IL46177A - Process for preparing a complex polyelectrolyte from two types of polymer and product obtained thereby - Google Patents
Process for preparing a complex polyelectrolyte from two types of polymer and product obtained therebyInfo
- Publication number
- IL46177A IL46177A IL46177A IL4617774A IL46177A IL 46177 A IL46177 A IL 46177A IL 46177 A IL46177 A IL 46177A IL 4617774 A IL4617774 A IL 4617774A IL 46177 A IL46177 A IL 46177A
- Authority
- IL
- Israel
- Prior art keywords
- polymer
- groups
- process according
- solution
- polymers
- Prior art date
Links
- 229920000642 polymer Polymers 0.000 title claims description 109
- 229920000867 polyelectrolyte Polymers 0.000 title claims description 37
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 238000000034 method Methods 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- 239000002904 solvent Substances 0.000 claims description 22
- 239000012528 membrane Substances 0.000 claims description 20
- 239000000843 powder Substances 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 15
- 239000000178 monomer Substances 0.000 claims description 15
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical group OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims description 11
- 239000002245 particle Substances 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 5
- 238000002156 mixing Methods 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 150000003512 tertiary amines Chemical class 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000001302 tertiary amino group Chemical group 0.000 claims description 3
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims 1
- 239000007791 liquid phase Substances 0.000 claims 1
- -1 amine salts Chemical class 0.000 description 38
- 150000003254 radicals Chemical class 0.000 description 37
- 239000000243 solution Substances 0.000 description 36
- 239000002253 acid Substances 0.000 description 18
- 229920001577 copolymer Polymers 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 125000004433 nitrogen atom Chemical group N* 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 9
- 150000002009 diols Chemical class 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 8
- 150000004985 diamines Chemical class 0.000 description 8
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical class C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000003792 electrolyte Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000003010 ionic group Chemical group 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 238000000108 ultra-filtration Methods 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 125000005442 diisocyanate group Chemical group 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229920000447 polyanionic polymer Polymers 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 3
- SMFDSFRYWRBNSQ-UHFFFAOYSA-N 2-prop-1-en-2-ylbenzenesulfonic acid Chemical class CC(=C)C1=CC=CC=C1S(O)(=O)=O SMFDSFRYWRBNSQ-UHFFFAOYSA-N 0.000 description 2
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 2
- VJOWMORERYNYON-UHFFFAOYSA-N 5-ethenyl-2-methylpyridine Chemical compound CC1=CC=C(C=C)C=N1 VJOWMORERYNYON-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 102000016943 Muramidase Human genes 0.000 description 2
- 108010014251 Muramidase Proteins 0.000 description 2
- 108010062010 N-Acetylmuramoyl-L-alanine Amidase Proteins 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000000502 dialysis Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000004325 lysozyme Substances 0.000 description 2
- 229960000274 lysozyme Drugs 0.000 description 2
