IL46075A - Method of combating nematodes by the use of certain alkanesulphonic acid esters - Google Patents
Method of combating nematodes by the use of certain alkanesulphonic acid estersInfo
- Publication number
- IL46075A IL46075A IL46075A IL4607574A IL46075A IL 46075 A IL46075 A IL 46075A IL 46075 A IL46075 A IL 46075A IL 4607574 A IL4607574 A IL 4607574A IL 46075 A IL46075 A IL 46075A
- Authority
- IL
- Israel
- Prior art keywords
- nematodes
- bromoethyl
- bromoethyl ester
- acid
- ester
- Prior art date
Links
- 241000244206 Nematoda Species 0.000 title claims description 15
- 238000000034 method Methods 0.000 title claims description 10
- 239000002253 acid Substances 0.000 title description 14
- 150000002148 esters Chemical class 0.000 title description 4
- -1 bromoethyl ester Chemical class 0.000 claims description 16
- 239000003085 diluting agent Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 125000005999 2-bromoethyl group Chemical group 0.000 description 7
- 230000001069 nematicidal effect Effects 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 239000000969 carrier Substances 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000005645 nematicide Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 206010011732 Cyst Diseases 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 206010061217 Infestation Diseases 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 208000031513 cyst Diseases 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- 241000680417 Aphelenchoides ritzemabosi Species 0.000 description 2
- 241000399949 Ditylenchus dipsaci Species 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 235000003228 Lactuca sativa Nutrition 0.000 description 2
- 241000243786 Meloidogyne incognita Species 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000000729 antidote Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- VWKCDMZFOOUXSF-UHFFFAOYSA-N 2-bromoethyl ethanesulfonate Chemical compound CCS(=O)(=O)OCCBr VWKCDMZFOOUXSF-UHFFFAOYSA-N 0.000 description 1
- ZUAJICINWDWGQN-UHFFFAOYSA-N 2-bromoethyl methanesulfonate Chemical compound CS(=O)(=O)OCCBr ZUAJICINWDWGQN-UHFFFAOYSA-N 0.000 description 1
- XTUURYHKIVTAPL-UHFFFAOYSA-N 2-bromoethyl propane-1-sulfonate Chemical compound CCCS(=O)(=O)OCCBr XTUURYHKIVTAPL-UHFFFAOYSA-N 0.000 description 1
- DLYFHOXJXBJNKH-UHFFFAOYSA-N 2-bromoethyl propane-2-sulfonate Chemical compound CC(C)S(=O)(=O)OCCBr DLYFHOXJXBJNKH-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 241000294569 Aphelenchoides Species 0.000 description 1
- 241000134843 Aphelenchoides besseyi Species 0.000 description 1
- 241000294568 Aphelenchoides fragariae Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000399934 Ditylenchus Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241001442497 Globodera rostochiensis Species 0.000 description 1
- 241001480224 Heterodera Species 0.000 description 1
- 241000379510 Heterodera schachtii Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001143352 Meloidogyne Species 0.000 description 1
- 241000243784 Meloidogyne arenaria Species 0.000 description 1
- 241000243785 Meloidogyne javanica Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241001148650 Paratylenchus Species 0.000 description 1
- 241000193943 Pratylenchus Species 0.000 description 1
- 241000201377 Radopholus Species 0.000 description 1
- 241000855013 Rotylenchus Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000201423 Xiphinema Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- LLCOIQRNSJBFSN-UHFFFAOYSA-N methane;sulfurochloridic acid Chemical compound C.OS(Cl)(=O)=O LLCOIQRNSJBFSN-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- RJQRCOMHVBLQIH-UHFFFAOYSA-N pentane-1-sulfonic acid Chemical compound CCCCCS(O)(=O)=O RJQRCOMHVBLQIH-UHFFFAOYSA-N 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2358017A DE2358017A1 (de) | 1973-11-21 | 1973-11-21 | Nematizide mittel |
| DE2418417A DE2418417A1 (de) | 1974-04-17 | 1974-04-17 | Nematizide mittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL46075A0 IL46075A0 (en) | 1975-02-10 |
| IL46075A true IL46075A (en) | 1977-07-31 |
Family
ID=25766132
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL46075A IL46075A (en) | 1973-11-21 | 1974-11-18 | Method of combating nematodes by the use of certain alkanesulphonic acid esters |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3934026A (ja) |
| JP (1) | JPS5077531A (ja) |
| AT (1) | AT338046B (ja) |
| BR (1) | BR7409742A (ja) |
| CH (1) | CH604499A5 (ja) |
| CS (1) | CS177885B2 (ja) |
| DD (1) | DD116127A5 (ja) |
| DK (1) | DK133846C (ja) |
| ES (1) | ES432112A1 (ja) |
| FR (1) | FR2251266B1 (ja) |
| GB (1) | GB1443905A (ja) |
| IE (1) | IE40216B1 (ja) |
