IL55149A - 1-benzhydryl imidazole carboxylic acid derivatives,their preparation and plant growth regulating,plant protection and antimycotic compositions comprising them - Google Patents
1-benzhydryl imidazole carboxylic acid derivatives,their preparation and plant growth regulating,plant protection and antimycotic compositions comprising themInfo
- Publication number
- IL55149A IL55149A IL55149A IL5514978A IL55149A IL 55149 A IL55149 A IL 55149A IL 55149 A IL55149 A IL 55149A IL 5514978 A IL5514978 A IL 5514978A IL 55149 A IL55149 A IL 55149A
- Authority
- IL
- Israel
- Prior art keywords
- benzhydryl
- preparation
- carboxylic acid
- acid derivatives
- growth regulating
- Prior art date
Links
- VLDZKISIMOJIIB-UHFFFAOYSA-N 1-benzhydrylimidazole-2-carboxylic acid Chemical class OC(=O)C1=NC=CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 VLDZKISIMOJIIB-UHFFFAOYSA-N 0.000 title 1
- 230000001857 anti-mycotic effect Effects 0.000 title 1
- 239000002543 antimycotic Substances 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 230000008635 plant growth Effects 0.000 title 1
- 230000001105 regulatory effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772732531 DE2732531A1 (de) | 1977-07-19 | 1977-07-19 | Imidazolcarbonsaeuren und deren derivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL55149A0 IL55149A0 (en) | 1978-09-29 |
| IL55149A true IL55149A (en) | 1982-07-30 |
Family
ID=6014260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL55149A IL55149A (en) | 1977-07-19 | 1978-07-17 | 1-benzhydryl imidazole carboxylic acid derivatives,their preparation and plant growth regulating,plant protection and antimycotic compositions comprising them |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4182624A (de) |
| EP (1) | EP0000373B1 (de) |
| JP (1) | JPS5422367A (de) |
| AT (1) | AT367601B (de) |
| AU (1) | AU516238B2 (de) |
| BR (1) | BR7804613A (de) |
| CA (1) | CA1095910A (de) |
| DD (1) | DD138877A5 (de) |
| DE (2) | DE2732531A1 (de) |
| DK (1) | DK320678A (de) |
| EG (1) | EG13351A (de) |
| ES (7) | ES471660A1 (de) |
| GR (1) | GR74141B (de) |
| IL (1) | IL55149A (de) |
| IT (1) | IT1097833B (de) |
| PH (1) | PH14312A (de) |
| PT (1) | PT68316A (de) |
| ZA (1) | ZA784094B (de) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3217094A1 (de) * | 1982-05-07 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | 1-substituierte imidazol-5-carbonsaeurederivate, ihre herstellung sowie ihre verwendung als biozide |
| DE3301717A1 (de) * | 1983-01-20 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von imidazol-4,5-dicarbonsaeure |
| US4820335A (en) * | 1983-11-02 | 1989-04-11 | Hoechst Ag | 1-substituted imidazole-5-carboxylic acid derivatives, their preparation and their use as biocides |
| DE3442690A1 (de) * | 1984-11-23 | 1986-05-28 | Hoechst Ag, 6230 Frankfurt | Salze von 1-phenyl-imidazol-5-carbonsaeuren, ein verfahren zu ihrer herstellung und ihre verwendung als wachstumsregulatoren |
| GB8502398D0 (en) * | 1985-01-31 | 1985-03-06 | Shell Int Research | Imidazole derivatives |
| GB8516573D0 (en) * | 1985-07-01 | 1985-08-07 | Janssen Pharmaceuticaa Nv | Controlling weeds |
| DE3537290A1 (de) * | 1985-10-19 | 1987-04-23 | Hoechst Ag | 1,2,5-substituierte imidazolverbindungen, verfahren zu ihrer herstellung und ihre verwendung als wachstumsregulatoren |
