IL61756A - Anti-cancer 2-amino-4 hydroxy quinazoline methylamino-benzamide derivatives,process for their preparation and pharmaceutical compositions including them - Google Patents
Anti-cancer 2-amino-4 hydroxy quinazoline methylamino-benzamide derivatives,process for their preparation and pharmaceutical compositions including themInfo
- Publication number
- IL61756A IL61756A IL61756A IL6175680A IL61756A IL 61756 A IL61756 A IL 61756A IL 61756 A IL61756 A IL 61756A IL 6175680 A IL6175680 A IL 6175680A IL 61756 A IL61756 A IL 61756A
- Authority
- IL
- Israel
- Prior art keywords
- methylamino
- cancer
- amino
- preparation
- pharmaceutical compositions
- Prior art date
Links
- DTHIYIYAPZMVTD-UHFFFAOYSA-N CNC1=C(C(=O)N)C=CC=C1.NC1=NC2=CC=CC=C2C(=N1)O Chemical class CNC1=C(C(=O)N)C=CC=C1.NC1=NC2=CC=CC=C2C(=N1)O DTHIYIYAPZMVTD-UHFFFAOYSA-N 0.000 title 1
- 230000001093 anti-cancer Effects 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7943715 | 1979-12-19 | ||
| GB8006813 | 1980-02-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL61756A0 IL61756A0 (en) | 1981-01-30 |
| IL61756A true IL61756A (en) | 1987-02-27 |
Family
ID=26273917
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL61756A IL61756A (en) | 1979-12-19 | 1980-12-18 | Anti-cancer 2-amino-4 hydroxy quinazoline methylamino-benzamide derivatives,process for their preparation and pharmaceutical compositions including them |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4447608A (da) |
| EP (1) | EP0031237B1 (da) |
| AU (1) | AU543237B2 (da) |
| CA (1) | CA1184900A (da) |
| DE (1) | DE3069468D1 (da) |
| DK (1) | DK157019C (da) |
| ES (3) | ES497884A0 (da) |
| FI (1) | FI76791C (da) |
| GB (1) | GB2065653B (da) |
| GR (1) | GR72847B (da) |
| HU (1) | HU193505B (da) |
| IE (1) | IE51188B1 (da) |
| IL (1) | IL61756A (da) |
| NO (1) | NO154919C (da) |
| NZ (1) | NZ195876A (da) |
| PT (1) | PT72232B (da) |
| YU (1) | YU321180A (da) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5026851A (en) * | 1985-03-08 | 1991-06-25 | The Trustees Of Princeton University | Pyrido[2,3-]pyrimidine derivatives |
| US4927828A (en) * | 1985-03-08 | 1990-05-22 | The Trustees Of Princeton University | Diastereoisomeric tetrahydropyrido-(2,3,d) pyrimidine derivatives |
| US4684653A (en) * | 1985-03-08 | 1987-08-04 | The Trustees Of Princeton University | Pyrido(2,3-d)pyrimidine derivatives |
| GB8513754D0 (en) * | 1985-05-31 | 1985-07-03 | Jones T R | Anti-cancer quinazoline derivatives |
| GB8607683D0 (en) * | 1986-03-27 | 1986-04-30 | Ici Plc | Anti-tumor agents |
| US5187167A (en) * | 1986-03-27 | 1993-02-16 | Imperial Chemical Industries Plc | Pharmaceutical compositions comprising quinazolin-4-one derivatives |
| US4833145A (en) * | 1986-06-30 | 1989-05-23 | The Trustees Of Princeton University | 4(3H)-oxo-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine derivatives |
| US4818819A (en) * | 1986-10-20 | 1989-04-04 | The Trustees Of Princeton University | Process for the preparation of fused pyridine compounds |
| US4902796A (en) * | 1986-10-20 | 1990-02-20 | The Trustees Of Princeton University | 6-alkenyl and ethynyl derivatives of 2-amino-4-hydroxypyrido[2,3-d]pyrimidines |
| GB8707053D0 (en) * | 1987-03-25 | 1987-04-29 | Ici Plc | Anti-tumour agents |
