IL44728A - Alpha-aminoacyldipeptide penicillins and their preparatio - Google Patents
Alpha-aminoacyldipeptide penicillins and their preparatioInfo
- Publication number
- IL44728A IL44728A IL44728A IL4472873A IL44728A IL 44728 A IL44728 A IL 44728A IL 44728 A IL44728 A IL 44728A IL 4472873 A IL4472873 A IL 4472873A IL 44728 A IL44728 A IL 44728A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- compound
- salt
- ester
- formula
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title claims description 20
- 150000002960 penicillins Chemical class 0.000 title description 10
- 239000002253 acid Substances 0.000 claims description 98
- 238000000034 method Methods 0.000 claims description 88
- 150000001875 compounds Chemical class 0.000 claims description 40
- 150000003839 salts Chemical class 0.000 claims description 37
- 150000002148 esters Chemical class 0.000 claims description 27
- -1 benzyloxy, thienyl Chemical group 0.000 claims description 26
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 10
- 229940049954 penicillin Drugs 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 230000000903 blocking effect Effects 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- 238000006136 alcoholysis reaction Methods 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000005633 phthalidyl group Chemical group 0.000 claims description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical group COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 claims description 2
- 235000019253 formic acid Nutrition 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 4
- 230000000063 preceeding effect Effects 0.000 claims 4
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- 239000012948 isocyanate Substances 0.000 claims 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims 1
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 1
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 210000004013 groin Anatomy 0.000 claims 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 claims 1
- 150000002513 isocyanates Chemical class 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 238000003556 assay Methods 0.000 description 15
- 239000000243 solution Substances 0.000 description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 239000000203 mixture Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- 150000004684 trihydrates Chemical class 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- JSJWCHRYRHKBBW-UHFFFAOYSA-N N-carbamoyl-beta-alanine Chemical compound NC(=O)NCCC(O)=O JSJWCHRYRHKBBW-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 1
- 229960003022 amoxicillin Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 150000008430 aromatic amides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 150000001913 cyanates Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical group C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- RPBAFSBGYDKNRG-NJBDSQKTSA-N epicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CCC=CC1 RPBAFSBGYDKNRG-NJBDSQKTSA-N 0.000 description 1
- 229960002457 epicillin Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- ZQDWXGKKHFNSQK-UHFFFAOYSA-N hydroxyzine Chemical compound C1CN(CCOCCO)CCN1C(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 ZQDWXGKKHFNSQK-UHFFFAOYSA-N 0.000 description 1
- 229960000930 hydroxyzine Drugs 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 150000003952 β-lactams Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB21203/73A GB1479267A (en) | 1973-05-04 | 1973-05-04 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL44728A true IL44728A (en) | 1977-08-31 |
