1048186B (it) | 1973-07-26 | 1974-07-25 | Lama per un motore a turbina a gas |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4260326A (it) |
| DE (1) | DE2435071C1 (it) |
| FR (1) | FR2463854A1 (it) |
| GB (1) | GB1596255A (it) |
| IT (1) | IT1048186B (it) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2121115A (en) * | 1982-06-03 | 1983-12-14 | Rolls Royce | Aerofoil vane assembly |
| US4962640A (en) * | 1989-02-06 | 1990-10-16 | Westinghouse Electric Corp. | Apparatus and method for cooling a gas turbine vane |
| US5609467A (en) * | 1995-09-28 | 1997-03-11 | Cooper Cameron Corporation | Floating interturbine duct assembly for high temperature power turbine |
| RU2136895C1 (ru) * | 1997-06-05 | 1999-09-10 | Акционерное общество "Турбомоторный завод" | Лопатка осевой турбины |
| US6000906A (en) * | 1997-09-12 | 1999-12-14 | Alliedsignal Inc. | Ceramic airfoil |
| RU2131044C1 (ru) * | 1998-01-06 | 1999-05-27 | Ковалев Евгений Павлович | Паровая турбина |
| RU2211926C2 (ru) * | 2001-05-04 | 2003-09-10 | Открытое акционерное общество "Авиадвигатель" | Высокотемпературная газовая турбина |
| DE10210866C5 (de) | 2002-03-12 | 2008-04-10 | Mtu Aero Engines Gmbh | Leitschaufelbefestigung in einem Strömungskanal einer Fluggasturbine |
| RU2237811C1 (ru) * | 2003-01-21 | 2004-10-10 | Открытое акционерное общество "Силовые машины - ЗТЛ, ЛМЗ, Электросила, Энергомашэкспорт" | Охлаждаемая сопловая лопатка газовой турбины |
| DE10346240A1 (de) * | 2003-10-06 | 2005-04-21 | Alstom Technology Ltd Baden | Bauteil einer Gasturbine |
| RU2276732C2 (ru) * | 2004-01-16 | 2006-05-20 | Ульяновский государственный технический университет | Охлаждаемая лопатка турбины |
| US6997675B2 (en) * | 2004-02-09 | 2006-02-14 | United Technologies Corporation | Turbulated hole configurations for turbine blades |
| US7114916B2 (en) * | 2004-02-09 | 2006-10-03 | United Technologies Corporation | Tailored turbulation for turbine blades |
| US7247003B2 (en) | 2004-12-02 | 2007-07-24 | Siemens Power Generation, Inc. | Stacked lamellate assembly |
| US7153096B2 (en) * | 2004-12-02 | 2006-12-26 | Siemens Power Generation, Inc. | Stacked laminate CMC turbine vane |
| US7255535B2 (en) * | 2004-12-02 | 2007-08-14 | Albrecht Harry A | Cooling systems for stacked laminate CMC vane |
| US7198458B2 (en) * | 2004-12-02 | 2007-04-03 | Siemens Power Generation, Inc. | Fail safe cooling system for turbine vanes |
| US7247002B2 (en) * | 2004-12-02 | 2007-07-24 | Siemens Power Generation, Inc. | Lamellate CMC structure with interlock to metallic support structure |
| US7326030B2 (en) * | 2005-02-02 | 2008-02-05 | Siemens Power Generation, Inc. | Support system for a composite airfoil in a turbine engine |
| RU2352791C1 (ru) * | 2007-11-09 | 2009-04-20 | Открытое акционерное общество "Авиадвигатель" | Двухступенчатая высокотемпературная газовая турбина |
| RU2544916C1 (ru) * | 2013-12-10 | 2015-03-20 | Владимир Алексеевич Трушин | Охлаждаемая перфорированная лопатка турбины |
| US9970317B2 (en) * | 2014-10-31 | 2018-05-15 | Rolls-Royce North America Technologies Inc. | Vane assembly for a gas turbine engine |