| US4857530A (en) * | 1987-11-03 | 1989-08-15 | Warner-Lambert Company | Substituted quinazolinones as anticancer agents |
| GB8727737D0 (en) * | 1987-11-26 | 1987-12-31 | Ici Plc | Antitumour agents |
| JP2830008B2 (ja) * | 1988-04-01 | 1998-12-02 | 武田薬品工業株式会社 | 縮合ピリミジン誘導体 |
| US5223620A (en) * | 1988-04-01 | 1993-06-29 | Takeda Chemical Industries, Ltd. | Pyrido[2,3-d]pyrimidine compounds useful as intermediates |
| GB8809978D0 (en) * | 1988-04-27 | 1988-06-02 | Ici Plc | Anti-tumour agents |
| EP0365763A1 (en) * | 1988-09-30 | 1990-05-02 | Agouron Pharmaceuticals, Inc. | Antiproliferative cyclic compounds |
| GB8829296D0 (en) * | 1988-12-15 | 1989-01-25 | Ici Plc | Anti-tumour compounds |
| US5252573A (en) * | 1988-12-15 | 1993-10-12 | Imperial Chemical Industries Plc | Anti-tumor agents |
| US4996206A (en) * | 1989-12-11 | 1991-02-26 | The Trustees Of Princeton University | N-(pyrrolo[2,3-d]pyrimidin-3-ylacyl)-glutamic acid derivatives |
| US5160727A (en) * | 1990-02-13 | 1992-11-03 | Warner-Lambert Company | Tumor cell sensitization method using quinazolinedione derivatives |
| US5286726A (en) * | 1990-04-12 | 1994-02-15 | The Regents Of The University Of Michigan | Difluoroglutamic acid conjugates with folates and anti-folates for the treatment of neoplastic diseases |
| IL98167A0 (en) * | 1990-05-30 | 1992-06-21 | Ici Plc | Anti-tumour quinazoline derivatives,processes for their preparation and pharmaceutical compositions comprising them |
| US6762188B1 (en) | 1990-06-19 | 2004-07-13 | Smithkline Beecham Corporation | Pharmaceutically active benzoquinazoline compounds |
| GB9013615D0 (en) * | 1990-06-19 | 1990-08-08 | Wellcome Found | Pharmaceutical compounds |
| GB9105771D0 (en) * | 1991-03-19 | 1991-05-01 | Cancer Res Inst Royal | Anti-cancer compounds |
| US5145854A (en) * | 1991-11-27 | 1992-09-08 | Nair Madhavan G | 1-formyl-5,8,10-trideazafolates |
| GB9205320D0 (en) * | 1992-03-11 | 1992-04-22 | Ici Plc | Anti-tumour compounds |
| GB9205907D0 (en) * | 1992-03-18 | 1992-04-29 | Cancer Res Inst Royal | Anti-cancer compounds |
| US5430148A (en) * | 1992-03-31 | 1995-07-04 | Agouron Pharmaceuticals, Inc. | Antiproliferative quinazolines |
| CH684644A5 (de) * | 1992-07-13 | 1994-11-15 | Eprova Ag | 5,10-Methylentetrahydrofolsäure-Cyclodextrin-Einschlussverbindungen. |
| GB9223352D0 (en) * | 1992-11-06 | 1992-12-23 | Ici Plc | Tricyclic compounds |
| AU693143B2 (en) * | 1993-12-06 | 1998-06-25 | Cytel Corporation | CS-1 peptidomimetics, compositions and methods of using the same |
| JPH09509146A (ja) * | 1993-12-06 | 1997-09-16 | サイテル コーポレイション | Cs−1ペプチド模擬物、組成物およびその使用法 |
| US5821231A (en) * | 1993-12-06 | 1998-10-13 | Cytel Corporation | CS-1 peptidomimetics, compositions and methods of using same |
| US5770573A (en) * | 1993-12-06 | 1998-06-23 | Cytel Corporation | CS-1 peptidomimetics, compositions and methods of using the same |
| US5804396A (en) * | 1994-10-12 | 1998-09-08 | Sugen, Inc. | Assay for agents active in proliferative disorders |
| US5837524A (en) * | 1994-12-15 | 1998-11-17 | Sugen, Inc. | PYK2 related polynucleotide products |
| US5837815A (en) * | 1994-12-15 | 1998-11-17 | Sugen, Inc. | PYK2 related polypeptide products |
| US5593999A (en) * | 1995-06-07 | 1997-01-14 | Nair; Madhavan G. | Non-classical folate analogue inhibitors of glycinamide ribonucleotide formyltransferase (GARFT) |