- 235000010335 lysozyme Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical class OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 229940035437 1,3-propanediol Drugs 0.000 description 1
- CDMDQYCEEKCBGR-UHFFFAOYSA-N 1,4-diisocyanatocyclohexane Chemical compound O=C=NC1CCC(N=C=O)CC1 CDMDQYCEEKCBGR-UHFFFAOYSA-N 0.000 description 1
- DFPJRUKWEPYFJT-UHFFFAOYSA-N 1,5-diisocyanatopentane Chemical compound O=C=NCCCCCN=C=O DFPJRUKWEPYFJT-UHFFFAOYSA-N 0.000 description 1
- MMBPSOJWYRIRMS-UHFFFAOYSA-N 1-chloro-1-phenylbut-3-ene-1-sulfonic acid Chemical class C=CCC(Cl)(S(=O)(=O)O)C1=CC=CC=C1 MMBPSOJWYRIRMS-UHFFFAOYSA-N 0.000 description 1
- OZFIGURLAJSLIR-UHFFFAOYSA-N 1-ethenyl-2h-pyridine Chemical compound C=CN1CC=CC=C1 OZFIGURLAJSLIR-UHFFFAOYSA-N 0.000 description 1
- ZCHMCDBADMAKNR-UHFFFAOYSA-N 1-methyl-2h-pyrimidine-2,4-dicarboxylic acid Chemical compound CN1C=CC(C(O)=O)=NC1C(O)=O ZCHMCDBADMAKNR-UHFFFAOYSA-N 0.000 description 1
- UBPFKSSDARNMNX-UHFFFAOYSA-N 2,3-dichloro-4-ethenylnaphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=C(Cl)C(Cl)=C(C=C)C2=C1 UBPFKSSDARNMNX-UHFFFAOYSA-N 0.000 description 1
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical class CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 1
- ZLSCHGRWXSMZBB-UHFFFAOYSA-N 2-(1,2,2-trihydroxyethenyl)benzenesulfonic acid Chemical class OC(O)=C(O)C1=CC=CC=C1S(O)(=O)=O ZLSCHGRWXSMZBB-UHFFFAOYSA-N 0.000 description 1
- IVERURBVJAABRR-UHFFFAOYSA-N 2-(2-bromoethenyl)benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1C=CBr IVERURBVJAABRR-UHFFFAOYSA-N 0.000 description 1
- XWSGEVNYFYKXCP-UHFFFAOYSA-N 2-[carboxymethyl(methyl)amino]acetic acid Chemical compound OC(=O)CN(C)CC(O)=O XWSGEVNYFYKXCP-UHFFFAOYSA-N 0.000 description 1
- HAZOZRAPGZDOEM-UHFFFAOYSA-N 2-aminoacetohydrazide Chemical compound NCC(=O)NN HAZOZRAPGZDOEM-UHFFFAOYSA-N 0.000 description 1
- QSKPIOLLBIHNAC-UHFFFAOYSA-N 2-chloro-acetaldehyde Chemical compound ClCC=O QSKPIOLLBIHNAC-UHFFFAOYSA-N 0.000 description 1
- GPOGMJLHWQHEGF-UHFFFAOYSA-N 2-chloroethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCl GPOGMJLHWQHEGF-UHFFFAOYSA-N 0.000 description 1
- BBJJJPPTYKZIJP-UHFFFAOYSA-N 2-ethenoxybenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1OC=C BBJJJPPTYKZIJP-UHFFFAOYSA-N 0.000 description 1
- XHCCPUQVFMEKIZ-UHFFFAOYSA-N 2-ethenyl-4,6-dimethylpyridine Chemical compound CC1=CC(C)=NC(C=C)=C1 XHCCPUQVFMEKIZ-UHFFFAOYSA-N 0.000 description 1
- YQUDMNIUBTXLSX-UHFFFAOYSA-N 2-ethenyl-5-ethylpyridine Chemical compound CCC1=CC=C(C=C)N=C1 YQUDMNIUBTXLSX-UHFFFAOYSA-N 0.000 description 1
- LCFYCLRCIJDYQD-UHFFFAOYSA-N 2-ethenyl-5-methylpyridine Chemical compound CC1=CC=C(C=C)N=C1 LCFYCLRCIJDYQD-UHFFFAOYSA-N 0.000 description 1
- VMWGBWNAHAUQIO-UHFFFAOYSA-N 2-ethenyl-6-methylpyridine Chemical compound CC1=CC=CC(C=C)=N1 VMWGBWNAHAUQIO-UHFFFAOYSA-N 0.000 description 1
- VMSBGXAJJLPWKV-UHFFFAOYSA-N 2-ethenylbenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1C=C VMSBGXAJJLPWKV-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- HFQRGMYQLGXWRI-UHFFFAOYSA-N 2-prop-1-en-2-ylnaphthalene-1-sulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(C(=C)C)=CC=C21 HFQRGMYQLGXWRI-UHFFFAOYSA-N 0.000 description 1
- BHDBDYGQQIHGSV-UHFFFAOYSA-N 2-propan-2-yl-6-prop-1-en-2-ylbenzenesulfonic acid Chemical class CC(C)C1=CC=CC(C(C)=C)=C1S(O)(=O)=O BHDBDYGQQIHGSV-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- VOPLICFBIPVZTC-UHFFFAOYSA-N 3-(dimethylamino)cyclopentane-1,2-dicarboxylic acid Chemical compound CN(C)C1CCC(C(O)=O)C1C(O)=O VOPLICFBIPVZTC-UHFFFAOYSA-N 0.000 description 1
- ATBDZSAENDYQDW-UHFFFAOYSA-N 3-ethenylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(C=C)=C1 ATBDZSAENDYQDW-UHFFFAOYSA-N 0.000 description 1