Family
ID=10158924
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL44728A IL44728A (en) | 1973-05-04 | 1973-05-04 | Alpha-aminoacyldipeptide penicillins and their preparatio |
| IL44728A IL44728A0 (en) | 1973-05-04 | 1974-04-29 | Novel penicillins and their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL44728A IL44728A0 (en) | 1973-05-04 | 1974-04-29 | Novel penicillins and their preparation |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3923788A (member.php) |
| JP (1) | JPS5756479B2 (member.php) |
| AR (1) | AR201768A1 (member.php) |
| AT (1) | AT330957B (member.php) |
| BE (1) | BE814559A (member.php) |
| BR (1) | BR7403455D0 (member.php) |
| CH (1) | CH603663A5 (member.php) |
| CS (1) | CS197231B2 (member.php) |
| DD (1) | DD111579A5 (member.php) |
| DE (1) | DE2421030A1 (member.php) |
| ES (1) | ES425945A1 (member.php) |
| FI (1) | FI58778C (member.php) |
| FR (1) | FR2227858B1 (member.php) |
| GB (1) | GB1479267A (member.php) |
| HU (1) | HU169830B (member.php) |
| IE (1) | IE40013B1 (member.php) |
| IL (2) | IL44728A (member.php) |
| MW (1) | MW1874A1 (member.php) |
| NL (1) | NL7406024A (member.php) |
| PH (1) | PH12910A (member.php) |
| RO (1) | RO67060A (member.php) |
| SE (1) | SE7703567L (member.php) |
| SU (1) | SU668606A3 (member.php) |
| YU (1) | YU122174A (member.php) |
| ZA (1) | ZA742788B (member.php) |
| ZM (1) | ZM7274A1 (member.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1503918A (en) * | 1974-06-18 | 1978-03-15 | Beecham Group Ltd | Penicillins |
| ES448679A1 (es) * | 1975-07-31 | 1977-11-16 | Kim Young Sul | Un procedimiento para la produccion de lisinato de metampi- cilina. |
| US4053609A (en) * | 1975-09-12 | 1977-10-11 | Tanabe Seiyaku Co., Ltd. | Penicillins and processes for preparing the same |
| TR201922977A2 (tr) * | 2019-12-31 | 2021-07-26 | T C Erciyes Ueniversitesi | Penisilin türevleri ve bunların sentezlenmesi için yöntem |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR6705A (member.php) * | 1958-02-06 | |||
| US3340252A (en) * | 1964-04-07 | 1967-09-05 | American Home Prod | Amino-acylamino-acylamino-penicillanic acids |
| GB1180745A (en) * | 1966-10-04 | 1970-02-11 | Beecham Group Ltd | Penicillins |
| US3483188A (en) * | 1968-06-13 | 1969-12-09 | Bristol Myers Co | 6-(alpha - 3 - allophanamidophenylacetamido) and 6 - (alpha - 3 - allophanamidothienylacetamido)-penicillanic acids |
-
1973
- 1973-05-04 IL IL44728A patent/IL44728A/en unknown
- 1973-05-04 GB GB21203/73A patent/GB1479267A/en not_active Expired
-
1974
- 1974-04-24 FI FI1265/74A patent/FI58778C/fi active
- 1974-04-26 BR BR3455/74A patent/BR7403455D0/pt unknown
- 1974-04-29 IL IL44728A patent/IL44728A0/xx unknown
- 1974-04-29 IE IE901/74A patent/IE40013B1/xx unknown
- 1974-04-30 SU SU742026174A patent/SU668606A3/ru active
- 1974-04-30 DE DE2421030A patent/DE2421030A1/de not_active Ceased
- 1974-04-30 YU YU01221/74A patent/YU122174A/xx unknown
- 1974-05-02 AT AT364374A patent/AT330957B/de not_active IP Right Cessation
- 1974-05-02 FR FR7415192A patent/FR2227858B1/fr not_active Expired
- 1974-05-02 ZA ZA00742788A patent/ZA742788B/xx unknown
- 1974-05-03 ZM ZM72/74A patent/ZM7274A1/xx unknown
- 1974-05-03 RO RO7478669A patent/RO67060A/ro unknown
- 1974-05-03 BE BE143931A patent/BE814559A/xx unknown
- 1974-05-03 HU HUBE1197A patent/HU169830B/hu unknown
- 1974-05-03 US US466814A patent/US3923788A/en not_active Expired - Lifetime
- 1974-05-03 CS CS743212A patent/CS197231B2/cs unknown