| AU5984296A (en) * | 1995-06-07 | 1996-12-30 | Sugen, Inc. | Quinazolines and pharmaceutical compositions |
| US6716575B2 (en) | 1995-12-18 | 2004-04-06 | Sugen, Inc. | Diagnosis and treatment of AUR1 and/or AUR2 related disorders |
| US7119174B2 (en) * | 1995-12-18 | 2006-10-10 | Sugen, Inc. | Diagnosis and treatment of AUR1 and/or AUR2 related disorders |
| ES2227729T3 (es) * | 1996-12-11 | 2005-04-01 | Sugen, Inc. | Metodos de cribaje para compuestos unidos al polipeptido pyk2. |
| US6818440B2 (en) * | 1997-04-28 | 2004-11-16 | Sugen, Inc. | Diagnosis and treatment of alk-7 related disorders |
| US6228641B1 (en) | 1997-05-20 | 2001-05-08 | Sugen, Inc. | Diagnosis and treatment of PTP04 related disorders |
| US6342593B1 (en) | 1997-06-11 | 2002-01-29 | Sugen, Inc. | Diagnosis and treatment of ALP related disorders |
| US7115710B2 (en) * | 1997-06-11 | 2006-10-03 | Sugen, Inc. | Diagnosis and treatment of PTP related disorders |
| US6388063B1 (en) | 1997-06-18 | 2002-05-14 | Sugen, Inc. | Diagnosis and treatment of SAD related disorders |
| CA2318403A1 (en) | 1998-01-21 | 1999-07-29 | Sugen, Inc. | Human orthologues of wart |
| DK1073723T3 (da) * | 1998-04-14 | 2006-01-02 | Sugen Inc | STE20-relaterede proteinkinaser |
| US6861442B1 (en) * | 1998-12-30 | 2005-03-01 | Sugen, Inc. | PYK2 and inflammation |
| GB9904275D0 (en) | 1999-02-24 | 1999-04-21 | Cancer Res Campaign Tech | Anti-cancer compounds |
| US6677382B1 (en) | 1999-09-23 | 2004-01-13 | Pharmacia Corporation | Substituted N,N-bis-phenyl aminoalcohol compounds useful for inhibiting cholesteryl ester transfer protein activity |
| US6476075B1 (en) | 1999-09-23 | 2002-11-05 | G.D. Searle & Co. | Use of substituted N, N-bis-benzyl aminoalcohol compounds inhibiting cholesteryl ester transfer protein activity |
| US6683113B2 (en) | 1999-09-23 | 2004-01-27 | Pharmacia Corporation | (R)-chiral halogenated substituted N,N-Bis-benzyl aminioalcohol compounds useful for inhibiting cholesteryl ester transfer protein activity |
| US6835546B1 (en) | 1999-10-22 | 2004-12-28 | Pharmacia & Upjohn Company | Drosophila G protein coupled receptors, nucleic acids, and methods related to the same |
| US20030162223A1 (en) * | 1999-10-22 | 2003-08-28 | Lowery David E. | Drosophila G protein coupled receptors, nucleic acids, and methods related to the same |
| US7364866B2 (en) * | 1999-10-22 | 2008-04-29 | Pharmacia & Upjohn Company | Drosophila G protein coupled receptors, nucleic acids, and methods related to the same |
| AU784543B2 (en) * | 1999-11-16 | 2006-04-27 | Pharmacia & Upjohn Company | Novel G protein-coupled receptors |
| US20030082534A1 (en) * | 1999-11-16 | 2003-05-01 | Peter Lind | Novel G protein-coupled receptors |
| US6143776A (en) * | 2000-02-02 | 2000-11-07 | Sunesis Pharmaceuticals, Inc. | Tosylproline analogs as thymidylate synthase inhibitors |
| WO2001062797A2 (en) * | 2000-02-23 | 2001-08-30 | Pharmacia & Upjohn Company | G protein-coupled receptors |
| US20030027308A1 (en) * | 2000-05-30 | 2003-02-06 | Sugen Incorporated | Novel human protein phosphatases identified from genomic sequencing |
| CA2321345A1 (fr) * | 2000-10-02 | 2002-04-02 | Abdelbast Guerfi | Utilisation du graphite dans un composite pour reduire l'accumulation de glace |
