IL41629A - N,n' diphenyl-n-(n"-alkylcarbamoyl)-formamidine derivatives,their production and herbicidal compositions containing them - Google Patents
N,n' diphenyl-n-(n"-alkylcarbamoyl)-formamidine derivatives,their production and herbicidal compositions containing themInfo
- Publication number
- IL41629A IL41629A IL41629A IL4162973A IL41629A IL 41629 A IL41629 A IL 41629A IL 41629 A IL41629 A IL 41629A IL 4162973 A IL4162973 A IL 4162973A IL 41629 A IL41629 A IL 41629A
- Authority
- IL
- Israel
- Prior art keywords
- formamidine
- compound
- formula
- methylcarbamoyl
- phenyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims 4
- 238000004519 manufacturing process Methods 0.000 title claims 3
- 239000000203 mixture Substances 0.000 title claims 3
- 150000001875 compounds Chemical class 0.000 claims abstract 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract 12
- 125000000217 alkyl group Chemical group 0.000 claims abstract 8
- 239000004009 herbicide Substances 0.000 claims abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract 2
- 239000001257 hydrogen Substances 0.000 claims abstract 2
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 claims 28
- 229910052801 chlorine Inorganic materials 0.000 claims 9
- 239000000460 chlorine Substances 0.000 claims 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 8
- 238000000034 method Methods 0.000 claims 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 7
- 125000004432 carbon atom Chemical group C* 0.000 claims 6
- -1 3-trifluoromethylphenyl Chemical group 0.000 claims 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 3
- 241000196324 Embryophyta Species 0.000 claims 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims 2
- NGRHHTODLFNUHB-UHFFFAOYSA-N CCN(CC)S(=O)=O Chemical compound CCN(CC)S(=O)=O NGRHHTODLFNUHB-UHFFFAOYSA-N 0.000 claims 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 2
- QQSRGYGYLVLMFU-UHFFFAOYSA-N 3,4-dimethylbenzenecarboximidamide Chemical compound CC1=CC=C(C(N)=N)C=C1C QQSRGYGYLVLMFU-UHFFFAOYSA-N 0.000 claims 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims 1
- 229920000742 Cotton Polymers 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 235000002595 Solanum tuberosum Nutrition 0.000 claims 1
- 244000061456 Solanum tuberosum Species 0.000 claims 1
- 239000013543 active substance Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 229960003887 dichlorophen Drugs 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 238000011065 in-situ storage Methods 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/56—X being a nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH285972A CH576432A5 (show.php) | 1972-02-29 | 1972-02-29 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL41629A0 IL41629A0 (en) | 1973-04-30 |
| IL41629A true IL41629A (en) | 1976-12-31 |
Family
ID=4243180
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL41629A IL41629A (en) | 1972-02-29 | 1973-02-27 | N,n' diphenyl-n-(n"-alkylcarbamoyl)-formamidine derivatives,their production and herbicidal compositions containing them |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3966805A (show.php) |
| JP (1) | JPS4898028A (show.php) |
| BR (1) | BR7301449D0 (show.php) |
| CA (1) | CA984838A (show.php) |
| CH (1) | CH576432A5 (show.php) |
| DE (1) | DE2308943A1 (show.php) |
| DK (1) | DK130960B (show.php) |
| EG (1) | EG10958A (show.php) |
| ES (1) | ES412101A1 (show.php) |
| FR (1) | FR2174103B1 (show.php) |
| GB (1) | GB1418999A (show.php) |
| IL (1) | IL41629A (show.php) |
| IT (1) | IT982862B (show.php) |
| TR (1) | TR17426A (show.php) |
| ZA (1) | ZA731413B (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2223361B1 (show.php) * | 1973-03-27 | 1977-04-29 | Philagro Sa | |
| IT1121579B (it) * | 1979-06-15 | 1986-04-02 | Montedison Spa | Nuovi erbicidi |
| DE19619628A1 (de) * | 1996-05-15 | 1997-11-20 | Hoechst Schering Agrevo Gmbh | (Hetero)Arylsulfonylharnstoffe mit einer Iminofunktion, ihre Darstellung und Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
| WO2009062171A1 (en) * | 2007-11-09 | 2009-05-14 | Materia, Inc. | Preparation of saturated imidazolinium salts and related compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL292790A (show.php) * | 1962-05-16 | |||