| US4813998A (en) * | 1986-02-27 | 1989-03-21 | Janssen Pharmaceutica N.V. | Herbicidal 1H-imidazole-5-carboxylic acid derivatives |
| US4937250A (en) * | 1988-03-07 | 1990-06-26 | Ciba-Geigy Corporation | Alpha-heterocycle substituted tolunitriles |
| US4978672A (en) * | 1986-03-07 | 1990-12-18 | Ciba-Geigy Corporation | Alpha-heterocyclc substituted tolunitriles |
| US4749713A (en) * | 1986-03-07 | 1988-06-07 | Ciba-Geigy Corporation | Alpha-heterocycle substituted tolunitriles |
| US4770689A (en) * | 1986-03-10 | 1988-09-13 | Janssen Pharmaceutica N.V. | Herbicidal imidazole-5-carboxylic acid derivatives |
| PL149675B1 (pl) * | 1986-03-10 | 1990-03-31 | Sposób wytwarzania nowych pochodnych kwasu 1-metyl0-1h-imidaz0l0karb0ksyl0weg0-5 | |
| DE3614364A1 (de) * | 1986-04-28 | 1987-10-29 | Hoechst Ag | 1-phenyl-imidazolverbindungen, verfahren zu ihrer herstellung und ihre verwendung als wachstumsregulatoren |
| US5246915A (en) * | 1986-06-20 | 1993-09-21 | Janssen Pharmaceutica N.V. | Method for controlling weeds |
| GB8631020D0 (en) * | 1986-12-30 | 1987-02-04 | Janssen Pharmaceutica Nv | 1-methyl-1h-imidazole-5-carboxylic acid derivatives |
| DE3720245A1 (de) * | 1987-06-19 | 1988-12-29 | Hoechst Ag | Verfahren zur herstellung von n-alkoxycarbonylmethyl-n-formyl-aminen und -anilinen |
| EP0314852B1 (de) * | 1987-11-06 | 1993-11-18 | Ciba-Geigy Ag | Verfahren zur Synthese von 1-substituierten Imidazol-5-carbonsäuren und -carbonsäure-derivaten |
| LT4013B (en) | 1994-10-04 | 1996-08-26 | Univ Kauno Tech | Growth regulator |
| CN1340051A (zh) * | 1999-02-11 | 2002-03-13 | 辉瑞产品公司 | 可用作抗癌剂的杂芳基取代的喹啉-2-酮衍生物 |
| FR2793796A1 (fr) * | 1999-04-14 | 2000-11-24 | Hoechst Marion Roussel Inc | Nouveaux derives d'imidazoles, leur procede de preparation et les intermediaires de ce procede, leur application comme medicaments et les compositions pharmaceutiques les contenant |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2519310A (en) * | 1948-12-01 | 1950-08-15 | American Cyanamid Co | Preparation of 2-mercaptoimidazole |
| FR1184709A (fr) * | 1957-09-21 | 1959-07-24 | Cfmc | Nouveaux dérivés imidazoliques, utilisables comme agents de protection contre les rayons ultra-violets et leurs procédés de fabrication |
| NL294421A (de) * | 1962-06-22 | |||
| US3354173A (en) * | 1964-04-16 | 1967-11-21 | Janssen Pharmaceutica Nv | Imidazole carboxylates |
| US3485917A (en) * | 1966-04-14 | 1969-12-23 | Janssen Pharmaceutica Nv | Composition and method for combating fungus with imidazole carboxylates |
| DE1908991B2 (de) * | 1969-02-22 | 1977-05-26 | Bayer Ag, 5090 Leverkusen | Alpha, alpha-disubstituierte n- benzylimidazole und deren salze |
| US4018924A (en) * | 1969-05-21 | 1977-04-19 | Bayer Aktiengesellschaft | Phenyl-imidazolyl-acetamide derivatives |
| BE756663A (fr) * | 1969-09-27 | 1971-03-25 | Bayer Ag | Composition destinee a la regulation de la croissance des vegetaux |
| US3993647A (en) * | 1972-09-26 | 1976-11-23 | Bayer Aktiengesellschaft | Imidazolylacetic acid amides |
| US4038286A (en) * | 1975-03-10 | 1977-07-26 | Janssen Pharmaceutica N.V. | Racemates and optical isomers of 1-(1-phenylethyl)-1h-imidazole-5-carboylic acid derivatives |
| US4020064A (en) * | 1975-05-30 | 1977-04-26 | E. R. Squibb & Sons, Inc. | 3-[Substituted-2-(methylamino) phenyl]-4-[2-oxo-2-(hetero-cyclic) ethyl]-5-substituted-1,2,4-triazoles |