| US20040157306A1 (en) * | 2000-11-13 | 2004-08-12 | Sugen Incorporated | Mammalian protein phosphatases |
| US20050069976A1 (en) * | 2001-02-14 | 2005-03-31 | Peter Lind | Protein-coupled receptor |
| EP2311850A1 (en) | 2001-08-31 | 2011-04-20 | BTG International Limited | Anti-cancer cyclopenta[g]quinazoline compounds |
| ES2373644T3 (es) | 2001-08-31 | 2012-02-07 | Btg International Limited | Uso de derivados de ciclopenta[g]quinazolina para el tratamiento del c�?ncer. |
| WO2003042390A1 (en) * | 2001-11-13 | 2003-05-22 | Sugen, Inc. | Mammalian protein phosphatases |
| US7537774B2 (en) * | 2005-12-23 | 2009-05-26 | Orion Therapeautics, Llc | Therapeutic formulation |
| US20110008347A1 (en) * | 2006-12-01 | 2011-01-13 | Agency For Science ,Technology And Research | Cancer-related protein kinases |
| PL2150514T3 (pl) | 2007-04-11 | 2019-05-31 | Merck & Cie | 18f-znakowane foliany |
| US8273617B2 (en) | 2009-09-30 | 2012-09-25 | Suvolta, Inc. | Electronic devices and systems, and methods for making and using the same |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1021196A (en) * | 1964-02-20 | 1966-03-02 | Parke Davis & Co | Novel amino acids and means for producing the same |
| US3471498A (en) * | 1967-08-11 | 1969-10-07 | Parke Davis & Co | Certain n-p-((2,4-diamino-6-quinazolinyl)-methyl)benzoylamino acids |
-
1980
- 1980-12-16 EP EP80304539A patent/EP0031237B1/en not_active Expired
- 1980-12-16 GB GB8040202A patent/GB2065653B/en not_active Expired
- 1980-12-16 DE DE8080304539T patent/DE3069468D1/de not_active Expired
- 1980-12-17 HU HU803031A patent/HU193505B/hu unknown
- 1980-12-18 YU YU03211/80A patent/YU321180A/xx unknown
- 1980-12-18 CA CA000367126A patent/CA1184900A/en not_active Expired
- 1980-12-18 DK DK540080A patent/DK157019C/da not_active IP Right Cessation
- 1980-12-18 IL IL61756A patent/IL61756A/xx unknown
- 1980-12-18 GR GR63713A patent/GR72847B/el unknown
- 1980-12-18 IE IE2672/80A patent/IE51188B1/en unknown
- 1980-12-18 NZ NZ195876A patent/NZ195876A/xx unknown
- 1980-12-18 FI FI803957A patent/FI76791C/fi not_active IP Right Cessation
- 1980-12-18 NO NO803868A patent/NO154919C/no unknown
- 1980-12-18 AU AU65495/80A patent/AU543237B2/en not_active Ceased
- 1980-12-18 PT PT72232A patent/PT72232B/pt unknown
- 1980-12-18 ES ES497884A patent/ES497884A0/es active Granted
-
1981
- 1981-12-30 ES ES508454A patent/ES8307762A1/es not_active Expired
- 1981-12-30 ES ES508453A patent/ES508453A0/es active Granted
-
1982
- 1982-10-19 US US06/435,215 patent/US4447608A/en not_active Expired - Lifetime
-
1984
- 1984-03-20 US US06/591,566 patent/US4564616A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO803868L (no) | 1981-06-22 |
| EP0031237B1 (en) | 1984-10-17 |
| GB2065653B (en) | 1983-03-09 |
| GB2065653A (en) | 1981-07-01 |
| NO154919C (no) | 1987-01-14 |
| FI803957L (fi) | 1981-06-20 |
| ES508454A0 (es) | 1983-08-01 |
| PT72232A (en) | 1981-01-01 |
| DK157019C (da) | 1990-03-26 |
| ES8300716A1 (es) | 1982-11-01 |
| IE802672L (en) | 1981-06-19 |
| AU6549580A (en) | 1981-06-25 |
| ES497884A0 (es) | 1982-11-01 |
| DE3069468D1 (en) | 1984-11-22 |
| FI76791B (fi) | 1988-08-31 |
| FI76791C (fi) | 1988-12-12 |
| GR72847B (da) | 1983-12-07 |
| PT72232B (en) | 1981-11-02 |
| US4564616A (en) | 1986-01-14 |
| YU321180A (en) | 1983-06-30 |
| IE51188B1 (en) | 1986-10-29 |