- DPZYLEIWHTWHCU-UHFFFAOYSA-N 3-ethenylpyridine Chemical compound C=CC1=CC=CN=C1 DPZYLEIWHTWHCU-UHFFFAOYSA-N 0.000 description 1
- LNIRBSSUMJWSBZ-UHFFFAOYSA-N 4-prop-1-en-2-ylbenzenesulfonic acid Chemical compound CC(=C)C1=CC=C(S(O)(=O)=O)C=C1 LNIRBSSUMJWSBZ-UHFFFAOYSA-N 0.000 description 1
- CARJPEPCULYFFP-UHFFFAOYSA-N 5-Sulfo-1,3-benzenedicarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(S(O)(=O)=O)=C1 CARJPEPCULYFFP-UHFFFAOYSA-N 0.000 description 1
- USQOVYLRWBOSQC-HNNXBMFYSA-N CCCCCCNC(=O)Oc1cccc(c1)-c1ccc(cc1F)[C@H](C)C(O)=O Chemical compound CCCCCCNC(=O)Oc1cccc(c1)-c1ccc(cc1F)[C@H](C)C(O)=O USQOVYLRWBOSQC-HNNXBMFYSA-N 0.000 description 1
- 101100516554 Caenorhabditis elegans nhr-5 gene Proteins 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 150000001279 adipic acids Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000002965 anti-thrombogenic effect Effects 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 150000005524 benzylchlorides Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- PHPRBRMJBRAPOV-UHFFFAOYSA-N but-2-ene-1-sulfonic acid Chemical compound CC=CCS(O)(=O)=O PHPRBRMJBRAPOV-UHFFFAOYSA-N 0.000 description 1
- MXYJJDFPHIIPMC-UHFFFAOYSA-N but-3-ene-1-sulfonic acid Chemical compound OS(=O)(=O)CCC=C MXYJJDFPHIIPMC-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical compound OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical class CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 239000012972 dimethylethanolamine Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 150000002238 fumaric acids Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002311 glutaric acids Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- VFIJKQJHCCRWHE-UHFFFAOYSA-N hex-1-ene-1-sulfonic acid Chemical class CCCCC=CS(O)(=O)=O VFIJKQJHCCRWHE-UHFFFAOYSA-N 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SDYRIBONPHEWCT-UHFFFAOYSA-N n,n-dimethyl-2-phenylethenamine Chemical compound CN(C)C=CC1=CC=CC=C1 SDYRIBONPHEWCT-UHFFFAOYSA-N 0.000 description 1
- NINOYJQVULROET-UHFFFAOYSA-N n,n-dimethylethenamine Chemical compound CN(C)C=C NINOYJQVULROET-UHFFFAOYSA-N 0.000 description 1
- BXAQFTLBYMGEIQ-UHFFFAOYSA-N n,n-dimethylhexan-3-amine Chemical compound CCCC(CC)N(C)C BXAQFTLBYMGEIQ-UHFFFAOYSA-N 0.000 description 1
- NXBBFAKHXAMPOM-UHFFFAOYSA-N n,n-dimethylprop-1-en-1-amine Chemical compound CC=CN(C)C NXBBFAKHXAMPOM-UHFFFAOYSA-N 0.000 description 1
- DDCVREGVKUIOSZ-UHFFFAOYSA-N n,n-dimethylprop-1-en-2-amine Chemical compound CN(C)C(C)=C DDCVREGVKUIOSZ-UHFFFAOYSA-N 0.000 description 1
- GBCKRQRXNXQQPW-UHFFFAOYSA-N n,n-dimethylprop-2-en-1-amine Chemical compound CN(C)CC=C GBCKRQRXNXQQPW-UHFFFAOYSA-N 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- MSIBHARACSILSI-UHFFFAOYSA-N oct-5-en-1-amine Chemical compound CCC=CCCCCN MSIBHARACSILSI-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- BIYCHPUIIDCAPR-UHFFFAOYSA-N pent-2-ene-2-sulfonic acid Chemical class CCC=C(C)S(O)(=O)=O BIYCHPUIIDCAPR-UHFFFAOYSA-N 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphonic acid group Chemical group P(O)(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical group [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000003047 pimelic acids Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000090 poly(aryl ether) Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- RAJUSMULYYBNSJ-UHFFFAOYSA-N prop-1-ene-1-sulfonic acid Chemical compound CC=CS(O)(=O)=O RAJUSMULYYBNSJ-UHFFFAOYSA-N 0.000 description 1