| US4118461A (en) * | 1975-12-18 | 1978-10-03 | Rohm And Haas Company | 1-Substituted aralkyl imidazoles |
-
1977
- 1977-07-19 DE DE19772732531 patent/DE2732531A1/de not_active Withdrawn
-
1978
- 1978-07-06 DE DE7878100314T patent/DE2860407D1/de not_active Expired
- 1978-07-06 EP EP78100314A patent/EP0000373B1/de not_active Expired
- 1978-07-12 ES ES471660A patent/ES471660A1/es not_active Expired
- 1978-07-17 EG EG445/78A patent/EG13351A/xx active
- 1978-07-17 PH PH21387A patent/PH14312A/en unknown
- 1978-07-17 GR GR56806A patent/GR74141B/el unknown
- 1978-07-17 IL IL55149A patent/IL55149A/xx unknown
- 1978-07-17 US US05/925,546 patent/US4182624A/en not_active Expired - Lifetime
- 1978-07-17 DD DD78206766A patent/DD138877A5/de unknown
- 1978-07-17 IT IT25809/78A patent/IT1097833B/it active
- 1978-07-18 CA CA307,637A patent/CA1095910A/en not_active Expired
- 1978-07-18 PT PT68316A patent/PT68316A/pt unknown
- 1978-07-18 JP JP8684478A patent/JPS5422367A/ja active Pending
- 1978-07-18 BR BR7804613A patent/BR7804613A/pt unknown
- 1978-07-18 DK DK320678A patent/DK320678A/da unknown
- 1978-07-18 ZA ZA00784094A patent/ZA784094B/xx unknown
- 1978-07-18 AT AT0518878A patent/AT367601B/de not_active IP Right Cessation
- 1978-07-18 AU AU38116/78A patent/AU516238B2/en not_active Expired
-
1979
- 1979-03-31 ES ES479162A patent/ES479162A1/es not_active Expired
- 1979-03-31 ES ES479158A patent/ES479158A1/es not_active Expired
- 1979-03-31 ES ES479159A patent/ES479159A1/es not_active Expired
- 1979-03-31 ES ES479161A patent/ES479161A1/es not_active Expired
- 1979-03-31 ES ES479160A patent/ES479160A1/es not_active Expired
- 1979-03-31 ES ES479163A patent/ES479163A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1097833B (it) | 1985-08-31 |
| ES479158A1 (es) | 1980-01-16 |
| DE2732531A1 (de) | 1979-02-01 |
| JPS5422367A (en) | 1979-02-20 |
| EP0000373B1 (de) | 1981-01-07 |
| PH14312A (en) | 1981-05-20 |
| AT367601B (de) | 1982-07-26 |
| ZA784094B (en) | 1979-07-25 |
| ES479161A1 (es) | 1980-01-16 |
| ATA518878A (de) | 1981-12-15 |
| EG13351A (en) | 1981-06-30 |
| IL55149A0 (en) | 1978-09-29 |
| US4182624A (en) | 1980-01-08 |
| ES479160A1 (es) | 1980-01-16 |
| PT68316A (en) | 1978-08-01 |
| IT7825809A0 (it) | 1978-07-17 |
| AU516238B2 (en) | 1981-05-21 |
| ES479159A1 (es) | 1980-01-16 |
| EP0000373A1 (de) | 1979-01-24 |
| DK320678A (da) | 1979-01-20 |
| CA1095910A (en) | 1981-02-17 |
| ES479162A1 (es) | 1980-01-16 |
| DD138877A5 (de) | 1979-11-28 |
| BR7804613A (pt) | 1979-05-22 |
| DE2860407D1 (en) | 1981-02-26 |
| GR74141B (de) | 1984-06-06 |
| ES471660A1 (es) | 1979-10-01 |
| ES479163A1 (es) | 1980-02-16 |
| AU3811678A (en) | 1980-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL55149A (en) | 1-benzhydryl imidazole carboxylic acid derivatives,their preparation and plant growth regulating,plant protection and antimycotic compositions comprising them | |
| IL55085A (en) | Phenoxyphenylthioalkanecarboxylic acid derivatives,their preparation and plant growth regulating and herbicidal compositions containing them | |
| IL75519A0 (en) | 1-hydroxyethyl-azole derivatives,their preparation and their use as plant growth regulators and fungicides | |
