IL36370A - 4-piperidylidene-benzocyclohepta-thiophene derivatives,their preparation and pharmaceutical compositions containing them - Google Patents
4-piperidylidene-benzocyclohepta-thiophene derivatives,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL36370A IL36370A IL36370A IL3637071A IL36370A IL 36370 A IL36370 A IL 36370A IL 36370 A IL36370 A IL 36370A IL 3637071 A IL3637071 A IL 3637071A IL 36370 A IL36370 A IL 36370A
- Authority
- IL
- Israel
- Prior art keywords
- benzocyclohepta
- piperidylidene
- preparation
- pharmaceutical compositions
- compositions containing
- Prior art date
Links
- LGPJQAJDEAAABN-UHFFFAOYSA-N 4-(2H-cyclohepta[e][1]benzothiol-3-ylidene)piperidine Chemical class N1CCC(CC1)=S1CC=C2C1=CC=C1C2=CC=CC=C1 LGPJQAJDEAAABN-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH359870A CH533639A (de) | 1970-03-11 | 1970-03-11 | Verfahren zur Herstellung neuer Benzo(4,5)cyclohepta(1,2-b)-thiophen-Derivate |
| CH1159370A CH531000A (de) | 1970-03-11 | 1970-07-31 | Verfahren zur Herstellung neuer Benzocycloheptathiophene |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL36370A0 IL36370A0 (en) | 1971-05-26 |
| IL36370A true IL36370A (en) | 1974-10-22 |
Family
ID=25693399
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL36370A IL36370A (en) | 1970-03-11 | 1971-03-09 | 4-piperidylidene-benzocyclohepta-thiophene derivatives,their preparation and pharmaceutical compositions containing them |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5217030B1 (show.php) |
| BG (1) | BG22398A3 (show.php) |
| CS (1) | CS185562B2 (show.php) |
| DD (1) | DD100000A5 (show.php) |
| DK (1) | DK134404B (show.php) |
| ES (2) | ES389044A1 (show.php) |
| FI (1) | FI52980C (show.php) |
| HU (1) | HU162868B (show.php) |
| IE (2) | IE34997B1 (show.php) |
| IL (1) | IL36370A (show.php) |
| IT (1) | IT7827770A0 (show.php) |
| MY (1) | MY8300201A (show.php) |
| NO (1) | NO133838C (show.php) |
| PL (1) | PL84083B1 (show.php) |
| SU (1) | SU512711A3 (show.php) |
| YU (2) | YU35019B (show.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101932575B (zh) | 2008-01-30 | 2013-06-12 | 日本脏器制药株式会社 | 哌啶衍生物 |
-
1971
- 1971-03-05 SU SU1628614A patent/SU512711A3/ru active
- 1971-03-09 FI FI68371A patent/FI52980C/fi active
- 1971-03-09 HU HUSA002175 patent/HU162868B/hu unknown
- 1971-03-09 ES ES389044A patent/ES389044A1/es not_active Expired
- 1971-03-09 IL IL36370A patent/IL36370A/xx unknown
- 1971-03-09 YU YU58671A patent/YU35019B/xx unknown
- 1971-03-09 CS CS171771A patent/CS185562B2/cs unknown
- 1971-03-09 PL PL14675171A patent/PL84083B1/pl unknown
- 1971-03-10 NO NO90171A patent/NO133838C/no unknown
- 1971-03-10 IE IE29971A patent/IE34997B1/xx unknown
- 1971-03-10 BG BG017004A patent/BG22398A3/xx unknown
- 1971-03-10 DK DK111471A patent/DK134404B/da not_active IP Right Cessation
- 1971-03-10 JP JP46013021A patent/JPS5217030B1/ja active Pending
- 1971-03-10 DD DD16465971A patent/DD100000A5/xx unknown
-
1973
- 1973-06-30 ES ES416480A patent/ES416480A1/es not_active Expired
-
1974
- 1974-07-15 IE IE149474A patent/IE34998B1/xx unknown
-
1978
- 1978-03-24 YU YU69978A patent/YU35254B/xx unknown
- 1978-09-15 IT IT7827770A patent/IT7827770A0/it unknown
-
1983
- 1983-12-30 MY MY8300201A patent/MY8300201A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MY8300201A (en) | 1983-12-31 |
| FI52980C (show.php) | 1978-01-10 |
| SU512711A3 (ru) | 1976-04-30 |