| RU2586231C1 (ru) * | 2015-03-13 | 2016-06-10 | Открытое акционерное общество "Авиадвигатель" | Охлаждаемая лопатка высокотемпературной турбины |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2254821A (en) * | 1938-01-07 | 1941-09-02 | Haw Jakob Heinrich | Airscrew blade construction |
| DE1062496B (de) * | 1958-01-14 | 1959-07-30 | Daimler Benz Ag | Schaufel fuer Stroemungsmaschinen, insbesondere Leitschaufel fuer Gasturbinen |
| FR1465803A (fr) * | 1964-12-22 | 1967-01-13 | United Aircraft Corp | Perfectionnements aux assemblages à plaquettes empilées, notamment pour aubes de turbines |
| US3301526A (en) * | 1964-12-22 | 1967-01-31 | United Aircraft Corp | Stacked-wafer turbine vane or blade |
| US3353359A (en) * | 1966-01-26 | 1967-11-21 | James E Webb | Multislot film cooled pyrolytic graphite rocket nozzle |
| GB1075910A (en) * | 1966-04-04 | 1967-07-19 | Rolls Royce | Improvements in or relating to blades for mounting in fluid flow ducts |
| US3515499A (en) * | 1968-04-22 | 1970-06-02 | Aerojet General Co | Blades and blade assemblies for turbine engines,compressors and the like |
-
1973
- 1973-07-26 GB GB35579/73A patent/GB1596255A/en not_active Expired
-
1974
- 1974-07-18 US US05/489,151 patent/US4260326A/en not_active Expired - Lifetime
- 1974-07-22 DE DE2435071A patent/DE2435071C1/de not_active Expired - Lifetime
- 1974-07-25 IT IT25590/74A patent/IT1048186B/it active
- 1974-07-25 FR FR7425917A patent/FR2463854A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2463854A1 (fr) | 1981-02-27 |
| US4260326A (en) | 1981-04-07 |
| DE2435071C1 (de) | 2000-12-28 |
| GB1596255A (en) | 1981-08-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT1048186B (it) | Lama per un motore a turbina a gas | |
| IT1046797B (it) | Paletta cava raffreddata per un motore a turbina a gas | |
| IT960166B (it) | Paletta o lama raffreddata per un motore a turbina a gas | |
| BE810901A (fr) | Moteur a turbine a gaz | |
| IT1041998B (it) | Struttura di statore per un motore a turbina a gas | |
| IT997686B (it) | Motore a turbina a gas | |
| IT8020482A0 (it) | Rotore palettato per motore a turbina a gas. | |
| IT7821288A0 (it) | Motore per turbina a gas. | |
| IT1076328B (it) | Lama o paletta per un motore a turbina a gas | |
| IT8020445A0 (it) | Motore a turbina a gas. | |
| IT1045592B (it) | Motore a tureina a gas | |
| IT7921628A0 (it) | Motore a turbina a gas. | |
| IT1054914B (it) | Perfezionamenti relativi a motori a turbina a gas | |
| IT1048656B (it) | Complesso integrato motore gondola di turbomotore a gas | |
| IT1051760B (it) | Equipaggiamento di combustione per motori a turbina a gas | |
| IT1022179B (it) | Ciclo per motore a turbina a gas | |
| IT7821869A0 (it) | Paletta di rotore raffreddata per motore a turbina a gas. | |
| DK138463B (da) | Forbrændingskammer for en gasturbine. | |
| IT1021693B (it) | Perfezionamento nelle turbine a gas | |
| IT960165B (it) | Paletta raffreddata per un motore a turbina a gas | |
| IT1031830B (it) | Paletta raffreddata per motori a turbina a gas | |
| IT1034600B (it) | Motore a turbina a gas | |
| IT1020195B (it) | Motore a turbina per aerei a ciclo doppio | |
| IT962211B (it) | Rotore per turbine a gas | |
| IT973079B (it) | Carcassa di turbina per un motore a turbina a gas |