| DE2861073D1 (en) | Pyridyloxy-phenoxy-alkanoic acid derivatives , processes for their preparation and their use as herbicides or plant growth regulators | |
| IL71849A0 (en) | Cyclohexanedionecarboxylic acid derivatives,their preparation and their use as herbicides and plant growth regulators | |
| IL52136A (en) | Plant growth regulating compositions comprising 1-phenyl-4-oxo-3-pyridine carboxylic acid derivatives, certain such novel compounds and their preparation | |
| DE3170703D1 (en) | Triazolylpropenol derivatives, process for their preparation as well as their use as fungicides and plant growth regulators | |
| DE2961055D1 (en) | Novel n-substituted 2-oxo-3-benzothiazoline derivatives, their use as leguminous plant growth regulants, and plant growth regulating compositions containing said derivatives as the active ingredients | |
| NZ186257A (en) | 1,2,4-triazole and imidazole compounds and fungicidal and plant growth regulating compositions | |
| IL62228A0 (en) | Plant growth regulating compositions comprising phenylacetic acid derivatives,certain such novel compounds and their preparation | |
| DE2965840D1 (en) | Novel alpha-amino-phenylacetic acid derivatives, processes for their preparation, their use as herbicidal, algicidal and plant growth regulating agents, and herbicidal, algicidal and plant growth regulating compositions containing them | |
| GB1550574A (en) | Pyridyloxy-phenoxy-propionic acid derivatives which are effective as herbicides and as agents regulating plant growth | |
| IL55133A (en) | 2-pyridone-5-carboxylic acid derivatives,their preparation and plant growth regulating compositions comprising them | |
| JPS54163812A (en) | Substituted benzorylthioalkanoic acid as plant growth regulating agent | |
| IL64039A (en) | 1,4-dihydro-4-oxo-pyridazine-5-carboxylic acid derivatives and their use as plant growth regulators | |
| IL57987A (en) | Phenyliminomethyl-pyridine derivatives,their preparation and their use as fungicides and plant growth regulators | |
| IL53042A0 (en) | Novel(1-phenyl-2-triazolyl-ethyl)-thioether derivatives, their preparation and their use as fungicides and plant growth regulators | |
| IL55112A (en) | Process for the preparation of chromone acetic acid derivatives,certain new such derivatives and their use as plant protection agents | |
| IL64198A0 (en) | Cyclopropanecarboxylic acid derivatives,their preparation and their use as plant growth regulants | |
| DE2861880D1 (en) | Propanthioic acid derivatives, herbicidal and/or plant growth regulating compositions comprising these derivatives and method of destroying or preventing undesirable plant growth | |
| PH13434A (en) | Plant growth regulating compositions and methods using alpha-isocyanocarboxylic acid compounds | |
| IL58333A0 (en) | A-isocyano-carboxylic acid amides, their preparation and their use as plant growth regulators | |
| IL61726A0 (en) | Imidazole derivatives,their preparation and their use as plant growth regulants | |
| IL56451A (en) | N-alkoxyalkylchloroacetanilide derivatives,their preparation and herbicidal and plant growth regulating compositions comprising them | |
| DE2963333D1 (en) | Novel n-substituted 2-oxo-3-benzothiazoline derivatives, their use as leguminous plant growth regulants, and plant growth regulating compositions containing said derivatives as the active ingredients |