IL37529A - Herbicidally active 1,1,3-trimethyl-3-(5-substituted-1,3,4thiadiazol-2-yl)ureas their manufacture and preparations containing them - Google Patents
Herbicidally active 1,1,3-trimethyl-3-(5-substituted-1,3,4thiadiazol-2-yl)ureas their manufacture and preparations containing themInfo
- Publication number
- IL37529A IL37529A IL37529A IL3752971A IL37529A IL 37529 A IL37529 A IL 37529A IL 37529 A IL37529 A IL 37529A IL 3752971 A IL3752971 A IL 3752971A IL 37529 A IL37529 A IL 37529A
- Authority
- IL
- Israel
- Prior art keywords
- compound
- general formula
- urea
- treated
- th1ad1azol
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 50
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 235000013877 carbamide Nutrition 0.000 title description 9
- 150000003672 ureas Chemical class 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims description 79
- 239000004202 carbamide Substances 0.000 claims description 74
- 241000196324 Embryophyta Species 0.000 claims description 47
- 238000000034 method Methods 0.000 claims description 36
- -1 carbamoyl halide Chemical class 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 150000007530 organic bases Chemical group 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000008187 granular material Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002432 hydroperoxides Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims description 2
- 238000005507 spraying Methods 0.000 claims description 2
- 239000001117 sulphuric acid Substances 0.000 claims description 2
- 235000011149 sulphuric acid Nutrition 0.000 claims description 2
- 239000000725 suspension Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims 2
- 229940100198 alkylating agent Drugs 0.000 claims 1
- 239000002168 alkylating agent Substances 0.000 claims 1
- 239000000839 emulsion Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 claims 1
- 239000013543 active substance Substances 0.000 description 19
- 230000000694 effects Effects 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 9
- 239000007900 aqueous suspension Substances 0.000 description 8
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical class O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- 235000003276 Apios tuberosa Nutrition 0.000 description 5
- 244000105624 Arachis hypogaea Species 0.000 description 5
- 235000010777 Arachis hypogaea Nutrition 0.000 description 5
- 235000010744 Arachis villosulicarpa Nutrition 0.000 description 5
- 244000061456 Solanum tuberosum Species 0.000 description 5
- 235000002595 Solanum tuberosum Nutrition 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 235000009973 maize Nutrition 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 241000743985 Alopecurus Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 240000004385 Centaurea cyanus Species 0.000 description 2
- 235000005940 Centaurea cyanus Nutrition 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241001101998 Galium Species 0.000 description 2
- 240000005702 Galium aparine Species 0.000 description 2
- 235000014820 Galium aparine Nutrition 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 235000010633 broth Nutrition 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 101100450129 Caenorhabditis elegans hal-3 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 244000144786 Chrysanthemum segetum Species 0.000 description 1
- 235000005470 Chrysanthemum segetum Nutrition 0.000 description 1
- 241001354404 Cyanus Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical class C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 240000003705 Senecio vulgaris Species 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 206010000496 acne Diseases 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229940045681 other alkylating agent in atc Drugs 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2044442A DE2044442C2 (de) | 1970-09-03 | 1970-09-03 | 1,1,3-Trimethyl-3-(-5-Äthylsulfonyl-1,3,4-Thiadiazol-2-yl)-Harnstoff mit herbizider Wirkung |
| DE19702059328 DE2059328C2 (de) | 1970-11-24 | 1970-11-24 | 1,1,3-Trimethyl-3-(5-äthylsulfinyl-1,3,4-thiadiazol-2-YL)-harnstoff |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL37529A0 IL37529A0 (en) | 1971-11-29 |
| IL37529A true IL37529A (en) | 1977-04-29 |
Family
ID=25759699
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL37529A IL37529A (en) | 1970-09-03 | 1971-08-19 | Herbicidally active 1,1,3-trimethyl-3-(5-substituted-1,3,4thiadiazol-2-yl)ureas their manufacture and preparations containing them |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS5327339B1 (cs) |
| AT (1) | AT310497B (cs) |
| BE (1) | BE772168A (cs) |
| BR (1) | BR7105556D0 (cs) |
| CA (1) | CA942751A (cs) |
| CH (1) | CH554636A (cs) |
| CS (1) | CS167939B2 (cs) |
| DK (1) | DK130182B (cs) |
| EG (1) | EG10379A (cs) |
| ES (1) | ES393478A1 (cs) |
| FI (1) | FI55838C (cs) |
| FR (1) | FR2107182A5 (cs) |
| GB (1) | GB1365556A (cs) |
| HU (1) | HU162898B (cs) |
| IE (1) | IE35564B1 (cs) |
| IL (1) | IL37529A (cs) |
| KE (1) | KE2545A (cs) |
| LU (1) | LU63804A1 (cs) |
| NL (1) | NL174044C (cs) |
| RO (3) | RO71694B (cs) |