| CH433245A (de) * | 1963-06-12 | 1967-04-15 | Basf Ag | Verfahren zur Herstellung von Harnstoffderivaten |
| FR1407241A (fr) * | 1964-06-11 | 1965-07-30 | Basf Ag | Procédé pour la production de dérivés d'urée |
| US3898277A (en) * | 1971-01-22 | 1975-08-05 | Ciba Geigy Corp | N-substituted aryl formimidoyl compounds |
-
1972
- 1972-02-29 CH CH285972A patent/CH576432A5/xx not_active IP Right Cessation
-
1973
- 1973-02-20 DK DK89473AA patent/DK130960B/da unknown
- 1973-02-23 DE DE19732308943 patent/DE2308943A1/de active Pending
- 1973-02-23 US US05/335,050 patent/US3966805A/en not_active Expired - Lifetime
- 1973-02-26 CA CA164,520A patent/CA984838A/en not_active Expired
- 1973-02-26 JP JP48023037A patent/JPS4898028A/ja active Pending
- 1973-02-26 TR TR17426A patent/TR17426A/xx unknown
- 1973-02-27 GB GB947373A patent/GB1418999A/en not_active Expired
- 1973-02-27 ES ES412101A patent/ES412101A1/es not_active Expired
- 1973-02-27 IL IL41629A patent/IL41629A/en unknown
- 1973-02-27 FR FR7306953A patent/FR2174103B1/fr not_active Expired
- 1973-02-27 BR BR731449A patent/BR7301449D0/pt unknown
- 1973-02-27 IT IT48483/73A patent/IT982862B/it active
- 1973-02-28 ZA ZA731413A patent/ZA731413B/xx unknown
- 1973-03-25 EG EG66/73*[A patent/EG10958A/xx active
Also Published As
| Publication number | Publication date |
|---|---|
| EG10958A (en) | 1976-09-30 |
| ZA731413B (en) | 1974-10-30 |
| US3966805A (en) | 1976-06-29 |
| BR7301449D0 (pt) | 1974-05-23 |
| FR2174103A1 (show.php) | 1973-10-12 |
| JPS4898028A (show.php) | 1973-12-13 |
| AU5273573A (en) | 1974-08-29 |
| DK130960C (show.php) | 1975-10-13 |
| TR17426A (tr) | 1975-07-23 |
| DE2308943A1 (de) | 1973-09-13 |
| DK130960B (da) | 1975-05-12 |
| IL41629A0 (en) | 1973-04-30 |
| ES412101A1 (es) | 1976-06-16 |
| FR2174103B1 (show.php) | 1977-02-04 |
| CH576432A5 (show.php) | 1976-06-15 |
| GB1418999A (en) | 1975-12-24 |
| CA984838A (en) | 1976-03-02 |
| IT982862B (it) | 1974-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL41252A (en) | 1,2,4-triazole derivatives,their production and their use as fungicides | |
| EP0033984B1 (en) | New sulphonyl compounds, method of preparing the new compounds, as well as aphicidal compositions on the basis of the new compounds | |
| US3989737A (en) | 2-Cyclohexene-1-one derivatives | |
| AU632319B2 (en) | Pest control compositions | |
| FR2812633A1 (fr) | Derives de phenyl(thio)urees et phenyl(thio)carbamates fongicides | |
| US3367949A (en) | Sulfanilamides | |
| ES8105249A1 (es) | Procedimiento de preparar difenileteres herbicidamente acti-vos. | |
| DE2643477A1 (de) | Mikrobizide | |
| US5190958A (en) | Piperidine derivatives | |
| IL41629A (en) | N,n' diphenyl-n-(n"-alkylcarbamoyl)-formamidine derivatives,their production and herbicidal compositions containing them | |
| IL38913A (en) | Aminopyridines and herbicidal,insecticidal and fungicidal compositions comprising them | |
| IL43299A (en) | Tetrasubstituted ureas,their preparation and their use as herbicides | |
| EP0242322B1 (en) | Phenylureas | |
| CA1282419C (en) | Imidazoles, their preparation and their use as fungicides | |
| US4170464A (en) | Herbicidal combinations | |
| DE2643403A1 (de) | Mikrobizide mittel | |
| US3857692A (en) | 1,2-dimethyl-3,5-diphenylpyrazolium salts and 3,5-dibromo-4-hydroxybenzonitrile herbicidal compositions | |
| US2914536A (en) | Novel 3-acylamino triazoles | |
| US4399143A (en) | Phenoxybutyltriazole compound, agricultural and horticultural fungicidal composition containing the same, and process for producing the same | |
| DE69829574T2 (de) | Biarylalkylencarbaminsäure-derivate und fungizide für landwirtschaft und gartenbau | |
| HU215497B (hu) | Herbicid tetrazolinonszármazék, eljárás előállítására, és azt tartalmazó készítmény | |
| IE51860B1 (en) | Insecticidally active acyl-ureas and their manufacture and use | |
| US4111682A (en) | N-(aminoalkylene thiomethyl)-N'-(aryl) urea herbicides | |
| EP0253447B1 (en) | Imidazole derivatives, their preparation and their use as fungicides | |
| US4205168A (en) | N-Carbamylalkyl-2,6-dialkyl-α-haloacetanilides |