| IL (1) | IL46075A (ja) |
| IT (1) | IT1025837B (ja) |
| LU (1) | LU71310A1 (ja) |
| NL (1) | NL7415062A (ja) |
| PH (1) | PH10838A (ja) |
| PL (1) | PL91853B1 (ja) |
| SU (1) | SU547168A3 (ja) |
| TR (1) | TR17989A (ja) |
-
1974
- 1974-11-05 US US05/521,117 patent/US3934026A/en not_active Expired - Lifetime
- 1974-11-14 CS CS776274A patent/CS177885B2/cs unknown
- 1974-11-18 SU SU2076492A patent/SU547168A3/ru active
- 1974-11-18 IL IL46075A patent/IL46075A/en unknown
- 1974-11-19 TR TR1798974A patent/TR17989A/xx unknown
- 1974-11-19 NL NL7415062A patent/NL7415062A/xx not_active Application Discontinuation
- 1974-11-19 CH CH1540174A patent/CH604499A5/xx not_active IP Right Cessation
- 1974-11-19 IT IT2961074A patent/IT1025837B/it active
- 1974-11-19 PH PH16532A patent/PH10838A/en unknown
- 1974-11-19 LU LU71310A patent/LU71310A1/xx unknown
- 1974-11-19 DD DD18245374A patent/DD116127A5/xx unknown
- 1974-11-19 AT AT925874A patent/AT338046B/de not_active IP Right Cessation
- 1974-11-20 DK DK603074A patent/DK133846C/da active
- 1974-11-20 ES ES432112A patent/ES432112A1/es not_active Expired
- 1974-11-20 BR BR974274A patent/BR7409742A/pt unknown
- 1974-11-20 IE IE239574A patent/IE40216B1/xx unknown
- 1974-11-20 GB GB5025174A patent/GB1443905A/en not_active Expired
- 1974-11-20 PL PL17580474A patent/PL91853B1/pl unknown
- 1974-11-21 FR FR7438276A patent/FR2251266B1/fr not_active Expired
- 1974-11-21 JP JP13323274A patent/JPS5077531A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL46075A0 (en) | 1975-02-10 |
| JPS5077531A (ja) | 1975-06-24 |
| NL7415062A (nl) | 1975-05-23 |
| SU547168A3 (ru) | 1977-02-15 |
| IE40216B1 (en) | 1979-04-11 |
| IT1025837B (it) | 1978-08-30 |
| FR2251266B1 (ja) | 1978-04-14 |
| AT338046B (de) | 1977-07-25 |
| PL91853B1 (ja) | 1977-03-31 |
| LU71310A1 (ja) | 1975-08-20 |
| US3934026A (en) | 1976-01-20 |
| AU7546474A (en) | 1976-05-20 |
| DD116127A5 (ja) | 1975-11-12 |
| CS177885B2 (ja) | 1977-08-31 |
| ATA925874A (de) | 1976-11-15 |
| PH10838A (en) | 1977-09-09 |
| FR2251266A1 (ja) | 1975-06-13 |
| TR17989A (tr) | 1976-08-20 |
| GB1443905A (en) | 1976-07-28 |
| BR7409742A (pt) | 1976-05-25 |
| CH604499A5 (ja) | 1978-09-15 |
| DK133846C (da) | 1976-12-27 |
| IE40216L (en) | 1975-05-21 |
| DK603074A (ja) | 1975-07-14 |
| ES432112A1 (es) | 1977-03-01 |
| DK133846B (da) | 1976-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0254461A2 (en) | Combatting plant nematodes using substituted hydrazones | |
| EP0410551A1 (en) | 5-Substituted 1,3,4-thiadiazole derivatives, their preparation and their use as pesticides | |
| US3819755A (en) | O,o-dialkyl-o-(4-trifluoromethylphenyl)-thionophosphoric acid esters | |
| US3422190A (en) | Aromatic isonitrile pest controlling agents | |
| JPH08311064A (ja) | 除草性[1,3,4]オキサジアゾール及びチアジアゾール類 | |
| EP0277091A2 (en) | 2-Imino-1,3-dithietanes, their preparation and use as pesticides | |
| IL46075A (en) | Method of combating nematodes by the use of certain alkanesulphonic acid esters | |
| US4171357A (en) | Cyclopropylmethylphosphoric acid derivatives | |
| EP2146955A1 (en) | Pesticidal diazene oxide carboxylates | |
| US3202658A (en) | Thionophosphonic acid esters and a process for their production | |
| US3689604A (en) | Amido-thiolphosphoric acid -o,s-dimethyl ester | |
| GB1565894A (en) | Pesticidal organic phosphorus compounds processes for their preparation and compositions containing them | |
| US3644598A (en) | 1 - alkoxy(-alkenyloxy -phenoxy) - 1-thiono-3-chloro(3-alkyl)phospholines | |
| US4010157A (en) | O-alkyl-S-[1,6-dihydro-3-methyl-6-oxo-pyridazin-(1)-ylmethyl](thiono) (di)thiol-phosphoric acid esters and ester-amides | |
| HU203739B (en) | Pesticide compositions of nematocide insecticide and acaricide activity containing 5-substituted-3-aryl-isoxazol derivatives as active components and process for producing the active components | |
| CA1083169A (en) | Dialkylthiolophosphoryl urea pesticides | |
| US5162351A (en) | Benzoisothiazoles, their preparation and their use as pesticides | |
| US4457923A (en) | O-Trihaloethyl phosphorodithioate pesticides | |
| KR910005707B1 (ko) | 3-아실-2-니트로메틸렌-테트라하이드로-2h-1,3-티아진의 제조방법 | |
| US4000173A (en) | 3-aryl-2-halothiopropionic acid s-esters | |
| US3989525A (en) | H-isopropyl-2-chloroethane-(thiono)-phosphonic acid ester amide compounds and herbicidal compositions | |
| EP0726263A2 (en) | Herbicidal (1,3,4)oxadiazoles and thiadiazoles | |
| CA1054608A (en) | 1,2,4-thiadiazolyl-(3)-phosphorus esters | |
| US3856949A (en) | N-isopropyl-o-ethyl-o-arylphosphoric acid ester amides as arthropodicides and nematocides | |
| US3197498A (en) | Alkyl-(mercapto, sulfoxy, sulfonyl)-acetic acid amide-s-esters of phosphorus acids |