- UIIIBRHUICCMAI-UHFFFAOYSA-N prop-2-ene-1-sulfonic acid Chemical compound OS(=O)(=O)CC=C UIIIBRHUICCMAI-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 150000003442 suberic acids Chemical class 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical group [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D69/00—Semi-permeable membranes for separation processes or apparatus characterised by their form, structure or properties; Manufacturing processes specially adapted therefor
- B01D69/12—Composite membranes; Ultra-thin membranes
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D71/00—Semi-permeable membranes for separation processes or apparatus characterised by the material; Manufacturing processes specially adapted therefor
- B01D71/06—Organic material
- B01D71/76—Macromolecular material not specifically provided for in a single one of groups B01D71/08 - B01D71/74
- B01D71/80—Block polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/08—Processes
- C08G18/0804—Manufacture of polymers containing ionic or ionogenic groups
- C08G18/0809—Manufacture of polymers containing ionic or ionogenic groups containing cationic or cationogenic groups
- C08G18/0814—Manufacture of polymers containing ionic or ionogenic groups containing cationic or cationogenic groups containing ammonium groups or groups forming them
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G81/00—Macromolecular compounds obtained by interreacting polymers in the absence of monomers, e.g. block polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G2340/00—Filter material
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Paints Or Removers (AREA)
- Secondary Cells (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7343242A FR2252862B1 (cg-RX-API-DMAC10.html) | 1973-12-04 | 1973-12-04 | |
| FR7426738A FR2280684A1 (fr) | 1973-12-04 | 1974-08-01 | Procede de preparation de polyelectrolytes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL46177A0 IL46177A0 (en) | 1975-03-13 |
| IL46177A true IL46177A (en) | 1977-05-31 |
Family
ID=26218065
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL46177A IL46177A (en) | 1973-12-04 | 1974-12-03 | Process for preparing a complex polyelectrolyte from two types of polymer and product obtained thereby |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS50105735A (cg-RX-API-DMAC10.html) |
| BE (2) | BE822902A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7410097A (cg-RX-API-DMAC10.html) |
| CH (1) | CH589678A5 (cg-RX-API-DMAC10.html) |
| DE (2) | DE2457328A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK627974A (cg-RX-API-DMAC10.html) |
| ES (1) | ES432558A1 (cg-RX-API-DMAC10.html) |
| FR (2) | FR2252862B1 (cg-RX-API-DMAC10.html) |
| GB (2) | GB1473857A (cg-RX-API-DMAC10.html) |
| IL (1) | IL46177A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1026766B (cg-RX-API-DMAC10.html) |
| LU (2) | LU71412A1 (cg-RX-API-DMAC10.html) |
| NL (2) | NL7415424A (cg-RX-API-DMAC10.html) |
| SU (1) | SU575034A3 (cg-RX-API-DMAC10.html) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2286851A1 (fr) * | 1974-10-02 | 1976-04-30 | Inst Nat Rech Chimique | Membranes en polyacrylamide reticule ou en polyacrylamide substitue reticule, leur fabrication et leur application |
| US4005012A (en) * | 1975-09-22 | 1977-01-25 | The United States Of America As Represented By The Secretary Of The Interior | Semipermeable membranes and the method for the preparation thereof |
| LU76955A1 (cg-RX-API-DMAC10.html) * | 1977-03-15 | 1978-10-18 | ||
| US4125462A (en) * | 1977-08-30 | 1978-11-14 | Rohm And Haas Company | Coated membranes |
| JPS5554004A (en) * | 1978-10-18 | 1980-04-21 | Teijin Ltd | Selective permeable membrane and its manufacturing |
| DE3170223D1 (en) * | 1981-01-13 | 1985-06-05 | Teijin Ltd | Ion-permeable composite membrane and its use in selective separation |
