IL43480A - Pyrocatechol mono-ethers and their production - Google Patents
Pyrocatechol mono-ethers and their productionInfo
- Publication number
- IL43480A IL43480A IL43480A IL4348073A IL43480A IL 43480 A IL43480 A IL 43480A IL 43480 A IL43480 A IL 43480A IL 4348073 A IL4348073 A IL 4348073A IL 43480 A IL43480 A IL 43480A
- Authority
- IL
- Israel
- Prior art keywords
- pyrocatechol
- lower alkyl
- formula
- ether
- parts
- Prior art date
Links
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 title claims description 47
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 6
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- -1 β-chloroethyl Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- RJXXCLQZUVADGY-UHFFFAOYSA-N 2-(1-ethoxyethoxy)phenol Chemical compound CCOC(C)OC1=CC=CC=C1O RJXXCLQZUVADGY-UHFFFAOYSA-N 0.000 claims 1
- NFKRBIJFEJTLBQ-UHFFFAOYSA-N 2-(1-methoxyethoxy)phenol Chemical compound COC(C)OC1=CC=CC=C1O NFKRBIJFEJTLBQ-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000009835 boiling Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000488583 Panonychus ulmi Species 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 241000238876 Acari Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- AOJDZKCUAATBGE-UHFFFAOYSA-N bromomethane Chemical compound Br[CH2] AOJDZKCUAATBGE-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252198A DE2252198C2 (de) | 1972-10-25 | 1972-10-25 | Brenzkatechinäther und Verfahren zu ihrer Herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL43480A0 IL43480A0 (en) | 1974-01-14 |
| IL43480A true IL43480A (en) | 1977-06-30 |
Family
ID=5859959
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL43480A IL43480A (en) | 1972-10-25 | 1973-10-25 | Pyrocatechol mono-ethers and their production |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS5747653B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE806132A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1036612A (cg-RX-API-DMAC10.html) |
| CH (1) | CH589581A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS196248B2 (cg-RX-API-DMAC10.html) |
| DD (1) | DD107251A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2252198C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2204604B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1444967A (cg-RX-API-DMAC10.html) |
| IL (1) | IL43480A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1008584B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7314701A (cg-RX-API-DMAC10.html) |
| SU (1) | SU629871A3 (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4163112A (en) * | 1977-04-04 | 1979-07-31 | Velsicol Chemical Corporation | O-alkoxy- and alkylthiophenyl carbamates |
| GR74976B (cg-RX-API-DMAC10.html) * | 1980-08-13 | 1984-07-12 | Interx Research Corp | |
| CN114230446B (zh) * | 2022-01-17 | 2022-12-20 | 山东泓瑞医药科技股份公司 | 一种藜芦醚的制备方法 |
-
1972
- 1972-10-25 DE DE2252198A patent/DE2252198C2/de not_active Expired
-
1973
- 1973-10-01 DD DD173804A patent/DD107251A5/xx unknown
- 1973-10-16 BE BE136737A patent/BE806132A/xx not_active IP Right Cessation
- 1973-10-17 CA CA183,560A patent/CA1036612A/en not_active Expired
- 1973-10-19 JP JP48117013A patent/JPS5747653B2/ja not_active Expired
- 1973-10-24 CS CS737335A patent/CS196248B2/cs unknown
- 1973-10-24 CH CH1498573A patent/CH589581A5/xx not_active IP Right Cessation
- 1973-10-24 IT IT53328/73A patent/IT1008584B/it active
- 1973-10-24 SU SU731965924A patent/SU629871A3/ru active
- 1973-10-24 GB GB4940373A patent/GB1444967A/en not_active Expired
- 1973-10-25 FR FR7338131A patent/FR2204604B1/fr not_active Expired
- 1973-10-25 NL NL7314701A patent/NL7314701A/xx not_active Application Discontinuation
- 1973-10-25 IL IL43480A patent/IL43480A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD107251A5 (cg-RX-API-DMAC10.html) | 1974-07-20 |
| JPS4972222A (cg-RX-API-DMAC10.html) | 1974-07-12 |
| FR2204604A1 (cg-RX-API-DMAC10.html) | 1974-05-24 |
| IT1008584B (it) | 1976-11-30 |
| BE806132A (fr) | 1974-04-16 |
| FR2204604B1 (cg-RX-API-DMAC10.html) | 1978-09-08 |
| DE2252198C2 (de) | 1981-11-26 |
| DE2252198A1 (de) | 1974-05-09 |
| CA1036612A (en) | 1978-08-15 |
| CH589581A5 (cg-RX-API-DMAC10.html) | 1977-07-15 |
| NL7314701A (cg-RX-API-DMAC10.html) | 1974-04-29 |
| JPS5747653B2 (cg-RX-API-DMAC10.html) | 1982-10-12 |
| CS196248B2 (en) | 1980-03-31 |
| IL43480A0 (en) | 1974-01-14 |
| AU6151773A (en) | 1975-04-17 |
| GB1444967A (en) | 1976-08-04 |
| SU629871A3 (ru) | 1978-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0939749A1 (en) | Process for the preparation of benzyl-ethers | |
| DE2304962A1 (de) | Neue aether | |
| IL43480A (en) | Pyrocatechol mono-ethers and their production | |
| US3992533A (en) | O-ethyl-S-N-propyl-O-(2-chloro-4-bromophenyl)-thiophosphate | |
| US4029662A (en) | Method of making barbituric acid derivatives | |
| IL42564A (en) | O-(substituted alkoxy)phenyl carbamates ther preparation and pesticidal compositions containing them | |
| US3224861A (en) | Controlling undesired vegetation with benzyl hexamethyleniminecarbothioates | |
| DE19801598C2 (de) | Katalytische Synthese von N-alkylierten Anilinen aus Olefinen und Anilinen | |
| US3671214A (en) | Inhibiting the growth of plants with substituted indole derivatives | |
| RU2133734C1 (ru) | Способ получения циклоалкил- или галогеналкил-о-аминофенилкетонов (варианты) | |
| US4140725A (en) | Pyrocatechol ethers | |
| US3962316A (en) | Carbamate | |
| US4129601A (en) | Pyrocatechol derivatives | |
| US3933837A (en) | 3,4-Methylenedioxyphenoxy-alkyl diketones and keto-esters | |
| EP0182166B1 (en) | Process for preparing phenylisopropylurea compounds | |
| HRP970607A2 (en) | Process for the preparation of benzyl-ethers by the use of a phase transfer | |
| US3982015A (en) | N-propargyl-anilinomethylenemalodinitrile derivatives | |
| US3148204A (en) | Halogenated ether cyano esters | |
| US4264770A (en) | Process for preparing 1,4-bis-piperonylpiperazine and similar compounds | |
| MXPA02001248A (es) | Proceso para la preparacion de compuestos de 1,3-dicarbonilo acilados. | |
| GB1593276A (en) | Imidazoline derivatives and their use as pesticides | |
| HUT53862A (en) | Process for producing naphthalene derivatives and their intermediates | |
| US4161528A (en) | 1,3-Diphenyl-2-trichloromethyl-imidazolidines | |
| US2567839A (en) | 4 methoxyphenyl ester of 4-chloro-benzene sulfonic acid | |
| US4276229A (en) | Process for preparing carbamate compounds |