| JPS5217030B1 (show.php) | 1977-05-12 |
| DK134404B (da) | 1976-11-01 |
| DD100000A5 (show.php) | 1973-09-05 |
| CS185562B2 (en) | 1978-10-31 |
| IE34998L (en) | 1975-10-15 |
| YU35019B (en) | 1980-06-30 |
| NO133838C (show.php) | 1976-07-07 |
| ES389044A1 (es) | 1974-02-01 |
| IL36370A0 (en) | 1971-05-26 |
| DK134404C (show.php) | 1977-04-04 |
| YU69978A (en) | 1980-04-30 |
| IE34997L (en) | 1971-09-11 |
| BG22398A3 (bg) | 1977-02-20 |
| IE34998B1 (en) | 1975-10-15 |
| NO133838B (show.php) | 1976-03-29 |
| PL84083B1 (show.php) | 1976-02-28 |
| HU162868B (show.php) | 1973-04-28 |
| YU58671A (en) | 1979-12-31 |
| YU35254B (en) | 1980-10-31 |
| IT7827770A0 (it) | 1978-09-15 |
| FI52980B (show.php) | 1977-09-30 |
| IE34997B1 (en) | 1975-10-15 |
| ES416480A1 (es) | 1976-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL36237A0 (en) | Substituted benzylimidazolidinones,their preparation and pharmaceutical compositions containing them | |
| IL37984A0 (en) | 2,4-diamino-5-benzylpyrimidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37598A0 (en) | Bis-chromonyloxy compounds,their preparation and pharmaceutical compositions containing them | |
| IL37252A0 (en) | Pteridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37340A (en) | Quinuclidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36926A0 (en) | Indole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36345A0 (en) | Benzhydryl-piperazine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37830A (en) | Derivatives of 1-phenoxy-2-hydroxy-3-amino-propane,their preparation and pharmaceutical compositions containing them | |
| IL36559A (en) | N-substituted-4-hydroxy-4-benzoyl-3-phenyl-piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36743A (en) | Phenylaminoalkanes,their preparation and pharmaceutical compositions containing them | |
| IL37839A0 (en) | Cinnoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37146A (en) | Indenopyrrole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37588A0 (en) | Pyrimidoisoquinolines,their preparation and pharmaceutical compositions containing them | |
| IL38440A0 (en) | Substituted dioxypiperidines,their preparation and pharmaceutical compositions containing them | |
| IL36160A (en) | 7-azido-5-phenyl-dihydro-benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37900A0 (en) | Thiazolone-(2)derivatives,their preparation,and pharmaceutical compositions containing them | |
| IL36827A (en) | Tetrahydropyridine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37438A0 (en) | Piperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37621A (en) | Benzocycloheptathiophene derivatives,their preparation and pharmaceutical compositions containing them | |
| IL37231A0 (en) | Bornanamine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL35976A0 (en) | Cardenolide-rhamnosides,their preparation and pharmaceutical compositions containing them | |
| IL38310A0 (en) | Benzopyranobenzopyran derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36352A0 (en) | Pregnatetraene derivatives,their preparation and pharmaceutical compositions containing them | |
| IL36370A (en) | 4-piperidylidene-benzocyclohepta-thiophene derivatives,their preparation and pharmaceutical compositions containing them | |
| IL38049A0 (en) | Novel 2-amino-dihydro-benzodiazepinones,their preparation and pharmaceutical compositions containing them |