| LU83350A1 (fr) * | 1981-05-08 | 1983-03-24 | Oreal | Composition destinee au traitement des fibres keratiniques a base de polymere cationique et de polymere anionique a groupements vinylsulfoniques et procede de traitement la mettant en oeuvre |
| US4415608A (en) * | 1982-01-15 | 1983-11-15 | Uop Inc. | Continuous production of polymethylpentene membranes |
| US4707266A (en) * | 1982-02-05 | 1987-11-17 | Pall Corporation | Polyamide membrane with controlled surface properties |
| CH656626A5 (fr) * | 1982-02-05 | 1986-07-15 | Pall Corp | Membrane en polyamide, presentant des proprietes de surface controlees, son utilisation et son procede de preparation. |
| US4427419A (en) * | 1982-03-12 | 1984-01-24 | The Standard Oil Company | Semipermeable membranes prepared from polymers containing pendent sulfone groups |
| US4539373A (en) * | 1982-07-12 | 1985-09-03 | The Dow Chemical Company | Thermoplastic polyelectrolyte complexes |
| US4806189A (en) * | 1984-08-13 | 1989-02-21 | Monsanto Company | Composite fluid separation membranes |
| US4717395A (en) * | 1986-08-07 | 1988-01-05 | The Dow Chemical Company | Gas separations using membranes comprising sulphonated polyether sulphone |
| JP2694341B2 (ja) * | 1987-02-04 | 1997-12-24 | ハイドロノーティクス | 改良された耐酸化性膜およびその製造方法 |
| US4990252A (en) * | 1987-02-04 | 1991-02-05 | Hydanautics | Stable membranes from sulfonated polyarylethers |
| US4840819A (en) * | 1987-04-08 | 1989-06-20 | Union Carbide Corporation | Method for preparing composite membranes for enhanced gas separation |
| US4826599A (en) * | 1987-07-10 | 1989-05-02 | Union Carbide Corporation | Composite membranes and their manufacture and use |
| JPH01215348A (ja) * | 1988-02-25 | 1989-08-29 | Asahi Glass Co Ltd | 陽イオン交換体 |
| DE4428641A1 (de) * | 1994-08-12 | 1996-02-15 | Basf Ag | Mesomorphe Komplexe aus Polyelektrolyten und Tensiden, Verfahren zu ihrer Herstellung sowie Filme, Folien, Fasern, Formkörper und Beschichtungen hieraus |
| US6026968A (en) * | 1996-05-13 | 2000-02-22 | Nitto Denko Corporation | Reverse osmosis composite membrane |
| EP0948746A1 (en) * | 1996-11-14 | 1999-10-13 | Pall Corporation | Membrane and methods of preparing and using same |
| DE19841404C2 (de) * | 1998-09-10 | 2000-12-21 | Basf Coatings Ag | Feststoffe auf der Basis mesomorpher Polyelektrolytkomplexe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| MX2011001208A (es) * | 2008-08-05 | 2012-06-29 | Polymers Crc Ltd | Membranas de poliamida de pelicula delgada, funcionalizada. |
| US10384167B2 (en) | 2013-11-21 | 2019-08-20 | Oasys Water LLC | Systems and methods for improving performance of osmotically driven membrane systems |
| KR102657532B1 (ko) | 2015-08-20 | 2024-04-12 | 니폰 제온 가부시키가이샤 | 비수계 2차 전지용 바인더 조성물, 비수계 2차 전지 기능층용 조성물, 비수계 2차 전지용 기능층 및 비수계 2차 전지 |
| WO2020051229A1 (en) | 2018-09-05 | 2020-03-12 | Campbell Membrane Techologies, Inc. | Ultrafiltration membranes for dairy protein separation |
| WO2024219965A1 (en) | 2023-04-17 | 2024-10-24 | Stichting Wageningen Research | Polyelectrolyte complex |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1493044A (fr) * | 1966-07-13 | 1967-08-25 | Nouveaux copolymères non caoutchouteux | |
| BE785741A (fr) * | 1971-07-02 | 1973-01-02 | Rhone Poulenc Sa | Polyelectrolytes |
-
1973
- 1973-12-04 FR FR7343242A patent/FR2252862B1/fr not_active Expired
-
1974
- 1974-08-01 FR FR7426738A patent/FR2280684A1/fr active Granted
- 1974-11-26 NL NL7415424A patent/NL7415424A/xx not_active Application Discontinuation
- 1974-11-26 NL NL7415419A patent/NL7415419A/xx not_active Application Discontinuation
- 1974-12-03 IT IT30150/74A patent/IT1026766B/it active
- 1974-12-03 IL IL46177A patent/IL46177A/en unknown
- 1974-12-03 JP JP49139351A patent/JPS50105735A/ja active Pending