| US4447608A (en) | 1984-05-08 |
| NO154919B (no) | 1986-10-06 |
| HU193505B (en) | 1987-10-28 |
| EP0031237A1 (en) | 1981-07-01 |
| NZ195876A (en) | 1983-11-18 |
| ES8308314A1 (es) | 1983-09-01 |
| DK540080A (da) | 1981-06-20 |
| DK157019B (da) | 1989-10-30 |
| CA1184900A (en) | 1985-04-02 |
| IL61756A0 (en) | 1981-01-30 |
| AU543237B2 (en) | 1985-04-04 |
| ES8307762A1 (es) | 1983-08-01 |
| ES508453A0 (es) | 1983-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL61756A (en) | Anti-cancer 2-amino-4 hydroxy quinazoline methylamino-benzamide derivatives,process for their preparation and pharmaceutical compositions including them | |
| DE2861688D1 (en) | Quinazoline derivatives, process for their preparation, pharmaceutical preparations and their preparation | |
| DE3068020D1 (en) | Aminoalkylbenzene derivatives, process for their preparation and pharmaceutical compositions | |
| IL56578A (en) | Quinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL64665A0 (en) | Quinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| DE3069587D1 (en) | 1-sulpho-2-oxoazetidine derivatives, their production and pharmaceutical compositions thereof | |
| IL63913A0 (en) | Pyrimidone derivatives,process for their preparation,pharmaceutical compositions containing them and their use | |
| IL55845A (en) | Quinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| DE3062586D1 (en) | 2-imidazoline derivatives, process for the preparation thereof and the pharmaceutical composition of the same | |
| IL59104A (en) | Heterotricyclic derivatives,process for their preparation and pharmaceutical compositions incorporating them | |
| PH16413A (en) | Quinazoline derivatives,their pharmaceutical compositions and use | |
| DE3062310D1 (en) | Pyrimidone derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| DE2861043D1 (en) | Cephalosporin derivatives, process for their preparation and pharmaceutical compositions and their preparation | |
| DE3062884D1 (en) | Spiro-hydantoin derivatives, process for their preparation and pharmaceutical compositions thereof | |
| IL59665A0 (en) | Xanthine derivatives,process for their preparation and their use in pharmaceutical compositions | |
| PT71411A (en) | Process for preparing novel quinazoline derivatives and pharmaceutical compositions thereof | |
| IL61240A0 (en) | Quinazoline derivatives, their preparation and pharmaceutical compositions containing them | |
| DE3061152D1 (en) | Pyrazoloindazole derivatives and process for preparing the same and pharmaceutical compositions | |
| IL59747A0 (en) | 6-substituted pyranone derivatives,their production and pharmaceutical compositions containing them | |
| IL60058A0 (en) | Hydroxyamino-eburnane derivatives,their preparation and pharmaceutical compositions containing them | |
| IL55857A0 (en) | Novel quinazoline derivatives, their preparation and pharmaceutical compositions containing them | |
| DE3165733D1 (en) | Pyrimidone derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| DE3063585D1 (en) | Chroman derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| IL59664A0 (en) | Xanthine derivatives,process for their preparation and their use in pharmaceutical compositions | |
| IL54326A0 (en) | Novel quinazoline derivatives, their preparation and pharmaceutical compositions containing them |