| SE (1) | SE375305B (cs) |
| YU (1) | YU34419B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2246461C2 (de) * | 1972-09-21 | 1985-07-18 | Schering AG, 1000 Berlin und 4709 Bergkamen | 1,1,3-Trimethyl-3-(5-Butylsulfonyl-1,3,4-thiadiazol-2-yl)-harnstoff und herbizide Mittel enthaltend diese Verbindung |
-
1971
- 1971-07-21 ES ES393478A patent/ES393478A1/es not_active Expired
- 1971-07-23 FI FI2099/71A patent/FI55838C/fi active
- 1971-07-27 CS CS5488A patent/CS167939B2/cs unknown
- 1971-07-27 YU YU1958/71A patent/YU34419B/xx unknown
- 1971-07-27 GB GB3513071A patent/GB1365556A/en not_active Expired
- 1971-08-04 DK DK381371AA patent/DK130182B/da unknown
- 1971-08-19 IL IL37529A patent/IL37529A/en unknown
- 1971-08-24 IE IE1065/71A patent/IE35564B1/xx unknown
- 1971-08-25 BR BR5556/71A patent/BR7105556D0/pt unknown
- 1971-08-30 EG EG387/71A patent/EG10379A/xx active
- 1971-08-31 LU LU63804D patent/LU63804A1/xx unknown
- 1971-09-01 AT AT763471A patent/AT310497B/de not_active IP Right Cessation
- 1971-09-02 FR FR7131774A patent/FR2107182A5/fr not_active Expired
- 1971-09-02 SE SE7111133A patent/SE375305B/xx unknown
- 1971-09-02 HU HUSC348A patent/HU162898B/hu unknown
- 1971-09-03 RO RO77408A patent/RO71694B/ro unknown
- 1971-09-03 RO RO68110A patent/RO58556A/ro unknown
- 1971-09-03 CH CH1296171A patent/CH554636A/xx not_active IP Right Cessation
- 1971-09-03 NL NLAANVRAGE7112198,A patent/NL174044C/xx not_active IP Right Cessation
- 1971-09-03 CA CA122,104A patent/CA942751A/en not_active Expired
- 1971-09-03 RO RO7177407A patent/RO71809A/ro unknown
- 1971-09-03 JP JP6801471A patent/JPS5327339B1/ja active Pending
- 1971-09-03 BE BE772168A patent/BE772168A/xx not_active IP Right Cessation
-
1975
- 1975-07-16 KE KE2545*UA patent/KE2545A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI55838B (fi) | 1979-06-29 |
| SE375305B (cs) | 1975-04-14 |
| YU34419B (en) | 1979-07-10 |
| LU63804A1 (cs) | 1972-01-06 |
| RO71694A (ro) | 1984-03-15 |
| GB1365556A (en) | 1974-09-04 |
| YU195871A (en) | 1978-12-31 |
| NL7112198A (cs) | 1972-03-07 |
| KE2545A (en) | 1975-08-01 |
| DK130182B (da) | 1975-01-13 |
| CS167939B2 (cs) | 1976-05-28 |
| IL37529A0 (en) | 1971-11-29 |
| FI55838C (fi) | 1979-10-10 |
| EG10379A (en) | 1976-10-31 |
| RO71809A (ro) | 1982-05-10 |
| IE35564L (en) | 1972-03-03 |
| DK130182C (cs) | 1975-08-11 |
| AT310497B (de) | 1973-10-10 |
| ES393478A1 (es) | 1974-10-01 |
| HU162898B (cs) | 1973-04-28 |
| IE35564B1 (en) | 1976-03-18 |
| RO58556A (cs) | 1975-10-15 |
| CA942751A (en) | 1974-02-26 |
| BE772168A (fr) | 1972-03-03 |
| FR2107182A5 (cs) | 1972-05-05 |
| JPS5327339B1 (cs) | 1978-08-08 |
| CH554636A (de) | 1974-10-15 |
| RO71694B (ro) | 1984-03-31 |
| BR7105556D0 (pt) | 1973-02-15 |
| NL174044C (nl) | 1984-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4927824A (en) | Fungicidal trisubstituted 1,3,5-triazine-2,4,6-triones | |
| CA1108618A (en) | 1, 2, 3-thiadiazol-3-in-5-ylidene ureas, a process for their manufacture and their use in regulating the growth of plants | |
| KR920004578B1 (ko) | 살균성 아닐린 유도체의 조성물 | |
| US4491595A (en) | Combating fungi with trisubstituted cyanoguanidines | |
| CA1129425A (en) | Biocidally active 1,2,3-triazolecarboxylic acid amides, a process for their manufacture and their use | |
| US4206212A (en) | Combating plant pathogenic bacteria with 3-halogeno-benzotriazine 1-oxides | |
| RU2159242C2 (ru) | Производные бензимидазола и их соли, образованные присоединением кислот, способ их получения и микробицидное средство на их основе | |
| IL31444A (en) | Pesticidal preparations containing trifluoromethyl-phenyl-(thio)ureas and certain new such compounds | |
| US4478848A (en) | Combating fungi with substituted anilinomethylene-oximes | |
| JPH0421672B2 (cs) | ||
| JPS62267277A (ja) | ベンゾチアジノン誘導体 | |
| IL37529A (en) | Herbicidally active 1,1,3-trimethyl-3-(5-substituted-1,3,4thiadiazol-2-yl)ureas their manufacture and preparations containing them | |
| CA1192912A (en) | N-sulphenylated benzylsulphonamides, a process and their use as microbicides | |
| US4716176A (en) | Benzaldoxime carbamate derivatives, their compositions and method of use | |
| HU206331B (en) | Fungicide composition containing 2,5-disubstituted 1,3,4-thiadiazol derivatives and process for producing the active components | |
| US4239524A (en) | Thiadiazolyl ureas with herbicidal effect | |
| CA1180334A (en) | N-sulphenylated biurets, processes for their preparation and their use as fungicides | |
| US4368202A (en) | Combating fungi with pyrazole-substituted oximino-cyano-acetamide derivatives | |
| US4666930A (en) | 3-hydrazono-benzisothiazole 1,1-dioxide fungicides | |
| US4348411A (en) | Combating bacteria with halogenomethylsulphonylphenyl-phthalamic acids | |
| CS231991B2 (en) | Herbceous agent and manufacturing process of active substances | |
| EP0152131B1 (en) | Carboxamide derivatives, their preparation and their use as fungicides | |
| US4496575A (en) | Fungicidal N-sulphenylated hydantoins | |
| GB2074561A (en) | Benzoxazolone derivatives, processes for preparation thereof and compositions containing them | |
| JPH0247993B2 (cs) |