- 1974-12-03 LU LU71412A patent/LU71412A1/xx unknown
- 1974-12-03 BR BR10097/74A patent/BR7410097A/pt unknown
- 1974-12-03 GB GB5227074A patent/GB1473857A/en not_active Expired
- 1974-12-03 SU SU7402082929A patent/SU575034A3/ru active
- 1974-12-03 GB GB5226574A patent/GB1463175A/en not_active Expired
- 1974-12-03 LU LU71413A patent/LU71413A1/xx unknown
- 1974-12-03 BE BE151115A patent/BE822902A/xx unknown
- 1974-12-03 CH CH1604474A patent/CH589678A5/xx not_active IP Right Cessation
- 1974-12-03 BE BE151114A patent/BE822901A/xx unknown
- 1974-12-03 DK DK627974A patent/DK627974A/da unknown
- 1974-12-04 ES ES432558A patent/ES432558A1/es not_active Expired
- 1974-12-04 DE DE19742457328 patent/DE2457328A1/de active Pending
- 1974-12-04 DE DE2457355A patent/DE2457355C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2280684B1 (cg-RX-API-DMAC10.html) | 1977-03-18 |
| ES432558A1 (es) | 1977-03-01 |
| CH589678A5 (cg-RX-API-DMAC10.html) | 1977-07-15 |
| FR2252862A1 (cg-RX-API-DMAC10.html) | 1975-06-27 |
| LU71412A1 (cg-RX-API-DMAC10.html) | 1975-08-20 |
| GB1463175A (en) | 1977-02-02 |
| NL7415419A (nl) | 1975-06-06 |
| DE2457328A1 (de) | 1975-06-05 |
| SU575034A3 (ru) | 1977-09-30 |
| IL46177A0 (en) | 1975-03-13 |
| NL7415424A (nl) | 1975-06-06 |
| DE2457355B2 (de) | 1979-08-02 |
| BR7410097A (pt) | 1976-06-08 |
| JPS50105735A (cg-RX-API-DMAC10.html) | 1975-08-20 |
| GB1473857A (en) | 1977-05-18 |
| IT1026766B (it) | 1978-10-20 |
| DE2457355C3 (de) | 1980-04-03 |
| BE822902A (fr) | 1975-06-03 |
| FR2280684A1 (fr) | 1976-02-27 |
| LU71413A1 (cg-RX-API-DMAC10.html) | 1975-08-20 |
| FR2252862B1 (cg-RX-API-DMAC10.html) | 1978-10-27 |
| DK627974A (cg-RX-API-DMAC10.html) | 1975-07-28 |
| DE2457355A1 (de) | 1975-06-05 |
| BE822901A (fr) | 1975-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL46177A (en) | Process for preparing a complex polyelectrolyte from two types of polymer and product obtained thereby | |
| JP3851358B2 (ja) | 高分子電解質及びその調製法 | |
| US7888397B1 (en) | Poly(phenylene)-based anion exchange membrane | |
| US3663507A (en) | Linear polyarylsulfones having functional groups thereon | |
| US7985339B2 (en) | Polyarylether compositions bearing zwitterion functionalities | |
| US6767585B2 (en) | Ionically and covalently cross-linked polymers and polymer membranes | |
| US20170014772A1 (en) | Anion exchange membranes, methods of preparation and uses thereof | |
| US3898188A (en) | Novel polyelectrolytes | |
| US4118439A (en) | Polyelectrolytes | |
| US7307138B2 (en) | Polymer electrolytes and process for their preparation | |
| JP2003031232A (ja) | 固体高分子型燃料電池用高分子電解質及び燃料電池 | |
| JPH09501722A (ja) | 強塩基性アニオン交換膜及びその製造方法 | |
| JPS61200114A (ja) | 抗血栓性ポリウレタン化合物及びその製造方法 | |
| US5798437A (en) | Thermoplastic block copolymers | |
| US3206438A (en) | Interfacial preparation of polyamides with water insoluble inorganic compounds as acid binders | |
| US3927242A (en) | Substrate coated with a layer of polyquaternary polyelectrolytes | |
| US4036808A (en) | Conductive hydrogel containing 3-ionene | |
| US7169499B2 (en) | Sulfonated polyphosphazenes, uses thereof, and methods for preparing same | |
| US5504182A (en) | Thermoplastically processable aromatic polyether amide | |
| US3673162A (en) | Copolyamides from bis(aminophenyl)sulfone | |
| US20090325028A1 (en) | Polymer electrolyte membrane, laminate thereof, and their production methods | |
| US3741945A (en) | Vinyl alcohol copolymers containing hydroxy sulfonyl groups | |
| US4734466A (en) | Modified polybenzimidazole polymer membranes | |
| JP4686719B2 (ja) | スルホン酸基を有する架橋陽イオン交換樹脂膜の製造方法及び該膜よりなる燃料電池用電解質膜 | |
| JPH0314842A (ja) | アニオン交換膜並びにそれを使用した電気透析装置及び電気透析方法 |