- 1974-05-03 PH PH15807A patent/PH12910A/en unknown
- 1974-05-03 NL NL7406024A patent/NL7406024A/xx not_active Application Discontinuation
- 1974-05-03 ES ES425945A patent/ES425945A1/es not_active Expired
- 1974-05-03 CH CH605774A patent/CH603663A5/xx not_active IP Right Cessation
- 1974-05-03 MW MW18/74*UA patent/MW1874A1/xx unknown
- 1974-05-04 JP JP49050193A patent/JPS5756479B2/ja not_active Expired
- 1974-05-06 DD DD178296A patent/DD111579A5/xx unknown
- 1974-05-06 AR AR253608A patent/AR201768A1/es active
-
1977
- 1977-03-28 SE SE7703567A patent/SE7703567L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RO67060A (ro) | 1982-10-26 |
| NL7406024A (member.php) | 1974-11-06 |
| YU122174A (en) | 1982-05-31 |
| AR201768A1 (es) | 1975-04-15 |
| MW1874A1 (en) | 1975-05-13 |
| IE40013B1 (en) | 1979-02-28 |
| FI58778B (fi) | 1980-12-31 |
| ES425945A1 (es) | 1976-12-16 |
| ZA742788B (en) | 1975-05-28 |
| FR2227858B1 (member.php) | 1977-11-04 |
| FI58778C (fi) | 1981-04-10 |
| AT330957B (de) | 1976-07-26 |
| AU6853474A (en) | 1975-11-06 |
| CH603663A5 (member.php) | 1978-08-31 |
| JPS5040589A (member.php) | 1975-04-14 |
| ATA364374A (de) | 1975-10-15 |
| ZM7274A1 (en) | 1976-11-22 |
| PH12910A (en) | 1979-10-04 |
| US3923788A (en) | 1975-12-02 |
| DE2421030A1 (de) | 1974-11-21 |
| IL44728A0 (en) | 1974-06-30 |
| DD111579A5 (member.php) | 1975-02-20 |
| BE814559A (fr) | 1974-11-04 |
| SU668606A3 (ru) | 1979-06-15 |
| FR2227858A1 (member.php) | 1974-11-29 |
| CS197231B2 (en) | 1980-04-30 |
| IE40013L (en) | 1974-11-04 |
| BR7403455D0 (pt) | 1974-12-31 |
| HU169830B (member.php) | 1977-02-28 |
| JPS5756479B2 (member.php) | 1982-11-30 |
| GB1479267A (en) | 1977-07-13 |
| SE7703567L (sv) | 1977-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1131620A (en) | Penicillins and cephalosporins | |
| DE2055337A1 (de) | Ureidocephalosporansaureverbindungen ihre Salze, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln | |
| FI63035C (fi) | Foerfarande foer framstaellning av 7-alfa-aminoacyl-3-klorcefalosporinderivat | |
| US3652546A (en) | Esters of 6-aminopenicillanic acid | |
| IL44728A (en) | Alpha-aminoacyldipeptide penicillins and their preparatio | |
| US4312982A (en) | α-Acylureidocephalosporins and salts and esters thereof | |
| US4193918A (en) | Process for the preparation of hydroxy-alpha-amino-benzyl penicillin | |
| NL8005006A (nl) | Dipeptide-zoetstof. | |
| FI73437C (fi) | Foerfarande foer framstaellning av 3-karbamoyloximetylkefalosporinfoereningar. | |
| US3720664A (en) | Alpha-ureidocyclohexadienylalkylene-penicillins | |
| FI66186B (fi) | Foerfarande foer framstaellning av penicillansyra- och cefalosporansyraderivat | |
| US3935189A (en) | Penicillins | |
| US4171303A (en) | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives | |
| FI58133B (fi) | Foerfarande foer framstaellning av hetacefalexin | |
| US3492297A (en) | Guanidino cephalosporins | |
| CA1056817A (en) | Penicillins | |
| US3720665A (en) | Acyloxymethyl esters of alpha-preidocyclo-hexadienylalkylene-penicillins | |
| US4123611A (en) | N-protected amino compounds | |
| US3668198A (en) | {60 -ureido-2,4,6-cycloheptatrienylmethylpenicillins | |
| JPS6183188A (ja) | ペニシリンの製造法 | |
| US3935192A (en) | Penicillins | |
| US3780088A (en) | Alpha-ureidocyclohexadienylalkylene carboxylic acids | |
| EP0122154A2 (en) | Improvements in or relating to benzothienylglycyl cephalosporin derivatives | |
| US3594366A (en) | Process for the preparation of aminoalicyclic and aminoarylalicyclic penicillins | |
| US3962216A (en) | Penicillins |